{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "2a17145f-e6aa-4209-8a96-f55376f31809", "code": "XTE7SG6GLQ", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "6090190c-009e-455b-8868-b6b532faf714", "code": "6992-11-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=6992-11-6", "code_system": "CAS", "references": [ "9e728026-454d-4b49-8c04-f46ba5a4188a", "36b8dfa2-bcad-4b97-9d97-7de1f22c13d4" ] }, { "uuid": "68e22941-3e1a-40bb-b8d3-c0a2d44bec3d", "code": "230-258-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.027.508", "code_system": "ECHA (EC/EINECS)", "references": [ "9e728026-454d-4b49-8c04-f46ba5a4188a" ] }, { "uuid": "89bdb654-e9d9-6c7f-104a-c62fb7c6c9f7", "code": "DTXSID5064542", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5064542", "code_system": "EPA CompTox", "references": [ "c4384b76-1828-16f8-c087-7c1ea9a9429a" ] }, { "uuid": "865b6ae8-4d84-41eb-bd9d-0b7149ba0db6", "code": "81471", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/81471", "code_system": "PUBCHEM" } ], "substance_class": "chemical", "names": [ { "uuid": "82f948c3-0669-4979-98aa-149b448f3f1e", "name": "2-Naphthalenecarboxamide, 4-((2,5-dichlorophenyl)azo)-N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)-3-hydroxy-", "stdName": "2-NAPHTHALENECARBOXAMIDE, 4-((2,5-DICHLOROPHENYL)AZO)-N-(2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-5-YL)-3-HYDROXY-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b39d521f-c7e1-475b-bd38-e646de01b226", "75c7c967-2248-4a1f-9dc7-cd9fe19e6643" ], "display_name": false }, { "uuid": "c2b7c0a3-719e-4e95-8c84-4f2b490c7b98", "name": "2-Naphthalenecarboxamide, 4-[2-(2,5-dichlorophenyl)diazenyl]-N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)-3-hydroxy-", "stdName": "2-NAPHTHALENECARBOXAMIDE, 4-(2-(2,5-DICHLOROPHENYL)DIAZENYL)-N-(2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-5-YL)-3-HYDROXY-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "36b8dfa2-bcad-4b97-9d97-7de1f22c13d4" ], "display_name": false }, { "uuid": "1dc4c08a-b788-4738-b2ed-3001ee0e9768", "name": "4-((2,5-Dichlorophenyl)azo)-N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)-3-hydroxynaphthalene-2-carboxamide", "stdName": "4-((2,5-DICHLOROPHENYL)AZO)-N-(2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-5-YL)-3-HYDROXYNAPHTHALENE-2-CARBOXAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3336e296-8e39-411a-b79b-fcbd7032efe1" ], "display_name": true }, { "uuid": "623a9196-1d2e-45eb-9fa0-ac2a9ac85c0e", "name": "4-[2-(2,5-Dichlorophenyl)diazenyl]-N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)-3-hydroxy-2-naphthalenecarboxamide", "stdName": "4-(2-(2,5-DICHLOROPHENYL)DIAZENYL)-N-(2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-5-YL)-3-HYDROXY-2-NAPHTHALENECARBOXAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "36b8dfa2-bcad-4b97-9d97-7de1f22c13d4" ], "display_name": false } ], "references": [ { "uuid": "75c7c967-2248-4a1f-9dc7-cd9fe19e6643", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b39d521f-c7e1-475b-bd38-e646de01b226", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9e728026-454d-4b49-8c04-f46ba5a4188a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393757000, "tags": [ "NOMEN" ] }, { "uuid": "c4384b76-1828-16f8-c087-7c1ea9a9429a", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6992-11-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "36b8dfa2-bcad-4b97-9d97-7de1f22c13d4", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "3336e296-8e39-411a-b79b-fcbd7032efe1", "citation": "PUBCHEM", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/81471", "doc_type": "PUBCHEM", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "fd66e740-9902-4baa-b7a5-f3fd667a031b", "id": "fd66e740-9902-4baa-b7a5-f3fd667a031b", "molfile": "\n Marvin 01132113072D \n\n 34 38 0 0 0 0 999 V2000\n 4.2633 -0.2246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2608 0.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5428 1.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5424 1.8374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2599 2.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2629 3.0782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9796 3.4867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6934 3.0674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6864 2.2467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9696 1.8382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9700 1.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6854 0.6022 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6871 -0.2228 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4023 -0.6338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1164 -0.2206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8330 -0.6352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5480 -0.2237 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8313 -1.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1173 -1.8692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4049 -1.4617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6918 -1.8768 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8290 0.5989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1112 1.0114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8297 -0.2218 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1157 -0.6350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3980 -0.2225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6885 -0.6350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6885 -1.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0706 -2.0179 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4091 -2.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.4867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2363 -2.6786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3980 -1.8725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1157 -1.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 11 2 0 0 0 0\n 4 3 2 0 0 0 0\n 22 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 10 5 2 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 15 14 1 0 0 0 0\n 14 20 2 0 0 0 0\n 16 15 2 0 0 0 0\n 16 17 1 0 0 0 0\n 18 16 1 0 0 0 0\n 19 18 2 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 23 22 2 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 34 25 2 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 33 28 2 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 30 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\nM END", "smiles": "c1ccc2c(c1)cc(c(c2/N=N/c3cc(ccc3Cl)Cl)O)C(=O)Nc4ccc5c(c4)[nH]c(=O)[nH]5", "formula": "C24H15Cl2N5O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "17715627-64dd-45f5-a3b1-9edaf4f87639" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "492.3144", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "538c6783-d327-4450-8bdc-6f8ad4764136", "version": "6", "structure": { "id": "56ff1069-b2db-49da-a8d3-be38f6e23b3a", "molfile": "\n Marvin 01132104312D \n\n 34 38 0 0 0 0 999 V2000\n 2.1112 1.0114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8290 0.5989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8297 -0.2218 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1157 -0.6350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3980 -0.2225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6885 -0.6350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6885 -1.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0706 -2.0179 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4091 -2.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.4867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2363 -2.6786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3980 -1.8725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1157 -1.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5428 1.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2608 0.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2633 -0.2246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9700 1.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6854 0.6022 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6871 -0.2228 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4023 -0.6338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4049 -1.4617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1173 -1.8692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8313 -1.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8330 -0.6352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5480 -0.2237 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1164 -0.2206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6918 -1.8768 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9696 1.8382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2599 2.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2629 3.0782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9796 3.4867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6934 3.0674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6864 2.2467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5424 1.8374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 7 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 4 2 0 0 0 0\n 2 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 24 26 1 0 0 0 0\n 26 20 2 0 0 0 0\n 21 27 1 0 0 0 0\n 17 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 2 0 0 0 0\n 32 33 1 0 0 0 0\n 33 28 2 0 0 0 0\n 29 34 1 0 0 0 0\n 34 14 2 0 0 0 0\nM END", "smiles": "c1ccc2c(c1)cc(c(c2/N=N/c3cc(ccc3Cl)Cl)O)C(=O)Nc4ccc5c(c4)[nH]c(=O)[nH]5", "formula": "C24H15Cl2N5O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "492.3144", "optical_activity": "NONE", "references": [ "75c7c967-2248-4a1f-9dc7-cd9fe19e6643" ], "stereo_centers": 0 }, "unii": "XTE7SG6GLQ" } ] }