{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3c6fdfc2-a206-4a23-a22a-e15460681920",
          "code": "7299-99-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7299-99-2",
          "code_system": "CAS",
          "references": [
            "e478237f-f550-47ee-84de-5df097180983",
            "f332b2f4-bfcc-4fb1-a18e-1ec8f2c24043"
          ]
        },
        {
          "uuid": "8fa8aa6a-d2fe-4c97-8bc5-4e8fdbe79df4",
          "code": "230-743-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.027.948",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e478237f-f550-47ee-84de-5df097180983"
          ]
        },
        {
          "uuid": "034674c8-260e-4c28-9ec7-dc17728195ea",
          "code": "1426406",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426406/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e478237f-f550-47ee-84de-5df097180983"
          ]
        },
        {
          "uuid": "a601f8c3-83e2-419f-9cd7-65a242740970",
          "code": "110956",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/110956",
          "code_system": "PUBCHEM",
          "references": [
            "e478237f-f550-47ee-84de-5df097180983"
          ]
        },
        {
          "uuid": "8b7f7321-b148-4759-8a72-1aa97e8632c4",
          "code": "XJ7052W897",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "f332b2f4-bfcc-4fb1-a18e-1ec8f2c24043"
          ]
        },
        {
          "uuid": "f0c016c2-76a8-ade9-5cfc-16a4e3dac12b",
          "code": "DTXSID90864037",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90864037",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "ea88fd62-0cf9-705f-0bad-1777a7726cc1",
          "code": "XJ7052W897",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=XJ7052W897",
          "code_system": "DAILYMED",
          "references": [
            "7d269181-7cc4-4a54-9316-eaee68d5fab9"
          ]
        },
        {
          "uuid": "ba433345-a94b-4985-97c7-497ec881fbda",
          "code": "1671073-03-2",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1671073-03-2",
          "code_system": "CAS",
          "references": [
            "f332b2f4-bfcc-4fb1-a18e-1ec8f2c24043"
          ]
        },
        {
          "uuid": "ccdfba00-3c06-4286-9345-29678795fd76",
          "code": "1402132-17-5",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1402132-17-5",
          "code_system": "CAS",
          "references": [
            "f332b2f4-bfcc-4fb1-a18e-1ec8f2c24043"
          ]
        },
        {
          "uuid": "4caaa4d1-bf75-472d-a386-f4d355eeae15",
          "code": "120097-45-2",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=120097-45-2",
          "code_system": "CAS",
          "references": [
            "f332b2f4-bfcc-4fb1-a18e-1ec8f2c24043"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1df9c50c-e71d-481f-a57c-7ec484b575fd",
          "name": "AEC PENTAERYTHRITYL TETRAETHYLHEXANOATE",
          "stdName": "AEC PENTAERYTHRITYL TETRAETHYLHEXANOATE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8616bb6-23a8-42ca-950d-1d72c580793b",
            "c09944eb-b501-4a5d-8a56-a599bdee3597"
          ],
          "display_name": false
        },
        {
          "uuid": "3a58f4b8-5259-4a22-a921-a193e89616da",
          "name": "DUB PTO",
          "stdName": "DUB PTO",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8616bb6-23a8-42ca-950d-1d72c580793b",
            "c09944eb-b501-4a5d-8a56-a599bdee3597"
          ],
          "display_name": false
        },
        {
          "uuid": "768aeab2-3b5a-4e83-a116-c594a29fdead",
          "name": "HATCOL 5140",
          "stdName": "HATCOL 5140",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8616bb6-23a8-42ca-950d-1d72c580793b",
            "c09944eb-b501-4a5d-8a56-a599bdee3597"
          ],
          "display_name": false
        },
        {
          "uuid": "ff7eee86-78cb-4992-be58-1fc04671e79c",
          "name": "HEST P-4-O",
          "stdName": "HEST P-4-O",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8616bb6-23a8-42ca-950d-1d72c580793b",
            "c09944eb-b501-4a5d-8a56-a599bdee3597"
          ],
          "display_name": false
        },
        {
          "uuid": "2fe61572-6178-41ad-b0a4-90e2eca3bdd3",
          "name": "Hexanoic acid, 2-ethyl-, 1,1′-[2,2-bis[[(2-ethyl-1-oxohexyl)oxy]methyl]-1,3-propanediyl] ester",
          "stdName": "HEXANOIC ACID, 2-ETHYL-, 1,1'-(2,2-BIS(((2-ETHYL-1-OXOHEXYL)OXY)METHYL)-1,3-PROPANEDIYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f332b2f4-bfcc-4fb1-a18e-1ec8f2c24043"
          ],
          "display_name": false
        },
        {
          "uuid": "6c46f80d-6827-4b4b-aacf-79cc91dbacc1",
          "name": "Hexanoic acid, 2-ethyl-, neopentanetetrayl ester",
          "stdName": "HEXANOIC ACID, 2-ETHYL-, NEOPENTANETETRAYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f332b2f4-bfcc-4fb1-a18e-1ec8f2c24043"
          ],
          "display_name": false
        },
        {
          "uuid": "51e76b05-fa44-4258-9dbb-798cf511506c",
          "name": "Hexanoic acid, 2-ethyl-, pentaerythritol tetraester",
          "stdName": "HEXANOIC ACID, 2-ETHYL-, PENTAERYTHRITOL TETRAESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f332b2f4-bfcc-4fb1-a18e-1ec8f2c24043"
          ],
          "display_name": false
        },
        {
          "uuid": "e03ae0ba-8c20-44c6-9413-0aff2dcedb21",
          "name": "Hexanoic acid, 2-ethyl-, tetraester with pentaerythritol",
          "stdName": "HEXANOIC ACID, 2-ETHYL-, TETRAESTER WITH PENTAERYTHRITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f332b2f4-bfcc-4fb1-a18e-1ec8f2c24043"
          ],
          "display_name": false
        },
        {
          "uuid": "22c0761c-213e-4b84-832b-80b1c325cc07",
          "name": "KAK PTO",
          "stdName": "KAK PTO",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8616bb6-23a8-42ca-950d-1d72c580793b",
            "c09944eb-b501-4a5d-8a56-a599bdee3597"
          ],
          "display_name": false
        },
        {
          "uuid": "e9c8ad7b-952b-4216-b2f1-3892acf5f076",
          "name": "NIKKOL PENTALAN-408",
          "stdName": "NIKKOL PENTALAN-408",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8616bb6-23a8-42ca-950d-1d72c580793b",
            "c09944eb-b501-4a5d-8a56-a599bdee3597"
          ],
          "display_name": false
        },
        {
          "uuid": "079ad99b-691a-4bd3-a678-f78ff58442bc",
          "name": "NIKKOL PENTARATE-408",
          "stdName": "NIKKOL PENTARATE-408",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8616bb6-23a8-42ca-950d-1d72c580793b",
            "c09944eb-b501-4a5d-8a56-a599bdee3597"
          ],
          "display_name": false
        },
        {
          "uuid": "58bb6c62-d537-402c-8dbc-6d721e4fe56f",
          "name": "NS-408",
          "stdName": "NS-408",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8616bb6-23a8-42ca-950d-1d72c580793b",
            "c09944eb-b501-4a5d-8a56-a599bdee3597"
          ],
          "display_name": false
        },
        {
          "uuid": "a52ee2fe-0367-4bc2-9a9d-5f8d1015fcbd",
          "name": "PENTAERYTHRITOL TETRA-2-ETHYLHEXANOATE",
          "stdName": "PENTAERYTHRITOL TETRA-2-ETHYLHEXANOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8616bb6-23a8-42ca-950d-1d72c580793b",
            "c09944eb-b501-4a5d-8a56-a599bdee3597"
          ],
          "display_name": false
        },
        {
          "uuid": "0c256573-e58e-4fee-9bb8-538fcf9ed61c",
          "name": "PENTAERYTHRITYL TETRA-(2-ETHYL HEXANOATE)",
          "stdName": "PENTAERYTHRITYL TETRA-(2-ETHYL HEXANOATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "164105ac-d2e5-435b-8852-6d13a46ee321",
            "c8616bb6-23a8-42ca-950d-1d72c580793b"
          ],
          "display_name": false
        },
        {
          "uuid": "5d5cb8f9-0e38-4f8b-8483-657dd69a9cdf",
          "name": "Pentaerythritol, tetrakis(2-ethylhexanoate)",
          "stdName": "PENTAERYTHRITOL, TETRAKIS(2-ETHYLHEXANOATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f332b2f4-bfcc-4fb1-a18e-1ec8f2c24043"
          ],
          "display_name": false
        },
        {
          "uuid": "87b39f52-e73a-4f3e-b414-6165ded2eb7a",
          "name": "Pentaerythrityl Tetraethylhexanoate",
          "stdName": "PENTAERYTHRITYL TETRAETHYLHEXANOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4603dd2d-dbe2-41a9-ac3a-339bb4733d4b",
            "c8616bb6-23a8-42ca-950d-1d72c580793b",
            "c09944eb-b501-4a5d-8a56-a599bdee3597"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "259dff92-cec3-4e64-9591-1753a625f3be",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "d223da94-e1c9-4993-bff8-40c4b0328c03",
          "name": "Pentaerythrityl tetraethylhexanoate, (±)-",
          "stdName": "PENTAERYTHRITYL TETRAETHYLHEXANOATE, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8616bb6-23a8-42ca-950d-1d72c580793b",
            "2d7545ef-5e9e-47d8-b195-0c70fda69a98"
          ],
          "display_name": false
        },
        {
          "uuid": "57483c2a-13f5-4e08-81b8-b973ff5f5c0f",
          "name": "Pentaerythrityl tetraoctanoate",
          "stdName": "PENTAERYTHRITYL TETRAOCTANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "164105ac-d2e5-435b-8852-6d13a46ee321",
            "fc03da94-576e-4199-9bfa-f30140da6469"
          ],
          "display_name": false
        },
        {
          "uuid": "7babb0cf-7edd-4f6a-9dcb-8e2ee5608af8",
          "name": "Salacos 5408",
          "stdName": "SALACOS 5408",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8616bb6-23a8-42ca-950d-1d72c580793b",
            "c09944eb-b501-4a5d-8a56-a599bdee3597"
          ],
          "display_name": false
        },
        {
          "uuid": "3f14eaa8-7c91-40de-8754-24357e98c540",
          "name": "Trivent PE-48",
          "stdName": "TRIVENT PE-48",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8616bb6-23a8-42ca-950d-1d72c580793b",
            "c09944eb-b501-4a5d-8a56-a599bdee3597"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "164105ac-d2e5-435b-8852-6d13a46ee321",
          "citation": "http://www.chemicalbook.com/ChemicalProductProperty_EN_CB9322590.htm",
          "url": "http://www.chemicalbook.com/ChemicalProductProperty_EN_CB9322590.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fc03da94-576e-4199-9bfa-f30140da6469",
          "citation": "DL",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c09944eb-b501-4a5d-8a56-a599bdee3597",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8616bb6-23a8-42ca-950d-1d72c580793b",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d7545ef-5e9e-47d8-b195-0c70fda69a98",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e478237f-f550-47ee-84de-5df097180983",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391324000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5c32846-4488-443e-b0e5-d13916e39655",
          "citation": "SRS import [XJ7052W897]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=XJ7052W897",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391324000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4603dd2d-dbe2-41a9-ac3a-339bb4733d4b",
          "citation": "PENTAERYTHRITYL TETRAETHYLHEXANOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f332b2f4-bfcc-4fb1-a18e-1ec8f2c24043",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7d269181-7cc4-4a54-9316-eaee68d5fab9",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "876cb3af-4984-4b34-9841-e9dd00b57f0c",
          "id": "876cb3af-4984-4b34-9841-e9dd00b57f0c",
          "molfile": "\n  Marvin  01132107022D          \n\n 45 44  0  0  0  0            999 V2000\n   11.1516   -4.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6213   -4.0035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8088   -4.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3963   -3.4323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5838   -3.5755    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.3016   -4.3508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8320   -4.9828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0535   -2.9435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3357   -2.1683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2410   -3.0868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8285   -2.3723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0160   -2.5156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8026   -1.7187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0056   -1.5052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9337   -0.6833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6095   -0.2101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1860   -0.3346    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.5102   -0.8078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7625   -0.4592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1141    0.4873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3172    0.7008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2453    1.5227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4976    1.8713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2035   -2.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7910   -1.9444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9786   -2.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4483   -1.4557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6964   -2.8629    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.2267   -3.4949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9445   -4.2701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8839   -3.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7406   -3.8187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9282   -3.9619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6460   -4.7372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0880   -3.3374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4121   -3.8107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6256   -4.6075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4226   -4.8212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0422   -5.1909    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.2454   -4.9774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6620   -5.5608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2558   -5.9878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5800   -6.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7935   -7.2580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2102   -7.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  8  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 24 12  1  0  0  0  0\n 35 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 15  1  0  0  0  0\n 17 18  1  0  0  0  0\n 20 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  2  0  0  0  0\n 28 26  1  0  0  0  0\n 28 29  1  0  0  0  0\n 31 28  1  0  0  0  0\n 29 30  1  0  0  0  0\n 32 31  1  0  0  0  0\n 33 32  1  0  0  0  0\n 34 33  1  0  0  0  0\n 36 35  1  0  0  0  0\n 36 37  1  0  0  0  0\n 38 37  2  0  0  0  0\n 39 37  1  0  0  0  0\n 39 40  1  0  0  0  0\n 42 39  1  0  0  0  0\n 40 41  1  0  0  0  0\n 43 42  1  0  0  0  0\n 44 43  1  0  0  0  0\n 45 44  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)C(=O)OCC(COC(=O)C(CC)CCCC)(COC(=O)C(CC)CCCC)COC(=O)C(CC)CCCC",
          "formula": "C37H68O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "86ab5716-6c83-4011-86f3-cee52cdc2691"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "640.9324",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a7139966-df26-42aa-b87e-f2c9dce97763",
      "version": "7",
      "structure": {
        "id": "0c183b83-30fd-443d-8b5f-89181eb784c8",
        "molfile": "\n  Marvin  01132100522D          \n\n 45 44  0  0  0  0            999 V2000\n   11.1516   -4.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6213   -4.0035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8088   -4.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3963   -3.4323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5838   -3.5755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0535   -2.9435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3357   -2.1683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2410   -3.0868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8285   -2.3723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0160   -2.5156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8026   -1.7187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0056   -1.5052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9337   -0.6833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1860   -0.3346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1141    0.4873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3172    0.7008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2453    1.5227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4976    1.8713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5102   -0.8078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7625   -0.4592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6095   -0.2101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2035   -2.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7910   -1.9444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9786   -2.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6964   -2.8629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8839   -3.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7406   -3.8187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9282   -3.9619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6460   -4.7372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2267   -3.4949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9445   -4.2701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4483   -1.4557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0880   -3.3374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4121   -3.8107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6256   -4.6075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0422   -5.1909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2558   -5.9878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5800   -6.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7935   -7.2580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2102   -7.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2454   -4.9774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6620   -5.5608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4226   -4.8212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3016   -4.3508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8320   -4.9828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 14 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 13  2  0  0  0  0\n 22 10  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  1  0  0  0  0\n 25 30  1  0  0  0  0\n 30 31  1  0  0  0  0\n 32 24  2  0  0  0  0\n 33 10  1  0  0  0  0\n 34 33  1  0  0  0  0\n 34 35  1  0  0  0  0\n 36 35  1  0  0  0  0\n 37 36  1  0  0  0  0\n 38 37  1  0  0  0  0\n 39 38  1  0  0  0  0\n 40 39  1  0  0  0  0\n 36 41  1  0  0  0  0\n 41 42  1  0  0  0  0\n 43 35  2  0  0  0  0\n  5 44  1  0  0  0  0\n 44 45  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)C(=O)OCC(COC(=O)C(CC)CCCC)(COC(=O)C(CC)CCCC)COC(=O)C(CC)CCCC",
        "formula": "C37H68O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "640.9324",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "f5c32846-4488-443e-b0e5-d13916e39655",
          "c09944eb-b501-4a5d-8a56-a599bdee3597"
        ],
        "stereo_centers": 4
      },
      "unii": "XJ7052W897"
    }
  ]
}