{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fc844a85-752d-4344-a562-aeeab987dbab",
          "code": "6219-66-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6219-66-5",
          "code_system": "CAS",
          "references": [
            "98b47141-7b33-4df4-b278-a3e38f70abe2",
            "fc3497ec-eac3-449a-be1d-a2d2d4cef46b"
          ]
        },
        {
          "uuid": "1ff84fbc-8a8e-41f6-bb75-eb6824bfc99c",
          "code": "228-289-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.025.718",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "98b47141-7b33-4df4-b278-a3e38f70abe2"
          ]
        },
        {
          "uuid": "ad188c6b-c40e-4d15-b0ba-386c8daf95a8",
          "code": "5355255",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5355255",
          "code_system": "PUBCHEM",
          "references": [
            "98b47141-7b33-4df4-b278-a3e38f70abe2"
          ]
        },
        {
          "uuid": "1fefe4cb-c656-2677-fc66-99f7994c60d2",
          "code": "DTXSID3064140",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3064140",
          "code_system": "EPA CompTox",
          "references": [
            "c0c423a5-39a7-0ee5-e73d-6860cee3899f"
          ]
        },
        {
          "uuid": "e251a3ae-335c-461e-98da-fa1b2a4aa3f1",
          "code": "Y6645RV9DR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7526489e-f144-ce72-a95d-d4be8f6fa6d4",
          "code": "90184",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:90184",
          "code_system": "CHEBI",
          "references": [
            "b59b62dc-3faa-b9a4-6a1e-120dfc14bd31"
          ]
        },
        {
          "uuid": "7dbf3574-6cfb-b9ee-b27d-88fdce24fddc",
          "code": "30555",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=30555",
          "code_system": "NSC",
          "references": [
            "ca236bff-2d86-9ce8-dcbd-0b7b6d4778a1"
          ]
        },
        {
          "uuid": "10060134-2ab8-307d-c3ba-033a4e2d0db7",
          "code": "170008",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=170008",
          "code_system": "NSC",
          "references": [
            "ca236bff-2d86-9ce8-dcbd-0b7b6d4778a1"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "24fcce9e-2ae8-4eb2-9a82-67f24b4c48f4",
          "name": "1,2-ANTHRACENEDICARBOXYLIC ACID, 7-ACETYL-6-ETHYL-9,10-DIHYDRO-3,5,8-TRIHYDROXY-9,10-DIOXO-",
          "stdName": "1,2-ANTHRACENEDICARBOXYLIC ACID, 7-ACETYL-6-ETHYL-9,10-DIHYDRO-3,5,8-TRIHYDROXY-9,10-DIOXO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "604372b8-5c5b-44ed-becb-3ee6180faaa6",
            "eae56a35-c4bb-4d69-b595-280f1417fe11"
          ],
          "display_name": false
        },
        {
          "uuid": "b5b41120-1619-0d1f-b2cb-78d4b0cea21d",
          "name": "7-ACETYL-6-ETHYL-9,10-DIHYDRO-3,5,8-TRIHYDROXY-9,10-DIOXO-1,2-ANTHRACENEDICARBOXYLIC ACID",
          "stdName": "7-ACETYL-6-ETHYL-9,10-DIHYDRO-3,5,8-TRIHYDROXY-9,10-DIOXO-1,2-ANTHRACENEDICARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f8eb09a-635c-7eaa-cd00-f1eb81edc2b7"
          ],
          "display_name": true
        },
        {
          "uuid": "026573f5-63c7-4136-8dd0-3acc59f0a1bd",
          "name": "LACCAIC ACID",
          "stdName": "LACCAIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "1f8eb09a-635c-7eaa-cd00-f1eb81edc2b7"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "41aa3456-1224-4c28-b88c-32f59dc150a7",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "49c75a5d-9a34-40d2-b1e4-c1f0ab289269",
          "name": "NSC-170008",
          "stdName": "NSC-170008",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "604372b8-5c5b-44ed-becb-3ee6180faaa6",
            "eae56a35-c4bb-4d69-b595-280f1417fe11"
          ],
          "display_name": false
        },
        {
          "uuid": "79523cc5-4106-4bb2-8489-fa1f20e1e1d0",
          "name": "NSC-30555",
          "stdName": "NSC-30555",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "604372b8-5c5b-44ed-becb-3ee6180faaa6",
            "eae56a35-c4bb-4d69-b595-280f1417fe11"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "eae56a35-c4bb-4d69-b595-280f1417fe11",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "604372b8-5c5b-44ed-becb-3ee6180faaa6",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98b47141-7b33-4df4-b278-a3e38f70abe2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391039000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32b0907f-ff1d-480e-abb4-05938f7d26aa",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c0c423a5-39a7-0ee5-e73d-6860cee3899f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6219-66-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1f8eb09a-635c-7eaa-cd00-f1eb81edc2b7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1481fbad-2f84-8392-88c1-f9b6f8bd7a4f",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "fc3497ec-eac3-449a-be1d-a2d2d4cef46b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b59b62dc-3faa-b9a4-6a1e-120dfc14bd31",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ca236bff-2d86-9ce8-dcbd-0b7b6d4778a1",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ee0fd1e5-25c0-4214-a010-3714c941dfb5",
          "id": "ee0fd1e5-25c0-4214-a010-3714c941dfb5",
          "molfile": "\n  Marvin  01132112202D          \n\n 30 32  0  0  0  0            999 V2000\n    6.7867   -2.0909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5050   -2.5016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5050   -3.3278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2235   -3.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9371   -3.3268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9371   -2.5063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6507   -3.7404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2235   -4.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9371   -4.9766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5050   -4.9757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5050   -5.8057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2117   -6.2190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7778   -6.2130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7778   -7.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7715   -7.6150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7715   -8.4450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4838   -7.2104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0676   -7.4450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0676   -8.2666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3463   -8.6797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7722   -8.6797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3518   -7.0271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6355   -7.4364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3518   -6.2008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0699   -5.7902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0699   -4.9697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3655   -4.5541    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7976   -4.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7976   -3.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0825   -3.3292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  3 29  1  0  0  0  0\n  5  4  1  0  0  0  0\n  8  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  2  0  0  0  0\n  8  9  2  0  0  0  0\n 10  8  1  0  0  0  0\n 10 11  1  0  0  0  0\n 28 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 13 25  1  0  0  0  0\n 14 15  1  0  0  0  0\n 18 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 22 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  2  0  0  0  0\n 22 23  1  0  0  0  0\n 24 22  2  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  1  0  0  0  0\n 29 28  1  0  0  0  0\n 29 30  2  0  0  0  0\nM  END",
          "smiles": "CCC1=C(C(=O)C)C(=O)c2c(C1=O)c(c3cc(c(c(c3c2O)C(=O)O)C(=O)O)O)O",
          "formula": "C20H14O10",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "699307c5-5611-43a3-9ccf-9067a9137c10"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "414.3199",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "afd18bfa-e7a0-430c-999e-2364abf4b132",
      "version": "10",
      "structure": {
        "id": "77a4538e-efea-42d5-8f5c-d42dc13e6b1b",
        "molfile": "\n  Marvin  01132106132D          \n\n 30 32  0  0  0  0            999 V2000\n    9.6507   -3.7404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9371   -3.3268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2235   -3.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5050   -3.3278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7976   -3.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0825   -3.3292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7976   -4.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5050   -4.9757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5050   -5.8057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2117   -6.2190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7778   -6.2130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0699   -5.7902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3518   -6.2008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3518   -7.0271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6355   -7.4364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0676   -7.4450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0676   -8.2666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3463   -8.6797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7722   -8.6797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7778   -7.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7715   -7.6150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7715   -8.4450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4838   -7.2104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0699   -4.9697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3655   -4.5541    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2235   -4.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9371   -4.9766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5050   -2.5016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7867   -2.0909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9371   -2.5063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 16 20  1  0  0  0  0\n 20 11  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 21 23  1  0  0  0  0\n 12 24  1  0  0  0  0\n 24  7  1  0  0  0  0\n 24 25  2  0  0  0  0\n  8 26  1  0  0  0  0\n 26  3  2  0  0  0  0\n 26 27  1  0  0  0  0\n  4 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n  2 30  1  0  0  0  0\nM  END",
        "smiles": "CCc1c(C(=O)C)c(c2c(c1O)C(=O)c3cc(c(c(c3C2=O)C(=O)O)C(=O)O)O)O",
        "formula": "C20H14O10",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "414.3199",
        "optical_activity": "NONE",
        "references": [
          "1f8eb09a-635c-7eaa-cd00-f1eb81edc2b7"
        ],
        "stereo_centers": 0
      },
      "unii": "Y6645RV9DR"
    }
  ]
}