{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e4d7f179-3ae9-4f70-bad5-4b9224c18022",
          "code": "107584-52-1",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=107584-52-1",
          "code_system": "CAS",
          "references": [
            "ea820770-11cc-8689-9ed1-3eeb07cd2d8c"
          ]
        },
        {
          "uuid": "4ccfd71b-7621-4b62-8c7a-14de5342b86b",
          "code": "228-819-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.199",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "366c5f87-7d2d-4bca-b5a5-879ce871d41a"
          ]
        },
        {
          "uuid": "827c0b7d-6339-4a63-a55c-ea67ece7b364",
          "code": "6359-98-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6359-98-4",
          "code_system": "CAS",
          "references": [
            "ea820770-11cc-8689-9ed1-3eeb07cd2d8c"
          ]
        },
        {
          "uuid": "b1c1bd76-4491-0d24-29e8-e6cfa0332656",
          "code": "DTXSID6041719",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6041719",
          "code_system": "EPA CompTox",
          "references": [
            "06d5147d-12e4-f211-5062-28463775301b"
          ]
        },
        {
          "uuid": "c58ffc09-0996-4513-8347-51ee8b80ecc7",
          "code": "Y428W9WW4D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5b74ec06-700b-2b92-215b-914781a68f7c",
          "code": "90206",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:90206",
          "code_system": "CHEBI",
          "references": [
            "fc5391af-9f6b-64ea-061b-9f5cfac2fcf6"
          ]
        },
        {
          "uuid": "9a89d584-6308-6af9-198b-793f5e03f625",
          "code": "Yellow 2G",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Yellow_2G",
          "code_system": "WIKIPEDIA",
          "references": [
            "9a514ba0-9b15-afb4-5903-cd51aec5b3f1"
          ]
        },
        {
          "uuid": "3252f5d5-629d-97a1-3b94-d4df32c99cbb",
          "code": "324981",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=324981",
          "code_system": "NSC",
          "references": [
            "ecf2598c-9f96-55dc-7b31-3bc0da4ca613"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a18de577-86bc-4da9-9c7d-5ba922e8f248",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "ed7b79bd-143b-4c97-b867-ecd90a5f1204",
            "refuuid": "b8d46460-7b5d-4773-a879-49398331ddd9",
            "name": "ACID YELLOW 17 FREE ACID",
            "unii": "9IEP9ULI22",
            "linking_id": "9IEP9ULI22",
            "ref_pname": "ACID YELLOW 17 FREE ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6f3d5d31-8737-418c-8e8a-66c876060be8",
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "9fd014aa-ba93-4482-80ae-84a9b3a162f7",
            "refuuid": "ab1a05f6-6372-03b0-8873-f4ca658a9cac",
            "name": "ALTERNATIVE DEFINITION for [ACID YELLOW 17]",
            "linking_id": "ab1a05f6-6372-03b0-8873-f4ca658a9cac",
            "ref_pname": "NO NAME"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b941c17f-23cd-43a2-8fa4-3f7b1a8c74f6",
          "name": "ACID LEATHER YELLOW 2GL",
          "stdName": "ACID LEATHER YELLOW 2GL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "afd39b95-1493-476d-858c-fb0ee9904603",
            "ab2248e5-219c-441f-8ac9-94d072f2eb87"
          ],
          "display_name": false
        },
        {
          "uuid": "f46a5c37-4e4b-43c1-bab2-adbba278f037",
          "name": "ACID YELLOW 17",
          "stdName": "ACID YELLOW 17",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "afd39b95-1493-476d-858c-fb0ee9904603",
            "5caba6ba-6a07-46c0-808b-a6cc1c8de130"
          ],
          "display_name": true
        },
        {
          "uuid": "462e6527-1ed0-4ffe-8b2e-a34459a1c9f0",
          "name": "BENZENESULFONIC ACID, 2,5-DICHLORO-4-(4,5-DIHYDRO-3-METHYL-5-OXO-4-((4-SULFOPHENYL)AZO)-1H-PYRAZOL-1-YL)-, DISODIUM SALT",
          "stdName": "BENZENESULFONIC ACID, 2,5-DICHLORO-4-(4,5-DIHYDRO-3-METHYL-5-OXO-4-((4-SULFOPHENYL)AZO)-1H-PYRAZOL-1-YL)-, DISODIUM SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "afd39b95-1493-476d-858c-fb0ee9904603",
            "5caba6ba-6a07-46c0-808b-a6cc1c8de130"
          ],
          "display_name": false
        },
        {
          "uuid": "ce11b3b1-3b0a-452d-8e43-085d140a1fa7",
          "name": "BENZENESULFONIC ACID, 2,5-DICHLORO-4-(4,5-DIHYDRO-3-METHYL-5-OXO-4-(2-(4-SULFOPHENYL)DIAZENYL)-1H-PYRAZOL-1-YL)-, SODIUM SALT (1:2)",
          "stdName": "BENZENESULFONIC ACID, 2,5-DICHLORO-4-(4,5-DIHYDRO-3-METHYL-5-OXO-4-(2-(4-SULFOPHENYL)DIAZENYL)-1H-PYRAZOL-1-YL)-, SODIUM SALT (1:2)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "afd39b95-1493-476d-858c-fb0ee9904603",
            "5caba6ba-6a07-46c0-808b-a6cc1c8de130"
          ],
          "display_name": false
        },
        {
          "uuid": "e4f3243f-1041-44bc-99ba-8f9eb454d6cc",
          "name": "C. I. ACID YELLOW 17",
          "stdName": "C. I. ACID YELLOW 17",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "afd39b95-1493-476d-858c-fb0ee9904603",
            "5caba6ba-6a07-46c0-808b-a6cc1c8de130"
          ],
          "display_name": false
        },
        {
          "uuid": "a09f87ef-ed6e-4d05-8ce9-228bf12e66ac",
          "name": "C.I. ACID YELLOW 17",
          "stdName": "C.I. ACID YELLOW 17",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "afd39b95-1493-476d-858c-fb0ee9904603",
            "5caba6ba-6a07-46c0-808b-a6cc1c8de130"
          ],
          "display_name": false
        },
        {
          "uuid": "4475a52f-d471-4a97-8bbd-9a758eca12a9",
          "name": "C.I. ACID YELLOW 17, DISODIUM SALT",
          "stdName": "C.I. ACID YELLOW 17, DISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "afd39b95-1493-476d-858c-fb0ee9904603",
            "ab2248e5-219c-441f-8ac9-94d072f2eb87"
          ],
          "display_name": false
        },
        {
          "uuid": "b1ed7a91-1ba7-4068-a295-2ac4832b893d",
          "name": "C.I. FOOD YELLOW 5",
          "stdName": "C.I. FOOD YELLOW 5",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "afd39b95-1493-476d-858c-fb0ee9904603",
            "ab2248e5-219c-441f-8ac9-94d072f2eb87"
          ],
          "display_name": false
        },
        {
          "uuid": "10f7190b-cc19-4aba-9d69-7580d54d13fd",
          "name": "CI 13075",
          "stdName": "CI 13075",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "afd39b95-1493-476d-858c-fb0ee9904603",
            "5caba6ba-6a07-46c0-808b-a6cc1c8de130"
          ],
          "display_name": false
        },
        {
          "uuid": "68175e77-bb21-4c18-8321-c869dbdd2c69",
          "name": "CI 18965",
          "stdName": "CI 18965",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "afd39b95-1493-476d-858c-fb0ee9904603",
            "5caba6ba-6a07-46c0-808b-a6cc1c8de130"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "8904b4f2-4e14-4576-935c-45683834f2ab",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "1cbec4f7-31e4-4dc0-86e1-146788e98dcf",
          "name": "DISODIUM 2,5-DICHLORO-4-(5-HYDROXY-3-METHYL-4- (SULPHOPHENYLAZO)PYRAZOL-1-YL)BENZENESULPHONATE",
          "stdName": "DISODIUM 2,5-DICHLORO-4-(5-HYDROXY-3-METHYL-4- (SULPHOPHENYLAZO)PYRAZOL-1-YL)BENZENESULPHONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "afd39b95-1493-476d-858c-fb0ee9904603",
            "ab2248e5-219c-441f-8ac9-94d072f2eb87"
          ],
          "display_name": false
        },
        {
          "uuid": "25d7a526-1990-4218-a356-2462e5dd45af",
          "name": "KITON FAST YELLOW 2GL",
          "stdName": "KITON FAST YELLOW 2GL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "afd39b95-1493-476d-858c-fb0ee9904603",
            "ab2248e5-219c-441f-8ac9-94d072f2eb87"
          ],
          "display_name": false
        },
        {
          "uuid": "903e43e6-1d33-4abe-a0b2-e9fa15ef89dc",
          "name": "NEW LEMON EMBL",
          "stdName": "NEW LEMON EMBL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "afd39b95-1493-476d-858c-fb0ee9904603",
            "ab2248e5-219c-441f-8ac9-94d072f2eb87"
          ],
          "display_name": false
        },
        {
          "uuid": "342a6876-da7a-42c8-904d-b4f701575daf",
          "name": "NSC-324981",
          "stdName": "NSC-324981",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "afd39b95-1493-476d-858c-fb0ee9904603",
            "ab2248e5-219c-441f-8ac9-94d072f2eb87"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ea820770-11cc-8689-9ed1-3eeb07cd2d8c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5caba6ba-6a07-46c0-808b-a6cc1c8de130",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "afd39b95-1493-476d-858c-fb0ee9904603",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab2248e5-219c-441f-8ac9-94d072f2eb87",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "366c5f87-7d2d-4bca-b5a5-879ce871d41a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392811000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dada29ba-0425-41a2-aef7-542223424fa1",
          "citation": "SRS import [Y428W9WW4D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Y428W9WW4D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392811000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "06d5147d-12e4-f211-5062-28463775301b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6359-98-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7b7330d6-17dc-9283-b586-b420f5b6519e",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "9a514ba0-9b15-afb4-5903-cd51aec5b3f1",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "fc5391af-9f6b-64ea-061b-9f5cfac2fcf6",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ecf2598c-9f96-55dc-7b31-3bc0da4ca613",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bace7f87-6c73-4c66-8a80-a801032119cc",
          "id": "bace7f87-6c73-4c66-8a80-a801032119cc",
          "molfile": "\n  Marvin  01132109402D          \n\n  1  0  0  0  0  0            999 V2000\n   -0.3802   -6.8780    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "dd0f91ce-a01a-41df-80c3-d464320a8767"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "2189e4bd-acaf-438f-807e-b2180b023d6a",
          "id": "2189e4bd-acaf-438f-807e-b2180b023d6a",
          "molfile": "\n  Marvin  01132101542D          \n\n 31 33  0  0  0  0            999 V2000\n    8.4602   -7.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7808   -7.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0068   -7.5587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5191   -6.9055    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6964   -6.9055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2804   -6.1903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4623   -6.1903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0417   -5.4790    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.0417   -6.9055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4623   -7.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2804   -7.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6964   -8.3275    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.2148   -6.9055    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2148   -6.0874    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.2148   -7.7286    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3870   -6.9055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0068   -6.2306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7517   -5.4566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7808   -6.4804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4602   -6.0023    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2118   -6.3425    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8777   -5.8502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7883   -5.0405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4594   -4.5535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2194   -4.8890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2999   -5.7116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6294   -6.1903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8815   -4.4013    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4027   -3.7303    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.3552   -5.0584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5385   -3.9136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 19  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 17  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 11  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 13  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n 13 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 27  2  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 26 25  2  0  0  0  0\n 25 28  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 29  1  0  0  0  0\n 28 30  2  0  0  0  0\n 28 31  2  0  0  0  0\nM  CHG  2  14  -1  29  -1\nM  END",
          "smiles": "Cc1c(c(=O)n(-c2cc(c(cc2Cl)S(=O)(=O)[O-])Cl)[nH]1)/N=N/c3ccc(cc3)S(=O)(=O)[O-]",
          "formula": "C16H10Cl2N4O7S2",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b34ed0ed-784a-46d3-a64d-ef7a07cb580c"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "505.3119",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a874c679-2e69-4df6-8bfc-0357da13f3b7",
      "version": "15",
      "structure": {
        "id": "dd431754-e90a-4c36-bda6-85f7a960dd6c",
        "molfile": "\n  Marvin  01132111282D          \n\n 33 33  0  0  0  0            999 V2000\n   15.0358   -4.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6201   -5.6433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8016   -5.6433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3813   -4.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8016   -4.2168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6201   -4.2168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3813   -3.5058    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   12.5540   -4.9324    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5540   -4.1139    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.5540   -5.7552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7265   -4.9324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0358   -6.3546    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   15.8590   -4.9324    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3463   -5.5853    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1203   -5.3392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1203   -4.5074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3463   -4.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0915   -3.4834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7998   -4.0288    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5514   -4.3690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2174   -3.8767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1283   -3.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7991   -2.5799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.5595   -2.9154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6397   -3.7381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.9691   -4.2168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2213   -2.4277    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   20.7425   -1.7570    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   21.6954   -3.0852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8787   -1.9404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7998   -5.8267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9591   -4.9024    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    8.9591   -4.9024    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n  8 11  2  0  0  0  0\n  2 12  1  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 13 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 16 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\n 21 26  2  0  0  0  0\n 24 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 27 29  2  0  0  0  0\n 27 30  2  0  0  0  0\n 15 31  1  0  0  0  0\n  1  2  1  0  0  0  0\nM  CHG  4   9  -1  28  -1  32   1  33   1\nM  STY  1   1 MUL\nM  SAL   1  2  32  33\nM  SPA   1  1  32\nM  SDI   1  4    8.5391   -5.3224    8.5391   -4.4824\nM  SDI   1  4    9.3791   -4.4824    9.3791   -5.3224\nM  SMT   1 2\nM  END",
        "smiles": "Cc1c(c(n(-c2cc(c(cc2Cl)S(=O)(=O)[O-])Cl)n1)O)/N=N/c3ccc(cc3)S(=O)(=O)[O-].[Na+].[Na+]",
        "formula": "C16H10Cl2N4O7S2.2Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "551.2914",
        "optical_activity": "NONE",
        "references": [
          "5caba6ba-6a07-46c0-808b-a6cc1c8de130",
          "dada29ba-0425-41a2-aef7-542223424fa1"
        ],
        "stereo_centers": 0
      },
      "unii": "Y428W9WW4D"
    }
  ]
}