{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "971fb517-54e4-437f-b537-70ded380ed9b",
          "code": "125-20-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=125-20-2",
          "code_system": "CAS",
          "references": [
            "ab0ee310-2a31-443f-9fac-b1af2d146e82",
            "87397766-68cf-481b-a916-ae57dbb9a0b2"
          ]
        },
        {
          "uuid": "03f3f153-e04c-4020-8f7f-41684813fb33",
          "code": "THYMOLPHTHALEIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Thymolphthalein",
          "code_system": "WIKIPEDIA",
          "references": [
            "ab0ee310-2a31-443f-9fac-b1af2d146e82"
          ]
        },
        {
          "uuid": "4f71bd42-6d3e-4c22-81e5-18a5623fcff7",
          "code": "m10826",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10826?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ab0ee310-2a31-443f-9fac-b1af2d146e82"
          ]
        },
        {
          "uuid": "b835eec7-20e2-4374-9131-c9f355a4c9fa",
          "code": "31316",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/31316",
          "code_system": "PUBCHEM",
          "references": [
            "ab0ee310-2a31-443f-9fac-b1af2d146e82"
          ]
        },
        {
          "uuid": "740f0fc2-c65b-4ebb-bd5a-45d705021ca2",
          "code": "204-729-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.300",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ab0ee310-2a31-443f-9fac-b1af2d146e82"
          ]
        },
        {
          "uuid": "6f89d794-1521-6486-e261-bb3dd8566265",
          "code": "DTXSID2051633",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2051633",
          "code_system": "EPA CompTox",
          "references": [
            "7480a7fa-589b-6b20-33d2-594fdfddbe7f"
          ]
        },
        {
          "uuid": "4475912e-48c0-45ea-9a5a-a848c545aff8",
          "code": "YG5I28WSQP",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0c8e5a69-4cda-3f67-2436-3589f33ff737",
          "code": "2186",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=2186",
          "code_system": "NSC",
          "references": [
            "8ab4dccd-c657-720d-0605-7b54ae36daa9"
          ]
        },
        {
          "uuid": "23c3007b-6262-a8ea-244a-4ad5f86972e2",
          "code": "300000053620",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "42503906-49e6-dfa5-b780-7346f351d8c5"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "25cfec63-e7b7-48a5-bddf-a5de6b90653e",
          "name": "2',2''-DIISOPROPYL-5',5''-DIMETHYLPHENOLPHTHALEIN",
          "stdName": "2',2''-DIISOPROPYL-5',5''-DIMETHYLPHENOLPHTHALEIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a88b7e0c-282e-4361-8873-0f7818237564",
            "b0dfc476-0b8f-4dde-93a5-a38969d31c34"
          ],
          "display_name": false
        },
        {
          "uuid": "07e36c2e-a726-46bf-9258-191c72a57e21",
          "name": "3,3-BIS(4-HYDROXY-2-METHYL-5-(1-METHYLETHYL)PHENYL)-1(3H)-ISOBENZOFURANONE",
          "stdName": "3,3-BIS(4-HYDROXY-2-METHYL-5-(1-METHYLETHYL)PHENYL)-1(3H)-ISOBENZOFURANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a88b7e0c-282e-4361-8873-0f7818237564",
            "d72a21aa-2184-440c-9518-da3dcfa01def"
          ],
          "display_name": false
        },
        {
          "uuid": "e8f5b83a-afbd-4b16-a4a2-8f7731d5a21d",
          "name": "3,3-BIS(4-HYDROXY-3-ISOPROPYL-6-METHYL)PHTHALIDE",
          "stdName": "3,3-BIS(4-HYDROXY-3-ISOPROPYL-6-METHYL)PHTHALIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a88b7e0c-282e-4361-8873-0f7818237564",
            "b0dfc476-0b8f-4dde-93a5-a38969d31c34"
          ],
          "display_name": false
        },
        {
          "uuid": "7ea660cd-b572-4154-aa12-f124404ea60a",
          "name": "5',5''-DIISOPROPYL-2',2''-DIMETHYLPHENOLPHTHALEIN",
          "stdName": "5',5''-DIISOPROPYL-2',2''-DIMETHYLPHENOLPHTHALEIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a88b7e0c-282e-4361-8873-0f7818237564",
            "eca76e47-271d-4703-a702-9760002e9cb7"
          ],
          "display_name": false
        },
        {
          "uuid": "8ba8bd26-7372-4a59-bc83-cb4689573ae7",
          "name": "NSC-2186",
          "stdName": "NSC-2186",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a88b7e0c-282e-4361-8873-0f7818237564",
            "e07579bf-b8b8-4e19-a9db-bfe7ebdfb342"
          ],
          "display_name": false
        },
        {
          "uuid": "5508a81f-4345-489b-8cce-f5bead949abd",
          "name": "PHENOLPHTHALEIN, 5',5''-DIISOPROPYL-2',2''-DIMETHYL-",
          "stdName": "PHENOLPHTHALEIN, 5',5''-DIISOPROPYL-2',2''-DIMETHYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a88b7e0c-282e-4361-8873-0f7818237564",
            "b0dfc476-0b8f-4dde-93a5-a38969d31c34"
          ],
          "display_name": false
        },
        {
          "uuid": "9743d969-3ea3-4e58-a509-8de67a25fab0",
          "name": "THYMOLPHTHALEIN",
          "stdName": "THYMOLPHTHALEIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a88b7e0c-282e-4361-8873-0f7818237564",
            "f0465682-53d3-42ca-b4f6-db7d6e95a97e",
            "d72a21aa-2184-440c-9518-da3dcfa01def"
          ],
          "display_name": true
        },
        {
          "uuid": "6bbd8287-a7fb-4f25-b49f-b7240040434c",
          "name": "THYMOLPHTHALEIN [MI]",
          "stdName": "THYMOLPHTHALEIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a88b7e0c-282e-4361-8873-0f7818237564",
            "d72a21aa-2184-440c-9518-da3dcfa01def"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d72a21aa-2184-440c-9518-da3dcfa01def",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a88b7e0c-282e-4361-8873-0f7818237564",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e07579bf-b8b8-4e19-a9db-bfe7ebdfb342",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0dfc476-0b8f-4dde-93a5-a38969d31c34",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eca76e47-271d-4703-a702-9760002e9cb7",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab0ee310-2a31-443f-9fac-b1af2d146e82",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391500000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10709c11-acf2-4cea-935e-d44a1f44d4f9",
          "citation": "SRS import [YG5I28WSQP]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YG5I28WSQP",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391500000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "575f3b8c-04ae-4e2c-aab1-4ee75107e8fe",
          "citation": "CHEMID RECORD 125-20-2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f0465682-53d3-42ca-b4f6-db7d6e95a97e",
          "citation": "THYMOLPHTHALEIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7480a7fa-589b-6b20-33d2-594fdfddbe7f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=125-20-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8ab4dccd-c657-720d-0605-7b54ae36daa9",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "87397766-68cf-481b-a916-ae57dbb9a0b2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "42503906-49e6-dfa5-b780-7346f351d8c5",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "45bdf066-bccb-47a9-adb6-0d1e80561376",
          "id": "45bdf066-bccb-47a9-adb6-0d1e80561376",
          "molfile": "\n  Marvin  01132103402D          \n\n 32 35  0  0  0  0            999 V2000\n    3.8464   -1.1176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0429   -0.9305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4798   -1.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8012   -0.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9954    0.0389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7549    0.8330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3158    1.4358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0763    2.2266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1193    1.2487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3620    0.4588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1668    0.2793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5701    1.1755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0500    1.8431    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5691    2.5095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8196    3.2931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2168    2.2537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9304    2.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6408    2.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6408    1.4252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9228    1.0145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2103    1.4271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1916    0.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9929    0.3904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5547   -0.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3603   -0.0154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9243   -0.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5954    0.7731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3185   -1.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8837   -1.6014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5150   -1.1881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0501   -0.5876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8494   -0.7724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 10  2  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n 12  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 21  1  0  0  0  0\n 12 22  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 14  1  0  0  0  0\n 16 17  1  0  0  0  0\n 21 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 31  2  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 24 28  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 28 29  1  0  0  0  0\n 30 28  2  0  0  0  0\n 31 30  1  0  0  0  0\n 31 32  1  0  0  0  0\nM  END",
          "smiles": "CC(C)c1cc(c(C)cc1O)C2(c3ccccc3C(=O)O2)c4cc(C(C)C)c(cc4C)O",
          "formula": "C28H30O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bbf2e3bf-18e3-4136-80a2-44b8d534a292"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "430.5364",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "42ca8251-262a-4349-a25f-697de59cc100",
      "version": "5",
      "structure": {
        "id": "c183cfd5-f061-4686-b1bb-750524ef5fba",
        "molfile": "\n  Marvin  01132110002D          \n\n 32 35  0  0  0  0            999 V2000\n    0.5701    1.1755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7549    0.8330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1916    0.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2103    1.4271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0500    1.8431    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9954    0.0389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3158    1.4358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9929    0.3904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0501   -0.5876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2168    2.2537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9228    1.0145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5691    2.5095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8012   -0.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1193    1.2487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0763    2.2266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5547   -0.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5150   -1.1881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8494   -0.7724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9304    2.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6408    1.4252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8196    3.2931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3620    0.4588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0429   -0.9305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3185   -1.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3603   -0.0154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6408    2.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1668    0.2793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8464   -1.1176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4798   -1.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8837   -1.6014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9243   -0.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5954    0.7731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  2  7  2  0  0  0  0\n  3  8  1  0  0  0  0\n  3  9  2  0  0  0  0\n  4 10  2  0  0  0  0\n  4 11  1  0  0  0  0\n  5 12  1  0  0  0  0\n  6 13  2  0  0  0  0\n  7 14  1  0  0  0  0\n  7 15  1  0  0  0  0\n  8 16  2  0  0  0  0\n  9 17  1  0  0  0  0\n  9 18  1  0  0  0  0\n 10 19  1  0  0  0  0\n 11 20  2  0  0  0  0\n 12 21  2  0  0  0  0\n 13 22  1  0  0  0  0\n 13 23  1  0  0  0  0\n 16 24  1  0  0  0  0\n 16 25  1  0  0  0  0\n 19 26  2  0  0  0  0\n 22 27  1  0  0  0  0\n 23 28  1  0  0  0  0\n 23 29  1  0  0  0  0\n 24 30  1  0  0  0  0\n 25 31  1  0  0  0  0\n 25 32  1  0  0  0  0\n 10 12  1  0  0  0  0\n 14 22  2  0  0  0  0\n 17 24  2  0  0  0  0\n 20 26  1  0  0  0  0\nM  END",
        "smiles": "CC(C)c1cc(c(C)cc1O)C2(c3ccccc3C(=O)O2)c4cc(C(C)C)c(cc4C)O",
        "formula": "C28H30O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "430.5364",
        "optical_activity": "NONE",
        "references": [
          "10709c11-acf2-4cea-935e-d44a1f44d4f9",
          "575f3b8c-04ae-4e2c-aab1-4ee75107e8fe"
        ],
        "stereo_centers": 0
      },
      "unii": "YG5I28WSQP"
    }
  ]
}