{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b2de61af-1abe-48d0-896f-4ab08d641fb8",
          "code": "C61653",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61653",
          "code_system": "NCI_THESAURUS",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "4937ead9-bb2e-4586-a719-c0d8a9721659",
          "code": "D017298",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68017298",
          "code_system": "MESH",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "4041ee4c-8291-49f3-bf70-92e242042812",
          "code": "NBK548471",
          "comments": "LiverTox|Cardiac|Antihypertensive|Beta blocker",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548471/",
          "code_system": "LIVERTOX",
          "references": [
            "ef4d34fe-fef4-068f-9d0f-bf81a98e7d7c"
          ]
        },
        {
          "uuid": "35d65e84-cc9f-43fb-aa10-5bc4be2d7d82",
          "code": "BISOPROLOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bisoprolol",
          "code_system": "WIKIPEDIA",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "60a157fc-56c9-4681-86b2-222a1d6a98a9",
          "code": "12.1",
          "comments": "WHO ESSENTIAL MEDICINES LIST|Cardiovascular medicines|Antianginal medicines",
          "type": "PRIMARY",
          "url": "http://prais.paho.org/medicine/213/?section=91#type527",
          "code_system": "WHO-ESSENTIAL MEDICINES LIST",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "f840b268-48dc-4ec2-812b-5e3a7b5c696a",
          "code": "12.2",
          "comments": "WHO ESSENTIAL MEDICINES LIST|Cardiovascular medicines|Antiarrhythmic medicines",
          "type": "PRIMARY",
          "url": "http://prais.paho.org/medicine/213/?section=92#type527",
          "code_system": "WHO-ESSENTIAL MEDICINES LIST",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "6cecd3d5-63df-4571-bf99-d1f067347da8",
          "code": "12.3",
          "comments": "WHO ESSENTIAL MEDICINES LIST|Cardiovascular medicines|Antihypertensive medicines",
          "type": "PRIMARY",
          "url": "http://prais.paho.org/medicine/213/?section=93#type527",
          "code_system": "WHO-ESSENTIAL MEDICINES LIST",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "2b1cd33a-ab00-477c-81ea-2a6737a65019",
          "code": "12.4",
          "comments": "WHO ESSENTIAL MEDICINES LIST|Cardiovascular medicines|Medicines used in heart failure",
          "type": "PRIMARY",
          "url": "http://prais.paho.org/medicine/213/?section=94#type527",
          "code_system": "WHO-ESSENTIAL MEDICINES LIST",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "e99d91cc-3685-480c-8801-6d2602446a75",
          "code": "C07AB57",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|BETA BLOCKING AGENTS|BETA BLOCKING AGENTS|Beta blocking agents, selective|bisoprolol, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C07AB57&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "988c39d5-022f-4133-91ea-249dc6002512",
          "code": "C07BB07",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|BETA BLOCKING AGENTS|BETA BLOCKING AGENTS AND THIAZIDES|Beta blocking agents, selective, and thiazides|bisoprolol and thiazides",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C07BB07&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "821fe510-6549-4f06-91f8-654c7475e644",
          "code": "C07FB07",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|BETA BLOCKING AGENTS|BETA BLOCKING AGENTS AND OTHER ANTIHYPERTENSIVES|Beta blocking agents, selective, and other antihypertensives|bisoprolol and other antihypertensives",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C07FB07&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "7dbccdc0-6414-48ae-a0e1-c8abde3f0b87",
          "code": "QC07AB57",
          "comments": "VATC|BETA BLOCKING AGENTS|BETA BLOCKING AGENTS|Beta blocking agents, selective|bisoprolol, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC07AB57&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "b3857651-1133-4b4e-8622-58a39fa92535",
          "code": "QC07AB07",
          "comments": "VATC|BETA BLOCKING AGENTS|BETA BLOCKING AGENTS|Beta blocking agents, selective|bisoprolol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC07AB07&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "85703eac-9a16-44f5-9cc8-ac565d5ea197",
          "code": "5225",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5225",
          "code_system": "INN",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "9a053b6f-4b7e-4e62-9074-b7bdbd8b947a",
          "code": "7129",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7129",
          "code_system": "IUPHAR",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "aa1c5501-feaa-4452-b361-2fa2c06099cb",
          "code": "m2565",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2565?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "3d7c3f15-f4ef-4c05-90c2-9e49e2791932",
          "code": "19484",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/19484/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "83baf8e6-140b-499e-b13d-68be5351bc35",
          "code": "DB00612",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00612",
          "code_system": "DRUG BANK",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "de94c9eb-2d5f-48db-a476-fa9ac7b5de20",
          "code": "C07AB07",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|BETA BLOCKING AGENTS|BETA BLOCKING AGENTS|Beta blocking agents, selective|bisoprolol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C07AB07&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "54cf6177-3f14-4035-a88d-8455ddafd3b8",
          "code": "N0000175556",
          "comments": "Established Pharmacologic Class [EPC]|beta-Adrenergic Blocker [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175556",
          "code_system": "NDF-RT",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "8f3b9844-083f-4821-8a6e-1c11d2e56047",
          "code": "N0000000161",
          "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|G-Protein-linked Receptor Interactions [MoA]|Adrenergic Receptor Interactions [MoA]|Adrenergic Antagonists [MoA]|Adrenergic beta-Antagonists [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000161",
          "code_system": "NDF-RT",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "f5319ce5-c093-4120-adc8-56617b885427",
          "code": "QC07FB07",
          "comments": "VATC|BETA BLOCKING AGENTS|BETA BLOCKING AGENTS AND OTHER ANTIHYPERTENSIVES|Beta blocking agents, selective,  and other antihypertensives|bisoprolol and other antihypertensives",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC07FB07&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "13fff296-fa22-4771-8cab-0cef570e9b16",
          "code": "QC07BB07",
          "comments": "VATC|BETA BLOCKING AGENTS|BETA BLOCKING AGENTS AND THIAZIDES|Beta blocking agents, selective, and thiazides|bisoprolol and thiazides",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC07BB07&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "51f84955-9cef-4f97-bd2d-68492a77e1ff",
          "code": "66722-44-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=66722-44-9",
          "code_system": "CAS",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1",
            "9e7e16ff-3e4f-4ad7-9619-e0fb6205c36e"
          ]
        },
        {
          "uuid": "0da43d5e-b573-4924-a1d7-46cc0b7946bb",
          "code": "SUB13096MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "b46c603c-86dd-4f8c-9445-3cca4186f788",
          "code": "CHEMBL645",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL645",
          "code_system": "ChEMBL",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "4f4f9f73-2930-4988-909a-2cb037bd48df",
          "code": "C09BX02",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|AGENTS ACTING ON THE RENIN-ANGIOTENSIN SYSTEM|ACE INHIBITORS, COMBINATIONS|ACE inhibitors, other combinations|perindopril and bisoprolol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C09BX02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "680b9a61-9f39-41d0-b20f-9c657aadd7d0",
          "code": "2405",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2405",
          "code_system": "PUBCHEM",
          "references": [
            "bf5d25e8-3928-4e61-9fb8-51d0420261f1"
          ]
        },
        {
          "uuid": "8f2ab574-c1a7-d358-a7f0-e6e6f6d40588",
          "code": "8316",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/8316",
          "code_system": "HSDB",
          "references": [
            "c2b04c55-a637-ba29-0eb8-ae1cb6181714"
          ]
        },
        {
          "uuid": "a76d3134-3a0f-06ed-0927-106abe17db41",
          "code": "DTXSID6022682",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6022682",
          "code_system": "EPA CompTox",
          "references": [
            "bf848636-04f1-5eb6-4763-ccf7635f7082"
          ]
        },
        {
          "uuid": "83f27c5b-6ecb-3c57-4f9b-3c97cbbcb786",
          "code": "C07FX04",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|BETA BLOCKING AGENTS|BETA BLOCKING AGENTS, OTHER COMBINATIONS|Beta blocking agents, other combinations|bisoprolol and acetylsalicylic acid",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C07FX04&showdescription=yes",
          "code_system": "WHO-ATC"
        },
        {
          "uuid": "157aed86-7a40-154f-9bdb-441a9487a8bb",
          "code": "C29576",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Adrenergic Agent[C29747]|Adrenergic Antagonist[C72900]|Beta-Adrenergic Antagonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29576",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ef4d34fe-fef4-068f-9d0f-bf81a98e7d7c"
          ]
        },
        {
          "uuid": "1263f83f-364d-4552-817a-0ed2f96eaebe",
          "code": "Y41JS2NL6U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "65a709fc-2448-6f76-dd10-a400c87b711a",
          "code": "Bisoprolol",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM285/",
          "code_system": "LACTMED",
          "references": [
            "ef4d34fe-fef4-068f-9d0f-bf81a98e7d7c"
          ]
        },
        {
          "uuid": "ccccde5d-da8a-4f63-1b55-25efe5bd6a60",
          "code": "380",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/380",
          "code_system": "DRUG CENTRAL",
          "references": [
            "ef4d34fe-fef4-068f-9d0f-bf81a98e7d7c"
          ]
        },
        {
          "uuid": "2b67d921-c277-6371-ec7a-cdd47fcd52f7",
          "code": "3127",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3127",
          "code_system": "CHEBI",
          "references": [
            "ef4d34fe-fef4-068f-9d0f-bf81a98e7d7c"
          ]
        },
        {
          "uuid": "2bc62306-219b-4696-e93c-cfd5e04e7adf",
          "code": "Y-69",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/Y-69/relevant/1/",
          "code_system": "USAN",
          "references": [
            "39402ee2-fb30-7551-8453-2fff61ca94e1"
          ]
        },
        {
          "uuid": "247ef9c9-8e9c-f3c7-0835-8dadf5b82a08",
          "code": "Y41JS2NL6U",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Y41JS2NL6U",
          "code_system": "DAILYMED",
          "references": [
            "aa00600d-c94c-d92f-af7e-f37f39e30046"
          ]
        },
        {
          "uuid": "0a74932c-7de8-3d38-7841-1f071ea42a92",
          "code": "100000092277",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f65264da-fa95-8a0b-08a7-bd832545b816"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "c02f7c10-233a-4055-883e-567bfa0ff779",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0d134445-6e67-4a7c-a2d2-d5f4e0a9242a",
          "citation": "INN Proposed List 48",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL48.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bb7062b9-4b23-42fc-8bfe-e65bc5b3856a",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ced49e2e-7278-48da-92e3-dc7e7a5a956e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c06d4731-b8f6-4578-8252-2d80e51f3124",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "969e080c-7776-489f-aafa-cf445a78bad9",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf5d25e8-3928-4e61-9fb8-51d0420261f1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390981000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c367da71-ef7e-44d2-877a-16c3783dfa48",
          "citation": "JOURNAL OF PHARMACEUTICAL SCIENCES, VOLUME 87, ISSUE 3, PAGES 289?294, MARCH 1998",
          "url": "http://onlinelibrary.wiley.com/doi/10.1021/js970316d/abstract",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4637bf0-aaf2-4405-a774-8fc237b6a63f",
          "citation": "J CARDIOVASC PHARMACOL. VOL. 8, SUPPL. II, 1986",
          "url": "http://journals.lww.com/cardiovascularpharm/Abstract/1986/11001/Pharmacokinetics_and_Metabolism_of_Bisoprolol_14C.4.aspx",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d2bd611-84ed-457d-91de-22ee9ae66fcc",
          "citation": "JOURNAL OF PHARMACEUTICAL SCIENCES, VOLUME 87, ISSUE 3, PAGES 289?294, MARCH 1998",
          "url": "http://onlinelibrary.wiley.com/doi/10.1021/js970316d/epdf",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "690fa3f0-28c8-43a1-9579-8909167ae333",
          "citation": "SRS import [Y41JS2NL6U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Y41JS2NL6U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390981000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b021892e-59e7-484a-a9e4-1ecac750e1ee",
          "citation": "USP Dictionary 2010; INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "568ab7c3-ab46-493d-b92b-2387b050f419",
          "citation": "BISOPROLOL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3441405c-baaf-4eeb-8de9-5f492414ed9e",
          "citation": "BISOPROLOL [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ff0cefbe-ec30-4ec2-92d1-6dca47f2f3a9",
          "citation": "BISOPROLOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4fa1ee51-24fa-45ec-982d-4622e489da88",
          "citation": "BISOPROLOL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ed8658f5-3359-4a22-83f7-4a49a6e396d8",
          "citation": "BISOPROLOL [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "89d6d13e-6a1b-a985-4c9c-cfb98a11ebd8",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c2b04c55-a637-ba29-0eb8-ae1cb6181714",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+66722-44-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bf848636-04f1-5eb6-4763-ccf7635f7082",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=66722-44-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d1a93484-e944-7da3-652c-d018b0414bdf",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+66722-44-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3a2e1320-ea06-bb03-cf5c-8fbed1a57ab1",
          "citation": "http://fco.factsandcomparisons.com/lco/action/doc/retrieve/docid/fc_dfc/5548783#f_pharmacokinetics",
          "doc_type": "LEPINDEX",
          "public_domain": true
        },
        {
          "uuid": "ef4d34fe-fef4-068f-9d0f-bf81a98e7d7c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9e7e16ff-3e4f-4ad7-9619-e0fb6205c36e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "39402ee2-fb30-7551-8453-2fff61ca94e1",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "aa00600d-c94c-d92f-af7e-f37f39e30046",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "1e065328-41a6-2c9f-6740-1f7bccec483f",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f65264da-fa95-8a0b-08a7-bd832545b816",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "73f4d379-ecc6-4e44-9dbf-3e16b1dad684",
          "id": "73f4d379-ecc6-4e44-9dbf-3e16b1dad684",
          "molfile": "\n  Marvin  01132106012D          \n\n 23 23  0  0  0  0            999 V2000\n   -1.1872   -0.1113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1995   -0.8780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5812   -1.3356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9539   -1.3645    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7619   -0.7915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5039   -1.3108    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -3.5244   -2.0941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.2788   -0.8780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0084   -1.2161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0084   -1.8715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3035   -2.2919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3035   -3.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0084   -3.5244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0084   -4.1716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3200   -4.6498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4873   -4.1345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7577   -4.7281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9086   -4.1716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1872   -4.6910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2844   -4.1716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1872   -5.4207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.7380   -3.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.7380   -2.2919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 23 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 22  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 19  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "CC(C)NCC(COc1ccc(cc1)COCCOC(C)C)O",
          "formula": "C18H31NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2fb707a1-f62b-4a3e-aa02-89d9dd5e967d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "325.4437",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "826d7272-7f6b-4562-ba9f-8aa66bf32b37",
      "version": "27",
      "structure": {
        "id": "d99e87dd-af0f-4784-a135-8f86c66312ca",
        "molfile": "\n  Marvin  01132111172D          \n\n 23 23  0  0  0  0            999 V2000\n   -1.9539   -1.3645    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0084   -1.2161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5039   -1.3108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0084   -1.8715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7619   -0.7915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.2788   -0.8780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0084   -3.5244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3035   -2.2919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.7380   -2.2919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3035   -3.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.7380   -3.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5244   -2.0941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9086   -4.1716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1995   -0.8780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3200   -4.6498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0084   -4.1716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1872   -4.6910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7577   -4.7281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4873   -4.1345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1872   -0.1113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5812   -1.3356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2844   -4.1716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1872   -5.4207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  6  1  0  0  0  0\n  3  5  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7 11  1  0  0  0  0\n  8  4  2  0  0  0  0\n  9  4  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11  9  2  0  0  0  0\n  3 12  1  0  0  0  0\n 13 18  1  0  0  0  0\n 14  1  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16  7  1  0  0  0  0\n 17 13  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 15  1  0  0  0  0\n 20 14  1  0  0  0  0\n 21 14  1  0  0  0  0\n 22 17  1  0  0  0  0\n 23 17  1  0  0  0  0\n 10  7  2  0  0  0  0\nM  END",
        "smiles": "CC(C)NCC(COc1ccc(cc1)COCCOC(C)C)O",
        "formula": "C18H31NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "325.4437",
        "optical_activity": "( + / - )",
        "references": [
          "690fa3f0-28c8-43a1-9579-8909167ae333",
          "b021892e-59e7-484a-a9e4-1ecac750e1ee",
          "0d134445-6e67-4a7c-a2d2-d5f4e0a9242a"
        ],
        "stereo_centers": 1
      },
      "unii": "Y41JS2NL6U",
      "relationships": [
        {
          "uuid": "dd7b7a67-c74f-46de-a611-7eafd4e6d259",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "825d1926-cdab-44c6-a2f3-c55c3cd38954",
            "refuuid": "826d7272-7f6b-4562-ba9f-8aa66bf32b37",
            "name": "BISOPROLOL",
            "unii": "Y41JS2NL6U",
            "linking_id": "Y41JS2NL6U",
            "ref_pname": "BISOPROLOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6dbf36b7-e8f4-4075-870e-134fb1998ed8",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "124f0b9f-2198-4f95-8714-c5b9eb9ba730",
            "refuuid": "891236b4-2901-4571-af2e-c0211ab748eb",
            "name": "BISOPROLOL FUMARATE",
            "unii": "UR59KN573L",
            "linking_id": "UR59KN573L",
            "ref_pname": "BISOPROLOL FUMARATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f672a5a0-1053-4666-b4b7-fbb00b30718b",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "99ebd51e-4676-4440-a7d7-87059a1730cd",
            "refuuid": "d6d8c7b7-e699-4c61-83c1-d7f1dcfb49c1",
            "name": "BISOPROLOL HYDROCHLORIDE",
            "unii": "2EX58570NP",
            "linking_id": "2EX58570NP",
            "ref_pname": "BISOPROLOL HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8dd9f036-17c0-4e05-80c3-994982c0529a",
          "comments": "The AUC and elimination half-life of (S)-(-)-bisoprolol were slightly larger than those of (R)-(+)-bisoprolol. In vitro: stereoselectively of CYP2D6 (R > S) and CYP3A4 was not stereoselective.",
          "type": "METABOLITE->PARENT",
          "interaction_type": "IN-VITRO",
          "references": [
            "c367da71-ef7e-44d2-877a-16c3783dfa48"
          ],
          "related_substance": {
            "uuid": "3a332096-2326-48ce-9591-00da0167835b",
            "refuuid": "1aad1589-4896-47e2-a3cd-bbf1fa2787d7",
            "name": "O-(DESISOPROPYL) BISOPROLOL ACID",
            "unii": "9B44647H2S",
            "linking_id": "9B44647H2S",
            "ref_pname": "O-(DESISOPROPYL) BISOPROLOL ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1b10bcb7-dd7d-48a0-86df-6376835bb65f",
          "qualification": "PLASMA; URINE",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "d4637bf0-aaf2-4405-a774-8fc237b6a63f"
          ],
          "related_substance": {
            "uuid": "8a9c0951-b9b7-40da-9238-fe9cd4e7885a",
            "refuuid": "1aad1589-4896-47e2-a3cd-bbf1fa2787d7",
            "name": "O-(DESISOPROPYL) BISOPROLOL ACID",
            "unii": "9B44647H2S",
            "linking_id": "9B44647H2S",
            "ref_pname": "O-(DESISOPROPYL) BISOPROLOL ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1d04b3de-ba7d-4b43-9dac-59d302e588e1",
          "comments": "The AUC and elimination half-life of (S)-(-)-bisoprolol were slightly larger than those of (R)-(+)-bisoprolol. In vitro: stereoselectively of CYP2D6 (R > S) and CYP3A4 was not stereoselective.",
          "type": "METABOLITE->PARENT",
          "interaction_type": "IN-VITRO",
          "references": [
            "c367da71-ef7e-44d2-877a-16c3783dfa48"
          ],
          "related_substance": {
            "uuid": "132cd46c-998e-4923-85c6-3c5ca6d7f1a8",
            "refuuid": "55f412ec-cc41-439d-9678-0081a6470e8f",
            "name": "O-(DESISOPROPYL)-O-(1-CARBOXYETHYL) BISOPROLOL",
            "unii": "4ANX22838L",
            "linking_id": "4ANX22838L",
            "ref_pname": "O-(DESISOPROPYL)-O-(1-CARBOXYETHYL) BISOPROLOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5eacb4ea-2e72-4fed-8459-861f173a9bb9",
          "qualification": "PLASMA; URINE",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MINOR",
          "references": [
            "d4637bf0-aaf2-4405-a774-8fc237b6a63f"
          ],
          "related_substance": {
            "uuid": "298b71f7-587b-4cfa-b679-32bdad99857e",
            "refuuid": "55f412ec-cc41-439d-9678-0081a6470e8f",
            "name": "O-(DESISOPROPYL)-O-(1-CARBOXYETHYL) BISOPROLOL",
            "unii": "4ANX22838L",
            "linking_id": "4ANX22838L",
            "ref_pname": "O-(DESISOPROPYL)-O-(1-CARBOXYETHYL) BISOPROLOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "eb7051c8-98e3-4310-ba3c-dbde3b250f83",
          "comments": "The AUC and elimination half-life of (S)-(-)-bisoprolol were slightly larger than those of (R)-(+)-bisoprolol. In vitro: stereoselectively of CYP2D6 (R > S) and CYP3A4 was not stereoselective.",
          "type": "METABOLITE->PARENT",
          "interaction_type": "IN-VITRO",
          "references": [
            "8d2bd611-84ed-457d-91de-22ee9ae66fcc"
          ],
          "related_substance": {
            "uuid": "55b0d122-12c5-4e73-a5a0-84079f17d9ed",
            "refuuid": "59a2c30b-55c1-4aab-b7ad-35fe9c3c50dd",
            "name": "4-(2-HYDROXY-3-((1-METHYLETHYL)AMINO)PROPOXY)BENZOIC ACID",
            "unii": "AS7314B2NH",
            "linking_id": "AS7314B2NH",
            "ref_pname": "4-(2-HYDROXY-3-((1-METHYLETHYL)AMINO)PROPOXY)BENZOIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3b7ce458-e7fa-4a4f-b7b0-88b1aba8551b",
          "qualification": "PLASMA; URINE",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MINOR",
          "references": [
            "d4637bf0-aaf2-4405-a774-8fc237b6a63f"
          ],
          "related_substance": {
            "uuid": "076f1c55-5001-44a9-bffd-54e85d06a4bc",
            "refuuid": "59a2c30b-55c1-4aab-b7ad-35fe9c3c50dd",
            "name": "4-(2-HYDROXY-3-((1-METHYLETHYL)AMINO)PROPOXY)BENZOIC ACID",
            "unii": "AS7314B2NH",
            "linking_id": "AS7314B2NH",
            "ref_pname": "4-(2-HYDROXY-3-((1-METHYLETHYL)AMINO)PROPOXY)BENZOIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "478f1b90-3b47-4e1d-abc8-dd501e7c529b",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "a119a586-2292-49d3-bbf7-7a05b4fd1dde",
            "refuuid": "a93c6adf-af3f-4d96-bd93-88b37f35f877",
            "name": "BISOPROLOL MONOFUMARATE",
            "unii": "U057CX04H0",
            "linking_id": "U057CX04H0",
            "ref_pname": "BISOPROLOL MONOFUMARATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0f519dbc-43e0-4f15-821b-daf41d8b0961",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "efb68906-c32a-4633-ad6c-836b320a9973",
            "refuuid": "a42765ec-1901-4f22-9cca-0bbc52819e46",
            "name": "BISOPROLOL, (R)-",
            "unii": "L68D148Q8N",
            "linking_id": "L68D148Q8N",
            "ref_pname": "BISOPROLOL, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "32622ecb-15e3-4894-9649-9a16d08ff3a3",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "225860a7-13ce-4a3b-bb8f-40a432a957fe",
            "refuuid": "878756d4-f58e-49cc-997e-4b8929a42b2c",
            "name": "BISOPROLOL, (S)-",
            "unii": "N0P2X2L8U0",
            "linking_id": "N0P2X2L8U0",
            "ref_pname": "BISOPROLOL, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4a7e4967-36ad-4dee-b4fc-5e82ee87805b",
          "amount": {
            "uuid": "34d90ed1-9122-4cba-b362-ad3e5957f350",
            "average": 30,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "interaction_type": "BINDING",
          "references": [
            "3a2e1320-ea06-bb03-cf5c-8fbed1a57ab1"
          ],
          "related_substance": {
            "uuid": "3824d050-0b9a-4848-87ce-044f9676da8b",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "954e95d6-529b-42db-a2da-a86d546a71a6",
          "name": "(±)-1-((.ALPHA.-(2-ISOPROPOXYETHOXY)-P-TOLYL)OXY)-3-(ISOPROPYLAMINO)-2-PROPANOL",
          "stdName": "(+/-)-1-((.ALPHA.-(2-ISOPROPOXYETHOXY)-P-TOLYL)OXY)-3-(ISOPROPYLAMINO)-2-PROPANOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c02f7c10-233a-4055-883e-567bfa0ff779"
          ],
          "display_name": false
        },
        {
          "uuid": "6fb0ff26-fcb2-43b5-9789-c51007dbbd9b",
          "name": "2-PROPANOL, 1-(4-((2-(1-METHYLETHOXY)ETHOXY)METHYL)PHENOXY)-3-((1-METHYLETHYL)AMINO)-, (±)-",
          "stdName": "2-PROPANOL, 1-(4-((2-(1-METHYLETHOXY)ETHOXY)METHYL)PHENOXY)-3-((1-METHYLETHYL)AMINO)-, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c02f7c10-233a-4055-883e-567bfa0ff779"
          ],
          "display_name": false
        },
        {
          "uuid": "8ae6c369-8003-48a7-abfe-582f5708d4dc",
          "name": "BISOPROLOL",
          "stdName": "BISOPROLOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb7062b9-4b23-42fc-8bfe-e65bc5b3856a",
            "c02f7c10-233a-4055-883e-567bfa0ff779",
            "ed8658f5-3359-4a22-83f7-4a49a6e396d8",
            "4fa1ee51-24fa-45ec-982d-4622e489da88",
            "c06d4731-b8f6-4578-8252-2d80e51f3124",
            "0d134445-6e67-4a7c-a2d2-d5f4e0a9242a",
            "ff0cefbe-ec30-4ec2-92d1-6dca47f2f3a9",
            "ced49e2e-7278-48da-92e3-dc7e7a5a956e",
            "969e080c-7776-489f-aafa-cf445a78bad9",
            "568ab7c3-ab46-493d-b92b-2387b050f419",
            "3441405c-baaf-4eeb-8de9-5f492414ed9e"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "0a2b1339-24e7-4830-bdc5-a63525a849e1",
              "name_org": "INN"
            },
            {
              "uuid": "18f66fdf-2b87-4798-9d51-856c50ddf39e",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "a0316d58-2ce3-44ed-a982-f4ffb1c334e1",
          "name": "BISOPROLOL [JAN]",
          "stdName": "BISOPROLOL [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89d6d13e-6a1b-a985-4c9c-cfb98a11ebd8"
          ],
          "display_name": false
        },
        {
          "uuid": "5da1e885-af64-4435-816d-2b0cd5c1e82b",
          "name": "BISOPROLOL [MI]",
          "stdName": "BISOPROLOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ced49e2e-7278-48da-92e3-dc7e7a5a956e"
          ],
          "display_name": false
        },
        {
          "uuid": "382fa4c6-be52-430d-9e43-e17235b38bcf",
          "name": "BISOPROLOL [USAN]",
          "stdName": "BISOPROLOL [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb7062b9-4b23-42fc-8bfe-e65bc5b3856a"
          ],
          "display_name": false
        },
        {
          "uuid": "48c3f630-d35d-4ba2-b725-594197166ca2",
          "name": "BISOPROLOL [VANDF]",
          "stdName": "BISOPROLOL [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "969e080c-7776-489f-aafa-cf445a78bad9"
          ],
          "display_name": false
        },
        {
          "uuid": "f46bce22-ca29-c7b9-b8b8-9e219ebf85ea",
          "name": "Bisoprolol [WHO-DD]",
          "stdName": "BISOPROLOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e065328-41a6-2c9f-6740-1f7bccec483f"
          ],
          "display_name": false
        },
        {
          "uuid": "9f835cb3-b266-4a1b-9694-ca73e6f276f7",
          "name": "EMD 33 512",
          "stdName": "EMD 33 512",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c02f7c10-233a-4055-883e-567bfa0ff779"
          ],
          "display_name": false
        },
        {
          "uuid": "d5a38114-6bfc-4c09-921e-27c181c2de14",
          "name": "bisoprolol [INN]",
          "stdName": "BISOPROLOL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0d134445-6e67-4a7c-a2d2-d5f4e0a9242a"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "d207b13c-8bda-42cb-ae79-f22cda92b5f7",
          "name": "Biological Half-life",
          "value": {
            "uuid": "dfa520c5-05bc-478e-888a-67ad685fb884",
            "high": 12,
            "low": 9,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "3a2e1320-ea06-bb03-cf5c-8fbed1a57ab1"
          ]
        }
      ]
    }
  ]
}