{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f3fc1ff9-5124-4bf6-b342-788f5d5d1c80",
          "code": "2644-45-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2644-45-3",
          "code_system": "CAS",
          "references": [
            "ba7644a3-7c30-4fe5-9b00-a377a7cc8f1c",
            "5484fe0d-2e6e-40a2-a2cc-e9e5638e2355"
          ]
        },
        {
          "uuid": "8201bf66-8012-4899-a4c0-4f76a80e2597",
          "code": "220-152-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.018.321",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ba7644a3-7c30-4fe5-9b00-a377a7cc8f1c"
          ]
        },
        {
          "uuid": "9c92d494-96c0-4061-b4d1-c9e254a1ee45",
          "code": "75844",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/75844",
          "code_system": "PUBCHEM",
          "references": [
            "ba7644a3-7c30-4fe5-9b00-a377a7cc8f1c"
          ]
        },
        {
          "uuid": "6c009618-a6fd-287c-286b-755180b0d081",
          "code": "DTXSID3062572",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3062572",
          "code_system": "EPA CompTox",
          "references": [
            "caa218ef-eab0-949c-8339-8e838b654c10"
          ]
        },
        {
          "uuid": "08d70e3c-10eb-4890-ab3d-61ef17e814ee",
          "code": "XPS9Q0ZPYZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a3eb8033-4484-4a8d-9bcc-5b01969aa4e7",
          "name": "(CARBOXYMETHYL)DECYLDIMETHYLAMMONIUM HYDROXIDE, INNER SALT",
          "stdName": "(CARBOXYMETHYL)DECYLDIMETHYLAMMONIUM HYDROXIDE, INNER SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "817e5da0-a102-4497-8488-0ca0f00566ce",
            "0416bdb0-867b-4cf7-a27c-c7abe3e7757d"
          ],
          "display_name": false
        },
        {
          "uuid": "c989cdf6-1896-45ab-b1bc-e27dfaa59e75",
          "name": "1-DECANAMINIUM, N-(CARBOXYMETHYL)-N,N-DIMETHYL-, HYDROXIDE, INNER SALT",
          "stdName": "1-DECANAMINIUM, N-(CARBOXYMETHYL)-N,N-DIMETHYL-, HYDROXIDE, INNER SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "817e5da0-a102-4497-8488-0ca0f00566ce",
            "0416bdb0-867b-4cf7-a27c-c7abe3e7757d"
          ],
          "display_name": false
        },
        {
          "uuid": "14ef0d7c-703f-4c5b-9174-a9c114ba57f6",
          "name": "1-DECANAMINIUM, N-(CARBOXYMETHYL)-N,N-DIMETHYL-, INNER SALT",
          "stdName": "1-DECANAMINIUM, N-(CARBOXYMETHYL)-N,N-DIMETHYL-, INNER SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "817e5da0-a102-4497-8488-0ca0f00566ce",
            "0416bdb0-867b-4cf7-a27c-c7abe3e7757d"
          ],
          "display_name": false
        },
        {
          "uuid": "6e5d3190-6e95-4385-95bb-a3d539c65fe1",
          "name": "AMMONIUM, (CARBOXYMETHYL)DECYLDIMETHYL-, HYDROXIDE, INNER SALT",
          "stdName": "AMMONIUM, (CARBOXYMETHYL)DECYLDIMETHYL-, HYDROXIDE, INNER SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "817e5da0-a102-4497-8488-0ca0f00566ce",
            "0416bdb0-867b-4cf7-a27c-c7abe3e7757d"
          ],
          "display_name": false
        },
        {
          "uuid": "8bbd61d5-867a-4e70-921f-e35a11994832",
          "name": "CAPRYL BETAINE",
          "stdName": "CAPRYL BETAINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "817e5da0-a102-4497-8488-0ca0f00566ce",
            "53aba810-aed5-47ac-9fb3-002dbd9f8c31"
          ],
          "display_name": false
        },
        {
          "uuid": "2a4dfdb3-d028-4433-8b19-532268fa7bfd",
          "name": "DECYL BETAINE",
          "stdName": "DECYL BETAINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "817e5da0-a102-4497-8488-0ca0f00566ce",
            "352927dd-6bf5-4c2a-9db3-5044159a57d7",
            "a740888d-3bd6-4e83-93c4-fde26b624997",
            "1f7f864c-8dd2-4516-a98c-6d3f17280361"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "0f185baf-4588-4949-a5cc-e4ddd0ab4be2",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "59fdf322-6b05-4de1-9688-6578988dbad3",
          "name": "DECYL DIMETHYL GLYCINE",
          "stdName": "DECYL DIMETHYL GLYCINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "817e5da0-a102-4497-8488-0ca0f00566ce",
            "a740888d-3bd6-4e83-93c4-fde26b624997"
          ],
          "display_name": false
        },
        {
          "uuid": "a8330e20-14f0-4b52-b218-d588726a4fcd",
          "name": "DECYLDIMETHYLAMMONIOACETATE",
          "stdName": "DECYLDIMETHYLAMMONIOACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "817e5da0-a102-4497-8488-0ca0f00566ce",
            "0416bdb0-867b-4cf7-a27c-c7abe3e7757d"
          ],
          "display_name": false
        },
        {
          "uuid": "20b7639c-ef64-4fb3-a29d-d5f388a1e0be",
          "name": "LONZAINE 10S",
          "stdName": "LONZAINE 10S",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "817e5da0-a102-4497-8488-0ca0f00566ce",
            "0416bdb0-867b-4cf7-a27c-c7abe3e7757d"
          ],
          "display_name": false
        },
        {
          "uuid": "70b81f80-5cda-4bf1-bcc0-063455b1219e",
          "name": "N-(CARBOXYMETHYL)-N,N-DIMETHYL-1-DECANAMINIUM HYDROXIDE, INNER SALT",
          "stdName": "N-(CARBOXYMETHYL)-N,N-DIMETHYL-1-DECANAMINIUM HYDROXIDE, INNER SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "817e5da0-a102-4497-8488-0ca0f00566ce",
            "a740888d-3bd6-4e83-93c4-fde26b624997"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "352927dd-6bf5-4c2a-9db3-5044159a57d7",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0416bdb0-867b-4cf7-a27c-c7abe3e7757d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "817e5da0-a102-4497-8488-0ca0f00566ce",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a740888d-3bd6-4e83-93c4-fde26b624997",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53aba810-aed5-47ac-9fb3-002dbd9f8c31",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba7644a3-7c30-4fe5-9b00-a377a7cc8f1c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390931000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35e7f0ea-d749-4ff2-bf0f-c7c3d278281f",
          "citation": "SRS import [XPS9Q0ZPYZ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=XPS9Q0ZPYZ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390931000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08fae770-16d0-468b-aeff-dc767d011a52",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f7f864c-8dd2-4516-a98c-6d3f17280361",
          "citation": "DECYL BETAINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "caa218ef-eab0-949c-8339-8e838b654c10",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2644-45-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5484fe0d-2e6e-40a2-a2cc-e9e5638e2355",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8512932f-1160-4f3f-88cb-337d1b11e336",
          "id": "8512932f-1160-4f3f-88cb-337d1b11e336",
          "molfile": "\n  Marvin  01132106542D          \n\n 17 16  0  0  0  0            999 V2000\n    1.3167   -6.4363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0284   -6.0192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7456   -6.4270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4574   -6.0099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1745   -6.4177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8863   -6.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6034   -6.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3152   -5.9913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0323   -6.3992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7441   -5.9820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4613   -6.3899    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    8.8783   -7.1016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0534   -7.1070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1730   -5.9727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8901   -6.3806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8955   -7.2056    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.6019   -5.9635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 15  2  0  0  0  0\nM  CHG  2  11   1  16  -1\nM  END",
          "smiles": "CCCCCCCCCC[N+](C)(C)CC(=O)[O-]",
          "formula": "C14H29NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8f309cbe-a1ca-4dc8-ac08-1b49e654569f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "243.3861",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b60fe31c-dd89-4891-be35-28e6629734af",
      "version": "4",
      "structure": {
        "id": "cb5e7a74-9c09-4763-92ae-86192b2c4f35",
        "molfile": "\n  Marvin  01132110302D          \n\n 17 16  0  0  0  0            999 V2000\n    9.8901   -6.3806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8955   -7.2056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6019   -5.9635    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.1730   -5.9727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8783   -7.1016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0534   -7.1070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4613   -6.3899    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.7441   -5.9820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0323   -6.3992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3152   -5.9913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6034   -6.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8863   -6.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1745   -6.4177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4574   -6.0099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7456   -6.4270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3167   -6.4363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0284   -6.0192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  3  1  1  0  0  0  0\n  1  4  1  0  0  0  0\n  7  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 17 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n  7  4  1  0  0  0  0\nM  CHG  2   3  -1   7   1\nM  END",
        "smiles": "CCCCCCCCCC[N+](C)(C)CC(=O)[O-]",
        "formula": "C14H29NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "243.3861",
        "optical_activity": "NONE",
        "references": [
          "35e7f0ea-d749-4ff2-bf0f-c7c3d278281f",
          "08fae770-16d0-468b-aeff-dc767d011a52"
        ],
        "stereo_centers": 0
      },
      "unii": "XPS9Q0ZPYZ"
    }
  ]
}