{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1b053faa-f1e8-4798-97e3-6246f844b817", "code": "13497-18-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=13497-18-2", "code_system": "CAS", "references": [ "3b9d832d-2faa-4e3c-a72e-e1f30bc50314", "a5569267-e17c-4375-8e20-cc15ecb62351" ] }, { "uuid": "546c2b08-1de1-48b0-a61b-8709099ab38d", "code": "236-818-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.033.456", "code_system": "ECHA (EC/EINECS)", "references": [ "3b9d832d-2faa-4e3c-a72e-e1f30bc50314" ] }, { "uuid": "d62416b6-17ca-495d-b16d-bbf2afab5257", "code": "83535", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/83535", "code_system": "PUBCHEM", "references": [ "3b9d832d-2faa-4e3c-a72e-e1f30bc50314" ] }, { "uuid": "68860efc-973b-a712-aabc-c80d10709260", "code": "DTXSID5065512", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5065512", "code_system": "EPA CompTox", "references": [ "10181c96-1898-612a-9b38-bc06e80aadf8" ] }, { "uuid": "18f48f57-9a70-4fd0-a438-1f32008f221f", "code": "Y34QW2E5AM", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "a698f7a8-5b63-45f3-b515-0556dbf90808", "name": "1-PROPANAMINE, 3-(TRIETHOXYSILYL)-N-(3-(TRIETHOXYSILYL)PROPYL)-", "stdName": "1-PROPANAMINE, 3-(TRIETHOXYSILYL)-N-(3-(TRIETHOXYSILYL)PROPYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7b0c837e-3ff7-40cc-a170-c0b67957b430", "352b18ec-36f0-4c65-b163-f62da0314357" ], "display_name": false }, { "uuid": "1bb10c49-792d-0bf3-5ee6-3d86a8e44e28", "name": "3-TRIETHOXYSILYL-N-(3-TRIETHOXYSILYLPROPYL)-1-PROPANAMINE", "stdName": "3-TRIETHOXYSILYL-N-(3-TRIETHOXYSILYLPROPYL)-1-PROPANAMINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a5885333-6b2c-d4fb-efce-672d8fd10ffe" ], "display_name": false }, { "uuid": "92b166dc-a6a7-24ce-c29c-4d2ba803eb7a", "name": "4,4,12,12-TETRAETHOXY-3,13-DIOXA-8-AZA-4,12-DISILAPENTADECANE", "stdName": "4,4,12,12-TETRAETHOXY-3,13-DIOXA-8-AZA-4,12-DISILAPENTADECANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a5885333-6b2c-d4fb-efce-672d8fd10ffe" ], "display_name": false }, { "uuid": "fffcb62c-c5a6-acea-b073-fcbf5f55c172", "name": "BIS(3-(TRIETHOXYSILYL)PROPYL)AMINE", "stdName": "BIS(3-(TRIETHOXYSILYL)PROPYL)AMINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a5885333-6b2c-d4fb-efce-672d8fd10ffe" ], "display_name": false }, { "uuid": "a47b9e03-69af-6c71-61ec-d2be139bc2bf", "name": "BIS(TRIETHOXYSILYL)PROPYLAMINE", "stdName": "BIS(TRIETHOXYSILYL)PROPYLAMINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a5885333-6b2c-d4fb-efce-672d8fd10ffe" ], "display_name": true }, { "uuid": "54afd5e0-26f7-ba35-ecd1-a899dbf20a1f", "name": "SI 252", "stdName": "SI 252", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a5885333-6b2c-d4fb-efce-672d8fd10ffe" ], "display_name": false } ], "references": [ { "uuid": "7b0c837e-3ff7-40cc-a170-c0b67957b430", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "352b18ec-36f0-4c65-b163-f62da0314357", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3b9d832d-2faa-4e3c-a72e-e1f30bc50314", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393761000, "tags": [ "NOMEN" ] }, { "uuid": "10181c96-1898-612a-9b38-bc06e80aadf8", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=13497-18-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a5885333-6b2c-d4fb-efce-672d8fd10ffe", "citation": "stn", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a5569267-e17c-4375-8e20-cc15ecb62351", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "9e1ccded-ffec-4982-92be-b975e53dbad5", "id": "9e1ccded-ffec-4982-92be-b975e53dbad5", "molfile": "\n Marvin 01132108132D \n\n 27 26 0 0 0 0 999 V2000\n 1.4456 -3.0568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1703 -3.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1846 -4.2911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9093 -4.7005 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6377 -5.1120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3517 -4.6987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0764 -5.1081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7903 -4.6948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5186 -5.1063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2306 -4.6966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9553 -5.1060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6692 -4.6927 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3832 -4.2793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3667 -3.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0807 -3.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2558 -3.9787 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6674 -3.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2556 -2.5421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0825 -5.4067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9038 -5.3902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3171 -6.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3208 -3.9721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9111 -3.2603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3206 -2.5356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4999 -5.4252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6787 -5.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2692 -6.1664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 1 0 0 0 0\n 22 4 1 0 0 0 0\n 25 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 16 12 1 0 0 0 0\n 19 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\nM END", "smiles": "CCO[Si](CCCNCCC[Si](OCC)(OCC)OCC)(OCC)OCC", "formula": "C18H43NO6Si2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "85504ce2-096c-46e3-8698-a632c43287f6" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "425.7086", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "10ff411b-9b95-4b66-8336-d598f0e0b6e6", "version": "5", "structure": { "id": "41028880-19a1-45ed-8c1c-c838910db907", "molfile": "\n Marvin 01132103262D \n\n 27 26 0 0 0 0 999 V2000\n 12.3786 -4.4195 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1382 -4.4116 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6539 -4.0100 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7900 -3.6911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9692 -5.1441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7248 -3.6976 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8522 -3.9982 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5515 -5.1256 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2594 -4.4137 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1069 -4.8309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4243 -4.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6997 -4.4155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8209 -4.4177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5455 -4.8270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9877 -4.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3804 -2.9793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1364 -2.9694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6396 -3.1852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8357 -3.1771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1480 -5.1606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.3727 -5.1091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9149 -2.7758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7899 -2.2546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5496 -2.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7385 -5.8853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7246 -2.2611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7860 -5.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 11 1 0 0 0 0\n 3 1 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 1 1 0 0 0 0\n 6 2 1 0 0 0 0\n 7 2 1 0 0 0 0\n 8 2 1 0 0 0 0\n 9 14 1 0 0 0 0\n 10 1 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 15 1 0 0 0 0\n 13 10 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 9 1 0 0 0 0\n 16 4 1 0 0 0 0\n 17 6 1 0 0 0 0\n 18 3 1 0 0 0 0\n 19 7 1 0 0 0 0\n 20 5 1 0 0 0 0\n 21 8 1 0 0 0 0\n 22 18 1 0 0 0 0\n 23 16 1 0 0 0 0\n 24 19 1 0 0 0 0\n 25 20 1 0 0 0 0\n 26 17 1 0 0 0 0\n 27 21 1 0 0 0 0\nM END", "smiles": "CCO[Si](CCCNCCC[Si](OCC)(OCC)OCC)(OCC)OCC", "formula": "C18H43NO6Si2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "425.7086", "optical_activity": "NONE", "references": [ "7b0c837e-3ff7-40cc-a170-c0b67957b430" ], "stereo_centers": 0 }, "unii": "Y34QW2E5AM" } ] }