{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2bd3f47e-8f59-401f-ba09-d5107c7547bb",
          "code": "80062-31-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=80062-31-3",
          "code_system": "CAS",
          "references": [
            "3d729421-fb0f-4b65-ac5f-268121a416ec",
            "56a80b0e-4593-4f0a-9738-0d10e5adc9bf"
          ]
        },
        {
          "uuid": "a568522f-04e1-4a28-bfbf-4c8e36f141bf",
          "code": "279-383-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.072.145",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3d729421-fb0f-4b65-ac5f-268121a416ec"
          ]
        },
        {
          "uuid": "1415a998-95a4-483c-83ee-c17db3adc0a2",
          "code": "15847293",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15847293",
          "code_system": "PUBCHEM",
          "references": [
            "3d729421-fb0f-4b65-ac5f-268121a416ec"
          ]
        },
        {
          "uuid": "de6b8947-647c-4e79-bf0a-ab05f6bd6c37",
          "code": "Y6YE3133F5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f34666a3-d0c4-2b96-29b2-fecbdb99f216",
          "code": "DTXSID50868556",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50868556",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3c79fc95-88e7-4a47-9c84-a5745e56e54d",
          "name": "1,2-PROPANEDIOL, 3-(3-(METHYLAMINO)-4-NITROPHENOXY)-",
          "stdName": "1,2-PROPANEDIOL, 3-(3-(METHYLAMINO)-4-NITROPHENOXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dde26767-ea7f-4763-ae36-3373054df406",
            "dcbb2741-aeae-482b-9726-8db9d05cbc38"
          ],
          "display_name": false
        },
        {
          "uuid": "5061c64b-1f01-4e0a-b9a9-32a745983f5f",
          "name": "2-NITRO-5-GLYCERYL METHANOLANILINE",
          "stdName": "2-NITRO-5-GLYCERYL METHANOLANILINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d729bc83-b451-436b-a95e-6bd501961499",
            "dcbb2741-aeae-482b-9726-8db9d05cbc38"
          ],
          "display_name": false
        },
        {
          "uuid": "c2892af2-d1af-41d3-9f72-a843addab7bd",
          "name": "2-NITRO-5-GLYCERYL METHYLANILINE",
          "stdName": "2-NITRO-5-GLYCERYL METHYLANILINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89c73777-de54-41f0-a4b3-24cb30c7a3f5",
            "dcbb2741-aeae-482b-9726-8db9d05cbc38",
            "46c790d3-6ebc-4f5e-ae21-3960391c3a5d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "11597dd7-ab32-4508-8346-cc88f7d5c593",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "86377043-6a8d-469a-ae3e-bca6a850d555",
          "name": "IMEXINE FT",
          "stdName": "IMEXINE FT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89c73777-de54-41f0-a4b3-24cb30c7a3f5",
            "dcbb2741-aeae-482b-9726-8db9d05cbc38"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "dde26767-ea7f-4763-ae36-3373054df406",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "dcbb2741-aeae-482b-9726-8db9d05cbc38",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89c73777-de54-41f0-a4b3-24cb30c7a3f5",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d729bc83-b451-436b-a95e-6bd501961499",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d729421-fb0f-4b65-ac5f-268121a416ec",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391406000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d26967e-03db-4367-8eb7-3f21c6f3e8d5",
          "citation": "SRS import [Y6YE3133F5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Y6YE3133F5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391406000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "46c790d3-6ebc-4f5e-ae21-3960391c3a5d",
          "citation": "2-NITRO-5-GLYCERYL METHYLANILINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "56a80b0e-4593-4f0a-9738-0d10e5adc9bf",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d9ea9a6d-6696-450a-9af7-61e1c1c8290d",
          "id": "d9ea9a6d-6696-450a-9af7-61e1c1c8290d",
          "molfile": "\n  Marvin  01132111182D          \n\n 17 17  0  0  0  0            999 V2000\n   12.0405   -5.7256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3261   -6.1381    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3261   -6.9631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0405   -7.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0405   -8.2006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7550   -8.6131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4695   -8.2006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1839   -8.6131    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   14.1839   -9.4381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8984   -8.2006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6128   -8.6131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3261   -8.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6115   -8.2006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6115   -7.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8970   -6.9631    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    9.8970   -6.1381    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.1826   -7.3756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 14  2  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n 12  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\nM  CHG  2  15   1  16  -1\nM  END",
          "smiles": "CNc1cc(ccc1[N+](=O)[O-])OCC(CO)O",
          "formula": "C10H14N2O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "eeea25e5-8f67-42df-9c5b-11c9f9ace2c2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "242.229",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "63ed790f-0276-4acc-bd52-cd76a84f8a98",
      "version": "4",
      "structure": {
        "id": "bb8267fc-3176-47eb-808f-11190d677750",
        "molfile": "\n  Marvin  01132109422D          \n\n 17 17  0  0  0  0            999 V2000\n   10.6115   -8.2006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6115   -7.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3261   -6.9631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0405   -7.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0405   -8.2006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3261   -8.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8970   -6.9631    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    9.8970   -6.1381    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.1826   -7.3756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3261   -6.1381    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0405   -5.7256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7550   -8.6131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4695   -8.2006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1839   -8.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8984   -8.2006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1839   -9.4381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6128   -8.6131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  3 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n  5 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 15 17  1  0  0  0  0\nM  CHG  2   7   1   8  -1\nM  END",
        "smiles": "CNc1cc(ccc1[N+](=O)[O-])OCC(CO)O",
        "formula": "C10H14N2O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "242.229",
        "optical_activity": "( + / - )",
        "references": [
          "89c73777-de54-41f0-a4b3-24cb30c7a3f5",
          "9d26967e-03db-4367-8eb7-3f21c6f3e8d5"
        ],
        "stereo_centers": 1
      },
      "unii": "Y6YE3133F5"
    }
  ]
}