{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "bcc98b0f-05b6-43d5-97c7-6c67bd94247a", "code": "68937-40-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=68937-40-6", "code_system": "CAS", "references": [ "59345bb2-7d6c-436a-b8ea-023863514514", "ef70edad-1380-4c24-a553-0375fced1bcd" ] }, { "uuid": "b006944d-a047-4db6-8453-dfe1c13f60ca", "code": "91700", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91700", "code_system": "PUBCHEM", "references": [ "59345bb2-7d6c-436a-b8ea-023863514514" ] }, { "uuid": "c7349721-0dc6-292e-427b-d26db7ca1b05", "code": "DTXSID20872645", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20872645", "code_system": "EPA CompTox", "references": [ "4e84e1a9-9c45-9618-3f1d-54c62ba7b646" ] }, { "uuid": "f81f419d-decd-4344-b710-2782fb87a9d7", "code": "XPE77R3GK8", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "e0e37397-53cb-46cf-8a0b-57680181398a", "name": "DURAD 220B", "stdName": "DURAD 220B", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "83631fb4-23d8-4842-ba10-9d0900aa558c" ], "display_name": false }, { "uuid": "57086d6c-a55b-4501-af63-ddd39d1727e5", "name": "PHENOL, ISOBUTYLENATED, PHOSPHATE (3:1)", "stdName": "PHENOL, ISOBUTYLENATED, PHOSPHATE (3:1)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "533877a7-9513-458e-8c11-70674517488a" ], "display_name": false }, { "uuid": "98a13335-2d7a-4f96-90f9-6dce42cc2b31", "name": "TRIISOBUTYLENATED TRIPHENYLPHOSPHATE", "stdName": "TRIISOBUTYLENATED TRIPHENYLPHOSPHATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "228113f6-37ad-498c-abc5-be948d86283a" ], "display_name": true } ], "references": [ { "uuid": "533877a7-9513-458e-8c11-70674517488a", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "83631fb4-23d8-4842-ba10-9d0900aa558c", "citation": "chemtura msds", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "228113f6-37ad-498c-abc5-be948d86283a", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "59345bb2-7d6c-436a-b8ea-023863514514", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392740000, "tags": [ "NOMEN" ] }, { "uuid": "b6177d63-dc3f-42c4-adc7-4ee4306947a4", "citation": "SRS import [XPE77R3GK8]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=XPE77R3GK8", "doc_type": "SRS", "public_domain": true, "document_date": 1493392740000, "tags": [ "NOMEN" ] }, { "uuid": "4e84e1a9-9c45-9618-3f1d-54c62ba7b646", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=68937-40-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ef70edad-1380-4c24-a553-0375fced1bcd", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "01b7d8ab-21d3-45e5-95a8-1abcbd4ca72e", "id": "01b7d8ab-21d3-45e5-95a8-1abcbd4ca72e", "molfile": "\n Marvin 01132100252D \n\n 35 37 0 0 0 0 999 V2000\n 8.1561 -6.7833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9019 -5.8273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5731 -5.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2103 -5.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7833 -5.0544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1900 -4.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7629 -3.6306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9392 -3.6408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5323 -2.9289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1256 -2.2170 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7086 -1.5052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4035 -2.6238 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6814 -3.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6713 -3.8543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9492 -4.2611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2475 -3.8441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4645 -4.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7729 -3.7933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -4.2306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7729 -2.9390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2577 -3.0204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9696 -2.6136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8375 -1.8102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6307 -1.3628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3425 -1.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0646 -1.3729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0646 -0.5492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8274 -0.0915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4884 -0.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1698 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4782 -1.3119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3527 -0.1322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6409 -0.5288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5323 -4.3628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9595 -5.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 35 2 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 34 2 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 10 23 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 22 2 0 0 0 0\n 14 15 2 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 21 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 33 2 0 0 0 0\n 25 26 2 0 0 0 0\n 27 26 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 32 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 34 35 1 0 0 0 0\nM END", "smiles": "CC(C)Cc1ccc(cc1)OP(=O)(Oc2ccc(cc2)CC(C)C)Oc3ccc(cc3)CC(C)C", "formula": "C30H39O4P", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "cd62afdb-b436-4469-9e18-6ec60477b0ef" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "494.6031", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "REPRESENTATIVE", "uuid": "0ebfb864-be37-49aa-af69-7a08b976d4d1", "version": "3", "structure": { "id": "26eee9f6-75e9-4f48-b598-0ce55371d454", "molfile": "\n Marvin 01132102092D \n\n 35 37 0 0 0 0 999 V2000\n 5.1256 -2.2170 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5323 -2.9289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4035 -2.6238 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8375 -1.8102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7086 -1.5052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9392 -3.6408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6814 -3.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6307 -1.3628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7629 -3.6306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6713 -3.8543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3425 -1.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5323 -4.3628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9696 -2.6136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6409 -0.5288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7833 -5.0544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2475 -3.8441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0646 -0.5492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1900 -4.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9492 -4.2611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0646 -1.3729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9595 -5.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2577 -3.0204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3527 -0.1322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2103 -5.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4645 -4.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8274 -0.0915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9019 -5.8273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7729 -3.7933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4884 -0.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1561 -6.7833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5731 -5.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -4.2306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7729 -2.9390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1698 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4782 -1.3119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 0 0 0 0\n 1 5 2 0 0 0 0\n 2 6 1 0 0 0 0\n 3 7 1 0 0 0 0\n 4 8 1 0 0 0 0\n 6 9 2 0 0 0 0\n 6 12 1 0 0 0 0\n 7 10 2 0 0 0 0\n 7 13 1 0 0 0 0\n 8 11 2 0 0 0 0\n 8 14 1 0 0 0 0\n 9 18 1 0 0 0 0\n 10 19 1 0 0 0 0\n 11 20 1 0 0 0 0\n 12 21 2 0 0 0 0\n 13 22 2 0 0 0 0\n 14 23 2 0 0 0 0\n 15 18 2 0 0 0 0\n 15 21 1 0 0 0 0\n 15 24 1 0 0 0 0\n 16 19 2 0 0 0 0\n 16 22 1 0 0 0 0\n 16 25 1 0 0 0 0\n 17 20 2 0 0 0 0\n 17 23 1 0 0 0 0\n 17 26 1 0 0 0 0\n 24 27 1 0 0 0 0\n 25 28 1 0 0 0 0\n 26 29 1 0 0 0 0\n 27 30 1 0 0 0 0\n 27 31 1 0 0 0 0\n 28 32 1 0 0 0 0\n 28 33 1 0 0 0 0\n 29 34 1 0 0 0 0\n 29 35 1 0 0 0 0\nM END", "smiles": "CC(C)Cc1ccc(cc1)OP(=O)(Oc2ccc(cc2)CC(C)C)Oc3ccc(cc3)CC(C)C", "formula": "C30H39O4P", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "494.6031", "optical_activity": "NONE", "references": [ "b6177d63-dc3f-42c4-adc7-4ee4306947a4", "533877a7-9513-458e-8c11-70674517488a" ], "stereo_centers": 0 }, "unii": "XPE77R3GK8" } ] }