{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "6a08b554-e5e1-4a27-868d-1bc7c5e38ae9", "code": "36944-85-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=36944-85-1", "code_system": "CAS", "references": [ "ed479b0a-beb9-451b-af90-9fb3f552f7c9", "f46efeeb-3d3b-483d-bcfb-a28f750e9d3d" ] }, { "uuid": "7a51f1b4-4e57-1363-f1ae-fd97a17f1114", "code": "102576471", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/102576471", "code_system": "PUBCHEM", "references": [ "eaf0751b-0bf6-1b8f-ccb0-46dcc978bb58" ] }, { "uuid": "c53fdc0b-11c8-4f5f-9be0-84c6833d402d", "code": "Y8CU6BKQ58", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "c33e5e7f-49d7-28fa-cf5e-979867ef505f", "code": "DTXSID301021268", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID301021268", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "bfef4977-011a-47a2-b554-505af3dfd413", "name": "4H-1,3,2-DIOXAPHOSPHORINO(4,5-C)PYRIDINE-5-METHANOL, 2-HYDROXY-8-METHYL-, 2-OXIDE", "stdName": "4H-1,3,2-DIOXAPHOSPHORINO(4,5-C)PYRIDINE-5-METHANOL, 2-HYDROXY-8-METHYL-, 2-OXIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "396cf87f-e70f-481a-95b2-3f89d2dacd31" ], "display_name": false }, { "uuid": "6607435e-0ee7-4afd-959b-68462e385736", "name": "PANADOXINE P", "stdName": "PANADOXINE P", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f46efeeb-3d3b-483d-bcfb-a28f750e9d3d", "eaf0751b-0bf6-1b8f-ccb0-46dcc978bb58" ], "display_name": true } ], "references": [ { "uuid": "396cf87f-e70f-481a-95b2-3f89d2dacd31", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ed479b0a-beb9-451b-af90-9fb3f552f7c9", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392055000, "tags": [ "NOMEN" ] }, { "uuid": "eaf0751b-0bf6-1b8f-ccb0-46dcc978bb58", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f46efeeb-3d3b-483d-bcfb-a28f750e9d3d", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c5e6b2ec-264e-4db2-9bf6-bcbcb24d3bd4", "id": "c5e6b2ec-264e-4db2-9bf6-bcbcb24d3bd4", "molfile": "\n Marvin 01132110142D \n\n 15 16 0 0 0 0 999 V2000\n 0.8112 -3.2490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5259 -2.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2406 -3.2490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9552 -2.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9552 -2.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6700 -1.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3846 -2.0125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2406 -1.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2406 -0.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5259 -0.3596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8112 -0.7717 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.9164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5305 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8112 -1.6004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5259 -2.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 15 2 2 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 8 5 2 0 0 0 0\n 6 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 15 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 2 0 0 0 0\n 14 11 1 0 0 0 0\n 15 14 1 0 0 0 0\nM END", "smiles": "Cc1c2c(COP(=O)(O)O2)c(cn1)CO", "formula": "C8H10NO5P", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "694633a2-3276-4e8c-a0f8-192d0bdb12f5" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "231.1428", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "e5e68d87-a157-41e2-8dee-4357767ad810", "version": "6", "structure": { "id": "afbdad48-7c91-45e4-9566-ec8a0538f07e", "molfile": "\n Marvin 01132109072D \n\n 15 16 0 0 0 0 999 V2000\n 1.5259 -2.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2406 -1.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9552 -2.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9552 -2.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2406 -3.2490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5259 -2.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8112 -3.2490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6700 -1.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3846 -2.0125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8112 -1.6004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8112 -0.7717 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5259 -0.3596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2406 -0.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5305 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.9164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 6 1 0 0 0 0\n 1 10 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 13 1 0 0 0 0\n 3 4 2 0 0 0 0\n 3 8 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 14 2 0 0 0 0\n 11 15 1 0 0 0 0\n 12 13 1 0 0 0 0\nM END", "smiles": "Cc1c2c(COP(=O)(O)O2)c(cn1)CO", "formula": "C8H10NO5P", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "231.1428", "optical_activity": "NONE", "references": [ "396cf87f-e70f-481a-95b2-3f89d2dacd31" ], "stereo_centers": 0 }, "unii": "Y8CU6BKQ58" } ] }