{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ba8c35db-ea37-4e50-b82f-78e17fd4183d",
          "code": "173994-78-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=173994-78-0",
          "code_system": "CAS",
          "references": [
            "8b301847-120d-4dc6-b37a-3b640971ea34",
            "0347fc40-2282-4f0a-bcef-2549939e0088"
          ]
        },
        {
          "uuid": "84b1fc1f-f539-40ad-9c2f-9d76f9e3b9c8",
          "code": "18541936",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18541936",
          "code_system": "PUBCHEM",
          "references": [
            "8b301847-120d-4dc6-b37a-3b640971ea34"
          ]
        },
        {
          "uuid": "517d8258-fc46-6818-2342-a5b5f3e724c3",
          "code": "DTXSID70169739",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70169739",
          "code_system": "EPA CompTox",
          "references": [
            "3c4e60f6-aeb0-88da-73ab-9ddf596f3864"
          ]
        },
        {
          "uuid": "877d1fee-f1ba-490d-a256-8e32e0f5837c",
          "code": "YCP4CS0W03",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "676c45d4-94e7-4cfd-a3e7-46391e7218ed",
          "name": "1H-PYRAZOLE-4,5-DIAMINE, 1-(1-METHYLETHYL)-, SULFATE (1:1)",
          "stdName": "1H-PYRAZOLE-4,5-DIAMINE, 1-(1-METHYLETHYL)-, SULFATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd391243-3704-4e5b-8ac2-5c9d079d2db6",
            "1ef29acc-9bb9-4642-93e5-ea6f7681b726"
          ],
          "display_name": false
        },
        {
          "uuid": "a835b054-76d8-47c4-83cc-f4d292862e64",
          "name": "4,5-DIAMINO-1-ISOPROPYL-1H-PYRAZOLE SULFATE",
          "stdName": "4,5-DIAMINO-1-ISOPROPYL-1H-PYRAZOLE SULFATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd391243-3704-4e5b-8ac2-5c9d079d2db6",
            "1ef29acc-9bb9-4642-93e5-ea6f7681b726"
          ],
          "display_name": false
        },
        {
          "uuid": "36da5e34-6761-4fb6-9325-57f114bc0286",
          "name": "N-ISOPROPYL 4,5-DIAMINO PYRAZOLE SULFATE",
          "stdName": "N-ISOPROPYL 4,5-DIAMINO PYRAZOLE SULFATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9ebb577-eed6-46bc-849f-8d92974527e8",
            "fd391243-3704-4e5b-8ac2-5c9d079d2db6",
            "ec29a55d-d001-4ae7-983c-42f233be205a"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b075d10d-1b76-4f68-828e-458fc34a600a",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "8b301847-120d-4dc6-b37a-3b640971ea34",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391546000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34cadf30-37ba-4b55-8cf1-df11ead4318e",
          "citation": "SRS import [YCP4CS0W03]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YCP4CS0W03",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391546000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec29a55d-d001-4ae7-983c-42f233be205a",
          "citation": "N-ISOPROPYL 4,5-DIAMINO PYRAZOLE SULFATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f9ebb577-eed6-46bc-849f-8d92974527e8",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fd391243-3704-4e5b-8ac2-5c9d079d2db6",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ef29acc-9bb9-4642-93e5-ea6f7681b726",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c4e60f6-aeb0-88da-73ab-9ddf596f3864",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=173994-78-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0347fc40-2282-4f0a-bcef-2549939e0088",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5e81ec37-d92f-41c8-8ab0-241b6ddd0717",
          "id": "5e81ec37-d92f-41c8-8ab0-241b6ddd0717",
          "molfile": "\n  Marvin  01132104542D          \n\n  5  4  0  0  0  0            999 V2000\n   14.4067   -3.8462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4067   -4.6712    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4067   -5.4962    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5817   -4.6712    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2317   -4.6712    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  2  5  2  0  0  0  0\nM  END",
          "smiles": "OS(=O)(=O)O",
          "formula": "H2O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "35a4496f-72c1-44c6-b556-6ac8cd835757"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "98.0796",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "e421fddb-adc8-43c9-8a5e-356ea1dfbed4",
          "id": "e421fddb-adc8-43c9-8a5e-356ea1dfbed4",
          "molfile": "\n  Marvin  01132111492D          \n\n 10 10  0  0  0  0            999 V2000\n   10.4665   -2.9470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1810   -3.3595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8954   -2.9470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1810   -4.1845    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8510   -4.6717    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5940   -5.4569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7680   -5.4569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2823   -6.1235    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5152   -4.6717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7307   -4.4171    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  9  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  9 10  1  0  0  0  0\nM  END",
          "smiles": "CC(C)n1c(c(cn1)N)N",
          "formula": "C6H12N4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "41cbc4c5-6ce6-4e53-8069-1816c6f31d81"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "140.1865",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "88b35905-8a14-4d60-84c5-7d419b08b8a5",
      "version": "4",
      "structure": {
        "id": "379d2e60-d73e-4c9e-949c-ece430ac27ef",
        "molfile": "\n  Marvin  01132102572D          \n\n 15 14  0  0  0  0            999 V2000\n    9.7305   -4.4170    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2822   -6.1234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5150   -4.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7678   -5.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5938   -5.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8508   -4.6716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1808   -4.1844    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1808   -3.3595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4663   -2.9469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8952   -2.9469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4030   -3.8452    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4030   -5.4948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5782   -4.6700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2277   -4.6700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4030   -4.6700    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  4  2  1  0  0  0  0\n  3  1  1  0  0  0  0\n  7  3  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 15 11  1  0  0  0  0\n 15 12  1  0  0  0  0\n 15 13  2  0  0  0  0\n 15 14  2  0  0  0  0\nM  END",
        "smiles": "CC(C)n1c(c(cn1)N)N.OS(=O)(=O)O",
        "formula": "C6H12N4.H2O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "238.2661",
        "optical_activity": "NONE",
        "references": [
          "1ef29acc-9bb9-4642-93e5-ea6f7681b726",
          "34cadf30-37ba-4b55-8cf1-df11ead4318e"
        ],
        "stereo_centers": 0
      },
      "unii": "YCP4CS0W03"
    }
  ]
}