{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "dd1d5fc7-6cab-4463-bc3a-76f090721cb0",
          "code": "828918-62-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=828918-62-3",
          "code_system": "CAS",
          "references": [
            "30b6c37e-b008-4de3-b5f7-07a3426ad2f3",
            "cf9d1e8c-520e-4e8f-9e89-f82633aafa26"
          ]
        },
        {
          "uuid": "299ab699-2bdb-4165-8ec2-acce0a0961ca",
          "code": "1363915",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1363915/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "30b6c37e-b008-4de3-b5f7-07a3426ad2f3"
          ]
        },
        {
          "uuid": "c023d267-4e28-4cd2-900a-2ba1661eb542",
          "code": "71416843",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71416843",
          "code_system": "PUBCHEM",
          "references": [
            "30b6c37e-b008-4de3-b5f7-07a3426ad2f3"
          ]
        },
        {
          "uuid": "6ea9656c-2abd-5a20-601b-d2c27de03c4d",
          "code": "DTXSID20232063",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20232063",
          "code_system": "EPA CompTox",
          "references": [
            "38762e7b-29f6-497e-5f71-dd63e0f3561e"
          ]
        },
        {
          "uuid": "d9bbd7a9-c31d-405d-bafc-5e19e6db479e",
          "code": "YGQ120RH3I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b1ed9d4b-85e5-eed7-d38d-770195679422",
          "code": "YGQ120RH3I",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=YGQ120RH3I",
          "code_system": "DAILYMED",
          "references": [
            "a792b545-c1e1-59c0-a72e-373ebbb4c8d8"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "52fa548e-e92f-4bcd-a9ab-ec3f878172b8",
          "name": "BIS-ETHOXYDIGLYCOL SUCCINATE",
          "stdName": "BIS-ETHOXYDIGLYCOL SUCCINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "19c2ce49-4c1c-4c1d-96b8-ba74fa672b44",
            "9f4ff203-3f73-4147-8bd6-8d89eb5bc771",
            "ddf7480e-5f03-4e85-931d-1e84e6bdbaf3"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "996cc39f-a0a8-489b-8e86-dc0a952a27b6",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "c639e867-6cf2-4bcc-aa3c-a89b0d19ad6b",
          "name": "BUTANEDIOIC ACID, 1,4-BIS(2-(2-ETHOXYETHOXY)ETHYL) ESTER",
          "stdName": "BUTANEDIOIC ACID, 1,4-BIS(2-(2-ETHOXYETHOXY)ETHYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f4ff203-3f73-4147-8bd6-8d89eb5bc771",
            "2dd0c172-0098-44a5-a451-715e0451e3fa"
          ],
          "display_name": false
        },
        {
          "uuid": "0a8caed9-bff7-42d1-8afe-1a7b99dbc27f",
          "name": "BUTANEDIOIC ACID, BIS(2-(2-ETHOXYETHOXY)ETHYL) ESTER",
          "stdName": "BUTANEDIOIC ACID, BIS(2-(2-ETHOXYETHOXY)ETHYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f4ff203-3f73-4147-8bd6-8d89eb5bc771",
            "2dd0c172-0098-44a5-a451-715e0451e3fa"
          ],
          "display_name": false
        },
        {
          "uuid": "f25b18d6-3c54-4a0f-8875-79d93de6fc44",
          "name": "HAIAQUEOUSTER DCS",
          "stdName": "HAIAQUEOUSTER DCS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "19c2ce49-4c1c-4c1d-96b8-ba74fa672b44",
            "9f4ff203-3f73-4147-8bd6-8d89eb5bc771"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "19c2ce49-4c1c-4c1d-96b8-ba74fa672b44",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9f4ff203-3f73-4147-8bd6-8d89eb5bc771",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2dd0c172-0098-44a5-a451-715e0451e3fa",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30b6c37e-b008-4de3-b5f7-07a3426ad2f3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391412000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a912d2a-3f29-46c9-93b7-9a3fc17fb2d2",
          "citation": "SRS import [YGQ120RH3I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YGQ120RH3I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391412000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ddf7480e-5f03-4e85-931d-1e84e6bdbaf3",
          "citation": "BIS-ETHOXYDIGLYCOL SUCCINATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "38762e7b-29f6-497e-5f71-dd63e0f3561e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=828918-62-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cf9d1e8c-520e-4e8f-9e89-f82633aafa26",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a792b545-c1e1-59c0-a72e-373ebbb4c8d8",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9dbc28e5-3dcc-4074-9126-c1fb3c2da0e1",
          "id": "9dbc28e5-3dcc-4074-9126-c1fb3c2da0e1",
          "molfile": "\n  Marvin  01132108122D          \n\n 24 23  0  0  0  0            999 V2000\n   12.4566   -7.5768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4566   -6.7518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7421   -6.3392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7421   -5.5142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0276   -5.1018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3132   -5.5142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5987   -5.1018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8842   -5.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1697   -5.1018    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4552   -5.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4552   -6.3393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7408   -5.1018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0263   -5.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3118   -5.1018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3118   -4.2768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5974   -5.5143    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8829   -5.1018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1684   -5.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4540   -5.1018    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7395   -5.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7395   -6.3393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4540   -6.7518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4540   -7.5768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1684   -7.9893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "CCOCCOCCOC(=O)CCC(=O)OCCOCCOCC",
          "formula": "C16H30O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d80788e6-5cc6-415f-941c-1dfbfdcf9d09"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "350.4052",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6351bd4c-9516-4a62-b813-d0f9ea77790f",
      "version": "5",
      "structure": {
        "id": "bad5e624-c189-4e87-80b8-ba4ca3251db4",
        "molfile": "\n  Marvin  01132109402D          \n\n 24 23  0  0  0  0            999 V2000\n    2.4540   -5.1018    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1684   -5.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8829   -5.1018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5974   -5.5143    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3118   -5.1018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0263   -5.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7408   -5.1018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4552   -5.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1697   -5.1018    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8842   -5.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5987   -5.1018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3132   -5.5142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3118   -4.2768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4552   -6.3393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7395   -5.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0276   -5.1018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7421   -5.5142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7421   -6.3392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4566   -6.7518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4566   -7.5768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7395   -6.3393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4540   -6.7518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4540   -7.5768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1684   -7.9893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n  5 13  2  0  0  0  0\n  8 14  2  0  0  0  0\n  1 15  1  0  0  0  0\n 12 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 15 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
        "smiles": "CCOCCOCCOC(=O)CCC(=O)OCCOCCOCC",
        "formula": "C16H30O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "350.4052",
        "optical_activity": "NONE",
        "references": [
          "0a912d2a-3f29-46c9-93b7-9a3fc17fb2d2",
          "2dd0c172-0098-44a5-a451-715e0451e3fa"
        ],
        "stereo_centers": 0
      },
      "unii": "YGQ120RH3I"
    }
  ]
}