{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "aaa5d03f-1c45-4505-9b76-b12996992e08",
          "code": "R03AC14",
          "comments": "ATC|RESPIRATORY SYSTEM|DRUGS FOR OBSTRUCTIVE AIRWAY DISEASES|ADRENERGICS, INHALANTS|Selective beta-2-adrenoreceptor agonists|clenbuterol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=R03AC14&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "9523d3de-646b-48e5-a843-6afb1014b769"
          ]
        },
        {
          "uuid": "1c9f13fd-f6dd-4db8-b54f-402c65a3e479",
          "code": "R03CC13",
          "comments": "ATC|RESPIRATORY SYSTEM|DRUGS FOR OBSTRUCTIVE AIRWAY DISEASES|ADRENERGICS FOR SYSTEMIC USE|Selective beta-2-adrenoreceptor agonists|clenbuterol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=R03CC13&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "9523d3de-646b-48e5-a843-6afb1014b769"
          ]
        },
        {
          "uuid": "002feffe-cbdf-4176-b267-f5ce02896308",
          "code": "QR03CC13",
          "comments": "VATC|DRUGS FOR OBSTRUCTIVE AIRWAY DISEASES|ADRENERGICS FOR SYSTEMIC USE|Selective beta-2-adrenoreceptor agonists|clenbuterol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR03CC13&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "9523d3de-646b-48e5-a843-6afb1014b769"
          ]
        },
        {
          "uuid": "08712776-7cd3-4322-a99a-1953301f2044",
          "code": "QR03CC90",
          "comments": "VATC|DRUGS FOR OBSTRUCTIVE AIRWAY DISEASES|ADRENERGICS FOR SYSTEMIC USE|Selective beta-2-adrenoreceptor agonists|clenbuterol, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR03CC90&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "9523d3de-646b-48e5-a843-6afb1014b769"
          ]
        },
        {
          "uuid": "f7200ac4-a6bd-4f4d-981e-788acd4f87c4",
          "code": "QG02CA91",
          "comments": "VATC|OTHER GYNECOLOGICALS|OTHER GYNECOLOGICALS|Sympathomimetics, labour repressants|clenbuterol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QG02CA91&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "9523d3de-646b-48e5-a843-6afb1014b769"
          ]
        },
        {
          "uuid": "02413806-9475-434b-b4ce-183321977633",
          "code": "QR03AC14",
          "comments": "VATC|DRUGS FOR OBSTRUCTIVE AIRWAY DISEASES|ADRENERGICS, INHALANTS|Selective beta-2-adrenoreceptor agonists|clenbuterol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR03AC14&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "9523d3de-646b-48e5-a843-6afb1014b769"
          ]
        },
        {
          "uuid": "1564fb2a-2811-434b-98b8-8fc2940af05e",
          "code": "37148-27-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=37148-27-9",
          "code_system": "CAS",
          "references": [
            "9523d3de-646b-48e5-a843-6afb1014b769",
            "77a5ff78-9aeb-4158-85a5-77067d40e5ea"
          ]
        },
        {
          "uuid": "ff1ec1ad-caba-490b-a8a4-bbeb540f0aac",
          "code": "C65335",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C65335",
          "code_system": "NCI_THESAURUS",
          "references": [
            "9523d3de-646b-48e5-a843-6afb1014b769"
          ]
        },
        {
          "uuid": "20721db8-00c7-476a-beab-c16b2986f240",
          "code": "D002976",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68002976",
          "code_system": "MESH",
          "references": [
            "9523d3de-646b-48e5-a843-6afb1014b769"
          ]
        },
        {
          "uuid": "78f9b607-5891-43ff-a3e0-716591705943",
          "code": "CLENBUTEROL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Clenbuterol",
          "code_system": "WIKIPEDIA",
          "references": [
            "9523d3de-646b-48e5-a843-6afb1014b769"
          ]
        },
        {
          "uuid": "61b8060c-f1ef-4f38-a128-49b7d0333d1d",
          "code": "3264",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3264",
          "code_system": "INN",
          "references": [
            "9523d3de-646b-48e5-a843-6afb1014b769"
          ]
        },
        {
          "uuid": "ab24e44a-79b8-4f96-8342-75f7ec0f460e",
          "code": "253-366-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.048.499",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9523d3de-646b-48e5-a843-6afb1014b769"
          ]
        },
        {
          "uuid": "ab2161d9-2f8c-4f38-9aaf-63cc13b7abd8",
          "code": "m3615",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3615?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "9523d3de-646b-48e5-a843-6afb1014b769"
          ]
        },
        {
          "uuid": "a2caba5b-10c7-4f6c-ab03-efc7fde8898c",
          "code": "2580",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2580/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "9523d3de-646b-48e5-a843-6afb1014b769"
          ]
        },
        {
          "uuid": "7fb7d663-d45c-4631-8701-b00368d789f7",
          "code": "DB01407",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01407",
          "code_system": "DRUG BANK",
          "references": [
            "9523d3de-646b-48e5-a843-6afb1014b769"
          ]
        },
        {
          "uuid": "06cc98eb-29e2-4375-9679-acb674e542d9",
          "code": "SUB06651MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "9523d3de-646b-48e5-a843-6afb1014b769"
          ]
        },
        {
          "uuid": "3464468e-3126-4cbe-afe2-79534272ba35",
          "code": "21 CFR 520.452",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 520 ORAL DOSAGE FORM NEW ANIMAL DRUGS|Sec. 520.452 Clenbuterol syrup.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=520.452",
          "code_system": "CFR",
          "references": [
            "9523d3de-646b-48e5-a843-6afb1014b769"
          ]
        },
        {
          "uuid": "2f9f7153-0e17-4920-8cdc-4ee3f98e5336",
          "code": "21 CFR 530.41",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 530?EXTRALABEL DRUG USE IN ANIMALS|Subpart E?Safe Levels for Extralabel Use of Drugs in Animals and Drugs Prohibited From Extralabel Use in Animals|Sec. 530.41 Drugs prohibited for extralabel use in animals.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=530.41",
          "code_system": "CFR",
          "references": [
            "9523d3de-646b-48e5-a843-6afb1014b769"
          ]
        },
        {
          "uuid": "fe1eec5c-c88c-4257-9e63-21341f1aec3d",
          "code": "CHEMBL49080",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL49080",
          "code_system": "ChEMBL",
          "references": [
            "9523d3de-646b-48e5-a843-6afb1014b769"
          ]
        },
        {
          "uuid": "5693d5b4-0836-4b43-ba8d-7e5aabc5a987",
          "code": "2783",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2783",
          "code_system": "PUBCHEM",
          "references": [
            "9523d3de-646b-48e5-a843-6afb1014b769"
          ]
        },
        {
          "uuid": "446f5420-8d69-2a06-9532-fcac5e91420f",
          "code": "DTXSID7022833",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7022833",
          "code_system": "EPA CompTox",
          "references": [
            "16a4f2bc-1c28-a1be-e731-6191514317cc"
          ]
        },
        {
          "uuid": "3be1a99a-f77e-02fa-8cf1-7e51cd1a38d0",
          "code": "451614",
          "comments": "ORPHAN DRUG|Designated|Adjunctive therapy with enzyme replacement therapy in the treatment of Pompe disease",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=451614",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "4aac9058-9b34-fc21-9a8c-5fe6edb270af",
          "code": "546316",
          "comments": "ORPHAN DRUG|Designated|Treatment of Pompe disease (glycogen storage disease type II)",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=546316",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "ff90c98c-ab61-0034-3b1e-48fc0bf7808b",
          "code": "C48149",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Adrenergic Agent[C29747]|Adrenergic Agonist[C87053]|Beta-Adrenergic Agonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C48149",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6d18b462-a8b6-5eab-6075-69c1454fcaaa"
          ]
        },
        {
          "uuid": "7b20915b-d962-a2c4-46c9-62998d8f2273",
          "code": "R03CC63",
          "comments": "ATC|RESPIRATORY SYSTEM|DRUGS FOR OBSTRUCTIVE AIRWAY DISEASES|ADRENERGICS FOR SYSTEMIC USE|Selective beta-2-adrenoreceptor agonists|clenbuterol and ambroxol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=R03CC63&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "6d18b462-a8b6-5eab-6075-69c1454fcaaa"
          ]
        },
        {
          "uuid": "df856bfe-5929-1097-12d6-2c645327cb5a",
          "code": "653918",
          "comments": "ORPHAN DRUG|Designated|Treatment of amyotrophic lateral sclerosis",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=653918",
          "code_system": "FDA ORPHAN DRUG",
          "references": [
            "6d18b462-a8b6-5eab-6075-69c1454fcaaa"
          ]
        },
        {
          "uuid": "47fad30b-7ffc-0e4b-496e-79affd6e2b1a",
          "code": "C319",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Respiratory System[C78273]|Anti-asthmatic Agent[C29712]|Bronchodilator",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C319",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6d18b462-a8b6-5eab-6075-69c1454fcaaa"
          ]
        },
        {
          "uuid": "338908a9-3d16-4407-a1ae-91ef708135da",
          "code": "XTZ6AXU7KN",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "05852fc6-ba66-00e7-be00-32aa8c26dee9",
          "code": "673",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/673",
          "code_system": "DRUG CENTRAL",
          "references": [
            "6d18b462-a8b6-5eab-6075-69c1454fcaaa"
          ]
        },
        {
          "uuid": "8eba4e2a-6edc-c732-8201-61167514dbcd",
          "code": "174690",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:174690",
          "code_system": "CHEBI",
          "references": [
            "6d18b462-a8b6-5eab-6075-69c1454fcaaa"
          ]
        },
        {
          "uuid": "0f3d440d-6d98-a7c3-dcbb-f2e3e74d55a9",
          "code": "XTZ6AXU7KN",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=XTZ6AXU7KN",
          "code_system": "DAILYMED",
          "references": [
            "37dc31d6-f804-7922-6869-71cbd7ff723a"
          ]
        },
        {
          "uuid": "d3e95e79-7d0b-bd50-b243-1f4c4ab0f52b",
          "code": "758633",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=758633",
          "code_system": "NSC",
          "references": [
            "367f8809-b32e-eba0-d759-70d60dbdb252"
          ]
        },
        {
          "uuid": "1d278d07-a558-97ef-46a9-4d238eb4e1b1",
          "code": "100000080213",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2826ae57-a36a-84e8-1a62-eb102154f52e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "73b3e2eb-ec4b-4ba4-8f40-ebb536dbebe4",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "14984b10-428e-489a-8920-57612b637a6b",
            "refuuid": "ba466016-d780-4b1d-af7d-58baa95f7590",
            "name": "CLENBUTEROL",
            "unii": "XTZ6AXU7KN",
            "linking_id": "XTZ6AXU7KN",
            "ref_pname": "CLENBUTEROL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "222453cb-4d1b-400e-b294-2dac956eca9d",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "beb92cb8-2f82-48aa-9c7e-45009e6f8c13",
            "refuuid": "00cc8f7d-717a-49b4-a458-e0a2471f09fe",
            "name": "CLENBUTEROL HYDROCHLORIDE",
            "unii": "GOR5747GWU",
            "linking_id": "GOR5747GWU",
            "ref_pname": "CLENBUTEROL HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "30cf0b81-8c1f-4b5c-b774-6cf7b7b3ed2d",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "84caafab-19fd-4913-85e8-87b79fe02290",
            "refuuid": "3ff3e8f5-1c97-4393-8ea8-ee09b78718cf",
            "name": "CLENBUTEROL, (S)-",
            "unii": "32SXB5VH2O",
            "linking_id": "32SXB5VH2O",
            "ref_pname": "CLENBUTEROL, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8e175885-7ce2-43f2-b8c0-87a5a655e53d",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "506d88b1-f779-42c4-96fb-81c272ac7f84",
            "refuuid": "1f5c923c-68bd-44fa-ac9f-15b739f99e6a",
            "name": "CLENBUTEROL, (R)-",
            "unii": "95Q3052YP1",
            "linking_id": "95Q3052YP1",
            "ref_pname": "CLENBUTEROL, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e4719688-f692-4c5e-a0b7-8e24547db222",
          "amount": {
            "uuid": "1b1b6f07-df9d-4e94-8039-707830ced0b3"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "38e70d3f-db2b-4ae4-b6a6-a0189e26faf6"
          ],
          "related_substance": {
            "uuid": "553642c7-dfe1-433d-98bf-23e895b0b47f",
            "refuuid": "04f991eb-cb98-4c0a-a78e-dc888fd6146d",
            "name": "4-AMINO-3,5-DICHLOROBENZOIC ACID",
            "unii": "BIK7NS3B2F",
            "linking_id": "BIK7NS3B2F",
            "ref_pname": "4-AMINO-3,5-DICHLOROBENZOIC ACID"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "866e9de1-d774-4f80-8b25-fb1725df1878",
          "name": "CLENBUTEROL",
          "stdName": "CLENBUTEROL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "adb0f714-3383-43d0-a5d7-38f7a4862e73",
            "85eab505-f22a-4c04-b10e-9c59e21fcaee",
            "881d6868-5791-4b59-84ec-cfbac5b0ba8a",
            "fb6787f8-524c-4f25-8998-7a35fddcad7c",
            "6c46cf1f-424c-4ae8-9cfd-73609b67eda0",
            "6bc65bbd-bed0-426b-9d94-e5ed06e02586",
            "e8e5953e-75db-48fd-aa11-4e963bcacc8f"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "fa3769a8-8854-4b8e-967a-ed58e907f466",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "0eefc076-b216-478b-af71-30252eae22cc",
          "name": "CLENBUTEROL [MI]",
          "stdName": "CLENBUTEROL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6bc65bbd-bed0-426b-9d94-e5ed06e02586"
          ],
          "display_name": false
        },
        {
          "uuid": "d121987e-45a4-427d-99d6-f5d204dfaff8",
          "name": "CONTRASPASMIN",
          "stdName": "CONTRASPASMIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "899b9283-daf3-4cb6-9734-3bf48fc9be10",
            "5cf68ab5-8e51-4f1d-8b1a-a9ed2b6c781e"
          ],
          "display_name": false
        },
        {
          "uuid": "5c2d8f61-7645-5528-2bbd-9e0f75c2cfc0",
          "name": "Clenbuterol [WHO-DD]",
          "stdName": "CLENBUTEROL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f248e4bc-2a06-5d1d-2853-79d33b605957"
          ],
          "display_name": false
        },
        {
          "uuid": "ac2f7318-f554-4b39-a22d-a51a426dca83",
          "name": "NAB 365",
          "stdName": "NAB 365",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc458a9c-5031-4ca7-9021-8fa66c9ad8a4"
          ],
          "display_name": false
        },
        {
          "uuid": "e566306f-544e-f231-069c-27ec1b778500",
          "name": "NSC-758633",
          "stdName": "NSC-758633",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "367f8809-b32e-eba0-d759-70d60dbdb252"
          ],
          "display_name": false
        },
        {
          "uuid": "9f553dc9-9cc4-4d4d-b891-22c5e15ca5ce",
          "name": "PLANIPART",
          "stdName": "PLANIPART",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "899b9283-daf3-4cb6-9734-3bf48fc9be10",
            "5cf68ab5-8e51-4f1d-8b1a-a9ed2b6c781e"
          ],
          "display_name": false
        },
        {
          "uuid": "6a3d2606-d813-47a0-ae7b-c45540dd7f07",
          "name": "clenbuterol [INN]",
          "stdName": "CLENBUTEROL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb6787f8-524c-4f25-8998-7a35fddcad7c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e8e5953e-75db-48fd-aa11-4e963bcacc8f",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cc458a9c-5031-4ca7-9021-8fa66c9ad8a4",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb6787f8-524c-4f25-8998-7a35fddcad7c",
          "citation": "INN Proposed List 28",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL28.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6bc65bbd-bed0-426b-9d94-e5ed06e02586",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "899b9283-daf3-4cb6-9734-3bf48fc9be10",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5cf68ab5-8e51-4f1d-8b1a-a9ed2b6c781e",
          "citation": "D07713",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c46cf1f-424c-4ae8-9cfd-73609b67eda0",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9523d3de-646b-48e5-a843-6afb1014b769",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389918000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3cb9fd43-300b-40e8-afe0-bcad5e15b9e8",
          "citation": "SRS import [XTZ6AXU7KN]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=XTZ6AXU7KN",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389918000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85eab505-f22a-4c04-b10e-9c59e21fcaee",
          "citation": "CLENBUTEROL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "adb0f714-3383-43d0-a5d7-38f7a4862e73",
          "citation": "CLENBUTEROL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "881d6868-5791-4b59-84ec-cfbac5b0ba8a",
          "citation": "CLENBUTEROL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "16a4f2bc-1c28-a1be-e731-6191514317cc",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=37148-27-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6d18b462-a8b6-5eab-6075-69c1454fcaaa",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "77a5ff78-9aeb-4158-85a5-77067d40e5ea",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "38e70d3f-db2b-4ae4-b6a6-a0189e26faf6",
          "citation": "Drug Metab Dispos. 1998 Jan;26(1):28-35.",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "367f8809-b32e-eba0-d759-70d60dbdb252",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "37dc31d6-f804-7922-6869-71cbd7ff723a",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "f248e4bc-2a06-5d1d-2853-79d33b605957",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2826ae57-a36a-84e8-1a62-eb102154f52e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "94c7c5d2-d000-42b2-b698-a3168990fe60",
          "id": "94c7c5d2-d000-42b2-b698-a3168990fe60",
          "molfile": "\n  Marvin  01132107432D          \n\n 17 17  0  0  0  0            999 V2000\n    3.3994   -3.4155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6836   -3.0036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2717   -3.7194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0955   -2.2878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9700   -2.5936    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9694   -1.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2559   -1.3606    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.2546   -0.5295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5369   -1.7761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1707   -1.3636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8860   -1.7747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6002   -1.3564    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8895   -2.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6085   -3.0135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1778   -3.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1787   -3.8395    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.5356   -2.6013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 17  2  0  0  0  0\n 10 11  2  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 15  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)NCC(c1cc(c(c(c1)Cl)N)Cl)O",
          "formula": "C12H18Cl2N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "210e4afc-0b82-4e31-a213-2d4d29b2f40e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "277.1905",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ba466016-d780-4b1d-af7d-58baa95f7590",
      "version": "20",
      "structure": {
        "id": "b2331fce-3d7d-4394-8c7a-a544982d10fb",
        "molfile": "\n  Marvin  01132109142D          \n\n 17 17  0  0  0  0            999 V2000\n   -0.8895   -2.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8860   -1.7747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1778   -3.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5369   -1.7761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5356   -2.6013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1707   -1.3636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9700   -2.5936    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2559   -1.3606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6836   -3.0036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9694   -1.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6085   -3.0135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6002   -1.3564    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1787   -3.8395    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.2546   -0.5295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3994   -3.4155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2717   -3.7194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0955   -2.2878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  2  1  0  0  0  0\n  7 10  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11  1  1  0  0  0  0\n 12  2  1  0  0  0  0\n 13  3  1  0  0  0  0\n 14  8  1  0  0  0  0\n 15  9  1  0  0  0  0\n 16  9  1  0  0  0  0\n 17  9  1  0  0  0  0\n  6  4  2  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)NCC(c1cc(c(c(c1)Cl)N)Cl)O",
        "formula": "C12H18Cl2N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "277.1905",
        "optical_activity": "( + / - )",
        "references": [
          "3cb9fd43-300b-40e8-afe0-bcad5e15b9e8",
          "e8e5953e-75db-48fd-aa11-4e963bcacc8f",
          "fb6787f8-524c-4f25-8998-7a35fddcad7c"
        ],
        "stereo_centers": 1
      },
      "unii": "XTZ6AXU7KN"
    }
  ]
}