{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "868f034c-ff1b-4430-b33a-edcd155a058a", "code": "307976-92-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=307976-92-7", "code_system": "CAS", "references": [ "13683b36-4532-4c12-9f16-a5b4455d3d44", "b5f25790-1d7d-4d21-b197-865fe838f7fa" ] }, { "uuid": "c83be31d-644d-4834-b868-1ad62b8d8c3c", "code": "11546886", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11546886", "code_system": "PUBCHEM", "references": [ "13683b36-4532-4c12-9f16-a5b4455d3d44" ] }, { "uuid": "583e6926-9e8a-4854-baed-513ea3e15f48", "code": "XWE55W00O1", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "236e7c35-f460-743d-0d1f-185d4e3148aa", "code": "DTXSID90184808", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90184808", "code_system": "EPA CompTox", "references": [ "9488fb92-57aa-4a6f-12d3-4202adf56d28" ] } ], "substance_class": "chemical", "names": [ { "uuid": "67a040ba-3dee-4711-b05c-da353416088b", "name": "ACETYL BENZOYLOXY PRASTERONE", "stdName": "ACETYL BENZOYLOXY PRASTERONE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "ee686ccc-b728-4192-a500-4e9de53f0c5a", "55ff0840-9d07-496d-8542-53391548dbc4", "aa92cf0d-75a8-4b84-bea7-8073d6ed3380" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "5b98319b-b1bf-4055-be25-998a4284e095", "name_org": "INCI" } ] }, { "uuid": "f2a742fb-59da-47f3-9272-921f735a4f64", "name": "ANDROST-5-EN-17-ONE, 3-(ACETYLOXY)-7-(BENZOYLOXY)-, (3.BETA.,7.ALPHA.)-", "stdName": "ANDROST-5-EN-17-ONE, 3-(ACETYLOXY)-7-(BENZOYLOXY)-, (3.BETA.,7.ALPHA.)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "55ff0840-9d07-496d-8542-53391548dbc4", "26149b5e-dad3-44c5-af10-5785f0369476" ], "display_name": false } ], "references": [ { "uuid": "aa92cf0d-75a8-4b84-bea7-8073d6ed3380", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "55ff0840-9d07-496d-8542-53391548dbc4", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "26149b5e-dad3-44c5-af10-5785f0369476", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "13683b36-4532-4c12-9f16-a5b4455d3d44", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391402000, "tags": [ "NOMEN" ] }, { "uuid": "50bde09b-8033-45e0-8e2a-d36ace5b7799", "citation": "SRS import [XWE55W00O1]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=XWE55W00O1", "doc_type": "SRS", "public_domain": true, "document_date": 1493391402000, "tags": [ "NOMEN" ] }, { "uuid": "ee686ccc-b728-4192-a500-4e9de53f0c5a", "citation": "ACETYL BENZOYLOXY PRASTERONE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "93947937-f693-c269-a3b0-0b7c4fc364ad", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=307976-92-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b5f25790-1d7d-4d21-b197-865fe838f7fa", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "9488fb92-57aa-4a6f-12d3-4202adf56d28", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "5de101fc-12a3-4de9-98de-d345447f2904", "id": "5de101fc-12a3-4de9-98de-d345447f2904", "molfile": "\n Marvin 01132104522D \n\n 33 37 0 0 1 0 999 V2000\n 11.0979 -5.8932 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 11.8989 -6.0911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3345 -5.3905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8028 -4.7596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0007 -3.9588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0386 -5.0704 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 11.0656 -4.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2964 -4.7104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6134 -5.1731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6727 -5.9960 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 10.4150 -6.3561 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 10.4743 -7.1789 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 11.2166 -7.5390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2760 -8.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5930 -8.8246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0183 -8.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0776 -9.5447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8199 -9.9047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5029 -9.4419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4435 -8.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7012 -8.2590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7914 -7.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0491 -7.2817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3662 -7.7445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6239 -7.3845 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 7.5646 -6.5616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2475 -6.0988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9898 -6.4588 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.9304 -5.6360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9409 -7.8473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1986 -7.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5158 -7.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1393 -6.6644 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 6 1 0 0 0 0\n 11 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 2 0 0 0 0\n 6 4 1 0 0 0 0\n 6 7 1 1 0 0 0\n 6 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 6 0 0 0\n 10 28 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 6 0 0 0\n 12 22 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 16 21 2 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 2 0 0 0 0\n 21 20 1 0 0 0 0\n 23 22 2 0 0 0 0\n 24 23 1 0 0 0 0\n 28 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 30 1 1 0 0 0\n 26 27 1 0 0 0 0\n 28 27 1 0 0 0 0\n 28 29 1 1 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 2 0 0 0 0\nM END", "smiles": "CC(=O)O[C@H]1CC[C@@]2(C)C(=C[C@H]([C@H]3[C@@H]4CCC(=O)[C@@]4(C)CCC32)OC(=O)c5ccccc5)C1", "formula": "C28H34O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "364409bf-bb5a-4d77-bdb8-accae2c2e764" }, "defined_stereo": 6, "ez_centers": 0, "molecular_weight": "450.5676", "optical_activity": "UNSPECIFIED", "stereo_centers": 7 } ], "definition_level": "COMPLETE", "uuid": "bd4a7f47-db26-46f3-923e-4c79a699ddcb", "version": "6", "structure": { "id": "678617d1-75fb-49a9-980f-2f697a4b99a8", "molfile": "\n Marvin 01132105232D \n\n 36 40 0 0 1 0 999 V2000\n 7.5646 -6.5616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2475 -6.0988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9898 -6.4588 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.0491 -7.2817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3662 -7.7445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6239 -7.3845 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.9409 -7.8473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1986 -7.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5158 -7.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1393 -6.6644 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6727 -5.9960 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.4150 -6.3561 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 10.4743 -7.1789 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.7914 -7.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6134 -5.1731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2964 -4.7104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0386 -5.0704 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.0979 -5.8932 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.9304 -5.6360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7320 -6.8189 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3557 -5.5332 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8989 -6.0911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8028 -4.7596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3345 -5.3905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0007 -3.9588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2429 -6.7054 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2166 -7.5390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2760 -8.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5930 -8.8246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0183 -8.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0776 -9.5447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8199 -9.9047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5029 -9.4419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4435 -8.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7012 -8.2590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0656 -4.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 1 6 1 0 0 0 0\n 6 7 1 1 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 4 14 2 0 0 0 0\n 3 11 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 12 18 1 0 0 0 0\n 11 15 1 0 0 0 0\n 3 19 1 1 0 0 0\n 11 20 1 6 0 0 0\n 12 21 1 1 0 0 0\n 23 24 1 0 0 0 0\n 24 22 1 0 0 0 0\n 18 22 1 0 0 0 0\n 17 23 1 0 0 0 0\n 23 25 2 0 0 0 0\n 18 26 1 6 0 0 0\n 13 27 1 6 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 28 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 2 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 2 0 0 0 0\n 31 30 2 0 0 0 0\n 30 35 1 0 0 0 0\n 17 36 1 1 0 0 0\nM END", "smiles": "CC(=O)O[C@H]1CC[C@@]2(C)C(=C[C@H]([C@@]3([H])[C@]4([H])CCC(=O)[C@@]4(C)CC[C@@]32[H])OC(=O)c5ccccc5)C1", "formula": "C28H34O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 7, "ez_centers": 0, "molecular_weight": "450.5676", "optical_activity": "UNSPECIFIED", "references": [ "50bde09b-8033-45e0-8e2a-d36ace5b7799", "aa92cf0d-75a8-4b84-bea7-8073d6ed3380" ], "stereo_centers": 7 }, "unii": "XWE55W00O1" } ] }