{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ae0bf644-54da-4a87-9b43-9be779f098c4",
          "code": "599-61-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=599-61-1",
          "code_system": "CAS",
          "references": [
            "ce1fb3e2-dab3-4dde-8aa9-76ceb4fd31ce",
            "6b5dce3f-c934-4afd-8197-1962c0b4d240"
          ]
        },
        {
          "uuid": "40703448-9b21-42c6-9604-fdc1326e0854",
          "code": "209-967-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.009.062",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ce1fb3e2-dab3-4dde-8aa9-76ceb4fd31ce"
          ]
        },
        {
          "uuid": "336ba1d5-08ea-4fa5-8494-3f6599f47ab2",
          "code": "11741",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11741",
          "code_system": "PUBCHEM",
          "references": [
            "ce1fb3e2-dab3-4dde-8aa9-76ceb4fd31ce"
          ]
        },
        {
          "uuid": "06d5073b-9b8a-c6fe-a12f-27a8d0dc776e",
          "code": "DTXSID3044962",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3044962",
          "code_system": "EPA CompTox",
          "references": [
            "13e1ecf9-6e0f-d04f-5ef4-dd3a042aa353"
          ]
        },
        {
          "uuid": "13ab4cf5-c152-4bab-8e1c-9939e07c81af",
          "code": "YFY9Q1LQN9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "24908544-b134-c466-3080-119b47c4d230",
          "code": "20610",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=20610",
          "code_system": "NSC",
          "references": [
            "033b6937-b38d-5e36-9684-a1c14984d0a3"
          ]
        },
        {
          "uuid": "2416f542-4345-a5d1-a621-cd95541ce683",
          "code": "300000053741",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "4570d868-2eab-5551-43b3-e3f9a59f289e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "15ff4c0b-05a6-45fd-80c9-353a0a7ced8e",
          "name": "3,3'-DAS",
          "stdName": "3,3'-DAS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "def596f9-2b04-4fac-affd-c4429341394c"
          ],
          "display_name": false
        },
        {
          "uuid": "f813537e-713b-4c99-adbb-39aa1a686ce5",
          "name": "3,3'-DDS",
          "stdName": "3,3'-DDS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "def596f9-2b04-4fac-affd-c4429341394c"
          ],
          "display_name": false
        },
        {
          "uuid": "69543cb8-9476-4e17-a837-40970e363416",
          "name": "3,3'-DIAMINODIPHENYL SULFONE",
          "stdName": "3,3'-DIAMINODIPHENYL SULFONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "def596f9-2b04-4fac-affd-c4429341394c"
          ],
          "display_name": false
        },
        {
          "uuid": "acda10b1-ec2b-4121-9316-bb21a1213f51",
          "name": "3,3'-DIAMINOPHENYL SULFONE",
          "stdName": "3,3'-DIAMINOPHENYL SULFONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "def596f9-2b04-4fac-affd-c4429341394c"
          ],
          "display_name": false
        },
        {
          "uuid": "eb066aec-4c1c-4afa-ac1f-131cee9212b9",
          "name": "3,3'-SULFONYLBIS(ANILINE)",
          "stdName": "3,3'-SULFONYLBIS(ANILINE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "def596f9-2b04-4fac-affd-c4429341394c"
          ],
          "display_name": false
        },
        {
          "uuid": "ebdc5067-d502-433d-a59b-1387a5a51deb",
          "name": "3,3'-SULPHONYLDIANILINE",
          "stdName": "3,3'-SULPHONYLDIANILINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62211140-09a2-4d21-8b06-28986ef5b8a5"
          ],
          "display_name": true
        },
        {
          "uuid": "2649502f-82c3-493c-894c-25a9d8cf7f72",
          "name": "ANILINE, 3,3'-SULFONYLDI-",
          "stdName": "ANILINE, 3,3'-SULFONYLDI-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "def596f9-2b04-4fac-affd-c4429341394c"
          ],
          "display_name": false
        },
        {
          "uuid": "3c55acf8-a43b-4fc0-8108-c710da055d90",
          "name": "BENZENAMINE, 3,3'-SULFONYLBIS-",
          "stdName": "BENZENAMINE, 3,3'-SULFONYLBIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "def596f9-2b04-4fac-affd-c4429341394c"
          ],
          "display_name": false
        },
        {
          "uuid": "b26a43c0-7e8c-443a-bdd6-b9e57c5c12b0",
          "name": "BIS(3-AMINOPHENYL) SULFONE",
          "stdName": "BIS(3-AMINOPHENYL) SULFONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "def596f9-2b04-4fac-affd-c4429341394c"
          ],
          "display_name": false
        },
        {
          "uuid": "9e3255af-becc-4e55-a9ef-6e8868a26940",
          "name": "BIS(M-AMINOPHENYL) SULFONE",
          "stdName": "BIS(M-AMINOPHENYL) SULFONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "def596f9-2b04-4fac-affd-c4429341394c"
          ],
          "display_name": false
        },
        {
          "uuid": "7f7ae3d9-8db9-4af5-ac58-6cf0bcac29d9",
          "name": "NSC-20610",
          "stdName": "NSC-20610",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1da1e72-d50d-4af1-95e7-514f3dfc2758"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "62211140-09a2-4d21-8b06-28986ef5b8a5",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "def596f9-2b04-4fac-affd-c4429341394c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1da1e72-d50d-4af1-95e7-514f3dfc2758",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce1fb3e2-dab3-4dde-8aa9-76ceb4fd31ce",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392317000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07439e47-b5a2-4fb8-a41b-f667ef78d4b0",
          "citation": "SRS import [YFY9Q1LQN9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YFY9Q1LQN9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392317000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13e1ecf9-6e0f-d04f-5ef4-dd3a042aa353",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=599-61-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "033b6937-b38d-5e36-9684-a1c14984d0a3",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6b5dce3f-c934-4afd-8197-1962c0b4d240",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4570d868-2eab-5551-43b3-e3f9a59f289e",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2a6bd066-4dbb-4ca8-8e7e-71664ebce90c",
          "id": "2a6bd066-4dbb-4ca8-8e7e-71664ebce90c",
          "molfile": "\n  Marvin  01132102182D          \n\n 17 18  0  0  0  0            999 V2000\n    1.2220   -3.3439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0041   -2.5481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2084   -2.3303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.5251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5873   -0.9473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3830   -1.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5914   -1.9609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9704   -0.5873    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3925    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5577    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5577   -1.1746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3398   -1.9704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9176   -2.5577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7228   -2.3492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9312   -1.5535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7364   -1.3357    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3534   -0.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  7  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  2  0  0  0  0\n 11  8  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 17  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\nM  END",
          "smiles": "c1cc(cc(c1)S(=O)(=O)c2cccc(c2)N)N",
          "formula": "C12H12N2O2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9ff6705a-c2a6-4f67-9f1b-03346dcec699"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "248.3024",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "32335622-84e1-4aff-9e97-9c1660595920",
      "version": "5",
      "structure": {
        "id": "39e22941-0801-4b07-ab3f-688493270994",
        "molfile": "\n  Marvin  01132103042D          \n\n 17 18  0  0  0  0            999 V2000\n    1.0041   -2.5481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2084   -2.3303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.5251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5873   -0.9473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3830   -1.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5914   -1.9609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2220   -3.3439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9312   -1.5535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7228   -2.3492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9176   -2.5577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3398   -1.9704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5577   -1.1746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3534   -0.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7364   -1.3357    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9704   -0.5873    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3925    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5577    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  6  1  0  0  0  0\n  1  7  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5 15  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 13  1  0  0  0  0\n  8 14  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  2  0  0  0  0\nM  END",
        "smiles": "c1cc(cc(c1)S(=O)(=O)c2cccc(c2)N)N",
        "formula": "C12H12N2O2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "248.3024",
        "optical_activity": "NONE",
        "references": [
          "62211140-09a2-4d21-8b06-28986ef5b8a5",
          "07439e47-b5a2-4fb8-a41b-f667ef78d4b0"
        ],
        "stereo_centers": 0
      },
      "unii": "YFY9Q1LQN9"
    }
  ]
}