{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c1c5c6a9-0fa9-4582-b610-5002e9e46ff5",
          "code": "J01MA10",
          "comments": "ATC|ANTIINFECTIVES FOR SYSTEMIC USE|ANTIBACTERIALS FOR SYSTEMIC USE|QUINOLONE ANTIBACTERIALS|Fluoroquinolones|rufloxacin",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=J01MA10&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "e6351949-31c7-4d3f-82ff-721c9299de37"
          ]
        },
        {
          "uuid": "584aba07-bedd-4dad-954d-3c3c794cc127",
          "code": "QJ01MA10",
          "comments": "VATC|ANTIBACTERIALS FOR SYSTEMIC USE|QUINOLONE AND QUINOXALINE ANTIBACTERIALS|Fluoroquinolones|rufloxacin",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QJ01MA10&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "e6351949-31c7-4d3f-82ff-721c9299de37"
          ]
        },
        {
          "uuid": "a6af36d1-a6ee-4a80-92e6-deb9e3b3c27b",
          "code": "101363-10-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=101363-10-4",
          "code_system": "CAS",
          "references": [
            "e6351949-31c7-4d3f-82ff-721c9299de37",
            "c06e07e0-cf31-4588-b205-336afe9d8871"
          ]
        },
        {
          "uuid": "7ecbc8ba-cf95-4da1-8422-dd5581e5c889",
          "code": "C72638",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C72638",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e6351949-31c7-4d3f-82ff-721c9299de37"
          ]
        },
        {
          "uuid": "4685f1b9-bf04-44cc-946b-87cf895ec6ce",
          "code": "C060328",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67060328",
          "code_system": "MESH",
          "references": [
            "e6351949-31c7-4d3f-82ff-721c9299de37"
          ]
        },
        {
          "uuid": "2a4ed56b-87a9-4f2d-92de-ed2853469cc9",
          "code": "6080",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6080",
          "code_system": "INN",
          "references": [
            "e6351949-31c7-4d3f-82ff-721c9299de37"
          ]
        },
        {
          "uuid": "04b54787-d65e-4165-b504-e33e426fce2c",
          "code": "m9697",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9697?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e6351949-31c7-4d3f-82ff-721c9299de37"
          ]
        },
        {
          "uuid": "dee6e4db-5481-476b-85db-6ee4d6d15488",
          "code": "SUB10404MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e6351949-31c7-4d3f-82ff-721c9299de37"
          ]
        },
        {
          "uuid": "ec91377c-1cb9-45d9-a0cd-39b3f0192ac1",
          "code": "CHEMBL295619",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL295619",
          "code_system": "ChEMBL",
          "references": [
            "e6351949-31c7-4d3f-82ff-721c9299de37"
          ]
        },
        {
          "uuid": "b808316f-1671-4723-a259-54e128fabf64",
          "code": "58258",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/58258",
          "code_system": "PUBCHEM",
          "references": [
            "e6351949-31c7-4d3f-82ff-721c9299de37"
          ]
        },
        {
          "uuid": "051d8487-d91c-b4ea-b488-f4dd25defa2d",
          "code": "DTXSID6048412",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6048412",
          "code_system": "EPA CompTox",
          "references": [
            "71fb5ede-7f98-95c4-ad5a-1ed1a34f2495"
          ]
        },
        {
          "uuid": "0e7c01d2-a407-1c8a-a999-4e71a103e519",
          "code": "C795",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antibiotic[C258]|Quinolone Antibiotic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C795",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5cbb6090-f7e3-6562-d95b-a2ad58cc5ac5"
          ]
        },
        {
          "uuid": "451b65da-522b-419d-86a4-abf7330b0c5b",
          "code": "Y521XM2900",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "dee631e0-0318-9efd-5b21-c6143cef31b8",
          "code": "DB13772",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13772",
          "code_system": "DRUG BANK",
          "references": [
            "5cbb6090-f7e3-6562-d95b-a2ad58cc5ac5"
          ]
        },
        {
          "uuid": "f89ef08a-7b5a-6621-3ee1-45a1f3ba2ed9",
          "code": "2412",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2412",
          "code_system": "DRUG CENTRAL",
          "references": [
            "5cbb6090-f7e3-6562-d95b-a2ad58cc5ac5"
          ]
        },
        {
          "uuid": "32a8de19-8623-91e2-231c-bb7c90b144fd",
          "code": "Rufloxacin",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Rufloxacin",
          "code_system": "WIKIPEDIA",
          "references": [
            "22cd2c99-b3eb-f5b6-183d-53600dfbfa90"
          ]
        },
        {
          "uuid": "f670bfa0-11db-2553-d7ee-7b8eb61e6037",
          "code": "759835",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759835",
          "code_system": "NSC",
          "references": [
            "184fb94b-3bdf-7e63-3b68-c913ed269e20"
          ]
        },
        {
          "uuid": "4e2ef12a-147f-0649-d689-a531e55810ee",
          "code": "100000092512",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d0d376a4-6cb7-11e1-5015-31324ff99ac8"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ba0d168a-c162-4ad1-bb87-6df9ba6c7f12",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "29345e8a-32e5-402e-a39a-6111b817a776",
            "refuuid": "3a40e56c-12ff-47f9-8d82-d0c2d074a8ca",
            "name": "RUFLOXACIN",
            "unii": "Y521XM2900",
            "linking_id": "Y521XM2900",
            "ref_pname": "RUFLOXACIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b01e92e9-89a3-4433-9e1e-3ec1198337c9",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "97dbd680-e927-4f99-b30f-16dd13322ac0",
            "refuuid": "5c4523e1-3686-427e-a5ff-49d57afb8344",
            "name": "RUFLOXACIN HYDROCHLORIDE",
            "unii": "1643374N6L",
            "linking_id": "1643374N6L",
            "ref_pname": "RUFLOXACIN HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "05444994-0ab1-4599-801a-1e636e7900bd",
          "name": "MF 934",
          "stdName": "MF 934",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a17df35-969d-4cc7-ad1c-03ff3498e59f",
            "e7175242-c687-4e44-8c63-0a09acfe87ae"
          ],
          "display_name": false
        },
        {
          "uuid": "6dcde383-d3e7-fc43-3021-eabf3537445f",
          "name": "NSC-759835",
          "stdName": "NSC-759835",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "184fb94b-3bdf-7e63-3b68-c913ed269e20"
          ],
          "display_name": false
        },
        {
          "uuid": "bd232323-1065-4f94-a117-6a97008c9a08",
          "name": "RUFLOXACIN",
          "stdName": "RUFLOXACIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22a1b76e-368d-4d0b-917b-834202de9f9b",
            "5bab92ef-69cc-4a6f-9d67-1f1860ce0bac",
            "f4b17fe9-90a3-496b-86af-94c2d896e683",
            "69984c5b-695b-497d-95b2-acf9baf9aedf",
            "b8754b7f-759e-4152-8a2e-c8a3468cffdc",
            "e7175242-c687-4e44-8c63-0a09acfe87ae",
            "a1e792c6-66f1-4ddf-8ea1-9aab819c3769",
            "4830389c-6878-4c6e-ac37-632b1b08a99e"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "03b04281-d70d-44c8-b675-ced416190c6e",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "9aac270b-289c-4d61-9d01-f2ddbcb5127e",
          "name": "RUFLOXACIN [MI]",
          "stdName": "RUFLOXACIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7175242-c687-4e44-8c63-0a09acfe87ae",
            "4830389c-6878-4c6e-ac37-632b1b08a99e"
          ],
          "display_name": false
        },
        {
          "uuid": "ab63e332-6867-94c8-240d-1abe0ff0cc87",
          "name": "Rufloxacin [WHO-DD]",
          "stdName": "RUFLOXACIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43b290db-473f-1b5f-63c0-7fd863e12a6e"
          ],
          "display_name": false
        },
        {
          "uuid": "b55440b3-8cda-4425-9369-af11096470ac",
          "name": "rufloxacin [INN]",
          "stdName": "RUFLOXACIN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1e792c6-66f1-4ddf-8ea1-9aab819c3769"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b8754b7f-759e-4152-8a2e-c8a3468cffdc",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a1e792c6-66f1-4ddf-8ea1-9aab819c3769",
          "citation": "INN Proposed List 57",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL57.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4830389c-6878-4c6e-ac37-632b1b08a99e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7175242-c687-4e44-8c63-0a09acfe87ae",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5bab92ef-69cc-4a6f-9d67-1f1860ce0bac",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a17df35-969d-4cc7-ad1c-03ff3498e59f",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6351949-31c7-4d3f-82ff-721c9299de37",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390742000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c9bb98ea-a168-4f09-afe7-1d2d79454122",
          "citation": "SRS import [Y521XM2900]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Y521XM2900",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390742000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b148c2a2-b58e-448f-9e9b-368f4e37b2cb",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4b17fe9-90a3-496b-86af-94c2d896e683",
          "citation": "RUFLOXACIN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "69984c5b-695b-497d-95b2-acf9baf9aedf",
          "citation": "RUFLOXACIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "22a1b76e-368d-4d0b-917b-834202de9f9b",
          "citation": "RUFLOXACIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "71fb5ede-7f98-95c4-ad5a-1ed1a34f2495",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=101363-10-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5cbb6090-f7e3-6562-d95b-a2ad58cc5ac5",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c06e07e0-cf31-4588-b205-336afe9d8871",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "22cd2c99-b3eb-f5b6-183d-53600dfbfa90",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "184fb94b-3bdf-7e63-3b68-c913ed269e20",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "43b290db-473f-1b5f-63c0-7fd863e12a6e",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d0d376a4-6cb7-11e1-5015-31324ff99ac8",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8643e4ab-8887-4f89-9691-faa8116e1a38",
          "id": "8643e4ab-8887-4f89-9691-faa8116e1a38",
          "molfile": "\n  Marvin  01132106582D          \n\n 25 28  0  0  0  0            999 V2000\n    0.6360   -5.7930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3180   -5.3409    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0817   -5.7087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7330   -5.2643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7483   -4.4061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0204   -4.0766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3180   -4.5133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4150   -3.9999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4150   -3.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7254   -2.7433    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1200   -2.7433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8352   -3.1903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8352   -4.0153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1200   -4.4061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1200   -5.2413    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8352   -5.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5529   -5.2566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5529   -4.4316    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2732   -4.0383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2732   -3.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9245   -2.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5759   -3.2516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9245   -2.1660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5529   -2.7816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5529   -1.9106    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5  8  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 14  2  0  0  0  0\n 10  9  1  0  0  0  0\n  9 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  2  0  0  0  0\n 12 24  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 18  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 21 20  1  0  0  0  0\n 24 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 21  2  0  0  0  0\n 25 24  2  0  0  0  0\nM  END",
          "smiles": "CN1CCN(CC1)c2c(cc3c4c2SCCn4cc(c3=O)C(=O)O)F",
          "formula": "C17H18FN3O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e0c3115c-a762-4279-a9cb-2d83214dd755"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "363.4083",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3a40e56c-12ff-47f9-8d82-d0c2d074a8ca",
      "version": "15",
      "structure": {
        "id": "5392f657-27d7-4480-b8ef-d2f3acef419f",
        "molfile": "\n  Marvin  01132104212D          \n\n 25 28  0  0  0  0            999 V2000\n    6.2732   -3.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8352   -3.1903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5529   -4.4316    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1200   -4.4061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8352   -4.0153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5529   -2.7816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2732   -4.0383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4150   -3.9999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4150   -3.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1200   -2.7433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7483   -4.4061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9245   -2.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1200   -5.2413    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3180   -5.3409    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5529   -1.9106    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7330   -5.2643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0204   -4.0766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5759   -3.2516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7254   -2.7433    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5529   -5.2566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0817   -5.7087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3180   -4.5133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9245   -2.1660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8352   -5.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6360   -5.7930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  1  2  0  0  0  0\n  8  4  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10  2  2  0  0  0  0\n 11  8  1  0  0  0  0\n 12  1  1  0  0  0  0\n 13 24  1  0  0  0  0\n 14 22  1  0  0  0  0\n 15  6  2  0  0  0  0\n 16 11  1  0  0  0  0\n 17 11  1  0  0  0  0\n 18 12  2  0  0  0  0\n 19  9  1  0  0  0  0\n 20  3  1  0  0  0  0\n 21 16  1  0  0  0  0\n 22 17  1  0  0  0  0\n 23 12  1  0  0  0  0\n 24 20  1  0  0  0  0\n 25 14  1  0  0  0  0\n  5  2  1  0  0  0  0\n  9  8  2  0  0  0  0\n 13  4  1  0  0  0  0\n 21 14  1  0  0  0  0\nM  END",
        "smiles": "CN1CCN(CC1)c2c(cc3c4c2SCCn4cc(c3=O)C(=O)O)F",
        "formula": "C17H18FN3O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "363.4083",
        "optical_activity": "NONE",
        "references": [
          "c9bb98ea-a168-4f09-afe7-1d2d79454122",
          "b148c2a2-b58e-448f-9e9b-368f4e37b2cb",
          "a1e792c6-66f1-4ddf-8ea1-9aab819c3769"
        ],
        "stereo_centers": 0
      },
      "unii": "Y521XM2900"
    }
  ]
}