{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e8f056f6-e344-41f9-8565-a19fae239046",
          "code": "68052-23-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=68052-23-3",
          "code_system": "CAS",
          "references": [
            "7cfe1e9d-ab1e-4b9d-84eb-1d02cdf0ff76",
            "a51476b5-468b-4181-9622-c88f44fde6fc"
          ]
        },
        {
          "uuid": "6f3684e3-5294-40b0-b31b-3aa1f61d2e8d",
          "code": "268-316-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.062.088",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7cfe1e9d-ab1e-4b9d-84eb-1d02cdf0ff76"
          ]
        },
        {
          "uuid": "14cd06a7-2eea-4e39-9f6e-42251f7296f4",
          "code": "1437987",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1437987/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7cfe1e9d-ab1e-4b9d-84eb-1d02cdf0ff76"
          ]
        },
        {
          "uuid": "f583c688-d089-4b8f-92dd-fb5090bef0b5",
          "code": "107080",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/107080",
          "code_system": "PUBCHEM",
          "references": [
            "7cfe1e9d-ab1e-4b9d-84eb-1d02cdf0ff76"
          ]
        },
        {
          "uuid": "8fc5dae4-5db6-17f7-d0ec-9c63893d770c",
          "code": "DTXSID8041242",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8041242",
          "code_system": "EPA CompTox",
          "references": [
            "d32673aa-0abf-9f39-bf3c-e3d997ed97ec"
          ]
        },
        {
          "uuid": "c30e3c60-8394-4852-a0bb-1c55816beaea",
          "code": "Y8PB83G67A",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b3457ada-4229-2141-3ffd-f6bd4f50f575",
          "code": "Y8PB83G67A",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Y8PB83G67A",
          "code_system": "DAILYMED",
          "references": [
            "a8fc6cd1-47c9-909f-4dc2-d9f5f3336274"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0cdec558-05ba-42c7-8cb6-92d7f3ce4a65",
          "name": "(±)-TRIMETHYLPENTANEDIYL DIBENZOATE",
          "stdName": "(+/-)-TRIMETHYLPENTANEDIYL DIBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0871918-93b3-4861-9874-3fa75cfd0398",
            "dbf04bd6-87fe-459a-b071-d2eb76370e7f"
          ],
          "display_name": false
        },
        {
          "uuid": "fc10da22-51b2-482f-ab62-9e84cefcbc9a",
          "name": "1,3-PENTANEDIOL, 2,2,4-TRIMETHYL-, DIBENZOATE",
          "stdName": "1,3-PENTANEDIOL, 2,2,4-TRIMETHYL-, DIBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b2b8089-e7ae-4863-84a4-209c5a2c96b8",
            "e0871918-93b3-4861-9874-3fa75cfd0398"
          ],
          "display_name": false
        },
        {
          "uuid": "9eac17eb-abb0-468b-9eb3-2e1718909560",
          "name": "2,2,4-TRIMETHYL-1,3-PENTANEDIOL DIBENZOATE",
          "stdName": "2,2,4-TRIMETHYL-1,3-PENTANEDIOL DIBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9cedaf98-5016-43ee-a15f-5b6ff639b3a6",
            "e0871918-93b3-4861-9874-3fa75cfd0398"
          ],
          "display_name": false
        },
        {
          "uuid": "234533da-6b25-4373-bdd5-778e9aeefca3",
          "name": "2,2,4-TRIMETHYL-1,3-PENTANEDIYL DIBENZOATE",
          "stdName": "2,2,4-TRIMETHYL-1,3-PENTANEDIYL DIBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9cedaf98-5016-43ee-a15f-5b6ff639b3a6",
            "e0871918-93b3-4861-9874-3fa75cfd0398"
          ],
          "display_name": false
        },
        {
          "uuid": "15aff54e-f460-4c36-a557-3051e4911320",
          "name": "2,2,4-TRIMETHYLPENTANE-1,3-DIYL DIBENZOATE",
          "stdName": "2,2,4-TRIMETHYLPENTANE-1,3-DIYL DIBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef366036-cab6-45a4-934a-624479fa7056",
            "e0871918-93b3-4861-9874-3fa75cfd0398"
          ],
          "display_name": false
        },
        {
          "uuid": "f7e3a79d-a47d-47a5-8144-d14e31d1e499",
          "name": "BENZOFLEX 354",
          "stdName": "BENZOFLEX 354",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b2b8089-e7ae-4863-84a4-209c5a2c96b8",
            "e0871918-93b3-4861-9874-3fa75cfd0398"
          ],
          "display_name": false
        },
        {
          "uuid": "0cc79ff5-4aaf-47b8-8d1d-8aa9b63f1461",
          "name": "TRIMETHYLPENTANEDIYL DIBENZOATE",
          "stdName": "TRIMETHYLPENTANEDIYL DIBENZOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b2b8089-e7ae-4863-84a4-209c5a2c96b8",
            "e0871918-93b3-4861-9874-3fa75cfd0398",
            "be73abd3-91dd-4836-b91e-1b04b0c5c3fc"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "83b55348-2ec3-47f5-b811-422f26f24609",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "ef107931-93f5-463f-b7bd-0f154340e8ea",
          "name": "TRIMETHYLPENTANEDIYL DIBENZOATE, (±)-",
          "stdName": "TRIMETHYLPENTANEDIYL DIBENZOATE, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0871918-93b3-4861-9874-3fa75cfd0398",
            "dbf04bd6-87fe-459a-b071-d2eb76370e7f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1b2b8089-e7ae-4863-84a4-209c5a2c96b8",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e0871918-93b3-4861-9874-3fa75cfd0398",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9cedaf98-5016-43ee-a15f-5b6ff639b3a6",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dbf04bd6-87fe-459a-b071-d2eb76370e7f",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef366036-cab6-45a4-934a-624479fa7056",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7cfe1e9d-ab1e-4b9d-84eb-1d02cdf0ff76",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391626000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f472a1b2-5e05-4702-ab81-2cbbd0ddc039",
          "citation": "SRS import [Y8PB83G67A]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Y8PB83G67A",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391626000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be73abd3-91dd-4836-b91e-1b04b0c5c3fc",
          "citation": "TRIMETHYLPENTANEDIYL DIBENZOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d32673aa-0abf-9f39-bf3c-e3d997ed97ec",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=68052-23-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a51476b5-468b-4181-9622-c88f44fde6fc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a8fc6cd1-47c9-909f-4dc2-d9f5f3336274",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "dbefad99-1010-4076-a0a9-5f0f3150224a",
          "id": "dbefad99-1010-4076-a0a9-5f0f3150224a",
          "molfile": "\n  Marvin  01132111242D          \n\n 26 27  0  0  0  0            999 V2000\n   11.2288   -3.4330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9295   -3.8494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6268   -3.4330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9295   -4.6618    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   12.6336   -5.0578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3342   -4.6448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3342   -3.8257    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0417   -5.0442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0417   -5.8701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7626   -6.2695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4633   -5.8566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4633   -5.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7457   -4.6109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2220   -5.0748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5538   -5.8566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8802   -5.8633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5147   -4.6686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8072   -5.0849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0862   -4.6787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0862   -3.8562    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3686   -5.0916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3686   -5.9277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6545   -6.3440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9402   -5.9277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9402   -5.0916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6545   -4.6787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 14  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 13  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 26  2  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\nM  END",
          "smiles": "CC(C)C(C(C)(C)COC(=O)c1ccccc1)OC(=O)c2ccccc2",
          "formula": "C22H26O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a13a039b-111c-4d9e-8a38-69689b055196"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "354.4403",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7b7b86ba-1604-4f1f-bdca-ad62b479de17",
      "version": "6",
      "structure": {
        "id": "9418f807-97c6-4ea6-af73-0ec3886a019e",
        "molfile": "\n  Marvin  01132107412D          \n\n 26 27  0  0  0  0            999 V2000\n    6.9402   -5.9277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6545   -6.3440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9402   -5.0916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4633   -5.8566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3686   -5.9277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6545   -4.6787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7626   -6.2695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4633   -5.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0862   -3.8562    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3686   -5.0916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0417   -5.8701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7457   -4.6109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0862   -4.6787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3342   -3.8257    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0417   -5.0442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8072   -5.0849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2288   -3.4330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6268   -3.4330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3342   -4.6448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5538   -5.8566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8802   -5.8633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5147   -4.6686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9295   -3.8494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6336   -5.0578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2220   -5.0748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9295   -4.6618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  7  4  1  0  0  0  0\n  3  1  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  3  2  0  0  0  0\n  8  4  2  0  0  0  0\n 10  5  2  0  0  0  0\n 10  6  1  0  0  0  0\n 11  7  2  0  0  0  0\n 12  8  1  0  0  0  0\n 13  9  2  0  0  0  0\n 13 10  1  0  0  0  0\n 15 11  1  0  0  0  0\n 15 12  2  0  0  0  0\n 16 13  1  0  0  0  0\n 19 14  2  0  0  0  0\n 19 15  1  0  0  0  0\n 22 16  1  0  0  0  0\n 23 17  1  0  0  0  0\n 23 18  1  0  0  0  0\n 24 19  1  0  0  0  0\n 25 20  1  0  0  0  0\n 25 21  1  0  0  0  0\n 25 22  1  0  0  0  0\n 26 23  1  0  0  0  0\n 26 24  1  0  0  0  0\n 26 25  1  0  0  0  0\nM  END",
        "smiles": "CC(C)C(C(C)(C)COC(=O)c1ccccc1)OC(=O)c2ccccc2",
        "formula": "C22H26O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "354.4403",
        "optical_activity": "( + / - )",
        "references": [
          "9cedaf98-5016-43ee-a15f-5b6ff639b3a6",
          "f472a1b2-5e05-4702-ab81-2cbbd0ddc039"
        ],
        "stereo_centers": 1
      },
      "unii": "Y8PB83G67A"
    }
  ]
}