{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1caaac10-680b-46a7-b0af-799eb41c038e", "code": "210174-65-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=210174-65-5", "code_system": "CAS", "references": [ "699cf398-8290-400b-acba-56eca3fe4efe", "4913ab8f-29b4-45bd-bc64-884b7562f586" ] }, { "uuid": "cbf68241-9a0c-0c24-1713-5d0f06550031", "code": "11745184", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11745184", "code_system": "PUBCHEM", "references": [ "d362b31a-483b-3e26-b038-e08ad20306d8" ] }, { "uuid": "5fbb2d02-7731-4018-bf1b-c946281c98b5", "code": "XZ5B92DR6X", "type": "PRIMARY", "code_system": "FDA UNII" } ], "relationships": [ { "uuid": "357a6a9d-bf90-4352-a8a2-273c59b6b765", "amount": { "uuid": "088bef6e-048f-410f-8d64-e246a0cc8fed" }, "type": "RACEMATE->ENANTIOMER", "related_substance": { "uuid": "def779be-2a74-4f5a-bc42-6dfecd966f3e", "refuuid": "65656316-6ebd-4c76-98a3-b9e43f929ec2", "name": "2',3'-EPOXYSAFROLE", "unii": "1X8LBY54MV", "linking_id": "1X8LBY54MV", "ref_pname": "2',3'-EPOXYSAFROLE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "3e3df90f-fa38-445c-98da-d43a8495deb9", "name": "(R)-(+)-SAFROLE OXIDE", "stdName": "(R)-(+)-SAFROLE OXIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9769032f-9b5d-4a3f-9a67-38f119cc0688" ], "display_name": false }, { "uuid": "eed38528-b4dc-4210-b5f5-406cb55c2931", "name": "(R)-2-(1,3-BENZODIOXOLE-5-YLMETHYL)OXIRANE", "stdName": "(R)-2-(1,3-BENZODIOXOLE-5-YLMETHYL)OXIRANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "aedf4f92-9eca-4d14-ba74-a0e7afd470bb" ], "display_name": false }, { "uuid": "42feb4c5-83fa-42a0-896b-e2bb5e449c97", "name": "1,3-BENZODIOXOLE, 5-((2R)-2-OXIRANYLMETHYL)-", "stdName": "1,3-BENZODIOXOLE, 5-((2R)-2-OXIRANYLMETHYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9769032f-9b5d-4a3f-9a67-38f119cc0688" ], "display_name": false }, { "uuid": "fb717d46-4ece-4f27-bf7a-26d9e9acb1d9", "name": "2',3'-EPOXYSAFROLE, (R)-", "stdName": "2',3'-EPOXYSAFROLE, (R)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "21126de7-cc77-4076-a55f-276ee7374cea" ], "display_name": true }, { "uuid": "64e46da0-76cd-421b-adb0-777ff3b14893", "name": "5-(((R)-OXIRANE-2.ALPHA.-YL)METHYL)-1,3-BENZODIOXOLE", "stdName": "5-(((R)-OXIRANE-2.ALPHA.-YL)METHYL)-1,3-BENZODIOXOLE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "aedf4f92-9eca-4d14-ba74-a0e7afd470bb" ], "display_name": false } ], "references": [ { "uuid": "21126de7-cc77-4076-a55f-276ee7374cea", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "9769032f-9b5d-4a3f-9a67-38f119cc0688", "citation": "SciFinder", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "aedf4f92-9eca-4d14-ba74-a0e7afd470bb", "citation": "http://jglobal.jst.go.jp/en/detail?JGLOBAL_ID=200907085947575606&q=J971.069H&t=7", "url": "http://jglobal.jst.go.jp/en/detail?JGLOBAL_ID=200907085947575606&q=J971.069H&t=7", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "699cf398-8290-400b-acba-56eca3fe4efe", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393573000, "tags": [ "NOMEN" ] }, { "uuid": "8f3be680-91c9-4024-b618-b68e62a2e395", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d362b31a-483b-3e26-b038-e08ad20306d8", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "4913ab8f-29b4-45bd-bc64-884b7562f586", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "80f9ba81-a127-4e93-8200-e8b8872f8dde", "id": "80f9ba81-a127-4e93-8200-e8b8872f8dde", "molfile": "\n Marvin 01132106422D \n\n 13 15 0 0 1 0 999 V2000\n 15.2732 -5.7049 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 15.2732 -6.5284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5602 -6.9460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5602 -7.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8428 -8.1846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1321 -7.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3356 -8.0221 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8527 -7.3521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3514 -6.6819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1321 -6.9460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8428 -6.5306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6884 -4.9783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8580 -4.9783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 12 1 0 0 0 0\n 13 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 11 2 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 10 6 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 13 12 1 0 0 0 0\nM END", "smiles": "c1cc2c(cc1C[C@@H]3CO3)OCO2", "formula": "C10H10O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "9b0563fd-4d88-4030-9647-be848411c770" }, "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "178.185", "optical_activity": "UNSPECIFIED", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "628579d1-c6f6-451b-961b-ebd25790cb96", "version": "5", "structure": { "id": "2b767d0a-7960-4ab5-89b8-04002336ad6c", "molfile": "\n Marvin 01132102212D \n\n 13 15 0 0 1 0 999 V2000\n 14.8580 -4.9783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2732 -5.7049 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 15.6884 -4.9783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2732 -6.5284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5602 -6.9460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8428 -6.5306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1321 -6.9460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1321 -7.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8428 -8.1846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5602 -7.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3356 -8.0221 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8527 -7.3521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3514 -6.6819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 1 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 5 10 2 0 0 0 0\n 9 10 1 0 0 0 0\n 8 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 7 13 1 0 0 0 0\n 12 13 1 0 0 0 0\nM END", "smiles": "c1cc2c(cc1C[C@@H]3CO3)OCO2", "formula": "C10H10O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "178.185", "optical_activity": "( + )", "references": [ "8f3be680-91c9-4024-b618-b68e62a2e395" ], "stereo_centers": 1 }, "unii": "XZ5B92DR6X" } ] }