{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3ae21993-04bb-46fc-b16c-e8ea02c69773",
          "code": "126535-15-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=126535-15-7",
          "code_system": "CAS",
          "references": [
            "eb29e08c-4d6c-46e3-90b8-10299bdec42f",
            "2abaccde-f7b4-45cc-a043-c31b5b1fef28"
          ]
        },
        {
          "uuid": "6a1bd075-baeb-4faa-af3d-c57e8b20659c",
          "code": "129002",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:4152",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "eb29e08c-4d6c-46e3-90b8-10299bdec42f"
          ]
        },
        {
          "uuid": "c684ac02-4264-4ef9-9ad1-61fb38007f48",
          "code": "m11127",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11127?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "eb29e08c-4d6c-46e3-90b8-10299bdec42f"
          ]
        },
        {
          "uuid": "1763804f-64a3-47b4-933f-43f947391fca",
          "code": "92434",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/92434",
          "code_system": "PUBCHEM",
          "references": [
            "eb29e08c-4d6c-46e3-90b8-10299bdec42f"
          ]
        },
        {
          "uuid": "1dff68c7-ba49-f9dd-e070-bb6b39939c92",
          "code": "DTXSID2032502",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2032502",
          "code_system": "EPA CompTox",
          "references": [
            "c1b309ad-392e-919a-364c-91931d7d1163"
          ]
        },
        {
          "uuid": "375f74f4-90ca-4190-89f4-2c91731355cd",
          "code": "Y8AR13FYC0",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f8262504-dd6f-9f2a-3b1e-009555872efd",
          "code": "triflusulfuron-methyl",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/triflusulfuron-methyl.html",
          "code_system": "ALANWOOD",
          "references": [
            "1332f2b0-e64c-3e31-f1cf-bc0018b50b8e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "280a0bc8-e7c5-4653-a271-86ae6f4553dd",
          "name": "METHYL 2-((((4-(DIMETHYLAMINO)-6-(2,2,2-TRIFLUOROETHOXY)-1,3,5-TRIAZIN-2-YL)AMINO)CARBONYL)AMINO)SULFONYL)-3-METHYLBENZOATE",
          "stdName": "METHYL 2-((((4-(DIMETHYLAMINO)-6-(2,2,2-TRIFLUOROETHOXY)-1,3,5-TRIAZIN-2-YL)AMINO)CARBONYL)AMINO)SULFONYL)-3-METHYLBENZOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15269a08-5265-4863-9914-3781b739a6de",
            "1ad247ff-9a69-4f2c-9f38-1c2c869254dd"
          ],
          "display_name": false
        },
        {
          "uuid": "91c3af73-2fb9-4c40-82f0-d6a3b73b1a84",
          "name": "METHYL 2-(4-DIMETHYLAMINO-6-(2,2,2-TRIFLUOROETHOXY)-1,3,5-TRIAZIN-2-YLCARBAMOYLSULFAMOYL)-M-TOLUATE",
          "stdName": "METHYL 2-(4-DIMETHYLAMINO-6-(2,2,2-TRIFLUOROETHOXY)-1,3,5-TRIAZIN-2-YLCARBAMOYLSULFAMOYL)-M-TOLUATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15269a08-5265-4863-9914-3781b739a6de",
            "1ad247ff-9a69-4f2c-9f38-1c2c869254dd"
          ],
          "display_name": false
        },
        {
          "uuid": "543fb233-343e-46cb-ac80-dc18e6adecf0",
          "name": "TRIFLUSULFURON METHYL ESTER",
          "stdName": "TRIFLUSULFURON METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "df131aba-17db-49ad-9916-43dfc065e2b1",
            "1ad247ff-9a69-4f2c-9f38-1c2c869254dd"
          ],
          "display_name": false
        },
        {
          "uuid": "d67dac23-b818-4cd9-aca5-64c4d35c4b9f",
          "name": "TRIFLUSULFURON-METHYL",
          "stdName": "TRIFLUSULFURON-METHYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c279af7-db75-475b-a86f-d6d5a4966d5b",
            "47463863-bf31-4ab2-b0c9-aab93a4d883a",
            "ba4ecd8c-4bd2-4764-9cd9-2825954132ff",
            "c1110760-cc19-4c9b-8d33-3342647cbc4d",
            "0c64bc6b-4611-4be0-9a01-f57f8746ab17",
            "1ad247ff-9a69-4f2c-9f38-1c2c869254dd"
          ],
          "display_name": true
        },
        {
          "uuid": "c11ce569-42c5-44dc-ae93-c6117301e75f",
          "name": "TRIFLUSULFURON-METHYL [ISO]",
          "stdName": "TRIFLUSULFURON-METHYL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba4ecd8c-4bd2-4764-9cd9-2825954132ff",
            "1ad247ff-9a69-4f2c-9f38-1c2c869254dd"
          ],
          "display_name": false
        },
        {
          "uuid": "c72821c6-255e-49f1-80bf-8b0d9c8d491d",
          "name": "TRIFLUSULFURON-METHYL [MI]",
          "stdName": "TRIFLUSULFURON-METHYL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1110760-cc19-4c9b-8d33-3342647cbc4d",
            "1ad247ff-9a69-4f2c-9f38-1c2c869254dd"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0c279af7-db75-475b-a86f-d6d5a4966d5b",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c1110760-cc19-4c9b-8d33-3342647cbc4d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ad247ff-9a69-4f2c-9f38-1c2c869254dd",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15269a08-5265-4863-9914-3781b739a6de",
          "citation": "http://www.alanwood.net/pesticides/derivatives/triflusulfuron-methyl.html",
          "url": "http://www.alanwood.net/pesticides/derivatives/triflusulfuron-methyl.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df131aba-17db-49ad-9916-43dfc065e2b1",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba4ecd8c-4bd2-4764-9cd9-2825954132ff",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb29e08c-4d6c-46e3-90b8-10299bdec42f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391494000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c0c4f8f1-ed27-4f19-9e08-f76e6d8abede",
          "citation": "SRS import [Y8AR13FYC0]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Y8AR13FYC0",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391494000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57fb5445-38f8-4f46-8237-eec33177e0a8",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47463863-bf31-4ab2-b0c9-aab93a4d883a",
          "citation": "TRIFLUSULFURON-METHYL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0c64bc6b-4611-4be0-9a01-f57f8746ab17",
          "citation": "TRIFLUSULFURON-METHYL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c1b309ad-392e-919a-364c-91931d7d1163",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=126535-15-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1332f2b0-e64c-3e31-f1cf-bc0018b50b8e",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "2abaccde-f7b4-45cc-a043-c31b5b1fef28",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0ad7a820-c100-484a-acc7-e7e0f953593d",
          "id": "0ad7a820-c100-484a-acc7-e7e0f953593d",
          "molfile": "\n  Marvin  01132100492D          \n\n 33 34  0  0  0  0            999 V2000\n    2.9034   -3.3664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5694   -2.9516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2394   -3.3627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9650   -2.9526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2394   -4.2619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5332   -4.6771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5332   -5.4972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2409   -5.9163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9561   -5.5106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6663   -5.9320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9561   -4.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6800   -4.2752    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2741   -3.5561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0905   -4.9941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3992   -3.8647    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1113   -4.2752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1113   -4.9590    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8150   -3.8367    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5446   -4.2238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5446   -5.0536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3064   -5.4398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3064   -6.2648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0479   -6.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7317   -6.2145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2789   -6.7699    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3300   -5.8158    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1744   -5.6601    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9712   -4.9966    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9712   -4.1715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2476   -3.7850    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6707   -3.7340    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6707   -2.9051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4000   -4.1186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n 11  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  2  0  0  0  0\n 12 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 30  2  0  0  0  0\n 21 20  2  0  0  0  0\n 21 22  1  0  0  0  0\n 28 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 24 27  1  0  0  0  0\n 29 28  2  0  0  0  0\n 30 29  1  0  0  0  0\n 29 31  1  0  0  0  0\n 31 32  1  0  0  0  0\n 31 33  1  0  0  0  0\nM  END",
          "smiles": "Cc1cccc(c1S(=O)(=O)NC(=O)Nc2nc(nc(n2)OCC(F)(F)F)N(C)C)C(=O)OC",
          "formula": "C17H19F3N6O6S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f1165c0f-677f-4aba-9bc3-61f53debaac0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "492.4313",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "856b516e-c8af-4b55-884a-611a48997622",
      "version": "4",
      "structure": {
        "id": "97b0d824-94e3-4947-b804-cbf57e840691",
        "molfile": "\n  Marvin  01132107532D          \n\n 33 34  0  0  0  0            999 V2000\n    2.9034   -3.3664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5694   -2.9516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2394   -3.3627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9650   -2.9526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2394   -4.2619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5332   -4.6771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5332   -5.4972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2409   -5.9163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9561   -5.5106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6663   -5.9320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9561   -4.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6800   -4.2752    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2741   -3.5561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0905   -4.9941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3992   -3.8647    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1113   -4.2752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1113   -4.9590    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8150   -3.8367    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5446   -4.2238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2476   -3.7850    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9712   -4.1715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6707   -3.7340    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6707   -2.9051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4000   -4.1186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9712   -4.9966    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3064   -5.4398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3064   -6.2648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0479   -6.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7317   -6.2145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2789   -6.7699    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3300   -5.8158    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1744   -5.6601    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5446   -5.0536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11  5  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  2  0  0  0  0\n 12 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 21 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 29 31  1  0  0  0  0\n 29 32  1  0  0  0  0\n 26 33  1  0  0  0  0\n 33 19  2  0  0  0  0\nM  END",
        "smiles": "Cc1cccc(c1S(=O)(=O)NC(=O)Nc2nc(nc(n2)OCC(F)(F)F)N(C)C)C(=O)OC",
        "formula": "C17H19F3N6O6S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "492.4313",
        "optical_activity": "NONE",
        "references": [
          "57fb5445-38f8-4f46-8237-eec33177e0a8",
          "c0c4f8f1-ed27-4f19-9e08-f76e6d8abede"
        ],
        "stereo_centers": 0
      },
      "unii": "Y8AR13FYC0"
    }
  ]
}