{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "697e4099-1584-40d1-ac9e-55941ad19a01", "code": "820959-17-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=820959-17-9", "code_system": "CAS", "references": [ "b5937689-c6dd-491d-80e2-0d622d0a9360", "a23ac478-7935-491c-8312-1c209900d8d9" ] }, { "uuid": "f0a4d7d5-035e-4788-a71f-9806a36ba9b8", "code": "11620163", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11620163", "code_system": "PUBCHEM", "references": [ "b5937689-c6dd-491d-80e2-0d622d0a9360" ] }, { "uuid": "80ef71bc-dfcb-515c-bc37-5ccf35a230e9", "code": "DTXSID10231560", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10231560", "code_system": "EPA CompTox", "references": [ "42ca4c83-f8e8-dbab-27c6-8e49063201bf" ] }, { "uuid": "8c01df7d-c2ff-936a-7550-7dbb7b027fbe", "code": "2052918", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2052918/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "aa63ccf2-e246-2605-1853-0cd2ff691bb4" ] }, { "uuid": "7f0d6703-7db6-4628-8282-bbd9f51f3f26", "code": "Y1DFQ308G8", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "2f753bdf-9024-bd77-a894-f08b31106a68", "code": "Y1DFQ308G8", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Y1DFQ308G8", "code_system": "DAILYMED", "references": [ "6fed7ba3-09d8-e6a9-4a8c-80d821dc285c" ] } ], "substance_class": "chemical", "names": [ { "uuid": "500a0445-d5f6-4bad-9d31-ee8c60568a0b", "name": "Ac-βAla-His-Ser-His", "stdName": "AC-.BETA.ALA-HIS-SER-HIS", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a23ac478-7935-491c-8312-1c209900d8d9" ], "display_name": false }, { "uuid": "bbbeef54-1009-4e4d-8070-afccfe6782b6", "name": "Acetyl Tetrapeptide-5", "stdName": "ACETYL TETRAPEPTIDE-5", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "03238d97-2442-44ba-b15a-6af56a3257a6", "4f08ac12-11be-4af2-917f-6ec8e19c43d5", "46d854de-dc37-4c4d-99e6-39a9e73d4297", "5a8fbd59-8d9d-400d-9bbb-d47b5ae261fa" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "32bc9aaf-cf7f-4e31-b394-7dd74dc35987", "name_org": "INCI" } ] }, { "uuid": "9bcf07ca-78d5-431b-baac-e93238ea0455", "name": "EYESERYL", "stdName": "EYESERYL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4f08ac12-11be-4af2-917f-6ec8e19c43d5", "46d854de-dc37-4c4d-99e6-39a9e73d4297" ], "display_name": false }, { "uuid": "ee2dff9e-cb9b-4ca7-ac54-be4ba886a21a", "name": "L-Histidine, N-acetyl-β-alanyl-L-histidyl-L-seryl-", "stdName": "L-HISTIDINE, N-ACETYL-.BETA.-ALANYL-L-HISTIDYL-L-SERYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a23ac478-7935-491c-8312-1c209900d8d9" ], "display_name": false }, { "uuid": "6e8c5cfc-cca3-4605-ac13-f8dd43569dc4", "name": "N-Acetyl-β-alanyl-L-histidyl-L-seryl-L-histidine", "stdName": "N-ACETYL-.BETA.-ALANYL-L-HISTIDYL-L-SERYL-L-HISTIDINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a23ac478-7935-491c-8312-1c209900d8d9" ], "display_name": false } ], "references": [ { "uuid": "46d854de-dc37-4c4d-99e6-39a9e73d4297", "citation": "http://vitaelinhealthcenter.com/Documents/eyeseryl.pdf", "url": "http://vitaelinhealthcenter.com/Documents/eyeseryl.pdf", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "4f08ac12-11be-4af2-917f-6ec8e19c43d5", "citation": "WEB PAGE", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5a8fbd59-8d9d-400d-9bbb-d47b5ae261fa", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b5937689-c6dd-491d-80e2-0d622d0a9360", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391316000, "tags": [ "NOMEN" ] }, { "uuid": "2a07dba6-b5df-47d9-8e18-144097bbd0c4", "citation": "SRS import [Y1DFQ308G8]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Y1DFQ308G8", "doc_type": "SRS", "public_domain": true, "document_date": 1493391316000, "tags": [ "NOMEN" ] }, { "uuid": "03238d97-2442-44ba-b15a-6af56a3257a6", "citation": "ACETYL TETRAPEPTIDE-5 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "42ca4c83-f8e8-dbab-27c6-8e49063201bf", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=820959-17-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "aa63ccf2-e246-2605-1853-0cd2ff691bb4", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true }, { "uuid": "a23ac478-7935-491c-8312-1c209900d8d9", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "6fed7ba3-09d8-e6a9-4a8c-80d821dc285c", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "9bf0236b-da55-4506-9d9c-1d5f97a04ea5", "id": "9bf0236b-da55-4506-9d9c-1d5f97a04ea5", "molfile": "\n Marvin 01132108062D \n\n 35 36 0 0 1 0 999 V2000\n 8.8022 -1.9198 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 8.7865 -1.0953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4932 -0.6695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2689 -0.9847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8065 -0.3422 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3807 0.3645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5600 0.1564 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0955 -2.3455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3732 -1.9469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3576 -1.1224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6666 -2.3727 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 6.6822 -3.1970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4045 -3.5957 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9443 -1.9740 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2376 -2.3998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2532 -3.2242 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5153 -2.0012 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 4.4997 -1.1767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2063 -0.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3005 0.0755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0938 0.2830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5196 -0.4236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9820 -1.0661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8361 -2.4264 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1138 -2.0277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0981 -1.2034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4072 -2.4535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6849 -2.0549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9782 -2.4806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2559 -2.0820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4508 -2.5078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2402 -1.2576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5245 -2.3184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2312 -1.8926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5402 -3.1428 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 8 1 1 0 0 0\n 33 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 3 7 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 11 9 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 14 1 6 0 0 0\n 12 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 24 1 1 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 19 23 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 25 27 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 30 32 2 0 0 0 0\n 33 34 1 0 0 0 0\n 33 35 2 0 0 0 0\nM END", "smiles": "CC(=O)NCCC(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc2c[nH]cn2)C(=O)O", "formula": "C20H28N8O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "472cc7f6-2ebe-488e-b7d4-f4179b8d81f8" }, "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "492.4865", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "2befac1b-d784-4484-8c32-f647db45d321", "version": "9", "structure": { "id": "13a43a44-3d5f-45b3-b22f-8b06aee8809a", "molfile": "N-Acetyl-?-alanyl-L-histidyl-L-seryl-L-histidine\n JSDraw212072308222D\n\n 35 36 0 0 1 0 0 V2000\n 23.6213 -6.3005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.2704 -5.5205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.9723 -5.5205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.6213 -7.8605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 26.3234 -6.3005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 24.9723 -3.9604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.2704 -8.6405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.6743 -5.5205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.2704 -10.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9194 -7.8605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0253 -6.3005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.6743 -3.9604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9194 -10.9805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3764 -5.5205 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0253 -7.8605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0253 -3.1805 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9194 -12.5404 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7273 -6.3005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5683 -13.3204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7273 -7.8605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.0783 -5.5205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5683 -14.8804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2174 -12.5404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 34.4292 -6.3005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 33.0783 -3.9604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.2704 -3.9604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.5325 -3.0435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0083 -3.0435 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 23.0504 -1.5600 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4904 -1.5600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.0783 -8.6405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.2413 -10.1919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.5034 -8.0060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 34.7673 -10.5163 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 35.5472 -9.1652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 0 0 0 0\n 2 26 1 0 0 0 0\n 3 5 1 0 0 0 0\n 3 6 2 0 0 0 0\n 4 7 1 0 0 0 0\n 5 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 7 10 2 0 0 0 0\n 8 11 1 0 0 0 0\n 8 12 1 1 0 0 0\n 9 13 1 0 0 0 0\n 11 14 1 0 0 0 0\n 11 15 2 0 0 0 0\n 12 16 1 0 0 0 0\n 13 17 1 0 0 0 0\n 14 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 18 20 1 6 0 0 0\n 18 21 1 0 0 0 0\n 19 22 1 0 0 0 0\n 19 23 2 0 0 0 0\n 20 31 1 0 0 0 0\n 21 24 1 0 0 0 0\n 21 25 2 0 0 0 0\n 26 27 2 0 0 0 0\n 26 28 1 0 0 0 0\n 27 29 1 0 0 0 0\n 28 30 1 0 0 0 0\n 29 30 2 0 0 0 0\n 31 32 2 0 0 0 0\n 31 33 1 0 0 0 0\n 32 34 1 0 0 0 0\n 33 35 1 0 0 0 0\n 34 35 2 0 0 0 0\nM END", "smiles": "CC(=O)NCCC(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc2cnc[nH]2)C(=O)O", "formula": "C20H28N8O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "492.4865", "optical_activity": "UNSPECIFIED", "references": [ "46d854de-dc37-4c4d-99e6-39a9e73d4297", "2a07dba6-b5df-47d9-8e18-144097bbd0c4" ], "stereo_centers": 3 }, "unii": "Y1DFQ308G8" } ] }