{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "986b6696-5a7a-4414-bf75-5154329a2609",
          "code": "71799-92-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=71799-92-3",
          "code_system": "CAS",
          "references": [
            "38bae773-1d68-41cd-9725-f35723b973f4",
            "5057c21a-1f51-43f1-97e5-9ab44e57ee44"
          ]
        },
        {
          "uuid": "ec7bae7c-5a80-4527-9e81-0ac0b44c26d1",
          "code": "14420749",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14420749",
          "code_system": "PUBCHEM",
          "references": [
            "38bae773-1d68-41cd-9725-f35723b973f4"
          ]
        },
        {
          "uuid": "2d8e5617-4837-988a-b19c-bd453284780c",
          "code": "DTXSID40222047",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40222047",
          "code_system": "EPA CompTox",
          "references": [
            "0134df29-9f82-9a0f-650d-0cfc70bfcde4"
          ]
        },
        {
          "uuid": "9c120892-5d34-4d92-b7bd-5948f9c91f61",
          "code": "Y40668X7G6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f672bcd7-a4e2-4a70-b021-6a6c1e9df524",
          "name": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, MANGANESE(2+) SALT (1:1)",
          "stdName": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, MANGANESE(2+) SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7b6268a-4d8c-413c-9372-2dc3ec4eea0a"
          ],
          "display_name": false
        },
        {
          "uuid": "19315171-186c-4f94-83f6-5f10f45290b0",
          "name": "MANGANESE (II) CITRATE",
          "stdName": "MANGANESE (II) CITRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "132dbe3b-d45e-4c84-9597-14ae8cd982a7"
          ],
          "display_name": false
        },
        {
          "uuid": "c73eb1ce-144f-4ead-92e9-db7dc14df58e",
          "name": "MANGANESE HYDROGEN CITRATE",
          "stdName": "MANGANESE HYDROGEN CITRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1812b460-9121-4745-b8db-e32e8bebb64a"
          ],
          "display_name": true
        },
        {
          "uuid": "77a43de7-70b5-4635-8b90-94fdbec9f403",
          "name": "MONOMANGANESE(II) CITRATE",
          "stdName": "MONOMANGANESE(II) CITRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7b6268a-4d8c-413c-9372-2dc3ec4eea0a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1812b460-9121-4745-b8db-e32e8bebb64a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e7b6268a-4d8c-413c-9372-2dc3ec4eea0a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "132dbe3b-d45e-4c84-9597-14ae8cd982a7",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38bae773-1d68-41cd-9725-f35723b973f4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391745000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "76035f1f-ec22-422c-97d6-caff90d6a362",
          "citation": "SRS import [Y40668X7G6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Y40668X7G6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391745000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0134df29-9f82-9a0f-650d-0cfc70bfcde4",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=71799-92-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5057c21a-1f51-43f1-97e5-9ab44e57ee44",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a4573ec3-4d62-4aed-999b-31853f347892",
          "id": "a4573ec3-4d62-4aed-999b-31853f347892",
          "molfile": "\n  Marvin  01132108322D          \n\n  1  0  0  0  0  0            999 V2000\n   10.1670   -4.0529    0.0000 Mn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Mn+2]",
          "formula": "Mn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cbcfc307-ae8d-43f9-9ea0-9528f5ef7e2c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "54.938",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "07154b6c-9a56-4f7d-845b-f768250b5f12",
          "id": "07154b6c-9a56-4f7d-845b-f768250b5f12",
          "molfile": "\n  Marvin  01132100392D          \n\n 13 12  0  0  0  0            999 V2000\n    5.1803   -4.8642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8998   -4.4608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6102   -4.8733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8998   -3.6404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8998   -2.8154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1895   -4.0529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4745   -3.6404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7595   -4.0529    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.4745   -2.8154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6148   -4.0529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3298   -3.6404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0403   -4.0529    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.3298   -2.8154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  4 10  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\nM  CHG  2   8  -1  12  -1\nM  END",
          "smiles": "C(C(=O)[O-])C(CC(=O)[O-])(C(=O)O)O",
          "formula": "C6H6O7",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "63c2ecd5-8832-47f2-8d82-531bb7281480"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "190.1079",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7be3f3ce-6fc0-43a3-ade5-076381c39ce5",
      "version": "3",
      "structure": {
        "id": "cef3a18a-570b-4ef7-9f81-7206ed181b09",
        "molfile": "\n  Marvin  01132110412D          \n\n 14 12  0  0  0  0            999 V2000\n   10.1670   -4.0529    0.0000 Mn  0  2  0  0  0  0  0  0  0  0  0  0\n    3.7595   -4.0529    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.4745   -3.6404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1895   -4.0529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8998   -3.6404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6148   -4.0529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3298   -3.6404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0403   -4.0529    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.3298   -2.8154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8998   -2.8154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8998   -4.4608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1803   -4.8642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6102   -4.8733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4745   -2.8154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  5 10  1  0  0  0  0\n  5 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n  3 14  2  0  0  0  0\nM  CHG  3   1   2   2  -1   8  -1\nM  END",
        "smiles": "C(C(=O)[O-])C(CC(=O)[O-])(C(=O)O)O.[Mn+2]",
        "formula": "C6H6O7.Mn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "245.0459",
        "optical_activity": "NONE",
        "references": [
          "e7b6268a-4d8c-413c-9372-2dc3ec4eea0a",
          "76035f1f-ec22-422c-97d6-caff90d6a362"
        ],
        "stereo_centers": 0
      },
      "unii": "Y40668X7G6"
    }
  ]
}