{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a8e41c9b-1188-45ce-bccd-749a07e6978e",
          "code": "243-847-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.039.846",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9162b9e9-3c0b-4229-954a-960766a2c092"
          ]
        },
        {
          "uuid": "c200c1be-9e54-43fd-a9cf-dd2312cb5f32",
          "code": "577126",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/577126",
          "code_system": "PUBCHEM",
          "references": [
            "9162b9e9-3c0b-4229-954a-960766a2c092"
          ]
        },
        {
          "uuid": "a82b602e-f47c-40b5-b601-68eb5074b351",
          "code": "DEHYDRODIHYDROIONONE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=2253",
          "code_system": "JECFA EVALUATION",
          "references": [
            "9162b9e9-3c0b-4229-954a-960766a2c092"
          ]
        },
        {
          "uuid": "20f8da4d-af37-426c-854d-0d36796eca3c",
          "code": "20483-36-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=20483-36-7",
          "code_system": "CAS",
          "references": [
            "9162b9e9-3c0b-4229-954a-960766a2c092",
            "6fec58f8-2d08-42ba-a362-164b4f1644fa"
          ]
        },
        {
          "uuid": "618729e5-f9ce-ede0-000b-2fb1c4706a5e",
          "code": "DTXSID0066618",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0066618",
          "code_system": "EPA CompTox",
          "references": [
            "1a00568d-57d6-3eb4-6ff7-d371800eefc2"
          ]
        },
        {
          "uuid": "6a90ca38-af75-4a19-a101-85f431de6206",
          "code": "XZS4VD987O",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fbf9717f-3451-64ba-95a4-8341edd0ceca",
          "code": "2557365",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2557365/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "f508f3be-8b06-2b42-96e0-79535abdb81a"
          ]
        },
        {
          "uuid": "ef2ef400-9b4f-1e45-7f98-31d18a429db6",
          "code": "88549",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:88549",
          "code_system": "CHEBI",
          "references": [
            "eb1f5ce3-322b-0351-153e-3930d3bc23de"
          ]
        },
        {
          "uuid": "952d0057-8ff4-df24-06c2-4047550c5779",
          "code": "XZS4VD987O",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=XZS4VD987O",
          "code_system": "DAILYMED",
          "references": [
            "8855f418-1d9c-473d-f52c-005b089d40a6"
          ]
        },
        {
          "uuid": "e8c1ff38-c5b4-9929-15f5-ced33677a8cd",
          "code": "334",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/334/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "73c4ed95-d3ff-e341-0494-59512f432f53"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "34d47015-5590-41f4-93c5-4287e08813fe",
          "name": "2-BUTANONE, 4-(2,6,6-TRIMETHYL-1,3-CYCLOHEXADIEN-1-YL)-",
          "stdName": "2-BUTANONE, 4-(2,6,6-TRIMETHYL-1,3-CYCLOHEXADIEN-1-YL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "644d7b28-e7a5-42b9-b96d-db7d464b6d9b",
            "5567b397-7db7-449e-a39f-651ebe11055c"
          ],
          "display_name": false
        },
        {
          "uuid": "1a8ffaf8-6a67-48b4-8b47-a382cbd57773",
          "name": "4-(2,6,6-TRIMETHYL-1,3-CYCLOHEXADIEN-1-YL)-2-BUTANONE",
          "stdName": "4-(2,6,6-TRIMETHYL-1,3-CYCLOHEXADIEN-1-YL)-2-BUTANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "644d7b28-e7a5-42b9-b96d-db7d464b6d9b",
            "5567b397-7db7-449e-a39f-651ebe11055c"
          ],
          "display_name": false
        },
        {
          "uuid": "81cbdbad-b1ef-428b-97ac-d46239089d69",
          "name": "4-(2,6,6-TRIMETHYLCYCLOHEXA-1,3-DIENYL)BUTAN-2-ONE",
          "stdName": "4-(2,6,6-TRIMETHYLCYCLOHEXA-1,3-DIENYL)BUTAN-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "644d7b28-e7a5-42b9-b96d-db7d464b6d9b",
            "5567b397-7db7-449e-a39f-651ebe11055c"
          ],
          "display_name": false
        },
        {
          "uuid": "9f9c89ee-1c3a-4888-9956-8ad6504d4cc7",
          "name": "7,8-DIHYDRO-3,4-DEHYDRO-.BETA.-IONONE",
          "stdName": "7,8-DIHYDRO-3,4-DEHYDRO-.BETA.-IONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "644d7b28-e7a5-42b9-b96d-db7d464b6d9b",
            "5567b397-7db7-449e-a39f-651ebe11055c"
          ],
          "display_name": false
        },
        {
          "uuid": "cd1b44f0-d447-43ac-a637-0cf713f0eded",
          "name": "DEHYDRODIHYDROIONONE",
          "stdName": "DEHYDRODIHYDROIONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42cf6f55-72d5-4017-9994-96938467e57e",
            "644d7b28-e7a5-42b9-b96d-db7d464b6d9b",
            "af4ac08c-5bfd-4288-82e5-08211dc0f7d2",
            "f844bb91-8134-432f-bc81-55d2480be2ff"
          ],
          "display_name": false
        },
        {
          "uuid": "ff7d46cb-22ad-4ac7-912a-6fe766ee814a",
          "name": "DEHYDRODIHYDROIONONE [FHFI]",
          "stdName": "DEHYDRODIHYDROIONONE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "644d7b28-e7a5-42b9-b96d-db7d464b6d9b",
            "f844bb91-8134-432f-bc81-55d2480be2ff"
          ],
          "display_name": false
        },
        {
          "uuid": "ec1f7e1f-37fd-4625-a598-ccda0c1027b0",
          "name": "DIHYDRODEHYDRO-.BETA.-IONONE",
          "stdName": "DIHYDRODEHYDRO-.BETA.-IONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42cf6f55-72d5-4017-9994-96938467e57e",
            "644d7b28-e7a5-42b9-b96d-db7d464b6d9b"
          ],
          "display_name": true
        },
        {
          "uuid": "9425daee-0d2f-4769-8514-880fde1fdd1e",
          "name": "FEMA NO. 3447",
          "stdName": "FEMA NO. 3447",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42cf6f55-72d5-4017-9994-96938467e57e",
            "644d7b28-e7a5-42b9-b96d-db7d464b6d9b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "42cf6f55-72d5-4017-9994-96938467e57e",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "644d7b28-e7a5-42b9-b96d-db7d464b6d9b",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5567b397-7db7-449e-a39f-651ebe11055c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f844bb91-8134-432f-bc81-55d2480be2ff",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9162b9e9-3c0b-4229-954a-960766a2c092",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391107000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fdbee7f9-071b-4c7f-b20b-65e528946e05",
          "citation": "SRS import [XZS4VD987O]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=XZS4VD987O",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391107000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af4ac08c-5bfd-4288-82e5-08211dc0f7d2",
          "citation": "DEHYDRODIHYDROIONONE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1a00568d-57d6-3eb4-6ff7-d371800eefc2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=20483-36-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "eb1f5ce3-322b-0351-153e-3930d3bc23de",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "f508f3be-8b06-2b42-96e0-79535abdb81a",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "6fec58f8-2d08-42ba-a362-164b4f1644fa",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8855f418-1d9c-473d-f52c-005b089d40a6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "73c4ed95-d3ff-e341-0494-59512f432f53",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "387cfc0e-df6d-4c89-92e2-a63e2f67669f",
          "id": "387cfc0e-df6d-4c89-92e2-a63e2f67669f",
          "molfile": "\n  Marvin  01132103002D          \n\n 14 14  0  0  0  0            999 V2000\n    5.5770   -1.2287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5770   -2.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2915   -2.4661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8625   -2.4661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1481   -2.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4336   -2.4661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4336   -3.2911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1481   -3.7036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7191   -3.7036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0047   -3.2911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0047   -2.4661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7191   -2.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1888   -1.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2494   -1.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  6 12  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\nM  END",
          "smiles": "CC1=C(CCC(=O)C)C(C)(C)CC=C1",
          "formula": "C13H20O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ce85da8e-b22c-4782-b2f3-6187920f73ba"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "192.2978",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6d3cbaa1-aace-4a8d-bfbf-593ee4c63f59",
      "version": "7",
      "structure": {
        "id": "61bc0fd9-54e6-442c-9b99-2fb0b72b2643",
        "molfile": "\n  Marvin  01132105042D          \n\n 14 14  0  0  0  0            999 V2000\n    2.0047   -2.4661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7191   -2.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4336   -2.4661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4336   -3.2911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7191   -3.7036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0047   -3.2911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1481   -3.7036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1888   -1.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2494   -1.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1481   -2.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8625   -2.4661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5770   -2.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2915   -2.4661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5770   -1.2287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  2  8  1  0  0  0  0\n  2  9  1  0  0  0  0\n  3 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\nM  END",
        "smiles": "CC1=C(CCC(=O)C)C(C)(C)CC=C1",
        "formula": "C13H20O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "192.2978",
        "optical_activity": "NONE",
        "references": [
          "fdbee7f9-071b-4c7f-b20b-65e528946e05",
          "5567b397-7db7-449e-a39f-651ebe11055c"
        ],
        "stereo_centers": 0
      },
      "unii": "XZS4VD987O"
    }
  ]
}