{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "568f49c3-4149-4307-8251-962c62434c6e",
          "code": "J01GA01",
          "comments": "ATC|ANTIINFECTIVES FOR SYSTEMIC USE|ANTIBACTERIALS FOR SYSTEMIC USE|AMINOGLYCOSIDE ANTIBACTERIALS|Streptomycins|streptomycin",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=J01GA01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "14339452-cadd-4d6e-817d-395cdb870040",
          "code": "A07AA04",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|ANTIDIARRHEALS, INTESTINAL ANTIINFLAMMATORY/ANTIINFECTIVE AGENTS|INTESTINAL ANTIINFECTIVES|Antibiotics|streptomycin",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A07AA04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "c90fd5c7-cc29-41f5-9342-3620ec30f8de",
          "code": "N0000175477",
          "comments": "Established Pharmacologic Class [EPC]|Aminoglycoside Antibacterial [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175477",
          "code_system": "NDF-RT",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "ccce5ccc-14f9-483a-9db7-635eec1c94f0",
          "code": "N0000175483",
          "comments": "Established Pharmacologic Class [EPC]|Antimycobacterial [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175483",
          "code_system": "NDF-RT",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "f7b6d771-aae3-42ee-be2f-9c2889e59f02",
          "code": "N0000007853",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Carbohydrates [Chemical/Ingredient]|Glycosides [Chemical/Ingredient]|Aminoglycosides [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000007853",
          "code_system": "NDF-RT",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "7cb6b3af-176b-4d65-bc75-619049a915b3",
          "code": "QJ04AM01",
          "comments": "VATC|ANTIMYCOBACTERIALS|DRUGS FOR TREATMENT OF TUBERCULOSIS|Combinations of drugs for the treatment of tuberculosis|streptomycin and isoniazid",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QJ04AM01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "e963f24e-b36f-457f-b1da-0a0aaede4565",
          "code": "QA07AA04",
          "comments": "VATC|ANTIDIARRHEALS, INTESTINAL ANTI-INFLAMMATORY/ANTIINFECTIVE AGENTS|INTESTINAL ANTIINFECTIVES|Antibiotics|streptomycin",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA07AA04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "1f4c0d35-082d-41e8-9bdb-cac4379620ff",
          "code": "QJ01GA01",
          "comments": "VATC|ANTIBACTERIALS FOR SYSTEMIC USE|AMINOGLYCOSIDE ANTIBACTERIALS|Streptomycins|streptomycin",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QJ01GA01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "eaaf015b-d32b-4951-b69b-5f3c77db1a76",
          "code": "57-92-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=57-92-1",
          "code_system": "CAS",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1",
            "eafd8164-e004-4c6d-a5f9-cc3f364001ba"
          ]
        },
        {
          "uuid": "795217ba-f067-4c30-960c-74a9be6ae88e",
          "code": "C61952",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61952",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "6ea85c7d-4f93-4131-b2f5-b5527cdbea3c",
          "code": "NBK548821",
          "comments": "LiverTox|Antimicrobial|Antituberculosis|Aminoglycoside",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548821/",
          "code_system": "LIVERTOX",
          "references": [
            "4b032fb9-085f-fb85-cf95-e8db6c2683ec"
          ]
        },
        {
          "uuid": "131957a0-78f8-41f6-8daf-963586bbf3fe",
          "code": "6.2.4",
          "comments": "WHO ESSENTIAL MEDICINES LIST|Anti-infective medicines|Antibacterials|Antituberculosis medicines",
          "type": "PRIMARY",
          "url": "http://prais.paho.org/medicine/104/?section=52#type284",
          "code_system": "WHO-ESSENTIAL MEDICINES LIST",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "888fae2e-81d6-4cf9-b71d-60c4c57aa2c5",
          "code": "D013307",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68013307",
          "code_system": "MESH",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "95fdbcf2-a02d-4d72-8e33-b6467b5d9969",
          "code": "STREPTOMYCIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Streptomycin",
          "code_system": "WIKIPEDIA",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "97848742-6289-459e-9cfd-6ef0923c2dfe",
          "code": "J04AM01",
          "comments": "ATC|ANTIINFECTIVES FOR SYSTEMIC USE|ANTIMYCOBACTERIALS|DRUGS FOR TREATMENT OF TUBERCULOSIS|Combinations of drugs for treatment of tuberculosis|streptomycin and isoniazid",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=J04AM01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "19cf62f5-13ce-4ca2-8472-44384fe4a41c",
          "code": "QA07AA54",
          "comments": "VATC|ANTIDIARRHEALS, INTESTINAL ANTI-INFLAMMATORY/ANTIINFECTIVE AGENTS|INTESTINAL ANTIINFECTIVES|Antibiotics|streptomycin, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA07AA54&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "41395768-566b-465d-b6b2-532095a5d94f",
          "code": "A07AA54",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|ANTIDIARRHEALS, INTESTINAL ANTIINFLAMMATORY/ANTIINFECTIVE AGENTS|INTESTINAL ANTIINFECTIVES|Antibiotics|streptomycin, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A07AA54&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "c5530e11-30bd-4707-b15d-234d3e3f715d",
          "code": "6306",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2023",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "c34c949c-d092-4289-ac62-fe1dacb10d87",
          "code": "3685",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3685",
          "code_system": "INN",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "49fb58a0-be02-4edb-bd8d-54309960ed75",
          "code": "m10226",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10226?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "2d0df7a1-9c68-4346-9ea9-ab54e07b2415",
          "code": "10109",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/10109/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "75953bf4-5b75-4761-99ea-b82755bfa7a9",
          "code": "DB01082",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01082",
          "code_system": "DRUG BANK",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "00cabf1b-b833-454d-aa7c-a705755e408e",
          "code": "SUB10656MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "8de9cddd-7848-413c-ab23-d9ccb03388ff",
          "code": "21 CFR 556.610",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 556 -- TOLERANCES FOR RESIDUES OF NEW ANIMAL DRUGS IN FOOD|Subpart B--Specific Tolerances for Residues of New Animal Drugs|Sec. 556.610 Streptomycin.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=556.610",
          "code_system": "CFR",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "f9fbe70b-08a2-414c-88b1-c89ebf4f5a6d",
          "code": "21 CFR 520.2158",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 520 ORAL DOSAGE FORM NEW ANIMAL DRUGS|Sec. 520.2158 Streptomycin.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=520.2158",
          "code_system": "CFR",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "0acf3160-b526-44f0-88c8-12d2acd7d9cf",
          "code": "CHEMBL372795",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL372795",
          "code_system": "ChEMBL",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "4e148bc8-ea54-444c-9e02-c7dee49558f2",
          "code": "200-355-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.323",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "ef77c0af-bcc4-4fbc-80a0-b8b75083ea77",
          "code": "19649",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/19649",
          "code_system": "PUBCHEM",
          "references": [
            "4e868e17-b662-43d0-87e8-45a210d4fce1"
          ]
        },
        {
          "uuid": "9a72446e-f837-168b-ec6d-8912ae27213b",
          "code": "1768",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1768",
          "code_system": "HSDB",
          "references": [
            "d5ee274c-6343-b87c-fa4e-2c116bd6e773"
          ]
        },
        {
          "uuid": "e2dd3b1f-968b-eb97-f7ff-efd242e666e3",
          "code": "DTXSID4023597",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4023597",
          "code_system": "EPA CompTox",
          "references": [
            "03a0b7e1-f9da-8588-56b7-1ae7a6fc8500"
          ]
        },
        {
          "uuid": "fd4646a5-1233-9a4b-7113-751beffa2f43",
          "code": "C2363",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antibiotic[C258]|Aminoglycoside Antibiotic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2363",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4b032fb9-085f-fb85-cf95-e8db6c2683ec"
          ]
        },
        {
          "uuid": "d6138831-6a1f-4479-97f6-b303170c9e42",
          "code": "Y45QSO73OB",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a2bd69e1-a80d-ec9a-60d9-5a76b85c2b62",
          "code": "Streptomycin",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM247/",
          "code_system": "LACTMED",
          "references": [
            "4b032fb9-085f-fb85-cf95-e8db6c2683ec"
          ]
        },
        {
          "uuid": "132056e8-2c79-b0da-fb0f-a4f30c8c72ed",
          "code": "2481",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2481",
          "code_system": "DRUG CENTRAL",
          "references": [
            "4b032fb9-085f-fb85-cf95-e8db6c2683ec"
          ]
        },
        {
          "uuid": "d86db708-09b2-402e-6d82-7edf7e4a5d38",
          "code": "17076",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17076",
          "code_system": "CHEBI",
          "references": [
            "4b032fb9-085f-fb85-cf95-e8db6c2683ec"
          ]
        },
        {
          "uuid": "6bf955b7-a9ab-ea45-59bf-c5b7bc367da3",
          "code": "58007",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:58007",
          "code_system": "CHEBI",
          "references": [
            "4b032fb9-085f-fb85-cf95-e8db6c2683ec"
          ]
        },
        {
          "uuid": "48ec8a56-6253-3ae8-c222-2283d376c307",
          "code": "Y45QSO73OB",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Y45QSO73OB",
          "code_system": "DAILYMED",
          "references": [
            "e0114078-761f-f27d-689e-b95c8a806ccd"
          ]
        },
        {
          "uuid": "8246ed4c-cd65-acf2-83ef-f5daf6d2c387",
          "code": "14083",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=14083",
          "code_system": "NSC",
          "references": [
            "8be20851-9520-e7e8-3609-f12437ac50d2"
          ]
        },
        {
          "uuid": "2807c197-f2bf-4d7e-493c-bbdd4d1bb72b",
          "code": "streptomycin",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/streptomycin.html",
          "code_system": "ALANWOOD",
          "references": [
            "2c880fe4-652a-b96e-8f07-ef55336fafaa"
          ]
        },
        {
          "uuid": "43ce7771-4f41-66eb-351c-091f2a909ae2",
          "code": "100000083503",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "55805019-4788-c782-bf37-65f70a745527"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "583e78b7-9af1-4a17-85f0-2a18ed73c9a6",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c5df2625-14c9-42cd-90a3-3a8cf0fa11ba",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "564b7ac8-0286-4f81-90e6-5ea01bac7b1a",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04591708-77e5-4bac-9154-90b604b5829c",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c314108-1bdf-4ada-b1b8-941336aae5c4",
          "citation": "FDA SRS 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6cc73c42-eb8d-4074-baeb-5322a74cf25d",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "58811cc7-c1e7-4c1e-a6e7-7e5a8df0bff6",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f45bf4d1-abe9-4c73-a87a-f81038d098e0",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "91f572a9-ba47-416f-9527-c3d90e34bc04",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e868e17-b662-43d0-87e8-45a210d4fce1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389714000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47998718-f9b1-4318-a0cf-373db5eedd8b",
          "citation": "SRS import [Y45QSO73OB]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Y45QSO73OB",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389714000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "221b24bd-f94a-4a08-9dab-b4e1293fa24a",
          "citation": "STREPTOMYCIN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "696b63f6-8fc3-4876-8565-e2283836fa55",
          "citation": "STREPTOMYCIN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "da5088d9-d3fe-4216-9bb2-3b490412fcf4",
          "citation": "STREPTOMYCIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "78a2025f-2db3-4c05-9fe6-66b3978c114d",
          "citation": "STREPTOMYCIN [GREEN BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8e20bf45-9368-412c-9da1-caa824099f5c",
          "citation": "STREPTOMYCIN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5989819f-bb0b-4cdd-9a19-71d677394921",
          "citation": "STREPTOMYCIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9b059b07-8d7f-4d83-8a05-8dfc61226c38",
          "citation": "STREPTOMYCIN [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d5ee274c-6343-b87c-fa4e-2c116bd6e773",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+57-92-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "03a0b7e1-f9da-8588-56b7-1ae7a6fc8500",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=57-92-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4158f18b-2f43-f8e3-4d0a-c662683e3ed4",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+57-92-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fc7e58e0-01af-0ced-f8c6-6dfbf75dfe33",
          "citation": "https://www.clinicalkey.com/pharmacology/monograph/575?sec=monphar",
          "doc_type": "CLINICAL PHARMACOLOGY",
          "public_domain": true
        },
        {
          "uuid": "4b032fb9-085f-fb85-cf95-e8db6c2683ec",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "eafd8164-e004-4c6d-a5f9-cc3f364001ba",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2c880fe4-652a-b96e-8f07-ef55336fafaa",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "8be20851-9520-e7e8-3609-f12437ac50d2",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "47bc51f3-2478-c92e-dc03-79e3ebbf2f5f",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e0114078-761f-f27d-689e-b95c8a806ccd",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "55805019-4788-c782-bf37-65f70a745527",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9d3814b0-da25-4fb6-bee2-538589ede520",
          "id": "9d3814b0-da25-4fb6-bee2-538589ede520",
          "molfile": "\n  Marvin  01132108102D          \n\n 40 42  0  0  1  0            999 V2000\n    0.2619   -3.5935    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    0.2619   -4.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9137   -3.0785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6256   -2.3016    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    1.3414   -1.8884    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0572   -2.3016    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.0572   -3.1280    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.3385   -3.5382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7730   -3.5382    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.7701   -4.3617    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4859   -3.1280    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.2017   -3.5411    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9117   -3.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9087   -2.3016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6275   -3.5382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4859   -2.3016    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.1959   -1.8855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7730   -1.8826    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.7701   -1.0591    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0543   -0.6488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0543    0.1746    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3385   -1.0562    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2007   -2.3394    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -0.9136   -1.9291    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6236   -2.3452    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   -1.6236   -3.1716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3394   -3.5818    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   -2.3481   -4.4053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0639   -4.8127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0493   -3.1716    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -3.7681   -3.5790    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0493   -2.3452    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   -3.7651   -1.9321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3394   -1.9262    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   -2.3481   -1.1027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0639   -0.6896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4190   -3.1366    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -1.1377   -3.5411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4277   -3.9601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1435   -4.3675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 37  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  6  0  0  0\n  4 23  1  0  0  0  0\n  6  5  1  6  0  0  0\n  6  7  1  0  0  0  0\n  6 18  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  6  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  1  0  0  0\n 16 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  2  0  0  0  0\n 16 17  1  6  0  0  0\n 18 16  1  0  0  0  0\n 18 19  1  1  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 20  2  0  0  0  0\n 23 24  1  1  0  0  0\n 23 37  1  0  0  0  0\n 25 24  1  6  0  0  0\n 25 26  1  0  0  0  0\n 34 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 27 28  1  1  0  0  0\n 30 27  1  0  0  0  0\n 29 28  1  0  0  0  0\n 30 31  1  6  0  0  0\n 30 32  1  0  0  0  0\n 32 33  1  1  0  0  0\n 32 34  1  0  0  0  0\n 34 35  1  6  0  0  0\n 36 35  1  0  0  0  0\n 37 38  1  1  0  0  0\n 37 39  1  0  0  0  0\n 40 39  2  0  0  0  0\nM  END",
          "smiles": "C[C@H]1[C@](C=O)([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H]([C@@H]([C@H]2O)O)NC(=N)N)O)NC(=N)N)O[C@H]3[C@H]([C@@H]([C@H]([C@H](CO)O3)O)O)NC)O",
          "formula": "C21H39N7O12",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4504acf5-b145-41e8-b499-f352d8c0e3f7"
          },
          "defined_stereo": 15,
          "ez_centers": 0,
          "molecular_weight": "581.5749",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 15
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "40225123-f377-4e8d-b025-affd9876d0e1",
      "version": "45",
      "structure": {
        "id": "b2ae3070-c175-4dae-8b0c-2b5036eb6f83",
        "molfile": "\n  Marvin  01132109152D          \n\n 42 44  0  0  1  0            999 V2000\n   -0.2007   -2.3394    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.0572   -2.3016    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -0.4190   -3.1366    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.7730   -1.8826    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.4859   -3.1280    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.6256   -2.3016    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -1.6236   -2.3452    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.4859   -2.3016    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -2.3394   -1.9262    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.0572   -3.1280    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.7730   -3.5382    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -3.0493   -2.3452    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -0.9136   -1.9291    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3414   -1.8884    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6236   -3.1716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9137   -3.0785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0493   -3.1716    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -2.3394   -3.5818    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.2619   -3.5935    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.7701   -1.0591    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2017   -3.5411    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0543   -0.6488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9117   -3.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0543    0.1746    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9087   -2.3016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4277   -3.9601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3481   -1.1027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1377   -3.5411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1959   -1.8855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1435   -4.3675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3385   -3.5382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7701   -4.3617    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.7651   -1.9321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3385   -1.0562    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6275   -3.5382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.7681   -3.5790    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3481   -4.4053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0639   -4.8127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2619   -4.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0639   -0.6896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0117   -1.5421    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0572   -1.4782    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2 14  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5 11  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7 13  1  6  0  0  0\n  8  4  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12  9  1  0  0  0  0\n 13  1  1  0  0  0  0\n  6 14  1  6  0  0  0\n 15  7  1  0  0  0  0\n 16  6  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 15  1  0  0  0  0\n 19  3  1  0  0  0  0\n  4 20  1  1  0  0  0\n  5 21  1  1  0  0  0\n 22 20  1  0  0  0  0\n 23 21  1  0  0  0  0\n 24 22  2  0  0  0  0\n 25 23  2  0  0  0  0\n  3 26  1  6  0  0  0\n  9 27  1  6  0  0  0\n  3 28  1  1  0  0  0\n  8 29  1  6  0  0  0\n 30 26  2  0  0  0  0\n 10 31  1  1  0  0  0\n 11 32  1  6  0  0  0\n 12 33  1  1  0  0  0\n 34 22  1  0  0  0  0\n 35 23  1  0  0  0  0\n 17 36  1  6  0  0  0\n 18 37  1  1  0  0  0\n 38 37  1  0  0  0  0\n 19 39  1  1  0  0  0\n 40 27  1  0  0  0  0\n  1 41  1  6  0  0  0\n  2 42  1  1  0  0  0\n 19 16  1  0  0  0  0\n 12 17  1  0  0  0  0\n  8  5  1  0  0  0  0\nM  END",
        "smiles": "C[C@H]1[C@](C=O)([C@]([H])([C@@H](O1)O[C@]2([H])[C@H]([C@@H]([C@H]([C@@H]([C@H]2O)O)NC(=N)N)O)NC(=N)N)O[C@H]3[C@H]([C@@H]([C@H]([C@H](CO)O3)O)O)NC)O",
        "formula": "C21H39N7O12",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 15,
        "ez_centers": 0,
        "molecular_weight": "581.5749",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "583e78b7-9af1-4a17-85f0-2a18ed73c9a6",
          "47998718-f9b1-4318-a0cf-373db5eedd8b",
          "c5df2625-14c9-42cd-90a3-3a8cf0fa11ba"
        ],
        "stereo_centers": 15
      },
      "unii": "Y45QSO73OB",
      "relationships": [
        {
          "uuid": "f86c765a-56cb-4ef4-94fe-b6ad76eafd75",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "0d52bdc4-d42c-4223-abb7-9b8802ca5a2e",
            "refuuid": "40225123-f377-4e8d-b025-affd9876d0e1",
            "name": "STREPTOMYCIN",
            "unii": "Y45QSO73OB",
            "linking_id": "Y45QSO73OB",
            "ref_pname": "STREPTOMYCIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "89c2c0a4-62dd-4c9c-a6cc-9832a4b28a99",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "72775e3a-e4bb-4086-a42f-aab136bd8ccf",
            "refuuid": "bb0f8981-9416-4203-b1da-f45782b15cbb",
            "name": "STREPTOMYCIN HYDROCHLORIDE",
            "unii": "8P331B9592",
            "linking_id": "8P331B9592",
            "ref_pname": "STREPTOMYCIN HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8dab24ee-7878-4a17-82d7-3587f102bf07",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "7c26d0fb-42ef-4c35-8053-fad7f468514b",
            "refuuid": "194fa185-6f79-4989-b6e1-22f1d6a01b7f",
            "name": "STREPTOMYCIN PANTOTHENATE",
            "unii": "XOQ162YYFV",
            "linking_id": "XOQ162YYFV",
            "ref_pname": "STREPTOMYCIN PANTOTHENATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "19bf3e7d-e3ee-48aa-8024-7c978c81d001",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "fcfb135b-98dc-462d-b30a-ad5e9f78d8e4",
            "refuuid": "bb775d60-8608-47cf-b91b-f46c3b4a4cb3",
            "name": "STREPTOMYCIN SULFATE",
            "unii": "CW25IKJ202",
            "linking_id": "CW25IKJ202",
            "ref_pname": "STREPTOMYCIN SULFATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "11aa0c49-69e6-44d6-8b4c-0390d7f7ebcf",
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "5e889704-a204-4ab5-a72f-8efa70630dac",
            "refuuid": "5996d19d-b5e1-42d3-a96a-16b6865639c1",
            "name": "O-3-PHOSPHORYLATE",
            "unii": "39D6G5DVI6",
            "linking_id": "39D6G5DVI6",
            "ref_pname": "O-3-PHOSPHORYLATE"
          }
        },
        {
          "uuid": "dbe9b440-904b-488d-a1f3-5094c3be9571",
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "9af1363c-f785-4bc4-a762-dbfcb2803b41",
            "refuuid": "2836ba9f-6de2-41bb-8236-c59c520c6d58",
            "name": "ADENYLYLSTREPTOMYCIN",
            "unii": "UC4TD900J8",
            "linking_id": "UC4TD900J8",
            "ref_pname": "ADENYLYLSTREPTOMYCIN"
          }
        }
      ],
      "names": [
        {
          "uuid": "92bdb4f3-88ba-4827-a7e3-a1ee9e1d6264",
          "name": "NSC-14083",
          "stdName": "NSC-14083",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91f572a9-ba47-416f-9527-c3d90e34bc04"
          ],
          "display_name": false
        },
        {
          "uuid": "d0f1d69d-80be-4d52-979c-8cf4c16a6fcc",
          "name": "STREPTOMYCIN",
          "stdName": "STREPTOMYCIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "583e78b7-9af1-4a17-85f0-2a18ed73c9a6",
            "58811cc7-c1e7-4c1e-a6e7-7e5a8df0bff6",
            "6cc73c42-eb8d-4074-baeb-5322a74cf25d",
            "564b7ac8-0286-4f81-90e6-5ea01bac7b1a",
            "f45bf4d1-abe9-4c73-a87a-f81038d098e0",
            "78a2025f-2db3-4c05-9fe6-66b3978c114d",
            "9b059b07-8d7f-4d83-8a05-8dfc61226c38",
            "04591708-77e5-4bac-9154-90b604b5829c",
            "221b24bd-f94a-4a08-9dab-b4e1293fa24a",
            "da5088d9-d3fe-4216-9bb2-3b490412fcf4",
            "c5df2625-14c9-42cd-90a3-3a8cf0fa11ba",
            "5989819f-bb0b-4cdd-9a19-71d677394921",
            "8e20bf45-9368-412c-9da1-caa824099f5c",
            "696b63f6-8fc3-4876-8565-e2283836fa55",
            "5c314108-1bdf-4ada-b1b8-941336aae5c4"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "d4fe9123-bd27-42a5-84c0-8d7dd1ecc8ce",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "bc7133a6-3215-4b07-923e-906066550281",
          "name": "STREPTOMYCIN [GREEN BOOK]",
          "stdName": "STREPTOMYCIN [GREEN BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c314108-1bdf-4ada-b1b8-941336aae5c4"
          ],
          "display_name": false
        },
        {
          "uuid": "8714c8ad-cc46-46aa-ab0b-7f7edf88583f",
          "name": "STREPTOMYCIN [HSDB]",
          "stdName": "STREPTOMYCIN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6cc73c42-eb8d-4074-baeb-5322a74cf25d"
          ],
          "display_name": false
        },
        {
          "uuid": "70a37a49-4b28-44f4-bdff-02666de375cf",
          "name": "STREPTOMYCIN [MART.]",
          "stdName": "STREPTOMYCIN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "564b7ac8-0286-4f81-90e6-5ea01bac7b1a"
          ],
          "display_name": false
        },
        {
          "uuid": "c15ed74a-226f-4315-aa52-b18039585eba",
          "name": "STREPTOMYCIN [MI]",
          "stdName": "STREPTOMYCIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04591708-77e5-4bac-9154-90b604b5829c"
          ],
          "display_name": false
        },
        {
          "uuid": "6e85a48c-8e2e-458c-b308-a9b6717960b4",
          "name": "STREPTOMYCIN [VANDF]",
          "stdName": "STREPTOMYCIN [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f45bf4d1-abe9-4c73-a87a-f81038d098e0"
          ],
          "display_name": false
        },
        {
          "uuid": "8f2a278d-bcf3-94ea-8e65-689ee0be2ddd",
          "name": "Streptomycin [WHO-DD]",
          "stdName": "STREPTOMYCIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "47bc51f3-2478-c92e-dc03-79e3ebbf2f5f"
          ],
          "display_name": false
        },
        {
          "uuid": "8c62f0f4-ac34-4ba7-bac8-58ed92e72526",
          "name": "streptomycin [INN]",
          "stdName": "STREPTOMYCIN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5df2625-14c9-42cd-90a3-3a8cf0fa11ba"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "ac6c3bf4-6e3e-452c-910a-02c2f9cdcf42",
          "name": "Volume of Distribution",
          "value": {
            "uuid": "ffe0497d-7a2e-4f52-8be5-a6aca017ce45",
            "average": 0.3,
            "units": "Liters/Kilogram"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "fc7e58e0-01af-0ced-f8c6-6dfbf75dfe33"
          ]
        },
        {
          "uuid": "98b758ce-dabb-4483-a5d3-5cdb82bee70d",
          "name": "Biological Half-life",
          "value": {
            "uuid": "2e5ecf6a-1494-43c6-8c3a-74cf44aad17d",
            "high": 3,
            "low": 2,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "fc7e58e0-01af-0ced-f8c6-6dfbf75dfe33"
          ]
        }
      ]
    }
  ]
}