{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "95719238-d76d-476a-9515-cf334407bd32", "code": "88122-99-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=88122-99-0", "code_system": "CAS", "references": [ "b467d535-bce2-49e4-8f92-f6963cdd88a4", "6dab67f4-e028-4b15-913f-1e343c8481b0" ] }, { "uuid": "d87ff321-1299-422f-8929-eb073caf9456", "code": "ETHYLHEXYL TRIAZONE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Ethylhexyl_triazone", "code_system": "WIKIPEDIA", "references": [ "b467d535-bce2-49e4-8f92-f6963cdd88a4" ] }, { "uuid": "7b9ba3c8-65a9-4707-9104-06d5d6d48f47", "code": "1314657", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1314657/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "b467d535-bce2-49e4-8f92-f6963cdd88a4" ] }, { "uuid": "5d3d6b77-f7b2-44ab-93b0-5599e075e1fd", "code": "m5134", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m5134?q=authorize", "code_system": "MERCK INDEX", "references": [ "b467d535-bce2-49e4-8f92-f6963cdd88a4" ] }, { "uuid": "6c1095f4-4d30-4f0f-a167-f6b780eeef60", "code": "SUB35560", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "b467d535-bce2-49e4-8f92-f6963cdd88a4" ] }, { "uuid": "c623dc24-fdd0-4d3c-8e2a-ced632ffbb03", "code": "159201", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/159201", "code_system": "PUBCHEM", "references": [ "b467d535-bce2-49e4-8f92-f6963cdd88a4" ] }, { "uuid": "62b79e2d-2842-9a90-5255-fcad292a660f", "code": "DB15469", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB15469", "code_system": "DRUG BANK", "references": [ "539aed27-47c5-5c1c-413d-21187e863c8e" ] }, { "uuid": "1a56c242-37dd-432b-be6f-87a3bada5a90", "code": "XQN8R9SAK4", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "f14a66f2-3de7-c8e7-5a1e-09cc3c7de750", "code": "1265537", "type": "PRIMARY", "url": "https://store.usp.org/product/1265537", "code_system": "RS_ITEM_NUM", "references": [ "539aed27-47c5-5c1c-413d-21187e863c8e" ] }, { "uuid": "76d2493e-160e-f4aa-cb01-604189b11711", "code": "DTXSID90868994", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90868994", "code_system": "EPA CompTox", "references": [ "539aed27-47c5-5c1c-413d-21187e863c8e" ] }, { "uuid": "04e08334-8d29-debe-28d0-9b48eba47c45", "code": "XQN8R9SAK4", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=XQN8R9SAK4", "code_system": "DAILYMED", "references": [ "1895d5f9-9691-af39-19c0-348ac09929e4" ] }, { "uuid": "1b205669-3d5d-4b11-7d6e-331724e2caef", "code": "100000128488", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "b116b2f9-f338-b308-cf7f-be096d51a8e4" ] } ], "relationships": [ { "uuid": "0abf063f-c7cc-4082-9247-30b80ab6c158", "type": "IMPURITY->PARENT", "related_substance": { "uuid": "34b458f0-2de8-4098-beb2-3722497175e8", "refuuid": "2181606b-2947-49b8-80c2-f012781b82f7", "name": "2-ETHYLHEXYL 4-AMINOBENZOATE", "unii": "7CHI67POY6", "linking_id": "7CHI67POY6", "ref_pname": "2-ETHYLHEXYL 4-AMINOBENZOATE" } }, { "uuid": "2bc2d9d0-4b0b-44cf-a3f0-eed1ccd26eb2", "type": "IMPURITY->PARENT", "related_substance": { "uuid": "06289429-1bd5-4249-ade4-5f8dcc7b4d8b", "refuuid": "2956ceba-b115-4e9e-ae52-b9169ea2a83d", "name": "BIS(2-ETHYLHEXYL) 4,4'-(6-(4-(ETHOXYCARBONYL)PHENYLAMINO)-1,3,5-TRIAZINE-2,4-DIYL)BIS(AZANEDIYL)DIBENZOATE", "unii": "U3LH3ER7ES", "linking_id": "U3LH3ER7ES", "ref_pname": "BIS(2-ETHYLHEXYL) 4,4'-(6-(4-(ETHOXYCARBONYL)PHENYLAMINO)-1,3,5-TRIAZINE-2,4-DIYL)BIS(AZANEDIYL)DIBENZOATE" } }, { "uuid": "03d9ba01-443e-4e03-93de-c1e830cb300d", "type": "IMPURITY->PARENT", "related_substance": { "uuid": "8a156f05-6e27-44be-b739-79d97a323d86", "refuuid": "1af908bd-2510-4524-acdd-41ad1bd3df7b", "name": "4-(4,6-BIS(4-((2-ETHYLHEXYLOXY)CARBONYL)PHENYLAMINO)-1,3,5-TRIAZIN-2-YLAMINO)BENZOIC ACID", "unii": "LHA5LZ0JSC", "linking_id": "LHA5LZ0JSC", "ref_pname": "4-(4,6-BIS(4-((2-ETHYLHEXYLOXY)CARBONYL)PHENYLAMINO)-1,3,5-TRIAZIN-2-YLAMINO)BENZOIC ACID" } } ], "substance_class": "chemical", "names": [ { "uuid": "07ab9b51-fc29-42da-9852-bd88c3b72a7a", "name": "2,4,6-TRIANILINO-(P-CARBO-2'-ETHYLHEXYL-1'-OXY)-1,3,5-TRIAZINE", "stdName": "2,4,6-TRIANILINO-(P-CARBO-2'-ETHYLHEXYL-1'-OXY)-1,3,5-TRIAZINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "85967eb2-ff26-4701-a32a-ab3af075603c", "baed555f-eb0a-4ce9-af3a-e56d3fa9d89a" ], "display_name": false }, { "uuid": "24fc833c-5b92-406b-89d8-e0f38b7d641f", "name": "BENZOIC ACID, 4,4',4''-(1,3,5-TRIAZINE-2,4,6-TRIYLTRIIMINO)TRIS-, TRIS(2-ETHYLHEXYL) ESTER", "stdName": "BENZOIC ACID, 4,4',4''-(1,3,5-TRIAZINE-2,4,6-TRIYLTRIIMINO)TRIS-, TRIS(2-ETHYLHEXYL) ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "85967eb2-ff26-4701-a32a-ab3af075603c", "baed555f-eb0a-4ce9-af3a-e56d3fa9d89a" ], "display_name": false }, { "uuid": "ce23c55f-f247-4d37-af3e-5079efb0a1ec", "name": "ETHYLHEXYL TRIAZONE", "stdName": "ETHYLHEXYL TRIAZONE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "be7065d8-e78e-48ce-8da1-cd7c806c558c", "56f24969-ccbe-4f3c-b458-8a9e32ecf6c7", "ca0fde2d-8010-41eb-8ae7-ec1793448333", "96ae73c9-5420-4a9b-a8e0-372b2f20d018", "85967eb2-ff26-4701-a32a-ab3af075603c", "4fc88a07-cb47-4bff-ac06-fa2584d46567", "fb936d08-29b3-4b15-8e9a-747da9756d9b", "c9169bf0-1d91-4eb6-b55a-e82b9f0eb3ec", "baed555f-eb0a-4ce9-af3a-e56d3fa9d89a" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "5174e297-b1f4-4cd9-be0e-4f15a1f782fe", "name_org": "INCI" } ] }, { "uuid": "99b00de2-ff64-46a5-be55-1f592ec7d467", "name": "ETHYLHEXYL TRIAZONE [MI]", "stdName": "ETHYLHEXYL TRIAZONE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "56f24969-ccbe-4f3c-b458-8a9e32ecf6c7", "baed555f-eb0a-4ce9-af3a-e56d3fa9d89a" ], "display_name": false }, { "uuid": "d742d735-3c2a-4592-9df1-54f1cc12228a", "name": "ETHYLHEXYL TRIAZONE [USP-RS]", "stdName": "ETHYLHEXYL TRIAZONE [USP-RS]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c9169bf0-1d91-4eb6-b55a-e82b9f0eb3ec", "baed555f-eb0a-4ce9-af3a-e56d3fa9d89a" ], "display_name": false }, { "uuid": "eda1db3a-b0d1-497d-872d-27d86ffd950a", "name": "OCTIL TRIAZONE", "stdName": "OCTIL TRIAZONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3d1151d1-3add-449b-bcee-ad6b0fd1e61f", "baed555f-eb0a-4ce9-af3a-e56d3fa9d89a" ], "display_name": false }, { "uuid": "db3b1c1e-8212-0337-6326-16d8baeb86f4", "name": "Octyl triazone [WHO-DD]", "stdName": "OCTYL TRIAZONE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c0b3b0ae-49f2-4665-9f44-63cd0d46cc0c" ], "display_name": false }, { "uuid": "a21c398c-7b54-4809-8644-e5086957857e", "name": "UVINUL T 150", "stdName": "UVINUL T 150", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "85967eb2-ff26-4701-a32a-ab3af075603c", "baed555f-eb0a-4ce9-af3a-e56d3fa9d89a" ], "display_name": false } ], "references": [ { "uuid": "be7065d8-e78e-48ce-8da1-cd7c806c558c", "citation": "USP Pending Standard", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "96ae73c9-5420-4a9b-a8e0-372b2f20d018", "citation": "USP PENDING STANDARD", "doc_type": "USP PHARMACOPOEIAL FORUM", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "56f24969-ccbe-4f3c-b458-8a9e32ecf6c7", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "baed555f-eb0a-4ce9-af3a-e56d3fa9d89a", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "85967eb2-ff26-4701-a32a-ab3af075603c", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c9169bf0-1d91-4eb6-b55a-e82b9f0eb3ec", "citation": "USP/NF", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3d1151d1-3add-449b-bcee-ad6b0fd1e61f", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b467d535-bce2-49e4-8f92-f6963cdd88a4", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390721000, "tags": [ "NOMEN" ] }, { "uuid": "6fba3cfd-6ef6-479f-a228-4b84bb3bfcd0", "citation": "SRS import [XQN8R9SAK4]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=XQN8R9SAK4", "doc_type": "SRS", "public_domain": true, "document_date": 1493390721000, "tags": [ "NOMEN" ] }, { "uuid": "fb936d08-29b3-4b15-8e9a-747da9756d9b", "citation": "ETHYLHEXYL TRIAZONE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "4fc88a07-cb47-4bff-ac06-fa2584d46567", "citation": "ETHYLHEXYL TRIAZONE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "ca0fde2d-8010-41eb-8ae7-ec1793448333", "citation": "ETHYLHEXYL TRIAZONE [USP-RS]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "539aed27-47c5-5c1c-413d-21187e863c8e", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "6dab67f4-e028-4b15-913f-1e343c8481b0", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "c0b3b0ae-49f2-4665-9f44-63cd0d46cc0c", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "1895d5f9-9691-af39-19c0-348ac09929e4", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "b116b2f9-f338-b308-cf7f-be096d51a8e4", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "81b97e8b-4674-4405-8f81-4a1171fb3cd1", "id": "81b97e8b-4674-4405-8f81-4a1171fb3cd1", "molfile": "\n Marvin 01132106442D \n\n 60 63 0 0 0 0 999 V2000\n -0.3270 -6.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0424 -5.8222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0424 -4.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7519 -4.5842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7519 -3.7608 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n -2.4731 -3.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1877 -3.7640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0453 -3.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3241 -3.7608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3826 -3.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3818 -2.5228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1037 -3.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8157 -3.3490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5303 -3.7607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5287 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2440 -4.9989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9593 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6746 -5.0036 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3901 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1055 -4.9989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8208 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5346 -5.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2495 -4.5928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2486 -3.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5318 -3.3530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8199 -3.7664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9581 -3.3462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9509 -2.5199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6764 -3.7521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3860 -3.3345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1043 -3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 11.8138 -3.3228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5263 -3.7316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1101 -4.5638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3977 -4.9813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3977 -5.8076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6823 -6.2193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3907 -3.7582 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6733 -3.3489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6689 -2.5199 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3823 -2.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0982 -2.5160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8111 -2.0998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8072 -1.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0844 -0.8634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3744 -1.2820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5201 -0.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5146 -0.0284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2385 -1.2631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9494 -0.8439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6677 -1.2497 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 10.3772 -0.8322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0955 -1.2380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6706 -2.0731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3860 -2.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0984 -2.0673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8138 -2.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9612 -3.7608 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8194 -5.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1043 -4.5924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 8 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 12 10 1 0 0 0 0\n 13 12 1 0 0 0 0\n 12 60 2 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 59 15 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 58 17 2 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 19 38 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 26 21 2 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 24 27 1 0 0 0 0\n 25 26 1 0 0 0 0\n 27 28 2 0 0 0 0\n 27 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 34 1 0 0 0 0\n 32 33 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 38 39 2 0 0 0 0\n 39 40 1 0 0 0 0\n 39 58 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 46 41 2 0 0 0 0\n 42 43 2 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 2 0 0 0 0\n 44 47 1 0 0 0 0\n 45 46 1 0 0 0 0\n 47 48 2 0 0 0 0\n 47 49 1 0 0 0 0\n 49 50 1 0 0 0 0\n 50 51 1 0 0 0 0\n 51 52 1 0 0 0 0\n 51 54 1 0 0 0 0\n 52 53 1 0 0 0 0\n 54 55 1 0 0 0 0\n 55 56 1 0 0 0 0\n 56 57 1 0 0 0 0\n 60 59 1 0 0 0 0\nM END", "smiles": "CCCCC(CC)COC(=O)c1ccc(cc1)Nc2nc(Nc3ccc(cc3)C(=O)OCC(CC)CCCC)nc(Nc4ccc(cc4)C(=O)OCC(CC)CCCC)n2", "formula": "C48H66N6O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a27b9572-f84c-40da-9e3c-017346325db6" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "823.0761", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "f0789739-c309-42e4-a3e8-85370cc4d4d9", "version": "17", "structure": { "id": "442249ca-eddd-4ff5-929f-2ddbc2d8d2bd", "molfile": "\n Marvin 01132103352D \n\n 60 63 0 0 0 0 999 V2000\n 1.1037 -3.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3826 -3.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3241 -3.7608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0453 -3.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7519 -3.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7519 -4.5842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5287 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2440 -4.9989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9593 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1043 -3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8138 -3.3228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2486 -3.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9581 -3.3462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6764 -3.7521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3860 -3.3345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1101 -4.5638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3977 -4.9813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3901 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1055 -4.9989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8208 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9612 -3.7608 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6746 -5.0036 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3907 -3.7582 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6733 -3.3489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6689 -2.5199 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3823 -2.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0982 -2.5160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8111 -2.0998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8072 -1.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0844 -0.8634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3744 -1.2820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5201 -0.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2385 -1.2631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5146 -0.0284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5346 -5.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2495 -4.5928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5318 -3.3530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8199 -3.7664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9509 -2.5199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5303 -3.7607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8157 -3.3490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1043 -4.5924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8194 -5.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4731 -3.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3818 -2.5228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1877 -3.7640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0424 -4.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0424 -5.8222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3270 -6.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3977 -5.8076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6823 -6.2193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5263 -3.7316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9494 -0.8439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6677 -1.2497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3772 -0.8322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0955 -1.2380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6706 -2.0731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3860 -2.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0984 -2.0673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8138 -2.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15 10 1 0 0 0 0\n 29 32 1 0 0 0 0\n 2 3 1 0 0 0 0\n 32 33 1 0 0 0 0\n 10 16 1 0 0 0 0\n 5 6 1 0 0 0 0\n 16 17 1 0 0 0 0\n 10 11 1 0 0 0 0\n 1 2 1 0 0 0 0\n 32 34 2 0 0 0 0\n 18 19 1 0 0 0 0\n 20 35 2 0 0 0 0\n 35 36 1 0 0 0 0\n 36 12 2 0 0 0 0\n 19 20 1 0 0 0 0\n 12 37 1 0 0 0 0\n 37 38 2 0 0 0 0\n 38 20 1 0 0 0 0\n 21 9 2 0 0 0 0\n 13 39 2 0 0 0 0\n 7 40 2 0 0 0 0\n 9 22 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 1 2 0 0 0 0\n 22 18 2 0 0 0 0\n 1 42 1 0 0 0 0\n 3 4 1 0 0 0 0\n 42 43 2 0 0 0 0\n 43 7 1 0 0 0 0\n 18 23 1 0 0 0 0\n 5 44 1 0 0 0 0\n 23 24 2 0 0 0 0\n 24 21 1 0 0 0 0\n 2 45 2 0 0 0 0\n 44 46 1 0 0 0 0\n 24 25 1 0 0 0 0\n 6 47 1 0 0 0 0\n 7 8 1 0 0 0 0\n 47 48 1 0 0 0 0\n 25 26 1 0 0 0 0\n 48 49 1 0 0 0 0\n 12 13 1 0 0 0 0\n 17 50 1 0 0 0 0\n 26 27 2 0 0 0 0\n 50 51 1 0 0 0 0\n 4 5 1 0 0 0 0\n 11 52 1 0 0 0 0\n 27 28 1 0 0 0 0\n 33 53 1 0 0 0 0\n 13 14 1 0 0 0 0\n 53 54 1 0 0 0 0\n 28 29 2 0 0 0 0\n 54 55 1 0 0 0 0\n 8 9 1 0 0 0 0\n 55 56 1 0 0 0 0\n 29 30 1 0 0 0 0\n 54 57 1 0 0 0 0\n 14 15 1 0 0 0 0\n 57 58 1 0 0 0 0\n 30 31 2 0 0 0 0\n 58 59 1 0 0 0 0\n 31 26 1 0 0 0 0\n 59 60 1 0 0 0 0\nM END", "smiles": "CCCCC(CC)COC(=O)c1ccc(cc1)Nc2nc(Nc3ccc(cc3)C(=O)OCC(CC)CCCC)nc(Nc4ccc(cc4)C(=O)OCC(CC)CCCC)n2", "formula": "C48H66N6O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "823.0761", "optical_activity": "UNSPECIFIED", "references": [ "be7065d8-e78e-48ce-8da1-cd7c806c558c", "6fba3cfd-6ef6-479f-a228-4b84bb3bfcd0" ], "stereo_centers": 3 }, "unii": "XQN8R9SAK4" } ] }