{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5acb095b-7c66-47d6-a626-1a5f78f9320e",
          "code": "30861-27-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=30861-27-9",
          "code_system": "CAS",
          "references": [
            "3b6e1a15-7d37-49a8-af0b-0eecb5d744ac",
            "8972a898-2574-444a-869d-c3a3d275610a"
          ]
        },
        {
          "uuid": "499db6ea-d752-4fc8-bd61-3308e221d770",
          "code": "C069868",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67069868",
          "code_system": "MESH",
          "references": [
            "3b6e1a15-7d37-49a8-af0b-0eecb5d744ac"
          ]
        },
        {
          "uuid": "033f6520-5d2c-4432-ac7d-d34764555e41",
          "code": "m1571",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1571?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3b6e1a15-7d37-49a8-af0b-0eecb5d744ac"
          ]
        },
        {
          "uuid": "2aec3d4a-6da9-4e61-93f2-3be2459f422c",
          "code": "160190",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/160190",
          "code_system": "PUBCHEM",
          "references": [
            "3b6e1a15-7d37-49a8-af0b-0eecb5d744ac"
          ]
        },
        {
          "uuid": "bb06c428-01e8-4082-aa80-bd326e36379c",
          "code": "Y27M69Y8ES",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d57816ab-6c65-11e2-1a14-15880e03f6e3",
          "code": "631262",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=631262",
          "code_system": "NSC",
          "references": [
            "99bf2644-e822-7039-0425-3d67e7c7dd60"
          ]
        },
        {
          "uuid": "82fafea2-f570-b35d-04ff-ef68b591b476",
          "code": "DTXSID80184877",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80184877",
          "code_system": "EPA CompTox",
          "references": [
            "11277a7e-6ea5-7c97-59b8-134d5e32c5f3"
          ]
        },
        {
          "uuid": "c0d0fcf1-b16f-073f-8a3c-9357eca0a6ff",
          "code": "Y27M69Y8ES",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(Y27M69Y8ES)",
          "code_system": "DAILYMED",
          "references": [
            "43f68fd2-118f-1bc1-7fda-e9b1a36cff3b"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "64deb159-08bf-4397-bed4-6ce9cb17342a",
          "name": "4H-1-BENZOPYRAN-4-ONE, 8-.BETA.-D-GLUCOPYRANOSYL-7-HYDROXY-5-METHYL-2-(2-OXOPROPYL)-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 8-.BETA.-D-GLUCOPYRANOSYL-7-HYDROXY-5-METHYL-2-(2-OXOPROPYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c14cff7-0139-41f7-be59-f8ce69c82069",
            "818364dd-93de-45f0-9fcf-6f82863d2e14"
          ],
          "display_name": false
        },
        {
          "uuid": "163f65c9-58f5-454f-870e-c6778caa02dc",
          "name": "ALOE RESIN B",
          "stdName": "ALOE RESIN B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c14cff7-0139-41f7-be59-f8ce69c82069",
            "818364dd-93de-45f0-9fcf-6f82863d2e14"
          ],
          "display_name": false
        },
        {
          "uuid": "b3610fe4-990a-4b86-b6e2-ba66c8765403",
          "name": "ALOESIN",
          "stdName": "ALOESIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c16abf12-e8b3-45fe-9ab3-2653ef218c4e",
            "092ce430-515e-4ba2-9d54-c88e22b3c731",
            "818364dd-93de-45f0-9fcf-6f82863d2e14",
            "cfe857b8-75d9-4234-9850-6de5a243fa8e",
            "b4c68ce8-59a3-4efd-b841-535f0babfd3e"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "fa57e4a0-861e-46cc-b4c0-2bd8ac9eaea8",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "0fd38e6c-7d97-4013-9b15-a8fe4e9718e7",
          "name": "ALOESIN [MI]",
          "stdName": "ALOESIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "818364dd-93de-45f0-9fcf-6f82863d2e14",
            "b4c68ce8-59a3-4efd-b841-535f0babfd3e"
          ],
          "display_name": false
        },
        {
          "uuid": "19f687e3-a28d-4139-ad98-9cec89f2ebb7",
          "name": "NSC-631262",
          "stdName": "NSC-631262",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f596923a-98e5-4495-ad31-ea4016166fe4",
            "818364dd-93de-45f0-9fcf-6f82863d2e14"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "092ce430-515e-4ba2-9d54-c88e22b3c731",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "818364dd-93de-45f0-9fcf-6f82863d2e14",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c14cff7-0139-41f7-be59-f8ce69c82069",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4c68ce8-59a3-4efd-b841-535f0babfd3e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f596923a-98e5-4495-ad31-ea4016166fe4",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b6e1a15-7d37-49a8-af0b-0eecb5d744ac",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390884000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "976ab542-8890-4627-89be-017c5229d598",
          "citation": "SRS import [Y27M69Y8ES]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Y27M69Y8ES",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390884000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "611fb6a0-11fe-4b20-b6fd-eb0d863f98f3",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cfe857b8-75d9-4234-9850-6de5a243fa8e",
          "citation": "ALOESIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c16abf12-e8b3-45fe-9ab3-2653ef218c4e",
          "citation": "ALOESIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a3f19e6a-9927-5fb5-2d55-36ac05095036",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=30861-27-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8972a898-2574-444a-869d-c3a3d275610a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "99bf2644-e822-7039-0425-3d67e7c7dd60",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "1934956f-168b-6712-b23f-f808a44c3e82",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "11277a7e-6ea5-7c97-59b8-134d5e32c5f3",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "43f68fd2-118f-1bc1-7fda-e9b1a36cff3b",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ebd00235-5cb5-4701-86b0-2f19640b92e8",
          "id": "ebd00235-5cb5-4701-86b0-2f19640b92e8",
          "molfile": "\n  Marvin  01132112122D          \n\n 28 30  0  0  1  0            999 V2000\n   11.2220   -8.1313    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.5076   -7.7188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7931   -8.1313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9365   -7.7188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6510   -8.1313    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   13.3655   -7.7188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0799   -8.1313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0799   -8.9563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7944   -7.7188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7944   -6.8938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5089   -6.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0799   -6.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3655   -6.8938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6510   -6.4813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6510   -5.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9365   -5.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2220   -5.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5076   -5.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2220   -6.4813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3655   -5.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0799   -5.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7944   -5.2438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6510   -8.9563    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   13.3655   -9.3688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9365   -9.3688    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   11.9365  -10.1938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2220   -8.9563    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   10.5076   -9.3688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 27  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  5  4  1  1  0  0  0\n  5  6  1  0  0  0  0\n 23  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n 13  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  2  0  0  0  0\n 12 13  1  0  0  0  0\n 21 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 20  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 23 24  1  6  0  0  0\n 25 23  1  0  0  0  0\n 25 26  1  1  0  0  0\n 27 25  1  0  0  0  0\n 27 28  1  6  0  0  0\nM  END",
          "smiles": "Cc1cc(c(c2c1c(=O)cc(CC(=O)C)o2)[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O",
          "formula": "C19H22O9",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "02183137-37ff-4c34-918a-96b7785968a0"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "394.3733",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "24d73e70-695f-49e4-895a-84c5124249be",
      "version": "11",
      "structure": {
        "id": "1e3e4041-670c-4b44-bbba-52317a73bf5d",
        "molfile": "\n  Marvin  01132101442D          \n\n 29 31  0  0  1  0            999 V2000\n   12.6510   -5.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3655   -5.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0799   -5.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0799   -6.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3655   -6.8938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6510   -6.4813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3655   -7.7188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0799   -8.1313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7944   -7.7188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7944   -6.8938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7944   -5.2438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9365   -5.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2220   -5.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5076   -5.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2220   -6.4813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5089   -6.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0799   -8.9563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6510   -8.1313    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.6510   -8.9563    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.3655   -9.3688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9365   -9.3688    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.9365  -10.1938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2220   -8.9563    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.5076   -9.3688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2220   -8.1313    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.9365   -7.7188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5076   -7.7188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7931   -8.1313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6510   -7.3045    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  4 10  2  0  0  0  0\n  5  7  2  0  0  0  0\n  3 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n  1 12  1  0  0  0  0\n 10 16  1  0  0  0  0\n  8 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  6  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  1  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  6  0  0  0\n 23 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  1  1  0  0  0\n 27 28  1  0  0  0  0\n 18 26  1  0  0  0  0\n  7 18  1  0  0  0  0\n 18 29  1  6  0  0  0\nM  END",
        "smiles": "Cc1cc(c(c2c1c(=O)cc(CC(=O)C)o2)[C@@]3([H])[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O",
        "formula": "C19H22O9",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "394.3733",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "976ab542-8890-4627-89be-017c5229d598",
          "611fb6a0-11fe-4b20-b6fd-eb0d863f98f3"
        ],
        "stereo_centers": 5
      },
      "unii": "Y27M69Y8ES"
    }
  ]
}