{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "348599e4-570d-4212-ad41-eddb13a31b3c",
          "code": "68049-83-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=68049-83-2",
          "code_system": "CAS",
          "references": [
            "5cb1a2c5-346d-4688-be60-cb4b92ec41ab",
            "c686fd8d-edc7-4730-8cf0-8c674b4c4b1c"
          ]
        },
        {
          "uuid": "15f1d9c4-8071-45d4-9413-819cb0d19f1a",
          "code": "119016",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:89",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "5cb1a2c5-346d-4688-be60-cb4b92ec41ab"
          ]
        },
        {
          "uuid": "495a1aaa-3954-4802-aa45-53b2215ecf4a",
          "code": "m2157",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2157?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "5cb1a2c5-346d-4688-be60-cb4b92ec41ab"
          ]
        },
        {
          "uuid": "afebef5e-1642-424e-a868-e2f78b9e3462",
          "code": "443029",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/443029",
          "code_system": "PUBCHEM",
          "references": [
            "5cb1a2c5-346d-4688-be60-cb4b92ec41ab"
          ]
        },
        {
          "uuid": "88ca3bda-275c-6daa-69c7-7be5c9e66860",
          "code": "DTXSID2034205",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2034205",
          "code_system": "EPA CompTox",
          "references": [
            "31aeb7fc-4929-2bf5-da38-bb2c9701a05c"
          ]
        },
        {
          "uuid": "781700f4-ebe2-70e1-98e0-46fbca19cbfd",
          "code": "2943",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:2943",
          "code_system": "CHEBI",
          "references": [
            "7aed4029-4999-b86a-6964-490e84e7ee34"
          ]
        },
        {
          "uuid": "4fb7bbf1-1b7f-4d79-8052-86e9fdd4407a",
          "code": "XQK9668H5M",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3b548503-a82b-8bec-9145-9be673dd0a73",
          "code": "azafenidin",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/azafenidin.html",
          "code_system": "ALANWOOD",
          "references": [
            "ab8f65b2-15b0-d529-a1a0-08129f1d31fc"
          ]
        },
        {
          "uuid": "6a579549-3031-591e-61a2-864d669d2d6f",
          "code": "300000053045",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "27ad63ca-6311-ebcf-fb0d-9dabaa49b455"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ce19fbb1-d9c1-4321-912e-ad68ab429261",
          "name": "2-(2,4-DICHLORO-5-(2-PROPYNYLOXY)PHENYL)-5,6,7,8-TETRAHYDRO-1,2,4-TRIAZOLO(4,3-A)PYRIDIN-3(2H)-ONE",
          "stdName": "2-(2,4-DICHLORO-5-(2-PROPYNYLOXY)PHENYL)-5,6,7,8-TETRAHYDRO-1,2,4-TRIAZOLO(4,3-A)PYRIDIN-3(2H)-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8224dc44-74ec-4ac8-af53-9c679a82bb0d",
            "c94eaa8b-3d63-4a07-b175-d27b9549f580"
          ],
          "display_name": false
        },
        {
          "uuid": "7919ec0e-74f4-439a-b656-c33d64ab84a2",
          "name": "2-(2,4-DICHLORO-5-PROP-2-YNYLOXYPHENYL)-5,6,7,8-TETRAHYDRO-1,2,4-TRIAZOLO(4,3-A)PYRIDIN-3(2H)-ONE",
          "stdName": "2-(2,4-DICHLORO-5-PROP-2-YNYLOXYPHENYL)-5,6,7,8-TETRAHYDRO-1,2,4-TRIAZOLO(4,3-A)PYRIDIN-3(2H)-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09cbc0d1-2f3a-4832-bc23-3d05ea9e5da4",
            "c94eaa8b-3d63-4a07-b175-d27b9549f580"
          ],
          "display_name": false
        },
        {
          "uuid": "56ed9e6a-6566-408a-8ea6-9e86524c7c01",
          "name": "AZAFENIDIN",
          "stdName": "AZAFENIDIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "230685e4-e906-40a9-8fd0-e003bf8bf199",
            "435e480b-90ce-45c6-9cbd-b3d6d43492d7",
            "a99cf127-7657-4db3-bf36-965874a16667",
            "3cfad412-b12b-48a6-aae7-1c2b0eb6149f",
            "c6fbd34a-3ad5-4f1f-889d-3f64bdab5f74",
            "b8b6d180-5562-4171-a57e-1f69159d319a"
          ],
          "display_name": true
        },
        {
          "uuid": "ac1559ff-2c2f-426e-8e5f-d55c85f25c48",
          "name": "AZAFENIDIN [ISO]",
          "stdName": "AZAFENIDIN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a99cf127-7657-4db3-bf36-965874a16667",
            "c6fbd34a-3ad5-4f1f-889d-3f64bdab5f74"
          ],
          "display_name": false
        },
        {
          "uuid": "a2dfaf55-4cb1-42c6-a2db-864034b39dee",
          "name": "AZAFENIDIN [MI]",
          "stdName": "AZAFENIDIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a99cf127-7657-4db3-bf36-965874a16667",
            "3cfad412-b12b-48a6-aae7-1c2b0eb6149f"
          ],
          "display_name": false
        },
        {
          "uuid": "6fb5f4c9-cd9f-47e5-aeaf-389788fe6668",
          "name": "DPX-R6447",
          "stdName": "DPX-R6447",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a99cf127-7657-4db3-bf36-965874a16667",
            "0ff7d245-31f6-45ef-a4c6-007ad979ed98"
          ],
          "display_name": false
        },
        {
          "uuid": "cbf0625b-77e3-44ec-abd5-73efbee71fe3",
          "name": "EVOLUS",
          "stdName": "EVOLUS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a99cf127-7657-4db3-bf36-965874a16667",
            "0ff7d245-31f6-45ef-a4c6-007ad979ed98"
          ],
          "display_name": false
        },
        {
          "uuid": "449a5fbb-c486-4f6b-831b-069a92dde6a7",
          "name": "MILESTONE",
          "stdName": "MILESTONE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a99cf127-7657-4db3-bf36-965874a16667",
            "0ff7d245-31f6-45ef-a4c6-007ad979ed98"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "230685e4-e906-40a9-8fd0-e003bf8bf199",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c94eaa8b-3d63-4a07-b175-d27b9549f580",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09cbc0d1-2f3a-4832-bc23-3d05ea9e5da4",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8224dc44-74ec-4ac8-af53-9c679a82bb0d",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3cfad412-b12b-48a6-aae7-1c2b0eb6149f",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a99cf127-7657-4db3-bf36-965874a16667",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ff7d245-31f6-45ef-a4c6-007ad979ed98",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6fbd34a-3ad5-4f1f-889d-3f64bdab5f74",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5cb1a2c5-346d-4688-be60-cb4b92ec41ab",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390951000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93536dd0-853a-4a45-bb19-03b19710da4a",
          "citation": "SRS import [XQK9668H5M]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=XQK9668H5M",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390951000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ee50290-8f7d-40c3-aeaf-23cf095f9730",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "435e480b-90ce-45c6-9cbd-b3d6d43492d7",
          "citation": "AZAFENIDIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b8b6d180-5562-4171-a57e-1f69159d319a",
          "citation": "AZAFENIDIN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "31aeb7fc-4929-2bf5-da38-bb2c9701a05c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=68049-83-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ab8f65b2-15b0-d529-a1a0-08129f1d31fc",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "7aed4029-4999-b86a-6964-490e84e7ee34",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c686fd8d-edc7-4730-8cf0-8c674b4c4b1c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "27ad63ca-6311-ebcf-fb0d-9dabaa49b455",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "81b832df-2a10-4b77-82d0-ef9316587412",
          "id": "81b832df-2a10-4b77-82d0-ef9316587412",
          "molfile": "\n  Marvin  01132106442D          \n\n 22 24  0  0  0  0            999 V2000\n    9.3158   -7.7043    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.6013   -7.2918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8868   -7.7043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1724   -7.2918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4579   -7.7043    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.1724   -6.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8868   -6.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6013   -6.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3158   -6.0543    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3158   -5.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0302   -4.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7448   -4.4043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4579   -6.0543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3717   -5.2338    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5647   -5.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1521   -4.3478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3272   -4.3478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9147   -5.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3272   -5.7768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1521   -5.7768    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7042   -6.3898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5327   -7.1969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  8  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n 13  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  3  0  0  0  0\n 13 14  1  0  0  0  0\n 21 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 20  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\nM  END",
          "smiles": "C#CCOc1cc(c(cc1Cl)Cl)-n2c(=O)n3CCCCc3n2",
          "formula": "C15H13Cl2N3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6be4b197-c690-4db1-9e52-31d91766aa55"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "338.1891",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "93d7266b-cf68-47c9-96fb-becdcaf86104",
      "version": "6",
      "structure": {
        "id": "a0a63b74-ea36-417d-b45c-827f7735dd18",
        "molfile": "\n  Marvin  01132108212D          \n\n 22 24  0  0  0  0            999 V2000\n    4.3272   -4.3478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9147   -5.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3272   -5.7768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1521   -5.7768    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5647   -5.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3717   -5.2338    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4579   -6.0543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1724   -6.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8868   -6.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6013   -6.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6013   -7.2918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8868   -7.7043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1724   -7.2918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4579   -7.7043    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.3158   -7.7043    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.3158   -6.0543    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3158   -5.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0302   -4.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7448   -4.4043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7042   -6.3898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5327   -7.1969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1521   -4.3478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13  8  1  0  0  0  0\n 13 14  1  0  0  0  0\n 11 15  1  0  0  0  0\n 10 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  3  0  0  0  0\n 20  7  1  0  0  0  0\n  4 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n  5 22  1  0  0  0  0\n  1 22  1  0  0  0  0\nM  END",
        "smiles": "C#CCOc1cc(c(cc1Cl)Cl)-n2c(=O)n3CCCCc3n2",
        "formula": "C15H13Cl2N3O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "338.1891",
        "optical_activity": "NONE",
        "references": [
          "93536dd0-853a-4a45-bb19-03b19710da4a",
          "8ee50290-8f7d-40c3-aeaf-23cf095f9730"
        ],
        "stereo_centers": 0
      },
      "unii": "XQK9668H5M"
    }
  ]
}