{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8a3a575f-3526-4a7d-a46e-4355686b4b0e", "code": "6786-83-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=6786-83-0", "code_system": "CAS", "references": [ "5bb0ba04-bbdf-4fc0-9dd8-49df03cd4f71", "d4df0cff-0aa1-437f-ad63-219a32333807" ] }, { "uuid": "ed85f4bb-015f-470c-81db-a011a63dd0ee", "code": "229-851-8", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.027.138", "code_system": "ECHA (EC/EINECS)", "references": [ "5bb0ba04-bbdf-4fc0-9dd8-49df03cd4f71" ] }, { "uuid": "c12994ed-4571-49ba-b604-b25a047cfd45", "code": "81245", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/81245", "code_system": "PUBCHEM", "references": [ "5bb0ba04-bbdf-4fc0-9dd8-49df03cd4f71" ] }, { "uuid": "9938f1f1-2369-cbcd-f975-293d48fdde7b", "code": "DTXSID4064474", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4064474", "code_system": "EPA CompTox", "references": [ "85a8d686-d5c2-8fe6-f1d1-c9691b4bf381" ] }, { "uuid": "524846c1-5fe3-48d2-b3dd-c2d264aa650d", "code": "YBL2HV4LGD", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "d4df0cff-0aa1-437f-ad63-219a32333807" ] }, { "uuid": "d019b003-a0d7-c968-a457-fa556dc3caed", "code": "300000052882", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "d73ad6ac-4075-8fa1-daa0-d1ce34299571" ] } ], "substance_class": "chemical", "names": [ { "uuid": "35a399a6-f469-43bd-92d2-a305d6f96c67", "name": "1-Naphthalenemethanol, α,α-bis[4-(dimethylamino)phenyl]-4-(phenylamino)-", "stdName": "1-NAPHTHALENEMETHANOL, .ALPHA.,.ALPHA.-BIS(4-(DIMETHYLAMINO)PHENYL)-4-(PHENYLAMINO)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "0ca9725f-bc8d-4812-8116-15c26f00f1a5" ], "display_name": false }, { "uuid": "aef59627-2dd5-4b67-8823-14e97751d13b", "name": "Solvent Blue 4", "stdName": "SOLVENT BLUE 4", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d4df0cff-0aa1-437f-ad63-219a32333807" ], "display_name": false }, { "uuid": "3663bc69-c161-44fb-a61b-62534d5f94d0", "name": "α,α-Bis[4-(dimethylamino)phenyl]-4-(phenylamino)-1-naphthalenemethanol", "stdName": ".ALPHA.,.ALPHA.-BIS(4-(DIMETHYLAMINO)PHENYL)-4-(PHENYLAMINO)-1-NAPHTHALENEMETHANOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d4df0cff-0aa1-437f-ad63-219a32333807" ], "display_name": true } ], "references": [ { "uuid": "0ca9725f-bc8d-4812-8116-15c26f00f1a5", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5bb0ba04-bbdf-4fc0-9dd8-49df03cd4f71", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392364000, "tags": [ "NOMEN" ] }, { "uuid": "85a8d686-d5c2-8fe6-f1d1-c9691b4bf381", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6786-83-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d4df0cff-0aa1-437f-ad63-219a32333807", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "d73ad6ac-4075-8fa1-daa0-d1ce34299571", "citation": "SMS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "24b76b09-0b38-4b38-b9eb-f4d2f7639fbd", "id": "24b76b09-0b38-4b38-b9eb-f4d2f7639fbd", "molfile": "\n Marvin 01132102022D \n\n 37 41 0 0 0 0 999 V2000\n 2.9986 -7.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7205 -7.5202 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4265 -7.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7205 -6.6873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0065 -6.2748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0065 -5.4498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7205 -5.0373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4424 -5.4498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4344 -6.2828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7284 -4.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1335 -4.5455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4424 -3.7998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4424 -2.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1563 -2.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8702 -2.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8702 -3.7998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1563 -4.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5921 -2.5543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3061 -2.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5921 -1.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8637 -3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8637 -2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1497 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4358 -2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7219 -2.4750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7219 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7140 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4279 -0.4046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4358 -1.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4358 -3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7140 -4.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7140 -4.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4358 -5.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1497 -4.9580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1497 -4.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 4 9 2 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 2 0 0 0 0\n 10 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 10 1 0 0 0 0\n 10 21 1 0 0 0 0\n 13 12 1 0 0 0 0\n 12 17 2 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 18 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 37 2 0 0 0 0\n 23 22 2 0 0 0 0\n 24 23 1 0 0 0 0\n 24 25 1 0 0 0 0\n 32 24 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 31 2 0 0 0 0\n 27 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 30 31 1 0 0 0 0\n 32 33 1 0 0 0 0\n 37 32 1 0 0 0 0\n 33 34 2 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 2 0 0 0 0\n 37 36 1 0 0 0 0\nM END", "smiles": "CN(C)c1ccc(cc1)C(c2ccc(cc2)N(C)C)(c3ccc(c4ccccc43)Nc5ccccc5)O", "formula": "C33H33N3O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e14c3974-89d3-4066-8de4-389727dcfafd" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "487.6358", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "e8b07e37-3d7d-4efc-8a61-613b958283b8", "version": "6", "structure": { "id": "bbdbb257-b5a4-4e45-b46a-b64cc398d7c1", "molfile": "\n Marvin 01132109432D \n\n 37 41 0 0 0 0 999 V2000\n 6.5921 -2.5543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8702 -2.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1563 -2.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4424 -2.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4424 -3.7998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1563 -4.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8702 -3.7998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7284 -4.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7205 -5.0373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0065 -5.4498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0065 -6.2748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7205 -6.6873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7205 -7.5202 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9986 -7.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4265 -7.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4344 -6.2828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4424 -5.4498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8637 -3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1497 -4.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4358 -3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4358 -2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7219 -2.4750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7219 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7140 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4279 -0.4046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4358 -1.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1497 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8637 -2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7140 -4.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7140 -4.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4358 -5.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1497 -4.9580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3061 -2.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5921 -1.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1335 -4.5455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 35 1 0 0 0 0\n 1 36 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 7 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 8 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 18 1 0 0 0 0\n 8 37 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 17 2 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 16 2 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 30 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 34 1 0 0 0 0\n 20 21 2 0 0 0 0\n 20 31 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 29 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 28 2 0 0 0 0\n 24 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 29 30 2 0 0 0 0\n 31 32 2 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 2 0 0 0 0\nM END", "smiles": "CN(C)c1ccc(cc1)C(c2ccc(cc2)N(C)C)(c3ccc(c4ccccc43)Nc5ccccc5)O", "formula": "C33H33N3O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "487.6358", "optical_activity": "NONE", "references": [ "0ca9725f-bc8d-4812-8116-15c26f00f1a5" ], "stereo_centers": 0 }, "unii": "YBL2HV4LGD" } ] }