{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8d6d5c6d-67bb-48da-a8cb-18dd4304f93e",
          "code": "6088-51-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6088-51-3",
          "code_system": "CAS",
          "references": [
            "16a3afaf-6d94-453b-83f4-f840311ad4ff",
            "fa85d582-ad51-4a52-aeae-957463ab334d"
          ]
        },
        {
          "uuid": "76db42f1-f675-487b-8fb2-57c80ab84933",
          "code": "m4112",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4112?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "16a3afaf-6d94-453b-83f4-f840311ad4ff"
          ]
        },
        {
          "uuid": "d7584400-421d-49ab-9dbf-4bc707e26532",
          "code": "228-025-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.025.478",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "16a3afaf-6d94-453b-83f4-f840311ad4ff"
          ]
        },
        {
          "uuid": "56b1ffe5-96c3-4386-92da-c7b66cafaa0c",
          "code": "22463",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22463",
          "code_system": "PUBCHEM",
          "references": [
            "16a3afaf-6d94-453b-83f4-f840311ad4ff"
          ]
        },
        {
          "uuid": "9c293a69-4de9-cad2-2ee4-63a07356f8d4",
          "code": "DTXSID7025429",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7025429",
          "code_system": "EPA CompTox",
          "references": [
            "49d639c2-cd86-788a-bda8-8b52ee7d7b3d"
          ]
        },
        {
          "uuid": "c0a38888-f72d-4406-9d0e-a431335b7a3d",
          "code": "Y4YW3C2D2S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ca455b65-cd08-52de-ed41-f4760a185600",
          "code": "87629",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=87629",
          "code_system": "NSC",
          "references": [
            "5343890b-df9b-3abb-0215-a9d6fd5c9f2d"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3ac70684-013b-4ffb-97ef-50e3010968d5",
          "name": "2,2'-DIHYDROXY-6,6'-DINAPHTHYL DISULFIDE",
          "stdName": "2,2'-DIHYDROXY-6,6'-DINAPHTHYL DISULFIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e594e9c7-c6f4-4ebe-857f-11710a69ee58",
            "4b58cdb0-cd45-497b-853e-57bbd172eb0d"
          ],
          "display_name": false
        },
        {
          "uuid": "60579be0-8462-470c-bb4e-c613a13cfb10",
          "name": "6,6'-DITHIOBIS(2-NAPHTHOL)",
          "stdName": "6,6'-DITHIOBIS(2-NAPHTHOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e594e9c7-c6f4-4ebe-857f-11710a69ee58",
            "4b58cdb0-cd45-497b-853e-57bbd172eb0d"
          ],
          "display_name": true
        },
        {
          "uuid": "a2ecfa59-184d-4357-8888-2ed00a18185d",
          "name": "6,6'-DITHIOBIS-2-NAPHTHALENOL",
          "stdName": "6,6'-DITHIOBIS-2-NAPHTHALENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e594e9c7-c6f4-4ebe-857f-11710a69ee58",
            "4b58cdb0-cd45-497b-853e-57bbd172eb0d"
          ],
          "display_name": false
        },
        {
          "uuid": "658f573b-a082-42f8-b98c-04addf9f2496",
          "name": "6,6'-DITHIODI-2-NAPHTHOL",
          "stdName": "6,6'-DITHIODI-2-NAPHTHOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e594e9c7-c6f4-4ebe-857f-11710a69ee58",
            "4b58cdb0-cd45-497b-853e-57bbd172eb0d"
          ],
          "display_name": false
        },
        {
          "uuid": "c2589928-69b4-4aa5-9a54-c32fc0a02195",
          "name": "6-HYDROXY-2-NAPHTHYL DISULFIDE",
          "stdName": "6-HYDROXY-2-NAPHTHYL DISULFIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ebadf37-8968-4613-b0e5-e12a75512d0b",
            "4b58cdb0-cd45-497b-853e-57bbd172eb0d"
          ],
          "display_name": false
        },
        {
          "uuid": "2b98dd21-7c8d-4d78-8f3e-56e11ab3cc77",
          "name": "BIS(6-HYDROXY-2-NAPHTHYL) DISULFIDE",
          "stdName": "BIS(6-HYDROXY-2-NAPHTHYL) DISULFIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e594e9c7-c6f4-4ebe-857f-11710a69ee58",
            "4b58cdb0-cd45-497b-853e-57bbd172eb0d"
          ],
          "display_name": false
        },
        {
          "uuid": "8e216abf-a969-4feb-afe3-c9fec445714a",
          "name": "DDD (ANALYTICAL)",
          "stdName": "DDD (ANALYTICAL)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e594e9c7-c6f4-4ebe-857f-11710a69ee58",
            "4b58cdb0-cd45-497b-853e-57bbd172eb0d",
            "1f0b988e-ca5b-44c0-a978-5ccf78985faa",
            "e030a022-4ffd-4efa-aad8-36207091590c"
          ],
          "display_name": false
        },
        {
          "uuid": "43fbaf95-145a-49db-949c-e487fc159446",
          "name": "DDD (ANALYTICAL) [MI]",
          "stdName": "DDD (ANALYTICAL) [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b58cdb0-cd45-497b-853e-57bbd172eb0d",
            "1f0b988e-ca5b-44c0-a978-5ccf78985faa"
          ],
          "display_name": false
        },
        {
          "uuid": "1ab8b650-8e20-4f24-8bb1-1fe208a670be",
          "name": "DIHYDROXY-6,6'-DINAPHTHYLDISULFIDE, 2,2'-",
          "stdName": "DIHYDROXY-6,6'-DINAPHTHYLDISULFIDE, 2,2'-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cdea22f0-85d3-4356-af39-c6ec2a0c4d98"
          ],
          "display_name": false
        },
        {
          "uuid": "bbaa160d-0eac-4a1d-b34d-e28ff3b9fa33",
          "name": "DIHYDROXY-6,6'-DINAPHTHYLDISULPHIDE, 2,2'-",
          "stdName": "DIHYDROXY-6,6'-DINAPHTHYLDISULPHIDE, 2,2'-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "289532fc-4116-4572-9c7a-9bb3315df88f"
          ],
          "display_name": false
        },
        {
          "uuid": "10bcda4a-49f2-4fcd-9c2d-5a68e3bfcc4f",
          "name": "NSC-87629",
          "stdName": "NSC-87629",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b58cdb0-cd45-497b-853e-57bbd172eb0d",
            "b621044d-f25f-4afe-83c0-cacc27f7c335"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cdea22f0-85d3-4356-af39-c6ec2a0c4d98",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "289532fc-4116-4572-9c7a-9bb3315df88f",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f0b988e-ca5b-44c0-a978-5ccf78985faa",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b58cdb0-cd45-497b-853e-57bbd172eb0d",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e594e9c7-c6f4-4ebe-857f-11710a69ee58",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b621044d-f25f-4afe-83c0-cacc27f7c335",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ebadf37-8968-4613-b0e5-e12a75512d0b",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "16a3afaf-6d94-453b-83f4-f840311ad4ff",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390953000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb139ccd-3b89-4fef-80d1-2736cd92f011",
          "citation": "SRS import [Y4YW3C2D2S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Y4YW3C2D2S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390953000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11b329ed-0452-4e09-8a36-7460ca7f60e8",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e030a022-4ffd-4efa-aad8-36207091590c",
          "citation": "DDD (ANALYTICAL) [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "49d639c2-cd86-788a-bda8-8b52ee7d7b3d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6088-51-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fa85d582-ad51-4a52-aeae-957463ab334d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5343890b-df9b-3abb-0215-a9d6fd5c9f2d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "387c927e-35ed-42f2-890c-605aac1f51cf",
          "id": "387c927e-35ed-42f2-890c-605aac1f51cf",
          "molfile": "\n  Marvin  01132103002D          \n\n 24 27  0  0  0  0            999 V2000\n   10.3505   -3.4376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9518   -4.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3738   -4.8555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9642   -5.6022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1585   -5.6022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7667   -6.3268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9376   -6.3268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5439   -7.0607    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7173   -7.0607    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2877   -6.3418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6941   -5.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2750   -4.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4611   -4.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0491   -4.1926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2150   -4.1926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7928   -3.4785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8106   -4.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2302   -5.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0491   -5.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4611   -6.3418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5105   -5.6407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9023   -4.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7233   -4.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1176   -4.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n 24  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 23  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  7 21  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 20 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 19 13  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "c1cc(cc2ccc(cc12)SSc3ccc4cc(ccc4c3)O)O",
          "formula": "C20H14O2S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3a4bdf72-7d69-46a9-9a24-e98421ea64f3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "350.4569",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d9e3af3f-b66e-4693-a4cb-9e5983c89d76",
      "version": "4",
      "structure": {
        "id": "3c7fe01f-d59e-4f94-85e3-61eb8a6f38e1",
        "molfile": "\n  Marvin  01132103122D          \n\n 24 27  0  0  0  0            999 V2000\n    5.0491   -5.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4611   -4.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2750   -4.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6941   -5.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2877   -6.3418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4611   -6.3418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7173   -7.0607    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5439   -7.0607    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9376   -6.3268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7667   -6.3268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1585   -5.6022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7233   -4.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1176   -4.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9518   -4.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3505   -3.4376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3738   -4.8555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9642   -5.6022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9023   -4.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5105   -5.6407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0491   -4.1926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2150   -4.1926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7928   -3.4785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8106   -4.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2302   -5.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  2  0  0  0  0\n 11 17  1  0  0  0  0\n 18 12  1  0  0  0  0\n 19 18  2  0  0  0  0\n  9 19  1  0  0  0  0\n  2 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 23 21  1  0  0  0  0\n 24 23  2  0  0  0  0\n  1 24  1  0  0  0  0\nM  END",
        "smiles": "c1cc(cc2ccc(cc12)SSc3ccc4cc(ccc4c3)O)O",
        "formula": "C20H14O2S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "350.4569",
        "optical_activity": "NONE",
        "references": [
          "11b329ed-0452-4e09-8a36-7460ca7f60e8",
          "fb139ccd-3b89-4fef-80d1-2736cd92f011"
        ],
        "stereo_centers": 0
      },
      "unii": "Y4YW3C2D2S"
    }
  ]
}