{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "66978da7-566f-40ee-bb19-08424de416df",
          "code": "21 CFR 331.11",
          "comments": "OTC|PART 331 -- ANTACID PRODUCTS FOR OVER-THE-COUNTER (OTC) HUMAN USE|Subpart B--Active Ingredients|Sec. 331.11 Listing of specific active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=331.11",
          "code_system": "CFR",
          "references": [
            "25ae86fe-ebba-4bd5-b2ef-d5f4124a579e"
          ]
        },
        {
          "uuid": "ae937ad8-e2c2-4119-8049-7633ff1a01fc",
          "code": "98601",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:114",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "25ae86fe-ebba-4bd5-b2ef-d5f4124a579e"
          ]
        },
        {
          "uuid": "eebad83c-b42c-4144-a3a3-f6a85270a79a",
          "code": "m2553",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2553?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "25ae86fe-ebba-4bd5-b2ef-d5f4124a579e"
          ]
        },
        {
          "uuid": "2004a074-ad44-441d-b33c-7f0548d88446",
          "code": "19476",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/19476/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "25ae86fe-ebba-4bd5-b2ef-d5f4124a579e"
          ]
        },
        {
          "uuid": "5385b2f0-66dc-4a40-a3b1-5073f79e5c98",
          "code": "SUB13091MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "25ae86fe-ebba-4bd5-b2ef-d5f4124a579e"
          ]
        },
        {
          "uuid": "afe3ec56-a585-4ca3-835f-8aa1cd34f711",
          "code": "202-742-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.493",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "25ae86fe-ebba-4bd5-b2ef-d5f4124a579e"
          ]
        },
        {
          "uuid": "75342e25-de5b-4b0f-86a6-637f1da8ccc4",
          "code": "99-26-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=99-26-3",
          "code_system": "CAS",
          "references": [
            "25ae86fe-ebba-4bd5-b2ef-d5f4124a579e",
            "38c63792-b806-46ab-a0eb-75c9ba21c246"
          ]
        },
        {
          "uuid": "92c2d923-c5e6-451a-8169-a40ea431c2a9",
          "code": "C77029",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77029",
          "code_system": "NCI_THESAURUS",
          "references": [
            "25ae86fe-ebba-4bd5-b2ef-d5f4124a579e"
          ]
        },
        {
          "uuid": "d0f68fb9-31fb-4f33-8241-564d9d57e73d",
          "code": "C002170",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67002170",
          "code_system": "MESH",
          "references": [
            "25ae86fe-ebba-4bd5-b2ef-d5f4124a579e"
          ]
        },
        {
          "uuid": "b099523f-6e47-4e42-a13f-6b721fd2315c",
          "code": "21 CFR 357.810",
          "comments": "OTC|PART 357 -- MISCELLANEOUS INTERNAL DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE|Subpart I--Deodorant Drug Products for Internal Use|Sec. 357.810 Active ingredients for deodorant drug products for internal use.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=357.810",
          "code_system": "CFR",
          "references": [
            "25ae86fe-ebba-4bd5-b2ef-d5f4124a579e"
          ]
        },
        {
          "uuid": "8a2b9b01-24db-4ef6-986a-f8b423feaa78",
          "code": "21 CFR 357.850",
          "comments": "OTC|Part 557 -- Deodorant Drug Products for Internal Use|Sec. 357.850 Labeling of deodorant drug products for internal use.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=357.850",
          "code_system": "CFR",
          "references": [
            "25ae86fe-ebba-4bd5-b2ef-d5f4124a579e"
          ]
        },
        {
          "uuid": "bf19e179-7348-4873-9271-822971dd8bc5",
          "code": "BISMUTH SUBGALLATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bismuth_subgallate",
          "code_system": "WIKIPEDIA",
          "references": [
            "25ae86fe-ebba-4bd5-b2ef-d5f4124a579e"
          ]
        },
        {
          "uuid": "ace54187-62bb-4611-8a67-cec12f1e0efe",
          "code": "21 CFR 331.15",
          "comments": "OTC|PART 331 -- ANTACID PRODUCTS FOR OVER-THE-COUNTER (OTC) HUMAN USE|Subpart B--Active Ingredients|Sec. 331.15 Combination with nonantacid active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=331.15",
          "code_system": "CFR",
          "references": [
            "25ae86fe-ebba-4bd5-b2ef-d5f4124a579e"
          ]
        },
        {
          "uuid": "38d6d7a5-31f0-600b-6183-2873be9de52c",
          "code": "DTXSID3046588",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3046588",
          "code_system": "EPA CompTox",
          "references": [
            "7de0a7c8-0c55-9c44-2bbb-29219f9b5e61"
          ]
        },
        {
          "uuid": "0834895e-8d0a-a168-66ec-066f7f94906d",
          "code": "C28394",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Topical Anti-Infective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28394",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6faddabf-8e6f-6af0-e502-932b6337a89e"
          ]
        },
        {
          "uuid": "386fbcf9-a4ea-c2bf-d5ba-b61bcb63ad01",
          "code": "4531",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4531",
          "code_system": "DRUG CENTRAL",
          "references": [
            "6faddabf-8e6f-6af0-e502-932b6337a89e"
          ]
        },
        {
          "uuid": "a4c89933-4700-4c85-98db-7ebb2147feae",
          "code": "YIW503MI7V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "619086ac-cef1-b9d9-8a3f-4e62db703295",
          "code": "DB13909",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB13909",
          "code_system": "DRUG BANK",
          "references": [
            "6faddabf-8e6f-6af0-e502-932b6337a89e"
          ]
        },
        {
          "uuid": "2f574e77-b8ae-c0a8-1955-a3b7b4323b41",
          "code": "31292",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:31292",
          "code_system": "CHEBI",
          "references": [
            "6faddabf-8e6f-6af0-e502-932b6337a89e"
          ]
        },
        {
          "uuid": "b482ef5b-89e0-21f2-bec3-b62f3a9b371e",
          "code": "73415769",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/73415769",
          "code_system": "PUBCHEM",
          "references": [
            "9de80917-753e-b19b-eab5-1cda946844b8"
          ]
        },
        {
          "uuid": "2107568e-92e9-15ab-8888-b3bc5f9cf73b",
          "code": "YIW503MI7V",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=YIW503MI7V",
          "code_system": "DAILYMED",
          "references": [
            "057e9712-a603-c485-69ac-8f435afd22b8"
          ]
        },
        {
          "uuid": "0cc9d71c-fdb7-673f-a14f-753b5f807f17",
          "code": "100000090478",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ba5e65dc-e073-d90f-0c24-344a13310c25"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "30e751cc-9824-42bb-8a45-0e81ae81a303",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a2fb7153-228f-4700-99a0-d98e0359c567",
            "refuuid": "6735e420-936a-4d22-9c79-4a4ec5b35246",
            "name": "BISMUTH CATION",
            "unii": "ZS9CD1I8YE",
            "linking_id": "ZS9CD1I8YE",
            "ref_pname": "BISMUTH CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a1d44601-f83f-456d-93fe-55c822c2a3de",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "194fe174-41b6-4520-8f0a-00cdd06f7756",
            "refuuid": "b1053cd1-4f22-4f39-aee6-772c59e7f28e",
            "name": "GALLIC ACID",
            "unii": "632XD903SP",
            "linking_id": "632XD903SP",
            "ref_pname": "GALLIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e37f44d2-050e-4b0a-81d2-82d27e18fada",
          "name": "BISMUTH SUBGALLATE",
          "stdName": "BISMUTH SUBGALLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b68e1b9-92fa-475b-a530-6d8825d2fe83",
            "45f8a6fa-05bd-408c-a99d-1779e807a17e",
            "4ba9425a-14d3-4ed8-b8a1-1a712a73b1ff",
            "08d68aab-0a13-42e2-af93-e0a88b2caa16",
            "0c142541-6108-4743-9fd7-88baea8a8a0d",
            "711905c6-5138-4403-8eba-3eeb079e1dcd",
            "ed3ee40c-1155-4a29-96d4-a4fdc3a2d59e",
            "a8c94e89-fb80-48b5-8d2f-e87214c23c75",
            "c12f9a2d-0f7b-4db9-9303-1b5ab9dec2fb",
            "0171df98-ecf9-42e3-8e00-fa7f116af44e",
            "120a2f5e-6673-459e-ba91-9ca31d6f8517",
            "53425848-42e2-4727-b5bd-6e4c812ce1dd",
            "c444c7d3-462f-4e47-b7e6-02cb15b1a726",
            "eff9f49f-c322-43f0-a472-34055d72c376",
            "ab6e34fd-ad40-4adf-81ee-ea212c9d068e",
            "51aa8772-d943-4c1f-b77f-b560f98c7352",
            "918c2725-14df-4dd2-9435-a14678755599",
            "b16effaa-754f-47c8-b77d-b96613e503b4",
            "39c10228-594b-46f5-83a6-7204f85a2d43"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "d1fbecaf-c729-493e-b808-3cbe3c6504cd",
              "name_org": "USAN"
            },
            {
              "uuid": "888e64da-be08-402d-9c43-cc9b810eee1b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "b4bd4e71-f468-a76e-dd44-3a1426a69415",
          "name": "BISMUTH SUBGALLATE [EP MONOGRAPH]",
          "stdName": "BISMUTH SUBGALLATE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82efab3d-b419-3e95-fa00-e7086ded56fc"
          ],
          "display_name": false
        },
        {
          "uuid": "e7b6da12-7c27-47d1-a95a-22ddadf03658",
          "name": "BISMUTH SUBGALLATE [II]",
          "stdName": "BISMUTH SUBGALLATE [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08d68aab-0a13-42e2-af93-e0a88b2caa16"
          ],
          "display_name": false
        },
        {
          "uuid": "f62ab98d-aa3f-4006-8f0f-e1e297530d6d",
          "name": "BISMUTH SUBGALLATE [JAN]",
          "stdName": "BISMUTH SUBGALLATE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61859e48-2610-4071-576a-e5cc2a56948c"
          ],
          "display_name": false
        },
        {
          "uuid": "47f5594c-ecac-4a9a-8e69-0e08483f12f9",
          "name": "BISMUTH SUBGALLATE [MART.]",
          "stdName": "BISMUTH SUBGALLATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c444c7d3-462f-4e47-b7e6-02cb15b1a726"
          ],
          "display_name": false
        },
        {
          "uuid": "db4df394-e28d-4af5-aa5e-a6235cde40d3",
          "name": "BISMUTH SUBGALLATE [MI]",
          "stdName": "BISMUTH SUBGALLATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51aa8772-d943-4c1f-b77f-b560f98c7352",
            "a8c94e89-fb80-48b5-8d2f-e87214c23c75"
          ],
          "display_name": false
        },
        {
          "uuid": "376a32de-2aee-48b0-8fb8-50445bc764d7",
          "name": "BISMUTH SUBGALLATE [USAN]",
          "stdName": "BISMUTH SUBGALLATE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ed3ee40c-1155-4a29-96d4-a4fdc3a2d59e"
          ],
          "display_name": false
        },
        {
          "uuid": "150d3305-f164-b5dc-578f-1e633ed9d648",
          "name": "BISMUTH SUBGALLATE [USP MONOGRAPH]",
          "stdName": "BISMUTH SUBGALLATE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb1cef9c-c737-1193-aef8-b72319013de3"
          ],
          "display_name": false
        },
        {
          "uuid": "824826fe-4e3c-4d8c-bdef-cc735cf490c5",
          "name": "BISMUTH SUBGALLATE [VANDF]",
          "stdName": "BISMUTH SUBGALLATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ba9425a-14d3-4ed8-b8a1-1a712a73b1ff",
            "a8c94e89-fb80-48b5-8d2f-e87214c23c75"
          ],
          "display_name": false
        },
        {
          "uuid": "5c63c4de-4493-4c83-a86b-6de4815ccda6",
          "name": "Basic bismuth gallate",
          "stdName": "BASIC BISMUTH GALLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08d68aab-0a13-42e2-af93-e0a88b2caa16"
          ],
          "display_name": false
        },
        {
          "uuid": "0844484c-584a-304b-3000-016fdd53aca2",
          "name": "Bismuth subgallate [WHO-DD]",
          "stdName": "BISMUTH SUBGALLATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a0be767-36b1-2606-c43d-541b910d5b78"
          ],
          "display_name": false
        },
        {
          "uuid": "99b19003-3470-4deb-9251-b2b0b5ce523b",
          "name": "GALLIC ACID BISMUTH BASIC SALT",
          "stdName": "GALLIC ACID BISMUTH BASIC SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08d68aab-0a13-42e2-af93-e0a88b2caa16"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "08d68aab-0a13-42e2-af93-e0a88b2caa16",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "73110e4a-4da9-4001-aec1-ebd57e929c37",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed3ee40c-1155-4a29-96d4-a4fdc3a2d59e",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "711905c6-5138-4403-8eba-3eeb079e1dcd",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "918c2725-14df-4dd2-9435-a14678755599",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c444c7d3-462f-4e47-b7e6-02cb15b1a726",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "51aa8772-d943-4c1f-b77f-b560f98c7352",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a8c94e89-fb80-48b5-8d2f-e87214c23c75",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c12f9a2d-0f7b-4db9-9303-1b5ab9dec2fb",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b16effaa-754f-47c8-b77d-b96613e503b4",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4ba9425a-14d3-4ed8-b8a1-1a712a73b1ff",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25ae86fe-ebba-4bd5-b2ef-d5f4124a579e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389720000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "802220cb-9780-4776-8929-bfcab2c4ccb9",
          "citation": "SRS import [YIW503MI7V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YIW503MI7V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389720000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ab6842d-6c04-4c4a-860c-e64c48c14062",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab6e34fd-ad40-4adf-81ee-ea212c9d068e",
          "citation": "BISMUTH SUBGALLATE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eff9f49f-c322-43f0-a472-34055d72c376",
          "citation": "BISMUTH SUBGALLATE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "120a2f5e-6673-459e-ba91-9ca31d6f8517",
          "citation": "BISMUTH SUBGALLATE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "39c10228-594b-46f5-83a6-7204f85a2d43",
          "citation": "BISMUTH SUBGALLATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "45f8a6fa-05bd-408c-a99d-1779e807a17e",
          "citation": "BISMUTH SUBGALLATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "53425848-42e2-4727-b5bd-6e4c812ce1dd",
          "citation": "BISMUTH SUBGALLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0c142541-6108-4743-9fd7-88baea8a8a0d",
          "citation": "BISMUTH SUBGALLATE [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0171df98-ecf9-42e3-8e00-fa7f116af44e",
          "citation": "BISMUTH SUBGALLATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3b68e1b9-92fa-475b-a530-6d8825d2fe83",
          "citation": "BISMUTH SUBGALLATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "61859e48-2610-4071-576a-e5cc2a56948c",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7de0a7c8-0c55-9c44-2bbb-29219f9b5e61",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=99-26-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6faddabf-8e6f-6af0-e502-932b6337a89e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "38c63792-b806-46ab-a0eb-75c9ba21c246",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fb1cef9c-c737-1193-aef8-b72319013de3",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "82efab3d-b419-3e95-fa00-e7086ded56fc",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "9de80917-753e-b19b-eab5-1cda946844b8",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "057e9712-a603-c485-69ac-8f435afd22b8",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "7a0be767-36b1-2606-c43d-541b910d5b78",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ba5e65dc-e073-d90f-0c24-344a13310c25",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "079b85d7-5f02-4904-a581-6eb5a4d31b21",
          "id": "079b85d7-5f02-4904-a581-6eb5a4d31b21",
          "molfile": "\n  Marvin  01132100402D          \n\n  1  0  0  0  0  0            999 V2000\n    4.4689   -2.2009    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "[OH-]",
          "formula": "HO",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1323a157-5e1f-462a-8ab2-3ee923140328"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "17.0073",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "14262af2-ef02-4ee1-8916-48da53bfab50",
          "id": "14262af2-ef02-4ee1-8916-48da53bfab50",
          "molfile": "\n  Marvin  01132101152D          \n\n  1  0  0  0  0  0            999 V2000\n    3.6468   -2.2184    0.0000 Bi  0  1  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   3\nM  END",
          "smiles": "[Bi+3]",
          "formula": "Bi",
          "atropisomerism": "No",
          "charge": 3,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e26ac7a8-35f3-40eb-934e-dd5b32bac6bb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "208.9804",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "f360ea4f-22b8-4753-b5a4-56053131c497",
          "id": "f360ea4f-22b8-4753-b5a4-56053131c497",
          "molfile": "\n  Marvin  01132112372D          \n\n 12 12  0  0  0  0            999 V2000\n    3.1513   -1.5392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3670   -1.7928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6529   -1.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9328   -1.7986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9328   -2.6120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6529   -3.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6557   -3.8538    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.3670   -2.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1512   -2.8714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2040   -1.3993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1837   -0.5684    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -0.5044   -1.8307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  8  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n 10  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  2  0  0  0  0\nM  CHG  2   7  -1  11  -1\nM  END",
          "smiles": "c1c(cc(c(c1[O-])O)O)C(=O)[O-]",
          "formula": "C7H4O5",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "59b790e0-ad92-4b89-836a-1e33c6979a75"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "168.1039",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "47ac3846-cf72-44b2-b925-bb1424c2c1e7",
      "version": "21",
      "structure": {
        "id": "ee418f97-036a-4fee-8a3e-201f629fe2c8",
        "molfile": "\n  Marvin  01132112202D          \n\n 14 12  0  0  0  0            999 V2000\n    2.3670   -2.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3670   -1.7928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1512   -2.8714    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.1513   -1.5392    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.6529   -3.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9328   -1.7986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6529   -1.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2040   -1.3993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9328   -2.6120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1837   -0.5684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6557   -3.8538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5044   -1.8307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6468   -2.2184    0.0000 Bi  0  1  0  0  0  0  0  0  0  0  0  0\n    4.4689   -2.2009    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  2  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  8  2  0  0  0  0\n 11  5  1  0  0  0  0\n 12  8  1  0  0  0  0\n  1  2  1  0  0  0  0\n  6  9  2  0  0  0  0\nM  CHG  4   3  -1   4  -1  13   3  14  -1\nM  END",
        "smiles": "c1c(cc(c(c1[O-])[O-])O)C(=O)O.[Bi+3].[OH-]",
        "formula": "C7H4O5.Bi.HO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "394.0917",
        "optical_activity": "NONE",
        "references": [
          "802220cb-9780-4776-8929-bfcab2c4ccb9",
          "1ab6842d-6c04-4c4a-860c-e64c48c14062"
        ],
        "stereo_centers": 0
      },
      "unii": "YIW503MI7V"
    }
  ]
}