{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "76f71567-d0f7-42f5-b3a7-1fd20a656352",
          "code": "606-28-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=606-28-0",
          "code_system": "CAS",
          "references": [
            "f8a51d9f-da1c-49b7-b8c0-b949a0557c10",
            "f09be9d4-8888-46bc-9faf-2e3943f63ab3"
          ]
        },
        {
          "uuid": "cce509ce-9173-4d5e-b2c8-72c9d6331c08",
          "code": "210-112-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.009.194",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f8a51d9f-da1c-49b7-b8c0-b949a0557c10"
          ]
        },
        {
          "uuid": "c6579652-f025-4f43-92e8-7ef5d0668fb2",
          "code": "11816",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11816",
          "code_system": "PUBCHEM",
          "references": [
            "f8a51d9f-da1c-49b7-b8c0-b949a0557c10"
          ]
        },
        {
          "uuid": "1f36dcd1-d37f-e408-447e-48ea341c14dc",
          "code": "DTXSID2060549",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2060549",
          "code_system": "EPA CompTox",
          "references": [
            "bfee14be-0ecc-b82d-5b70-661b3df6bc63"
          ]
        },
        {
          "uuid": "098cf2e6-b7f0-41a7-b11e-be5a5b77984c",
          "code": "XUP7S9NT59",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7e266c83-fc5b-0ad9-9c00-e8218fe55c9d",
          "code": "3797",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=3797",
          "code_system": "NSC",
          "references": [
            "c6b958cd-e75b-8d32-a16a-75bf8ab44149"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0f298907-5239-466d-8338-a7de1df132be",
          "name": "AI3-00516",
          "stdName": "AI3-00516",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7c431ee-1399-4436-ae3b-6a3246b22476"
          ],
          "display_name": false
        },
        {
          "uuid": "07b8de77-323d-4ba8-be6a-3ab591c0f1d6",
          "name": "Benzoic acid, 2-benzoyl-, methyl ester",
          "stdName": "BENZOIC ACID, 2-BENZOYL-, METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7c431ee-1399-4436-ae3b-6a3246b22476"
          ],
          "display_name": false
        },
        {
          "uuid": "5c219aaf-7c0e-499a-8a55-ab06dd3b2ec4",
          "name": "Benzoic acid, o-benzoyl-, methyl ester",
          "stdName": "BENZOIC ACID, O-BENZOYL-, METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7c431ee-1399-4436-ae3b-6a3246b22476"
          ],
          "display_name": false
        },
        {
          "uuid": "8d48dbf4-0fe5-4c50-8ad9-98bfb92b5e31",
          "name": "Methyl 2-benzoylbenzoate",
          "stdName": "METHYL 2-BENZOYLBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40996084-8d5a-4940-becc-c5a4c07d9c04"
          ],
          "display_name": true
        },
        {
          "uuid": "e649143f-4763-476c-8262-26b3f8fb8f1c",
          "name": "Methyl o-benzoylbenzoate",
          "stdName": "METHYL O-BENZOYLBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7c431ee-1399-4436-ae3b-6a3246b22476"
          ],
          "display_name": false
        },
        {
          "uuid": "864550f0-52ea-409e-885c-11e17942d4db",
          "name": "NSC-3797",
          "stdName": "NSC-3797",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7c431ee-1399-4436-ae3b-6a3246b22476"
          ],
          "display_name": false
        },
        {
          "uuid": "e9ff2730-dcab-46b7-81bf-576738adf712",
          "name": "o-(Methoxycarbonyl)benzophenone",
          "stdName": "O-(METHOXYCARBONYL)BENZOPHENONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7c431ee-1399-4436-ae3b-6a3246b22476"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "40996084-8d5a-4940-becc-c5a4c07d9c04",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7c431ee-1399-4436-ae3b-6a3246b22476",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8a51d9f-da1c-49b7-b8c0-b949a0557c10",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391995000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bfee14be-0ecc-b82d-5b70-661b3df6bc63",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=606-28-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f09be9d4-8888-46bc-9faf-2e3943f63ab3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c6b958cd-e75b-8d32-a16a-75bf8ab44149",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a05dabc4-6cd7-4469-bf2e-09a5adeaac49",
          "id": "a05dabc4-6cd7-4469-bf2e-09a5adeaac49",
          "molfile": "\n  Marvin  01132108202D          \n\n 18 19  0  0  0  0            999 V2000\n    4.3117   -2.8745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6039   -2.4644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6039   -1.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3161   -1.2301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8831   -1.2301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8831   -0.4057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1796    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4588   -0.4014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4588   -1.2214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1796   -1.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1796   -2.4601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8615   -2.8745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4631   -2.8831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4631   -3.5694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7337   -3.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.5564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0173   -2.9004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7337   -2.4774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n 10  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 18  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\nM  END",
          "smiles": "COC(=O)c1ccccc1C(=O)c2ccccc2",
          "formula": "C15H12O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1598ed4f-7eea-434c-a1d8-72a8aef6ef44"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "240.2545",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "dbc443f5-8013-44e2-9cd5-d953a7e3731c",
      "version": "6",
      "structure": {
        "id": "e4d6089d-5ace-4b16-bab6-179e10ba13a9",
        "molfile": "\n  Marvin  01132111512D          \n\n 18 19  0  0  0  0            999 V2000\n    2.1796   -1.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8831   -1.2301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1796   -2.4601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4588   -1.2214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8831   -0.4057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6039   -1.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4631   -2.8831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8615   -2.8745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4588   -0.4014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1796    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6039   -2.4644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3161   -1.2301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4631   -3.5694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7337   -2.4774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3117   -2.8745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7337   -3.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0173   -2.9004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.5564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  2  0  0  0  0\n  2  5  2  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  3  8  2  0  0  0  0\n  4  9  1  0  0  0  0\n  5 10  1  0  0  0  0\n  6 11  1  0  0  0  0\n  6 12  2  0  0  0  0\n  7 13  1  0  0  0  0\n  7 14  2  0  0  0  0\n  9 10  2  0  0  0  0\n 11 15  1  0  0  0  0\n 13 16  2  0  0  0  0\n 14 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 17 18  2  0  0  0  0\nM  END",
        "smiles": "COC(=O)c1ccccc1C(=O)c2ccccc2",
        "formula": "C15H12O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "240.2545",
        "optical_activity": "NONE",
        "references": [
          "40996084-8d5a-4940-becc-c5a4c07d9c04"
        ],
        "stereo_centers": 0
      },
      "unii": "XUP7S9NT59"
    }
  ]
}