{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fdb164b1-0c64-4b32-b432-b0d7a09799ab",
          "code": "94400-98-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=94400-98-3",
          "code_system": "CAS",
          "references": [
            "fbd25796-ff13-410e-842c-9a576aca24c9",
            "1f7d47a1-e71a-4674-93d5-e53cc03929df"
          ]
        },
        {
          "uuid": "e5185ee3-f1aa-4cd3-a627-ef4c6e2f3d9a",
          "code": "44152188",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44152188",
          "code_system": "PUBCHEM",
          "references": [
            "fbd25796-ff13-410e-842c-9a576aca24c9"
          ]
        },
        {
          "uuid": "b988a2c4-345e-456d-877a-fde152e0887b",
          "code": "XRC77M2QTL",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "767abb84-d0be-1aaa-6855-1e2e37dfe4b9",
          "code": "DTXSID50888739",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50888739",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "da61b368-2f13-418d-87ea-4f9ecfa88f6e",
          "name": "MOXALONE",
          "stdName": "MOXALONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f7d47a1-e71a-4674-93d5-e53cc03929df"
          ],
          "display_name": true
        },
        {
          "uuid": "64dc7a8b-09db-470f-ac86-b4f49436b4f3",
          "name": "NAPHTH(2,3-B)OXIRENE, 1A,2,3,4,5,6,7,7A-OCTAHYDRO-1A,3,3,4,6,6-HEXAMETHYL-, (1A.ALPHA.,4.ALPHA.,7A.ALPHA.)-",
          "stdName": "NAPHTH(2,3-B)OXIRENE, 1A,2,3,4,5,6,7,7A-OCTAHYDRO-1A,3,3,4,6,6-HEXAMETHYL-, (1A.ALPHA.,4.ALPHA.,7A.ALPHA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f7d47a1-e71a-4674-93d5-e53cc03929df"
          ],
          "display_name": false
        },
        {
          "uuid": "e63cb551-df1b-47b1-b092-9e71425c3f70",
          "name": "NAPHTH(2,3-B)OXIRENE, 1A,2,3,4,5,6,7,7A-OCTAHYDRO-1A,3,3,4,6,6-HEXAMETHYL-, (1AR,4S,7AS)-REL-",
          "stdName": "NAPHTH(2,3-B)OXIRENE, 1A,2,3,4,5,6,7,7A-OCTAHYDRO-1A,3,3,4,6,6-HEXAMETHYL-, (1AR,4S,7AS)-REL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d15a151f-43d6-4a68-a43e-a4654412b172"
          ],
          "display_name": false
        },
        {
          "uuid": "929a88fa-5938-458d-bb43-7ed3822c2e91",
          "name": "REL-(1AR,4S,7AS)-1A,2,3,4,5,6,7,7A-OCTAHYDRO-1A,3,3,4,6,6-HEXAMETHYLNAPHTH(2,3-B)OXIRENE",
          "stdName": "REL-(1AR,4S,7AS)-1A,2,3,4,5,6,7,7A-OCTAHYDRO-1A,3,3,4,6,6-HEXAMETHYLNAPHTH(2,3-B)OXIRENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f7d47a1-e71a-4674-93d5-e53cc03929df"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d15a151f-43d6-4a68-a43e-a4654412b172",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fbd25796-ff13-410e-842c-9a576aca24c9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392263000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f7d47a1-e71a-4674-93d5-e53cc03929df",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "446679b1-dea7-4f38-bd6f-a9c255c42c9f",
          "id": "446679b1-dea7-4f38-bd6f-a9c255c42c9f",
          "molfile": "\n  Marvin  04092210222D          \n\n 18 20  0  0  1  0            999 V2000\n   11.5607   -3.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5607   -4.4890    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.2703   -4.8951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2703   -3.2449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9842   -3.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9842   -4.4890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6938   -4.8993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4078   -4.4847    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.4078   -3.6597    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.6938   -3.2492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9935   -5.0660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6764   -5.6089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6805   -5.4807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6805   -2.6592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6764   -2.5311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1174   -4.0699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8426   -4.8951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4078   -2.8347    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 17  1  1  0  0  0\n  3  6  1  0  0  0  0\n  3 12  1  0  0  0  0\n  3 13  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 14  1  0  0  0  0\n  4 15  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5 10  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 11  1  0  0  0  0\n  8 16  1  6  0  0  0\n  9 10  1  0  0  0  0\n  9 16  1  6  0  0  0\n  9 18  1  1  0  0  0\nM  END",
          "smiles": "C[C@H]1CC(C)(C)C2=C(C[C@]3(C)[C@]([H])(C2)O3)C1(C)C",
          "formula": "C16H26O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9b3a26c9-de3d-4a97-b0ac-0e0bcd6d77ab"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "234.3776",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fc3e7d3e-0857-4937-9388-18a96e48ccda",
      "version": "5",
      "structure": {
        "id": "05c00431-a0cd-4b66-af26-f2384e7b928e",
        "molfile": "\n   JSDraw204092210222D\n\n 18 20  0  0  0  0              0 V2000\n   21.8603   -6.9282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8603   -8.4882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2021   -9.2561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2021   -6.1359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.5520   -6.9282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.5520   -8.4882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8938   -9.2642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.2439   -8.4801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.2439   -6.9201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8938   -6.1440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.3513   -9.5794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9700  -10.6060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0867  -10.3636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0867   -5.0284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9700   -4.7860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5857   -7.6959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.5023   -9.2561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8159   -5.3601    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 17  1  1  0  0  0\n  3  6  1  0  0  0  0\n  3 12  1  0  0  0  0\n  3 13  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 14  1  0  0  0  0\n  4 15  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5 10  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 11  1  1  0  0  0\n  8 16  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 16  1  0  0  0  0\n  9 18  1  1  0  0  0\nM  END",
        "smiles": "C[C@H]1CC(C)(C)C2=C(C[C@]3(C)[C@]([H])(C2)O3)C1(C)C",
        "formula": "C16H26O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "234.3776",
        "optical_activity": "( + / - )",
        "references": [
          "d15a151f-43d6-4a68-a43e-a4654412b172",
          "1f7d47a1-e71a-4674-93d5-e53cc03929df"
        ],
        "stereo_centers": 3
      },
      "unii": "XRC77M2QTL"
    }
  ]
}