{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "aa3f227b-a734-4b82-802c-9420009a0096",
          "code": "C10AB02",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|LIPID MODIFYING AGENTS|LIPID MODIFYING AGENTS, PLAIN|Fibrates|bezafibrate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C10AB02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "9fe9ab98-188c-4257-8ab6-b758ab97407c"
          ]
        },
        {
          "uuid": "01444a9c-d9d9-4c4c-ad1a-53131a72b888",
          "code": "QC10AB02",
          "comments": "VATC|LIPID MODIFYING AGENTS|LIPID MODIFYING AGENTS, PLAIN|Fibrates|bezafibrate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC10AB02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "9fe9ab98-188c-4257-8ab6-b758ab97407c"
          ]
        },
        {
          "uuid": "99a38506-63d3-4464-9dae-56e2a3abf28b",
          "code": "41859-67-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=41859-67-0",
          "code_system": "CAS",
          "references": [
            "9fe9ab98-188c-4257-8ab6-b758ab97407c",
            "b6a6c673-7b3f-458a-8000-5737b9faed00"
          ]
        },
        {
          "uuid": "8a296203-8a6c-4b2c-9e45-7c5396faeb52",
          "code": "C87449",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87449",
          "code_system": "NCI_THESAURUS",
          "references": [
            "9fe9ab98-188c-4257-8ab6-b758ab97407c"
          ]
        },
        {
          "uuid": "296d7007-6193-4a0b-8352-f1b7d53f0b87",
          "code": "D001629",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68001629",
          "code_system": "MESH",
          "references": [
            "9fe9ab98-188c-4257-8ab6-b758ab97407c"
          ]
        },
        {
          "uuid": "756f2c97-fec1-42bd-aea1-e01bfb740525",
          "code": "BEZAFIBRATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bezafibrate",
          "code_system": "WIKIPEDIA",
          "references": [
            "9fe9ab98-188c-4257-8ab6-b758ab97407c"
          ]
        },
        {
          "uuid": "0491792b-e1ac-4d1e-b553-8ae8feb056a6",
          "code": "3968",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3968",
          "code_system": "INN",
          "references": [
            "9fe9ab98-188c-4257-8ab6-b758ab97407c"
          ]
        },
        {
          "uuid": "d9460ece-a614-4394-92c6-835270bcb4da",
          "code": "2668",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=2668",
          "code_system": "IUPHAR",
          "references": [
            "9fe9ab98-188c-4257-8ab6-b758ab97407c"
          ]
        },
        {
          "uuid": "a9295624-bf15-46f2-8d61-257e87be7c85",
          "code": "m2469",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2469?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "9fe9ab98-188c-4257-8ab6-b758ab97407c"
          ]
        },
        {
          "uuid": "bd11fbcc-b43e-4dfe-bf13-a8ea8b22bbe3",
          "code": "1525",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1525/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "9fe9ab98-188c-4257-8ab6-b758ab97407c"
          ]
        },
        {
          "uuid": "1a4bd1b8-7a6b-4dc5-930a-b6ec7a63f1a6",
          "code": "DB01393",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01393",
          "code_system": "DRUG BANK",
          "references": [
            "9fe9ab98-188c-4257-8ab6-b758ab97407c"
          ]
        },
        {
          "uuid": "f4239fa3-3ee4-4ff1-90d1-2fda8ab1c3f4",
          "code": "SUB05810MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "9fe9ab98-188c-4257-8ab6-b758ab97407c"
          ]
        },
        {
          "uuid": "ef2771c2-3ac6-4667-9c24-5adf65c13b8b",
          "code": "CHEMBL264374",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL264374",
          "code_system": "ChEMBL",
          "references": [
            "9fe9ab98-188c-4257-8ab6-b758ab97407c"
          ]
        },
        {
          "uuid": "2ac3009d-4b99-487d-a073-67ce6d56e98d",
          "code": "255-567-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.050.498",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9fe9ab98-188c-4257-8ab6-b758ab97407c"
          ]
        },
        {
          "uuid": "15f313c2-925b-4db8-a056-57400482c14b",
          "code": "39042",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/39042",
          "code_system": "PUBCHEM",
          "references": [
            "9fe9ab98-188c-4257-8ab6-b758ab97407c"
          ]
        },
        {
          "uuid": "7cafd01a-52c8-4e64-f362-543909f14bd8",
          "code": "DTXSID3029869",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3029869",
          "code_system": "EPA CompTox",
          "references": [
            "88c544ea-cb7b-0ec2-6152-725b5677c4f2"
          ]
        },
        {
          "uuid": "7afb8cd4-feb5-09c4-b694-7e8d4a54a24b",
          "code": "400013",
          "comments": "ORPHAN DRUG|Designated|For therapeutic treatment of Barth syndrome",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=400013",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "ea1f7e8a-abc8-82e7-dda9-1de065ecd2cd",
          "code": "C98150",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Digestive System or Metabolism[C78276]|Antilipidemic Agent[C29703]|Fibrate Antilipidemic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C98150",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b6c2051e-fa38-8de2-6d6c-accfa4ae8d1e"
          ]
        },
        {
          "uuid": "08bb5a5b-fcc0-43d1-b753-4a998666c2b7",
          "code": "Y9449Q51XH",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9d53de39-b960-598c-818f-e4b98a7d542e",
          "code": "362",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/362",
          "code_system": "DRUG CENTRAL",
          "references": [
            "b6c2051e-fa38-8de2-6d6c-accfa4ae8d1e"
          ]
        },
        {
          "uuid": "80399368-f5aa-f4ce-5188-c426194d3bcf",
          "code": "47612",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:47612",
          "code_system": "CHEBI",
          "references": [
            "b6c2051e-fa38-8de2-6d6c-accfa4ae8d1e"
          ]
        },
        {
          "uuid": "eeff2c51-ffa6-5531-e8dc-7a70c8bfe456",
          "code": "937523",
          "comments": "ORPHAN DRUG|Designated|Treatment of primary biliary cholangitis",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=937523",
          "code_system": "FDA ORPHAN DRUG",
          "references": [
            "b6c2051e-fa38-8de2-6d6c-accfa4ae8d1e"
          ]
        },
        {
          "uuid": "ac6c1bf3-2f80-b845-ead0-1004b48c8c72",
          "code": "Y9449Q51XH",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Y9449Q51XH",
          "code_system": "DAILYMED",
          "references": [
            "d6de8fd4-def7-1e6b-275a-6e9cd92aaf22"
          ]
        },
        {
          "uuid": "843b9819-b33d-63d7-846e-1179e18fd8cd",
          "code": "758174",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=758174",
          "code_system": "NSC",
          "references": [
            "c8446c1e-42b9-61b1-d8c6-443e9dd4b467"
          ]
        },
        {
          "uuid": "769e63e4-4b42-523d-dcc5-db9e9c936bac",
          "code": "100000085894",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "51b54438-7b42-85fa-58d5-7ea84a40bc90"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "7fdc30ad-0f58-42f7-8a66-1468f9396a76",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "3b3614a9-376a-4d01-8f77-d2e229c12b2c",
            "refuuid": "3e3271c2-d2ac-456f-99e2-6d33b5652e27",
            "name": "BEZAFIBRATE",
            "unii": "Y9449Q51XH",
            "linking_id": "Y9449Q51XH",
            "ref_pname": "BEZAFIBRATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "11a23330-3b70-472e-944f-45a09f173ab2",
          "name": "2-(P-(2-(P-CHLOROBENZAMIDO)ETHYL)PHENOXY)-2-METHYLPROPIONIC ACID",
          "stdName": "2-(P-(2-(P-CHLOROBENZAMIDO)ETHYL)PHENOXY)-2-METHYLPROPIONIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9362398f-0a66-4d6c-8b03-4536e8985328"
          ],
          "display_name": false
        },
        {
          "uuid": "5c4da56d-1fef-479e-a659-c1ae52300e56",
          "name": "BEZAFIBRATE",
          "stdName": "BEZAFIBRATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d122659-615d-4bff-b4e8-64cbc5b82dd1",
            "dac4947c-7ac6-4a79-8e42-eafff659026f",
            "36f1cf71-98de-4f51-87d2-f6060fdb75dd",
            "089737fb-95df-4fab-8aee-ef4fdbed5264",
            "ef209958-4673-420b-92c8-cae604e9bd8e",
            "e5054196-5e75-4541-9753-7306a7a5ba52",
            "d8e6ff18-86b5-4438-9103-4a8de72eeea2",
            "99677c1c-ff44-4e6c-bd0f-6fd0bf6e9e63",
            "6529028b-9fc5-4f44-99fa-ecf2e3166821",
            "8a5d394d-c946-442f-bc97-bdfd1df421a6",
            "3efb3f7a-6ff0-44bd-8f9d-33cce02adce9",
            "941fb327-a155-4a9e-8762-ff522fb58c0c",
            "5bf733b3-fbe7-41bc-9856-f723f313cd82"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "f6b1522e-ba20-44eb-a9b6-d3f716e28b45",
              "name_org": "INN"
            },
            {
              "uuid": "1197e935-d69f-4ebf-87d8-5ccc03fb6cc9",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "3d7f0f16-eae3-e0bf-769c-4f36a492fccc",
          "name": "BEZAFIBRATE [EP MONOGRAPH]",
          "stdName": "BEZAFIBRATE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fce14eb-7882-d697-8e8f-c547856c1714"
          ],
          "display_name": false
        },
        {
          "uuid": "17c32b74-3edb-43ae-976d-50ed969271cf",
          "name": "BEZAFIBRATE [JAN]",
          "stdName": "BEZAFIBRATE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feef41d4-03d6-a023-c24a-101664cb585b"
          ],
          "display_name": false
        },
        {
          "uuid": "fe732037-f3a7-4e71-9efe-8ba3d532f73a",
          "name": "BEZAFIBRATE [MART.]",
          "stdName": "BEZAFIBRATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef209958-4673-420b-92c8-cae604e9bd8e"
          ],
          "display_name": false
        },
        {
          "uuid": "96b6135b-13aa-4e22-ad4e-1138b06525c1",
          "name": "BEZAFIBRATE [MI]",
          "stdName": "BEZAFIBRATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36f1cf71-98de-4f51-87d2-f6060fdb75dd"
          ],
          "display_name": false
        },
        {
          "uuid": "39167483-5065-42f9-b220-eee51ff20aaf",
          "name": "BEZAFIBRATE [USAN]",
          "stdName": "BEZAFIBRATE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d122659-615d-4bff-b4e8-64cbc5b82dd1"
          ],
          "display_name": false
        },
        {
          "uuid": "83de824e-1fbd-4ef5-a657-390c0958bc4b",
          "name": "BEZATOL SR",
          "stdName": "BEZATOL SR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "198c1f8b-f608-47a6-9b96-3f64efb42735",
            "6b7eca92-53f5-45c9-81e7-39eaa60c8a9b"
          ],
          "display_name": false
        },
        {
          "uuid": "0cb6055c-fce8-4711-a24e-909fcc63b4db",
          "name": "BM 15.075",
          "stdName": "BM 15.075",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9362398f-0a66-4d6c-8b03-4536e8985328"
          ],
          "display_name": false
        },
        {
          "uuid": "7b991f66-7eb7-4747-a8a1-84021cbcf5b0",
          "name": "BM-15.075",
          "stdName": "BM-15.075",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6a7033c-7c66-4b5c-9a0b-443e636e9a9b"
          ],
          "display_name": false
        },
        {
          "uuid": "78fea315-b38e-4afd-a3eb-a0a2b1c77afd",
          "name": "BM-15075",
          "stdName": "BM-15075",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6a7033c-7c66-4b5c-9a0b-443e636e9a9b"
          ],
          "display_name": false
        },
        {
          "uuid": "44fa36ae-945b-ae0c-1bca-b31a6e086691",
          "name": "Bezafibrate [WHO-DD]",
          "stdName": "BEZAFIBRATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b591bbb-8975-ae82-c13b-0f3cd02e0a44"
          ],
          "display_name": false
        },
        {
          "uuid": "8222a686-02c9-239c-7d48-9e2827f61f91",
          "name": "NSC-758174",
          "stdName": "NSC-758174",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8446c1e-42b9-61b1-d8c6-443e9dd4b467"
          ],
          "display_name": false
        },
        {
          "uuid": "6955d3a1-6344-4087-94df-b4b79837caba",
          "name": "PROPANOIC ACID, 2-(4-(2-((4-CHLOROBENZOYL)AMINO)ETHYL)PHENOXY)-2-METHYL-",
          "stdName": "PROPANOIC ACID, 2-(4-(2-((4-CHLOROBENZOYL)AMINO)ETHYL)PHENOXY)-2-METHYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9362398f-0a66-4d6c-8b03-4536e8985328"
          ],
          "display_name": false
        },
        {
          "uuid": "56bbb0b4-5f30-422d-bd5d-1b8ae60c4b3e",
          "name": "bezafibrate [INN]",
          "stdName": "BEZAFIBRATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99677c1c-ff44-4e6c-bd0f-6fd0bf6e9e63"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5bf733b3-fbe7-41bc-9856-f723f313cd82",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9362398f-0a66-4d6c-8b03-4536e8985328",
          "citation": "usp dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99677c1c-ff44-4e6c-bd0f-6fd0bf6e9e63",
          "citation": "INN Proposed List 35",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL35.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1d122659-615d-4bff-b4e8-64cbc5b82dd1",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "941fb327-a155-4a9e-8762-ff522fb58c0c",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef209958-4673-420b-92c8-cae604e9bd8e",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36f1cf71-98de-4f51-87d2-f6060fdb75dd",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "198c1f8b-f608-47a6-9b96-3f64efb42735",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b7eca92-53f5-45c9-81e7-39eaa60c8a9b",
          "citation": "D01366",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a5d394d-c946-442f-bc97-bdfd1df421a6",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6a7033c-7c66-4b5c-9a0b-443e636e9a9b",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9fe9ab98-188c-4257-8ab6-b758ab97407c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389706000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d5aeded-2db5-481c-ac6c-018ec5d599c3",
          "citation": "SRS import [Y9449Q51XH]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Y9449Q51XH",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389706000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8e6ff18-86b5-4438-9103-4a8de72eeea2",
          "citation": "BEZAFIBRATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "089737fb-95df-4fab-8aee-ef4fdbed5264",
          "citation": "BEZAFIBRATE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6529028b-9fc5-4f44-99fa-ecf2e3166821",
          "citation": "BEZAFIBRATE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dac4947c-7ac6-4a79-8e42-eafff659026f",
          "citation": "BEZAFIBRATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e5054196-5e75-4541-9753-7306a7a5ba52",
          "citation": "BEZAFIBRATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3efb3f7a-6ff0-44bd-8f9d-33cce02adce9",
          "citation": "BEZAFIBRATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "feef41d4-03d6-a023-c24a-101664cb585b",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "88c544ea-cb7b-0ec2-6152-725b5677c4f2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=41859-67-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b6c2051e-fa38-8de2-6d6c-accfa4ae8d1e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b6a6c673-7b3f-458a-8000-5737b9faed00",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c8446c1e-42b9-61b1-d8c6-443e9dd4b467",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7fce14eb-7882-d697-8e8f-c547856c1714",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "d6de8fd4-def7-1e6b-275a-6e9cd92aaf22",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "7b591bbb-8975-ae82-c13b-0f3cd02e0a44",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "51b54438-7b42-85fa-58d5-7ea84a40bc90",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "97dfe123-f056-4f01-b701-e4a169662f6d",
          "id": "97dfe123-f056-4f01-b701-e4a169662f6d",
          "molfile": "\n  Marvin  01132107532D          \n\n 25 26  0  0  0  0            999 V2000\n    0.4548   -1.1370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8688   -0.4227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2798   -1.1370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5860   -0.0127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3040   -0.4367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0123   -0.0251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7361   -0.4357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7424   -1.2598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4581   -1.6682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1765   -1.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8922   -1.6593    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6062   -1.2343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5979   -0.4012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3339   -1.6459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0457   -1.2289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7614   -1.6374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7657   -2.4694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4788   -2.8964    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.0639   -2.8806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3402   -2.4700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0241   -1.6773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3083   -1.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1545   -0.0117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5597   -0.4227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1516    0.8134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  2 23  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n 22  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 21  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 20 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  2  0  0  0  0\nM  END",
          "smiles": "CC(C)(C(=O)O)Oc1ccc(cc1)CCNC(=O)c2ccc(cc2)Cl",
          "formula": "C19H20ClNO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a351b86f-a33f-4fcb-85af-da4fe1926cb4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "361.8201",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3e3271c2-d2ac-456f-99e2-6d33b5652e27",
      "version": "18",
      "structure": {
        "id": "3a8e4ed5-2a4b-469b-9f6c-ae9707bfb9ec",
        "molfile": "\n  Marvin  01132103062D          \n\n 25 26  0  0  0  0            999 V2000\n    6.6062   -1.2343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5860   -0.0127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3339   -1.6459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5979   -0.4012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8922   -1.6593    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3402   -2.4700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0457   -1.2289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3040   -0.4367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7657   -2.4694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7614   -1.6374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0639   -2.8806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7424   -1.2598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4788   -2.8964    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.3083   -1.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0123   -0.0251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7361   -0.4357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0241   -1.6773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1765   -1.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4581   -1.6682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8688   -0.4227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1545   -0.0117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5597   -0.4227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4548   -1.1370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2798   -1.1370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1516    0.8134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  7  3  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10  7  2  0  0  0  0\n 11  6  1  0  0  0  0\n 12 16  1  0  0  0  0\n 13  9  1  0  0  0  0\n 14  8  2  0  0  0  0\n 15  8  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 14  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 12  1  0  0  0  0\n 17 12  2  0  0  0  0\n 11  9  2  0  0  0  0\n  2 20  1  0  0  0  0\n  1  5  1  0  0  0  0\n 20 21  1  0  0  0  0\n  3  1  1  0  0  0  0\n 21 22  1  0  0  0  0\n  4  1  2  0  0  0  0\n 20 23  1  0  0  0  0\n  5 18  1  0  0  0  0\n 20 24  1  0  0  0  0\n  6  3  2  0  0  0  0\n 21 25  2  0  0  0  0\nM  END",
        "smiles": "CC(C)(C(=O)O)Oc1ccc(cc1)CCNC(=O)c2ccc(cc2)Cl",
        "formula": "C19H20ClNO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "361.8201",
        "optical_activity": "NONE",
        "references": [
          "3d5aeded-2db5-481c-ac6c-018ec5d599c3",
          "5bf733b3-fbe7-41bc-9856-f723f313cd82",
          "99677c1c-ff44-4e6c-bd0f-6fd0bf6e9e63"
        ],
        "stereo_centers": 0
      },
      "unii": "Y9449Q51XH"
    }
  ]
}