{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0cd4b644-9fbe-47eb-bd96-e659fae17693",
          "code": "895-85-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=895-85-2",
          "code_system": "CAS",
          "references": [
            "0572061b-04af-435b-a626-49f9ceb36080",
            "617ad34a-3351-4324-8fd9-5248a2814544"
          ]
        },
        {
          "uuid": "2395fddf-1048-42a2-9da5-99f46c84f2b1",
          "code": "123091",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/123091",
          "code_system": "PUBCHEM",
          "references": [
            "0572061b-04af-435b-a626-49f9ceb36080"
          ]
        },
        {
          "uuid": "4de291e0-9b62-a789-26c2-f90b86234ba9",
          "code": "DTXSID6074332",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6074332",
          "code_system": "EPA CompTox",
          "references": [
            "1ad85c0e-6b82-a549-4be5-cba182924efb"
          ]
        },
        {
          "uuid": "e07bf79f-f225-493a-b228-f1ebfaa298d0",
          "code": "YCC4HA3UHV",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ac519ca8-002c-4a6f-96a8-cfb2fac328e8",
          "name": "4-METHYLBENZOYL PEROXIDE",
          "stdName": "4-METHYLBENZOYL PEROXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35473103-b7eb-4657-aabc-615c0d5f4a01",
            "f021e879-299b-493f-b072-e4e0d571c39d"
          ],
          "display_name": false
        },
        {
          "uuid": "e7c60f81-f181-4735-9074-763e09b8ca7d",
          "name": "BIS(4-METHYLBENZOYL) PEROXIDE",
          "stdName": "BIS(4-METHYLBENZOYL) PEROXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35473103-b7eb-4657-aabc-615c0d5f4a01"
          ],
          "display_name": true
        },
        {
          "uuid": "399d9634-96bd-4475-845d-61324887e786",
          "name": "BIS(P-METHYLBENZOYL) PEROXIDE",
          "stdName": "BIS(P-METHYLBENZOYL) PEROXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35473103-b7eb-4657-aabc-615c0d5f4a01",
            "f021e879-299b-493f-b072-e4e0d571c39d"
          ],
          "display_name": false
        },
        {
          "uuid": "96296191-f82a-4f10-97c6-40efb04c4181",
          "name": "DI(P-METHYLBENZOYL) PEROXIDE",
          "stdName": "DI(P-METHYLBENZOYL) PEROXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35473103-b7eb-4657-aabc-615c0d5f4a01",
            "f021e879-299b-493f-b072-e4e0d571c39d"
          ],
          "display_name": false
        },
        {
          "uuid": "37a1a70c-dc00-4492-b759-465cd3b64458",
          "name": "P,P'-DIMETHYLBENZOYL PEROXID",
          "stdName": "P,P'-DIMETHYLBENZOYL PEROXID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35473103-b7eb-4657-aabc-615c0d5f4a01",
            "f021e879-299b-493f-b072-e4e0d571c39d"
          ],
          "display_name": false
        },
        {
          "uuid": "6d9a6dfe-8cb2-4ff5-a3e3-f098a1a14ea0",
          "name": "P,P'-DIMETHYLDIBENZOYL PEROXIDE",
          "stdName": "P,P'-DIMETHYLDIBENZOYL PEROXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35473103-b7eb-4657-aabc-615c0d5f4a01",
            "f021e879-299b-493f-b072-e4e0d571c39d"
          ],
          "display_name": false
        },
        {
          "uuid": "6cbf1929-d4cf-4b12-a192-5caf91e5faa1",
          "name": "P-METHYLBENZOYL PEROXIDE",
          "stdName": "P-METHYLBENZOYL PEROXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35473103-b7eb-4657-aabc-615c0d5f4a01",
            "f021e879-299b-493f-b072-e4e0d571c39d"
          ],
          "display_name": false
        },
        {
          "uuid": "104a7138-5636-4433-af90-34bc51a73065",
          "name": "P-TOLUOYL PEROXIDE",
          "stdName": "P-TOLUOYL PEROXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35473103-b7eb-4657-aabc-615c0d5f4a01",
            "f021e879-299b-493f-b072-e4e0d571c39d"
          ],
          "display_name": false
        },
        {
          "uuid": "15546a10-e281-4bc4-b398-ed62f771d88a",
          "name": "PEROXIDE, BIS(4-METHYLBENZOYL)",
          "stdName": "PEROXIDE, BIS(4-METHYLBENZOYL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35473103-b7eb-4657-aabc-615c0d5f4a01",
            "f021e879-299b-493f-b072-e4e0d571c39d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "35473103-b7eb-4657-aabc-615c0d5f4a01",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f021e879-299b-493f-b072-e4e0d571c39d",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0572061b-04af-435b-a626-49f9ceb36080",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390993000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d96984c9-0a61-4691-827e-4608cb4ea7ed",
          "citation": "SRS import [YCC4HA3UHV]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=YCC4HA3UHV",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390993000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "16408b4a-61d2-482a-8036-14590611abea",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ad85c0e-6b82-a549-4be5-cba182924efb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=895-85-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "617ad34a-3351-4324-8fd9-5248a2814544",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bbd2a20e-836b-4efa-a8a2-be922ceac750",
          "id": "bbd2a20e-836b-4efa-a8a2-be922ceac750",
          "molfile": "\n  Marvin  01132109432D          \n\n 20 21  0  0  0  0            999 V2000\n   11.2865   -3.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4461   -4.2163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4461   -5.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7001   -5.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0125   -5.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0125   -4.2163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7523   -3.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2674   -5.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2674   -6.1907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5259   -5.0560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8860   -5.3511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1416   -5.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1416   -4.2163    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4010   -5.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4010   -6.1907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7072   -6.6371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9673   -6.1907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0808   -6.6371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9673   -5.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7072   -5.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  8  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 20 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 19  2  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(cc1)C(=O)OOC(=O)c2ccc(C)cc2",
          "formula": "C16H14O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5a64a32a-c2fa-4f79-aed3-3e156b9722cc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "270.2806",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b731ba55-12de-4d46-be96-ecb089206459",
      "version": "3",
      "structure": {
        "id": "9cb9de97-8fdb-45aa-89c1-29be6854159c",
        "molfile": "\n  Marvin  01132108092D          \n\n 20 21  0  0  0  0            999 V2000\n    6.1416   -5.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8860   -5.3511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5259   -5.0560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2674   -5.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0125   -5.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7001   -5.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4461   -5.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4461   -4.2163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7523   -3.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0125   -4.2163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2865   -3.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2674   -6.1907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4010   -5.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4010   -6.1907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7072   -6.6371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9673   -6.1907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9673   -5.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7072   -5.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0808   -6.6371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1416   -4.2163    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10  5  2  0  0  0  0\n 11  8  1  0  0  0  0\n 12  4  2  0  0  0  0\n 13  1  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 13  2  0  0  0  0\n 19 16  1  0  0  0  0\n 20  1  2  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(cc1)C(=O)OOC(=O)c2ccc(C)cc2",
        "formula": "C16H14O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "270.2806",
        "optical_activity": "NONE",
        "references": [
          "16408b4a-61d2-482a-8036-14590611abea",
          "d96984c9-0a61-4691-827e-4608cb4ea7ed"
        ],
        "stereo_centers": 0
      },
      "unii": "YCC4HA3UHV"
    }
  ]
}