{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a7007550-b7b0-4ae9-bd55-8191fbc2bab9",
          "code": "212707-61-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=212707-61-4",
          "code_system": "CAS",
          "references": [
            "dfa31205-6e80-4f58-8a0e-06a13ab6a6ea",
            "076cc14e-5d5e-4652-acab-0d5ea5363bbc"
          ]
        },
        {
          "uuid": "2517a520-8ef7-4e20-acbc-ac515563054a",
          "code": "823206",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/823206",
          "code_system": "PUBCHEM",
          "references": [
            "dfa31205-6e80-4f58-8a0e-06a13ab6a6ea"
          ]
        },
        {
          "uuid": "88c03e4d-3858-2c22-1b0d-beafbfcdbac8",
          "code": "DTXSID60356398",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60356398",
          "code_system": "EPA CompTox",
          "references": [
            "9e1514ca-f7c3-76d8-bdb0-ddd4adb6627e"
          ]
        },
        {
          "uuid": "10c4d194-662d-4a93-a107-1c8905f73e18",
          "code": "XY7RW8O14Q",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b0bb8848-ee2e-40df-8dcb-48971278b3f8",
          "name": "2-PROPENAMIDE, N-(2-(1H-INDOL-3-YL)ETHYL)-3-PHENYL-, (2E)-",
          "stdName": "2-PROPENAMIDE, N-(2-(1H-INDOL-3-YL)ETHYL)-3-PHENYL-, (2E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e271a15-4576-440b-bbb2-1bbfb33b1f1d",
            "4ac63635-51be-463c-9aad-6070cb79d846"
          ],
          "display_name": false
        },
        {
          "uuid": "62f5375d-c2ee-40af-98d6-442d4a0f1e90",
          "name": "CINNAMOYL TRYPTAMINE",
          "stdName": "CINNAMOYL TRYPTAMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2d3081b-8b11-4948-98e3-867b5bfe2d3c",
            "4ac63635-51be-463c-9aad-6070cb79d846",
            "d9d0e3a1-df1b-47c5-8629-1f10a979f893"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f07a575c-85c7-4166-a424-a63fabed91e4",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e09fda77-3d2f-465b-9206-0eecc308dba9",
          "name": "MELAESER",
          "stdName": "MELAESER",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2d3081b-8b11-4948-98e3-867b5bfe2d3c",
            "4ac63635-51be-463c-9aad-6070cb79d846"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c2d3081b-8b11-4948-98e3-867b5bfe2d3c",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4ac63635-51be-463c-9aad-6070cb79d846",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e271a15-4576-440b-bbb2-1bbfb33b1f1d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dfa31205-6e80-4f58-8a0e-06a13ab6a6ea",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393195000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ab45286-6917-4fbd-aac2-7ae2e8a4a17c",
          "citation": "SRS import [XY7RW8O14Q]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=XY7RW8O14Q",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393195000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9d0e3a1-df1b-47c5-8629-1f10a979f893",
          "citation": "CINNAMOYL TRYPTAMINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9e1514ca-f7c3-76d8-bdb0-ddd4adb6627e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=212707-61-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "076cc14e-5d5e-4652-acab-0d5ea5363bbc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2c55fcef-fc88-419f-af3f-f9ce2dfa6779",
          "id": "2c55fcef-fc88-419f-af3f-f9ce2dfa6779",
          "molfile": "\n  Marvin  01132102242D          \n\n 22 24  0  0  0  0            999 V2000\n   14.7781   -3.7768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4426   -4.5304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6221   -4.6167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1372   -3.9492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3168   -4.0355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8318   -3.3681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0868   -2.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4193   -2.0985    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7519   -2.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9449   -2.4119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3929   -3.0249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6477   -3.8096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4547   -3.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0067   -3.3681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9276   -5.1979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7480   -5.1117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2329   -5.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0535   -5.6929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5384   -6.3603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2028   -7.1140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3824   -7.2002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8974   -6.5328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  2 15  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6 14  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 14  9  2  0  0  0  0\n 10 11  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 22  2  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)/C=C/C(=O)NCCc2c[nH]c3ccccc23",
          "formula": "C19H18N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7e8a47c2-1028-46b8-8521-f96873904be5"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "290.3597",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f0a148fb-6323-4c72-b989-e557716fd351",
      "version": "4",
      "structure": {
        "id": "026669aa-29e7-4d22-8665-f8bf3cef75e0",
        "molfile": "\n  Marvin  01132100262D          \n\n 22 24  0  0  0  0            999 V2000\n   12.3168   -4.0355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8318   -3.3681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0868   -2.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4193   -2.0985    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7519   -2.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9449   -2.4119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3929   -3.0249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6477   -3.8096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4547   -3.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0067   -3.3681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1372   -3.9492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6221   -4.6167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4426   -4.5304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7781   -3.7768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9276   -5.1979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7480   -5.1117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2329   -5.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0535   -5.6929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5384   -6.3603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2028   -7.1140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3824   -7.2002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8974   -6.5328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10  5  2  0  0  0  0\n  2 10  1  0  0  0  0\n  1 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 17 22  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)/C=C/C(=O)NCCc2c[nH]c3ccccc23",
        "formula": "C19H18N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "290.3597",
        "optical_activity": "NONE",
        "references": [
          "0e271a15-4576-440b-bbb2-1bbfb33b1f1d",
          "9ab45286-6917-4fbd-aac2-7ae2e8a4a17c"
        ],
        "stereo_centers": 0
      },
      "unii": "XY7RW8O14Q"
    }
  ]
}