{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "01d95a19-4d98-4e4c-b43c-b4a177e0664b",
          "code": "A11DA03",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|VITAMINS|VITAMIN B1, PLAIN AND IN COMBINATION WITH VITAMIN B6 AND B12|Vitamin B1, plain|benfotiamine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A11DA03&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "1f5d978e-1b27-4832-9c41-396eb79e2abe"
          ]
        },
        {
          "uuid": "98d84628-cb74-4b04-838b-ae6bcf8a0288",
          "code": "QA11DA03",
          "comments": "VATC|VITAMINS|VITAMIN B1, PLAIN AND IN COMBINATION WITH VITAMIN B6 AND B12|Vitamin B1, plain|benfotiamine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA11DA03&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "1f5d978e-1b27-4832-9c41-396eb79e2abe"
          ]
        },
        {
          "uuid": "f60e7c13-0028-4446-ad35-5c1d0ab88de1",
          "code": "22457-89-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=22457-89-2",
          "code_system": "CAS",
          "references": [
            "1f5d978e-1b27-4832-9c41-396eb79e2abe",
            "1621f56c-56dc-4001-a614-791404512bbf"
          ]
        },
        {
          "uuid": "d4206d8f-5dd6-4196-bf66-2f99aea40439",
          "code": "C013835",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67013835",
          "code_system": "MESH",
          "references": [
            "1f5d978e-1b27-4832-9c41-396eb79e2abe"
          ]
        },
        {
          "uuid": "fb670c29-e8c0-475f-9987-5fb87bdb867b",
          "code": "BENFOTIAMINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Benfotiamine",
          "code_system": "WIKIPEDIA",
          "references": [
            "1f5d978e-1b27-4832-9c41-396eb79e2abe"
          ]
        },
        {
          "uuid": "0a2bd4b2-389c-43dd-848c-d6f76ce13751",
          "code": "1300",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1300",
          "code_system": "INN",
          "references": [
            "1f5d978e-1b27-4832-9c41-396eb79e2abe"
          ]
        },
        {
          "uuid": "99947f65-9772-458c-98b9-88139bf73a05",
          "code": "m2313",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2313?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "1f5d978e-1b27-4832-9c41-396eb79e2abe"
          ]
        },
        {
          "uuid": "489644af-35ea-415a-b30b-ac3d35de6e1e",
          "code": "18891",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/18891/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "1f5d978e-1b27-4832-9c41-396eb79e2abe"
          ]
        },
        {
          "uuid": "0ef82458-c778-411a-83c5-3539f28dc06a",
          "code": "SUB05716MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "1f5d978e-1b27-4832-9c41-396eb79e2abe"
          ]
        },
        {
          "uuid": "1b63a275-7e1c-4401-b0e0-f34565a26c0b",
          "code": "CHEMBL1491875",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1491875",
          "code_system": "ChEMBL",
          "references": [
            "1f5d978e-1b27-4832-9c41-396eb79e2abe"
          ]
        },
        {
          "uuid": "58402fb4-fc45-4a42-8975-974372145820",
          "code": "245-013-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.040.906",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1f5d978e-1b27-4832-9c41-396eb79e2abe"
          ]
        },
        {
          "uuid": "a75f0faf-e923-4795-b98d-926d3782060c",
          "code": "2320",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2320",
          "code_system": "PUBCHEM",
          "references": [
            "1f5d978e-1b27-4832-9c41-396eb79e2abe"
          ]
        },
        {
          "uuid": "aa31c798-63da-fe53-d703-41985b4a164f",
          "code": "DTXSID3045433",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3045433",
          "code_system": "EPA CompTox",
          "references": [
            "61ba1929-debe-9476-4495-10b479f572d3"
          ]
        },
        {
          "uuid": "4de1a632-7707-1aaf-c438-906d255988be",
          "code": "C169805",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C169805",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d1e0d7ea-f874-860c-a3cb-328c272f1a19"
          ]
        },
        {
          "uuid": "eab0248e-90c2-4a23-95d6-c98bbf8086f6",
          "code": "Y92OUS2H9B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0077cd78-c189-2072-a628-d897ad2317f9",
          "code": "308",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/308",
          "code_system": "DRUG CENTRAL",
          "references": [
            "d1e0d7ea-f874-860c-a3cb-328c272f1a19"
          ]
        },
        {
          "uuid": "d7f20e70-ac99-0046-2017-158e1ac40a2e",
          "code": "2452 (Number of products:105)",
          "comments": "Dietary Supplement Label Database|vitamin|Vitamin B1 (benfotiamine)",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2452&item=Vitamin B1 (benfotiamine)",
          "code_system": "DSLD",
          "references": [
            "d1e0d7ea-f874-860c-a3cb-328c272f1a19"
          ]
        },
        {
          "uuid": "abd09f78-a961-19d8-18b2-a4698788cda8",
          "code": "DB11748",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB11748",
          "code_system": "DRUG BANK",
          "references": [
            "d1e0d7ea-f874-860c-a3cb-328c272f1a19"
          ]
        },
        {
          "uuid": "920cc15c-7ef1-9331-b804-9537258fd971",
          "code": "41039",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:41039",
          "code_system": "CHEBI",
          "references": [
            "d1e0d7ea-f874-860c-a3cb-328c272f1a19"
          ]
        },
        {
          "uuid": "12b03c52-c57a-f27f-9713-570c7395700c",
          "code": "Y92OUS2H9B",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Y92OUS2H9B",
          "code_system": "DAILYMED",
          "references": [
            "ef43181c-33d9-e2e9-a8db-25e7ad8aeec1"
          ]
        },
        {
          "uuid": "d24c8fe8-d393-06c6-729a-7e39ce52ffc3",
          "code": "758241",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=758241",
          "code_system": "NSC",
          "references": [
            "fe34e5dc-5967-f4cd-d82a-845bdc444d0f"
          ]
        },
        {
          "uuid": "dd37412f-3714-9a4a-825f-f7010184c6e3",
          "code": "100000086330",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d8d68b9e-0e65-b57d-d264-c9a710ee85ae"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "92c1c5b3-63a9-423b-a380-f794fb2c60c7",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "9f415ede-512f-49ae-9223-b77dd9e9fd67",
            "refuuid": "ad967838-bb94-4e56-8223-74f1d1494892",
            "name": "BENFOTIAMINE",
            "unii": "Y92OUS2H9B",
            "linking_id": "Y92OUS2H9B",
            "ref_pname": "BENFOTIAMINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "695be426-358c-4fc5-a47d-d17d3adac0c0",
          "name": "8088 C.B",
          "stdName": "8088 C.B",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60806cb3-6f27-41a6-baea-70031abdff8f"
          ],
          "display_name": false
        },
        {
          "uuid": "381074a8-6628-4c41-a739-8f9fc22b26bf",
          "name": "8088 C.B.",
          "stdName": "8088 C.B.",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d37fb9e5-6a77-4868-9829-a02be904caae"
          ],
          "display_name": false
        },
        {
          "uuid": "81566940-4ef0-4ed6-a7d7-9eabd595fb91",
          "name": "8088-CB",
          "stdName": "8088-CB",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "647d3189-bca5-4d05-a02a-eb388784f4f1"
          ],
          "display_name": false
        },
        {
          "uuid": "3a6c6317-80c3-4458-b53e-3a9e83f57705",
          "name": "8088CB",
          "stdName": "8088CB",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d2d5ce3-5cad-424b-ba2a-6621730cb2a5"
          ],
          "display_name": false
        },
        {
          "uuid": "249b15e8-d848-4670-9217-bf008000bc9b",
          "name": "BENFOTHIAMINE",
          "stdName": "BENFOTHIAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d2d5ce3-5cad-424b-ba2a-6621730cb2a5"
          ],
          "display_name": false
        },
        {
          "uuid": "4ab42d1d-110f-4b2c-85e6-476afb178766",
          "name": "BENFOTIAMINE",
          "stdName": "BENFOTIAMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49db74e7-eeee-4d73-a73c-e655be21852c",
            "194f3833-8249-4d8d-a282-e26b09de18eb",
            "21fdcfb6-88ea-4763-9ae0-ec200748ac30",
            "7649ad0b-f9af-41c3-840a-a3e8902aaddf",
            "74ffeb32-586c-498b-a650-d4fbe1bf8a21",
            "b0eb888d-3206-4b45-a6bb-c0133775c459",
            "68395cdc-1a9a-45a6-911c-256ec4896bd2",
            "083ab363-37ee-4b83-a84d-5af9c77bc6fb",
            "57c76961-0a5c-4a36-8846-25289b95843b",
            "13a23310-6e25-4e1f-a948-10959b97a012",
            "15274abf-01c5-4de1-93f8-aa74dc9412aa",
            "7f292b7d-1c53-4b45-9132-28014cb4c387",
            "b15e9613-f8ef-49a1-a2ab-adf0a701933f"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "c475bd68-5c55-461f-b01d-7100dee42259",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "3fd06dcd-e5fc-4754-9cc2-8448475cd2f0",
          "name": "BENFOTIAMINE [JAN]",
          "stdName": "BENFOTIAMINE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "194f3833-8249-4d8d-a282-e26b09de18eb"
          ],
          "display_name": false
        },
        {
          "uuid": "f62251fa-2b76-4b59-a3c5-b8110f149285",
          "name": "BENFOTIAMINE [MART.]",
          "stdName": "BENFOTIAMINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f292b7d-1c53-4b45-9132-28014cb4c387"
          ],
          "display_name": false
        },
        {
          "uuid": "71370516-5376-4346-8347-20bf99f6cc7b",
          "name": "BENFOTIAMINE [MI]",
          "stdName": "BENFOTIAMINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74ffeb32-586c-498b-a650-d4fbe1bf8a21"
          ],
          "display_name": false
        },
        {
          "uuid": "6315420d-3258-46d2-9fb2-85959e46e76a",
          "name": "BENFOTIAMINE [VANDF]",
          "stdName": "BENFOTIAMINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "083ab363-37ee-4b83-a84d-5af9c77bc6fb"
          ],
          "display_name": false
        },
        {
          "uuid": "07becf63-6464-4ef3-bafd-618f2816dc2d",
          "name": "BENPHOTHIAMINE",
          "stdName": "BENPHOTHIAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a151d3f4-5be3-4c5f-b1f3-1b9e6dc4a4e6"
          ],
          "display_name": false
        },
        {
          "uuid": "1b5fc49d-b5fc-4f1c-b2db-f4fee171553d",
          "name": "BENZENECARBOTHIOIC ACID, S-(2-(((4-AMINO-2-METHYL-5-PYRIMIDINYL)METHYL)FORMYLAMINO)-1-(2-(PHOSPHONOOXY)ETHYL)-1-PROPEN-1-YL) ESTER",
          "stdName": "BENZENECARBOTHIOIC ACID, S-(2-(((4-AMINO-2-METHYL-5-PYRIMIDINYL)METHYL)FORMYLAMINO)-1-(2-(PHOSPHONOOXY)ETHYL)-1-PROPEN-1-YL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d2d5ce3-5cad-424b-ba2a-6621730cb2a5"
          ],
          "display_name": false
        },
        {
          "uuid": "f7596b44-2ff7-473f-9f97-f32284ef0e4c",
          "name": "BENZOYLTHIAMINE MONOPHOSPHATE",
          "stdName": "BENZOYLTHIAMINE MONOPHOSPHATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d2d5ce3-5cad-424b-ba2a-6621730cb2a5"
          ],
          "display_name": false
        },
        {
          "uuid": "f6ce1c2b-5847-4ca3-80ee-2a7d94ac11fc",
          "name": "BENZOYLTHIAMINE O-MONOPHOSPHATE",
          "stdName": "BENZOYLTHIAMINE O-MONOPHOSPHATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d2d5ce3-5cad-424b-ba2a-6621730cb2a5"
          ],
          "display_name": false
        },
        {
          "uuid": "daed825c-c77b-41ff-8e0d-cda3d8b51512",
          "name": "BENZOYLTHIAMINMONOPHOSPHAT",
          "stdName": "BENZOYLTHIAMINMONOPHOSPHAT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49db74e7-eeee-4d73-a73c-e655be21852c"
          ],
          "display_name": false
        },
        {
          "uuid": "e8e33e39-b7f4-4a66-9335-ee864dd40ae3",
          "name": "BIOTAMIN",
          "stdName": "BIOTAMIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "194f3833-8249-4d8d-a282-e26b09de18eb",
            "53336573-4b8f-4168-8c68-2e4550739677"
          ],
          "display_name": false
        },
        {
          "uuid": "28e20075-4397-4020-a80e-9700f5eafb63",
          "name": "BTMP",
          "stdName": "BTMP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d2d5ce3-5cad-424b-ba2a-6621730cb2a5"
          ],
          "display_name": false
        },
        {
          "uuid": "5d3d0c6f-ae44-4b9c-750c-0cc87d88d391",
          "name": "Benfotiamine [WHO-DD]",
          "stdName": "BENFOTIAMINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac8af18d-13dc-d318-99b9-457e1690e416"
          ],
          "display_name": false
        },
        {
          "uuid": "7c159295-d606-4afb-ac74-17ff074b66ae",
          "name": "N-((4-AMINO-2-METHYL-5-PYRIMIDINYL)METHYL)-N-(4-HYDROXY-2-MERCAPTO-1-METHYL-1-BUTENYL)FORMAMIDE S-BENZOATE O-PHOSPHATE",
          "stdName": "N-((4-AMINO-2-METHYL-5-PYRIMIDINYL)METHYL)-N-(4-HYDROXY-2-MERCAPTO-1-METHYL-1-BUTENYL)FORMAMIDE S-BENZOATE O-PHOSPHATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d37fb9e5-6a77-4868-9829-a02be904caae"
          ],
          "display_name": false
        },
        {
          "uuid": "e26971d7-f7bc-ff99-791d-384a7478f4f8",
          "name": "NSC-758241",
          "stdName": "NSC-758241",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe34e5dc-5967-f4cd-d82a-845bdc444d0f"
          ],
          "display_name": false
        },
        {
          "uuid": "128602fb-dc4c-4e88-aa38-f238cb850d89",
          "name": "S-BENZOYLTHIAMINE MONOPHOSPHATE",
          "stdName": "S-BENZOYLTHIAMINE MONOPHOSPHATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d2d5ce3-5cad-424b-ba2a-6621730cb2a5"
          ],
          "display_name": false
        },
        {
          "uuid": "c88e2b5e-356c-48cd-b06a-80d210f27bd9",
          "name": "S-BENZOYLTHIAMINE O-MONOPHOSPHATE",
          "stdName": "S-BENZOYLTHIAMINE O-MONOPHOSPHATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d2d5ce3-5cad-424b-ba2a-6621730cb2a5"
          ],
          "display_name": false
        },
        {
          "uuid": "05326449-7eff-4eb1-b8fc-4da44a6bbc4d",
          "name": "benfotiamine [INN]",
          "stdName": "BENFOTIAMINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "13a23310-6e25-4e1f-a948-10959b97a012"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "49db74e7-eeee-4d73-a73c-e655be21852c",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d37fb9e5-6a77-4868-9829-a02be904caae",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d2d5ce3-5cad-424b-ba2a-6621730cb2a5",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13a23310-6e25-4e1f-a948-10959b97a012",
          "citation": "INN Proposed List 13",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "194f3833-8249-4d8d-a282-e26b09de18eb",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f292b7d-1c53-4b45-9132-28014cb4c387",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74ffeb32-586c-498b-a650-d4fbe1bf8a21",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53336573-4b8f-4168-8c68-2e4550739677",
          "citation": "D01255",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a151d3f4-5be3-4c5f-b1f3-1b9e6dc4a4e6",
          "citation": "rxnorm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b15e9613-f8ef-49a1-a2ab-adf0a701933f",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "083ab363-37ee-4b83-a84d-5af9c77bc6fb",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "647d3189-bca5-4d05-a02a-eb388784f4f1",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60806cb3-6f27-41a6-baea-70031abdff8f",
          "citation": "CHEMBL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f5d978e-1b27-4832-9c41-396eb79e2abe",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390842000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c21c07ba-3f3c-45f1-899b-5a5142df97ee",
          "citation": "SRS import [Y92OUS2H9B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Y92OUS2H9B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390842000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57c76961-0a5c-4a36-8846-25289b95843b",
          "citation": "BENFOTIAMINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "15274abf-01c5-4de1-93f8-aa74dc9412aa",
          "citation": "BENFOTIAMINE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "68395cdc-1a9a-45a6-911c-256ec4896bd2",
          "citation": "BENFOTIAMINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "21fdcfb6-88ea-4763-9ae0-ec200748ac30",
          "citation": "BENFOTIAMINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b0eb888d-3206-4b45-a6bb-c0133775c459",
          "citation": "BENFOTIAMINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7649ad0b-f9af-41c3-840a-a3e8902aaddf",
          "citation": "BENFOTIAMINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "61ba1929-debe-9476-4495-10b479f572d3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=22457-89-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d1e0d7ea-f874-860c-a3cb-328c272f1a19",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "1621f56c-56dc-4001-a614-791404512bbf",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fe34e5dc-5967-f4cd-d82a-845bdc444d0f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ac8af18d-13dc-d318-99b9-457e1690e416",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ef43181c-33d9-e2e9-a8db-25e7ad8aeec1",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "d8d68b9e-0e65-b57d-d264-c9a710ee85ae",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6f609441-4a9a-44f9-b528-2063607615d2",
          "id": "6f609441-4a9a-44f9-b528-2063607615d2",
          "molfile": "\n  Marvin  01132105472D          \n\n 31 32  0  0  0  0            999 V2000\n   -0.3212   -5.6856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3497   -5.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3574   -4.4657    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3678   -4.0382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0828   -4.4604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0646   -5.2686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7769   -5.6856    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5385   -5.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2509   -5.6908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5229   -4.4423    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8132   -4.0304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8209   -3.1860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0646   -4.0382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0698   -3.2198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0569   -5.6804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0620   -6.4809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3574   -6.8745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3574   -7.7164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3470   -8.1231    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0491   -8.5739    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7512   -7.4056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0803   -8.8743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7666   -5.2712    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5255   -5.6934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2301   -5.2738    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5204   -6.5120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7976   -6.9109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7924   -7.7294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5255   -8.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2456   -7.7294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2353   -6.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n 15  2  2  3  0  0  0\n  3  4  1  0  0  0  0\n 13  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 11  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 14 13  2  0  0  0  0\n 16 15  1  0  0  0  0\n 23 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 19  1  0  0  0  0\n 22 19  2  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  2  0  0  0  0\n 26 24  1  0  0  0  0\n 27 26  1  0  0  0  0\n 31 26  2  0  0  0  0\n 28 27  2  0  0  0  0\n 29 28  1  0  0  0  0\n 29 30  2  0  0  0  0\n 30 31  1  0  0  0  0\nM  END",
          "smiles": "CC(=C(CCOP(=O)(O)O)SC(=O)c1ccccc1)N(Cc2cnc(C)nc2N)C=O",
          "formula": "C19H23N4O6PS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d8b76c8d-8ca0-4607-a74d-dbc16f07ebbb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "466.4497",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ad967838-bb94-4e56-8223-74f1d1494892",
      "version": "16",
      "structure": {
        "id": "04323c1f-ebd1-469e-8d61-3cf8cfef5f70",
        "molfile": "\n  Marvin  01132100312D          \n\n 31 32  0  0  0  0            999 V2000\n   -2.5229   -4.4423    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3470   -8.1231    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0828   -4.4604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0569   -5.6804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8132   -4.0304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3574   -4.4657    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7666   -5.2712    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3497   -5.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5255   -5.6934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3678   -4.0382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7769   -5.6856    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5385   -5.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0646   -4.0382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0646   -5.2686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0803   -8.8743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2301   -5.2738    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5204   -6.5120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0698   -3.2198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0620   -6.4809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3574   -7.7164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8209   -3.1860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0491   -8.5739    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7512   -7.4056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3574   -6.8745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3212   -5.6856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2509   -5.6908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7976   -6.9109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2353   -6.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7924   -7.7294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2456   -7.7294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5255   -8.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2 20  1  0  0  0  0\n  3  5  2  0  0  0  0\n  4  8  2  3  0  0  0\n  5  1  1  0  0  0  0\n  6 10  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12  1  2  0  0  0  0\n 13  6  1  0  0  0  0\n 14 11  2  0  0  0  0\n 15  2  2  0  0  0  0\n 16  9  2  0  0  0  0\n 17  9  1  0  0  0  0\n 18 13  2  0  0  0  0\n 19  4  1  0  0  0  0\n 20 24  1  0  0  0  0\n 21  5  1  0  0  0  0\n 22  2  1  0  0  0  0\n 23  2  1  0  0  0  0\n 24 19  1  0  0  0  0\n 25  8  1  0  0  0  0\n 26 12  1  0  0  0  0\n 27 17  2  0  0  0  0\n 28 17  1  0  0  0  0\n 29 27  1  0  0  0  0\n 30 28  2  0  0  0  0\n 31 30  1  0  0  0  0\n 14  3  1  0  0  0  0\n 31 29  2  0  0  0  0\nM  END",
        "smiles": "CC(=C(CCOP(=O)(O)O)SC(=O)c1ccccc1)N(Cc2cnc(C)nc2N)C=O",
        "formula": "C19H23N4O6PS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "466.4497",
        "optical_activity": "NONE",
        "references": [
          "49db74e7-eeee-4d73-a73c-e655be21852c",
          "c21c07ba-3f3c-45f1-899b-5a5142df97ee",
          "13a23310-6e25-4e1f-a948-10959b97a012"
        ],
        "stereo_centers": 0
      },
      "unii": "Y92OUS2H9B"
    }
  ]
}