{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "76762817-2844-49b3-918f-14fc9a3d1bcb",
          "code": "INS-1518",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=3893",
          "code_system": "JECFA EVALUATION",
          "references": [
            "27cc4859-8d31-415a-a237-f4af4ba36812"
          ]
        },
        {
          "uuid": "29035e89-d107-4bc8-b166-70a0bd2734a0",
          "code": "102-76-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=102-76-1",
          "code_system": "CAS",
          "references": [
            "27cc4859-8d31-415a-a237-f4af4ba36812",
            "68993fdc-a3a0-40b1-9332-61e8d1552a0e"
          ]
        },
        {
          "uuid": "1152ca81-7315-4e90-8e28-7bf204d80528",
          "code": "C82268",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C82268",
          "code_system": "NCI_THESAURUS",
          "references": [
            "27cc4859-8d31-415a-a237-f4af4ba36812"
          ]
        },
        {
          "uuid": "c42a6b4f-43a3-4965-8e67-50a7f7d0dc38",
          "code": "21 CFR 175.320",
          "comments": "PART 175 -- INDIRECT FOOD ADDITIVES: ADHESIVES AND COMPONENTS OF COATINGS|Subpart C--Substances for Use as Components of Coatings|Sec. 175.320 Resinous and polymeric coatings for polyolefin films.|(ii) Plasticizers",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=175.320",
          "code_system": "CFR",
          "references": [
            "27cc4859-8d31-415a-a237-f4af4ba36812"
          ]
        },
        {
          "uuid": "14a1505f-aa59-4593-9231-347a95c5f995",
          "code": "TRIACETIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Triacetin",
          "code_system": "WIKIPEDIA",
          "references": [
            "27cc4859-8d31-415a-a237-f4af4ba36812"
          ]
        },
        {
          "uuid": "c47dad0a-0e31-46e4-add6-bd9efa938c75",
          "code": "21 CFR 184.1901",
          "comments": "PART 184 -- DIRECT FOOD SUBSTANCES AFFIRMED AS GENERALLY RECOGNIZED AS SAFE|Subpart B--Listing of Specific Substances Affirmed as GRAS|Sec. 184.1901 Triacetin",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=184.1901",
          "code_system": "CFR",
          "references": [
            "27cc4859-8d31-415a-a237-f4af4ba36812"
          ]
        },
        {
          "uuid": "9620be3e-e5c0-4c3a-90f1-e0215ac233fc",
          "code": "INS-1518",
          "comments": "Codex Alimentarius|Functional Classification|Carrier|Emulsifier|Humectant",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=378",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "27cc4859-8d31-415a-a237-f4af4ba36812"
          ]
        },
        {
          "uuid": "515ac149-172b-48ec-9abc-4734cfe13770",
          "code": "836",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=836",
          "code_system": "INN",
          "references": [
            "27cc4859-8d31-415a-a237-f4af4ba36812"
          ]
        },
        {
          "uuid": "6c49c697-dfc2-41b8-8f4d-4dc8ba22780c",
          "code": "203-051-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.775",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "27cc4859-8d31-415a-a237-f4af4ba36812"
          ]
        },
        {
          "uuid": "94d80ce9-a2fb-46f5-ae73-6768345b2bc0",
          "code": "10756",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/10756/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "27cc4859-8d31-415a-a237-f4af4ba36812"
          ]
        },
        {
          "uuid": "621669c0-c4f8-40b3-ae99-0d66c99486b2",
          "code": "m11021",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11021?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "27cc4859-8d31-415a-a237-f4af4ba36812"
          ]
        },
        {
          "uuid": "1fa0ba58-d5a9-4857-9e1f-d681c5988a01",
          "code": "SUB11249MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "27cc4859-8d31-415a-a237-f4af4ba36812"
          ]
        },
        {
          "uuid": "b5ddace1-512f-444c-bfa3-a9b413171904",
          "code": "CHEMBL1489254",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1489254",
          "code_system": "ChEMBL",
          "references": [
            "27cc4859-8d31-415a-a237-f4af4ba36812"
          ]
        },
        {
          "uuid": "d1d8282f-5035-4276-893b-c4d6874ebe0e",
          "code": "5541",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5541",
          "code_system": "PUBCHEM",
          "references": [
            "27cc4859-8d31-415a-a237-f4af4ba36812"
          ]
        },
        {
          "uuid": "d7ad2fbd-ad5c-f0b5-eee2-758d53d581ae",
          "code": "585",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/585",
          "code_system": "HSDB",
          "references": [
            "09fe163b-ec74-cca1-8886-90c2d47dec87"
          ]
        },
        {
          "uuid": "b742459a-061e-aabb-628b-dd48304c6d21",
          "code": "DTXSID3026691",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3026691",
          "code_system": "EPA CompTox",
          "references": [
            "071cffe4-c89a-670e-419f-22926f4c112d"
          ]
        },
        {
          "uuid": "196b558e-3974-38f7-a49b-59c8ec2e8d5f",
          "code": "C1697",
          "comments": "Industrial Aid[C45678]|Pesticide[C737]|Fungicide",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1697",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ce934246-bda8-1851-aff0-ac00a559a365"
          ]
        },
        {
          "uuid": "08543326-6f5f-4ea6-9abb-be19048c5164",
          "code": "XHX3C3X673",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "18c8fb43-c970-9cae-c3a0-1f5ae95f46cd",
          "code": "3624",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3624",
          "code_system": "DRUG CENTRAL",
          "references": [
            "ce934246-bda8-1851-aff0-ac00a559a365"
          ]
        },
        {
          "uuid": "84be9bcb-6173-768b-cc8f-b3d0856bd411",
          "code": "9661",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9661",
          "code_system": "CHEBI",
          "references": [
            "ce934246-bda8-1851-aff0-ac00a559a365"
          ]
        },
        {
          "uuid": "62d3396f-e911-0334-6fd4-baf065bf5305",
          "code": "1675007",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1675007",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "ce934246-bda8-1851-aff0-ac00a559a365"
          ]
        },
        {
          "uuid": "0340464e-cd61-aaa1-ac97-eb2f3c21ad83",
          "code": "XHX3C3X673",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=XHX3C3X673",
          "code_system": "DAILYMED",
          "references": [
            "2e7382f0-f30e-46f8-2ad7-bcd418103d73"
          ]
        },
        {
          "uuid": "88f3a56f-303b-a300-58b9-29b6e198b700",
          "code": "4796",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=4796",
          "code_system": "NSC",
          "references": [
            "c25186df-e9fa-67c3-ee3a-9eb79acafe0e"
          ]
        },
        {
          "uuid": "4f3c140e-1d6f-890d-dddf-716efe39804b",
          "code": "731",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/731/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "8f04ceb0-246c-049c-d86c-849977310bcc"
          ]
        },
        {
          "uuid": "cb14e2a5-fefd-bf08-2060-842990470de8",
          "code": "100000077489",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "60c25dbb-4c08-03d5-887e-d702897f7dca"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "cc2a1cb6-93d9-4a93-bcb7-4e4d1fee5752",
          "amount": {
            "uuid": "9536de53-102c-47f0-bf73-62f2f3cc5ad4"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "aab9fc75-4e0e-4f88-ba52-e0a3e03c6478",
            "refuuid": "332a6af2-cfaa-4b2e-9004-6a7a589dbed1",
            "name": "Triacetin",
            "unii": "XHX3C3X673",
            "linking_id": "XHX3C3X673",
            "ref_pname": "Triacetin",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4e48be5e-3f24-4d4a-8f53-ee60910173af",
          "amount": {
            "uuid": "305521e4-186b-4430-a048-cddb306b67e1"
          },
          "comments": "Triacetine (ug/cigarette)\nCanadian = 23.1 SD(15.6)\nImported = 36.3 SD(9.3)",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "b8042c08-4d30-4ec1-8276-18f6e514c205"
          ],
          "related_substance": {
            "uuid": "b473c18c-8911-4f2e-b34a-e20665d473ad",
            "refuuid": "58f6d6ce-a65e-4351-b483-33cad323b1b8",
            "name": "TOBACCO LEAF",
            "unii": "6YR2608RSU",
            "linking_id": "6YR2608RSU",
            "ref_pname": "TOBACCO LEAF",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0291f7c8-356a-4401-bbbf-f1d508c950f7",
          "amount": {
            "uuid": "1c3a0015-95e5-4658-9518-1c1d601126ae",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (GC)",
          "references": [
            "01f7d9fc-b156-42b3-8693-34e7c14eba01"
          ],
          "related_substance": {
            "uuid": "2a746ded-dd82-4ecd-940b-9d2997c0da19",
            "refuuid": "aa9c7c81-c5d1-4b39-ab41-d3ded6e87b6d",
            "name": "GLYCERYL 2-ACETATE",
            "unii": "4Z481ZM9Z9",
            "linking_id": "4Z481ZM9Z9",
            "ref_pname": "GLYCERYL 2-ACETATE"
          }
        },
        {
          "uuid": "b7015914-234a-4769-bff7-51bd11d07d7d",
          "amount": {
            "uuid": "dcaf8bbe-3df1-4108-835a-75285e879bf9",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (GC)",
          "references": [
            "f5cf9cda-68dd-4cff-a9aa-9c4bc73864b2"
          ],
          "related_substance": {
            "uuid": "3ff50134-7ff1-480e-961c-18c380174d62",
            "refuuid": "43bd5108-e2b2-4edb-a44e-d5afe498a32a",
            "name": "Acetic acid",
            "unii": "Q40Q9N063P",
            "linking_id": "Q40Q9N063P",
            "ref_pname": "Acetic acid"
          }
        },
        {
          "uuid": "1f8a2137-26c7-45dc-a417-a8eccd86fa85",
          "amount": {
            "uuid": "4d0bc2a7-d22c-4917-870a-3b76a946db05",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (GC)",
          "references": [
            "3840bebc-2bb5-43ea-9649-f4426be755ef"
          ],
          "related_substance": {
            "uuid": "da490a46-4771-4ddc-aede-1ad1b42a478a",
            "refuuid": "8965eda9-1f32-473f-b875-cff6eeadb56b",
            "name": "Glycerin",
            "unii": "PDC6A3C0OX",
            "linking_id": "PDC6A3C0OX",
            "ref_pname": "Glycerin"
          }
        },
        {
          "uuid": "d4e0e352-f9b5-4807-8924-3572e0d9e0ea",
          "amount": {
            "uuid": "9c334a79-3f08-4113-b9f3-b98e4ca5ccf7",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (GC)",
          "references": [
            "154d1f02-d4d8-4079-b491-29ea853cee44"
          ],
          "related_substance": {
            "uuid": "bd89bb0d-252c-4ce4-be11-56877b9778cd",
            "refuuid": "fac5cddc-b1ba-41b6-b337-899c2d0d66b6",
            "name": "GLYCERYL 1,3-DIACETATE",
            "unii": "G45CU3Z186",
            "linking_id": "G45CU3Z186",
            "ref_pname": "GLYCERYL 1,3-DIACETATE"
          }
        },
        {
          "uuid": "eec98209-b74e-4a05-879c-7a34e3b4074c",
          "amount": {
            "uuid": "90d4b3ce-4e8e-4306-99fb-b57f49c311b1",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (GC)",
          "references": [
            "23ff0da6-0e48-41f6-9db4-568ee89b90e7"
          ],
          "related_substance": {
            "uuid": "82078ca5-c86f-420e-a81f-1f16dd2cf8f9",
            "refuuid": "9787e36b-f4fe-43cf-a586-0bd82fcb861a",
            "name": "GLYCERYL 1-ACETATE",
            "unii": "1NA86SF2H2",
            "linking_id": "1NA86SF2H2",
            "ref_pname": "GLYCERYL 1-ACETATE"
          }
        },
        {
          "uuid": "d96449aa-148d-4b55-9278-04460568d4bc",
          "amount": {
            "uuid": "02f35a09-c8e3-4842-9aa4-b987dfb81639",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (GC)",
          "references": [
            "cd8a01e1-733c-4869-8ebe-d75fc4de8282"
          ],
          "related_substance": {
            "uuid": "1eccf9e3-06e3-42a1-b9a6-9298f8c32344",
            "refuuid": "2672502b-2ca9-4027-9a18-ef65484f8648",
            "name": "GLYCERYL 1,2-DIACETATE",
            "unii": "9W955270ZW",
            "linking_id": "9W955270ZW",
            "ref_pname": "GLYCERYL 1,2-DIACETATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b6e711e7-8f1a-414c-9639-be98899dc4fe",
          "name": "1,2,3-PROPANETRIOL TRIACETATE",
          "stdName": "1,2,3-PROPANETRIOL TRIACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "115e2d19-ee55-461f-a2e3-ec22722d7a1d"
          ],
          "display_name": false
        },
        {
          "uuid": "a48bd134-37da-44f0-89e4-4e4e1959b3a7",
          "name": "1,2,3-PROPANETRIOL, TRIACETATE",
          "stdName": "1,2,3-PROPANETRIOL, TRIACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81897aa1-b71d-4102-8ab0-514710c8a888"
          ],
          "display_name": false
        },
        {
          "uuid": "33ab41b3-3049-4c67-8741-19ca4d4a3283",
          "name": "E-1518",
          "stdName": "E-1518",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "23cdd042-1c9a-46df-9d78-c27787d633e6"
          ],
          "display_name": false
        },
        {
          "uuid": "26e032ad-c4f1-446e-9c0e-7c66e8d50ecf",
          "name": "ENZACTIN",
          "stdName": "ENZACTIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1c37f4d-cdd3-447c-8f0c-c98ca2b37194",
            "06d12e6c-50f5-4bfa-a4dc-d383ff8699bd"
          ],
          "display_name": false
        },
        {
          "uuid": "5b6320b1-02c0-4b81-827b-8b67bd7ce55d",
          "name": "ESTOL 1581",
          "stdName": "ESTOL 1581",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81897aa1-b71d-4102-8ab0-514710c8a888"
          ],
          "display_name": false
        },
        {
          "uuid": "d4938ae5-d9a4-4a6e-aba9-019076505e0b",
          "name": "FEMA NO. 2007",
          "stdName": "FEMA NO. 2007",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce254120-f400-4fd3-9e21-64c3c1a0b9d6"
          ],
          "display_name": false
        },
        {
          "uuid": "db9895cd-6290-497a-8772-72e3ad3c3c16",
          "name": "GLYCEROL TRIACETATE",
          "stdName": "GLYCEROL TRIACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2795fb5d-b5d0-48bb-b49a-5d2ea74d43ab"
          ],
          "display_name": false
        },
        {
          "uuid": "97c9b035-f0dd-4ad4-9f62-e5c8493ad667",
          "name": "GLYCERYL TRIACETATE",
          "stdName": "GLYCERYL TRIACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "115e2d19-ee55-461f-a2e3-ec22722d7a1d"
          ],
          "display_name": false
        },
        {
          "uuid": "dd853687-cda2-4e9e-9bd8-083e1b6dace4",
          "name": "GLYCERYLTRIACETATE",
          "stdName": "GLYCERYLTRIACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0acebf6-67aa-43d9-a74e-6f94dcda040c"
          ],
          "display_name": false
        },
        {
          "uuid": "62e64dfc-793a-48db-91da-6362f4cbe35a",
          "name": "INS NO.1518",
          "stdName": "INS NO.1518",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "23cdd042-1c9a-46df-9d78-c27787d633e6"
          ],
          "display_name": false
        },
        {
          "uuid": "ff57687f-bcc2-4af4-abf4-12aff74f2db2",
          "name": "INS-1518",
          "stdName": "INS-1518",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "23cdd042-1c9a-46df-9d78-c27787d633e6"
          ],
          "display_name": false
        },
        {
          "uuid": "fdb0efb1-12cd-4a70-9187-6d51a61b7191",
          "name": "NSC-4796",
          "stdName": "NSC-4796",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ffe7932-cf90-4434-a15e-c67001564140"
          ],
          "display_name": false
        },
        {
          "uuid": "4370664c-db5f-408c-d338-27b607fa6663",
          "name": "TRIACETIN [EP MONOGRAPH]",
          "stdName": "TRIACETIN [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f8db0a2-14eb-454c-3c8e-a74d78bdcf98"
          ],
          "display_name": false
        },
        {
          "uuid": "6f7696c7-6dd6-486e-bd62-9f43a47ea513",
          "name": "TRIACETIN [FCC]",
          "stdName": "TRIACETIN [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11dde1d1-5560-44cf-9f06-008d9ab0f3ee"
          ],
          "display_name": false
        },
        {
          "uuid": "d0f583e1-7745-426f-8c3f-303974793c47",
          "name": "TRIACETIN [FHFI]",
          "stdName": "TRIACETIN [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08215d58-0aaf-4b05-9626-10aabd2afbb5"
          ],
          "display_name": false
        },
        {
          "uuid": "4ab5b440-8488-4511-9df3-6f93bda234d5",
          "name": "TRIACETIN [HSDB]",
          "stdName": "TRIACETIN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04c70afa-976c-472b-8ea5-b34973c20bba"
          ],
          "display_name": false
        },
        {
          "uuid": "2e4a3684-f203-4fdd-b596-5ca6b48d2e28",
          "name": "TRIACETIN [II]",
          "stdName": "TRIACETIN [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ed39fc2d-12ab-4b9f-bb47-089abd72bd17"
          ],
          "display_name": false
        },
        {
          "uuid": "1506a14e-ef0d-4f06-8eb9-9b5c7b0f5db6",
          "name": "TRIACETIN [MART.]",
          "stdName": "TRIACETIN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "129abfaa-5da5-4fc7-afe1-9cc31d74247f"
          ],
          "display_name": false
        },
        {
          "uuid": "ba4c127e-9682-4724-b26d-bbd0dcd42ed6",
          "name": "TRIACETIN [MI]",
          "stdName": "TRIACETIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ecc248ed-b118-44bf-aeb6-8bfef5f21f68"
          ],
          "display_name": false
        },
        {
          "uuid": "5ade696b-695b-8d64-90e7-1e903c0f026e",
          "name": "TRIACETIN [USP MONOGRAPH]",
          "stdName": "TRIACETIN [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9a527ca-3934-cc4d-5ce1-250ebbc1b2e1"
          ],
          "display_name": false
        },
        {
          "uuid": "4e221940-5111-491e-8082-5fadd3e36dd4",
          "name": "TRIACETIN [USP-RS]",
          "stdName": "TRIACETIN [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bcd97769-9cff-4427-8fc0-c418c8135a41"
          ],
          "display_name": false
        },
        {
          "uuid": "4f7edbc4-f34d-43ba-a487-bf1b2bdc1a2d",
          "name": "TRIACETIN [VANDF]",
          "stdName": "TRIACETIN [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f50980e-fdea-4ea9-a882-0cdf3506b262"
          ],
          "display_name": false
        },
        {
          "uuid": "92e0ee92-73ca-49c0-b602-9eb64700a192",
          "name": "TRIACETINE",
          "stdName": "TRIACETINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb465a75-c786-41ce-886e-2e267bb83243"
          ],
          "display_name": false
        },
        {
          "uuid": "72e725e6-3d6f-4aa6-b5f9-97628ca10893",
          "name": "TRIACETYLGLYCEROL",
          "stdName": "TRIACETYLGLYCEROL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81897aa1-b71d-4102-8ab0-514710c8a888"
          ],
          "display_name": false
        },
        {
          "uuid": "5fe5520c-a0c1-4d54-a8ba-351bf60a9c89",
          "name": "Triacetin",
          "stdName": "TRIACETIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f50980e-fdea-4ea9-a882-0cdf3506b262",
            "b8580073-df26-4b79-97e3-339b28a80510",
            "5bf8ce66-17ca-4e7b-ac64-5dcfbf1888e7",
            "bcd97769-9cff-4427-8fc0-c418c8135a41",
            "d072d6c4-aa83-45ed-b8d6-261d3b3c6c40",
            "f95553d5-8e28-4ec9-ae90-eafa78c67d62",
            "e785eea0-3833-4ea2-a72c-2d6ce165c287",
            "f5f4d392-8d62-4b75-9e52-71147bd91a72",
            "52f6c928-4fef-45cd-a68f-16c60cf2bea5",
            "96a45cdc-f045-421d-9ca3-319135c485ec",
            "129abfaa-5da5-4fc7-afe1-9cc31d74247f",
            "8eda6150-787c-41b1-865d-8f26feb0b792",
            "1ace3790-7316-4b4b-9a31-9237b505bdef",
            "04c70afa-976c-472b-8ea5-b34973c20bba",
            "9364bd7c-8242-4f8d-b3e3-4c8e382970e9",
            "11dde1d1-5560-44cf-9f06-008d9ab0f3ee",
            "08215d58-0aaf-4b05-9626-10aabd2afbb5",
            "565170b8-a02c-4cef-8946-560a9baeee06",
            "92b39a8f-965f-4f70-b5b7-ca694b2e383d",
            "ecc248ed-b118-44bf-aeb6-8bfef5f21f68",
            "be17a6ba-e31a-4b04-b8e5-4a2e1c952edf",
            "a0ae60b6-d9da-46a9-98f4-5ac681d12ec1",
            "ed39fc2d-12ab-4b9f-bb47-089abd72bd17",
            "3c5067fa-670f-45b0-80b6-dc373b72a4aa",
            "19521b10-8c0a-4d29-b805-35d496d361b1",
            "c7378cea-4b3f-4384-8e1c-027982a0cbd6"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a09a8c95-0c64-4767-ae3c-bf879168003e",
              "name_org": "INN"
            },
            {
              "uuid": "ee03e942-e2e3-4545-b7a5-c8427d2a1bfb",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e4c0af62-a993-361b-1262-134cae7b2be6",
          "name": "Triacetin [WHO-DD]",
          "stdName": "TRIACETIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4049dea-9b08-18fa-9409-eba43bb5f28c"
          ],
          "display_name": false
        },
        {
          "uuid": "59907622-1984-48bf-8a14-b0676d4489b4",
          "name": "UJOSTABIL",
          "stdName": "UJOSTABIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81897aa1-b71d-4102-8ab0-514710c8a888"
          ],
          "display_name": false
        },
        {
          "uuid": "720ce6bb-f749-42b2-b4cd-1d8a9ad1b1c5",
          "name": "triacetin [INN]",
          "stdName": "TRIACETIN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c5067fa-670f-45b0-80b6-dc373b72a4aa"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ed39fc2d-12ab-4b9f-bb47-089abd72bd17",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "115e2d19-ee55-461f-a2e3-ec22722d7a1d",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2795fb5d-b5d0-48bb-b49a-5d2ea74d43ab",
          "citation": "EMA LIST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce254120-f400-4fd3-9e21-64c3c1a0b9d6",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c5067fa-670f-45b0-80b6-dc373b72a4aa",
          "citation": "INN Proposed List 8",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL08.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f95553d5-8e28-4ec9-ae90-eafa78c67d62",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e785eea0-3833-4ea2-a72c-2d6ce165c287",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "129abfaa-5da5-4fc7-afe1-9cc31d74247f",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ecc248ed-b118-44bf-aeb6-8bfef5f21f68",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1c37f4d-cdd3-447c-8f0c-c98ca2b37194",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "06d12e6c-50f5-4bfa-a4dc-d383ff8699bd",
          "citation": "D00384",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "565170b8-a02c-4cef-8946-560a9baeee06",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11dde1d1-5560-44cf-9f06-008d9ab0f3ee",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08215d58-0aaf-4b05-9626-10aabd2afbb5",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04c70afa-976c-472b-8ea5-b34973c20bba",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bcd97769-9cff-4427-8fc0-c418c8135a41",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52f6c928-4fef-45cd-a68f-16c60cf2bea5",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f50980e-fdea-4ea9-a882-0cdf3506b262",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb465a75-c786-41ce-886e-2e267bb83243",
          "citation": "http://www.chemindustry.com/chemicals/0154197.html",
          "url": "http://www.chemindustry.com/chemicals/0154197.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "23cdd042-1c9a-46df-9d78-c27787d633e6",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81897aa1-b71d-4102-8ab0-514710c8a888",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ffe7932-cf90-4434-a15e-c67001564140",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27cc4859-8d31-415a-a237-f4af4ba36812",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390762000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c7765bc-1ae5-4bbb-a27a-57344d44792f",
          "citation": "AN OVERVIEW OF THE EFFECTS OF TOBACCO INGREDIENTS ON SMOKE CHEMISTRY AND TOXICITY; FOOD AND CHEMICAL TOXICOLOGY; BAKER, RR; 42(SUPPL):53-83, 2004",
          "url": "http://www.sciencedirect.com/science/article/pii/S0278691504000043",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b8042c08-4d30-4ec1-8276-18f6e514c205",
          "citation": "CONSTITUENTS IN TOBACCO AND SMOKE EMISSIONS FROM CANADIAN CIGARETTES; TOBACCO CONTROL; HAMMOND, D; VOL:17 SUPPL 1 PG:I24-I31; 2008",
          "url": "http://tobaccocontrol.bmj.com/content/17/Suppl_1/i24.full.pdf+html",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "973d2493-a1c3-45f8-942b-6d4e0973a54a",
          "citation": "SRS import [XHX3C3X673]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=XHX3C3X673",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390762000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec799e89-a06a-476e-a9ea-84ffad93a72b",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b8580073-df26-4b79-97e3-339b28a80510",
          "citation": "TRIACETIN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1ace3790-7316-4b4b-9a31-9237b505bdef",
          "citation": "TRIACETIN [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "96a45cdc-f045-421d-9ca3-319135c485ec",
          "citation": "TRIACETIN [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "92b39a8f-965f-4f70-b5b7-ca694b2e383d",
          "citation": "TRIACETIN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c7378cea-4b3f-4384-8e1c-027982a0cbd6",
          "citation": "TRIACETIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5bf8ce66-17ca-4e7b-ac64-5dcfbf1888e7",
          "citation": "TRIACETIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "be17a6ba-e31a-4b04-b8e5-4a2e1c952edf",
          "citation": "TRIACETIN [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a0ae60b6-d9da-46a9-98f4-5ac681d12ec1",
          "citation": "TRIACETIN [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d072d6c4-aa83-45ed-b8d6-261d3b3c6c40",
          "citation": "TRIACETIN [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "19521b10-8c0a-4d29-b805-35d496d361b1",
          "citation": "TRIACETIN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8eda6150-787c-41b1-865d-8f26feb0b792",
          "citation": "TRIACETIN [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9364bd7c-8242-4f8d-b3e3-4c8e382970e9",
          "citation": "TRIACETIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f5f4d392-8d62-4b75-9e52-71147bd91a72",
          "citation": "TRIACETIN [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "09fe163b-ec74-cca1-8886-90c2d47dec87",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+102-76-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "071cffe4-c89a-670e-419f-22926f4c112d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=102-76-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ce934246-bda8-1851-aff0-ac00a559a365",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "fc8d386d-0d01-6d2f-de90-972e6188f3ed",
          "citation": "USP42-NF37 - 4441, Triacetin Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "23ff0da6-0e48-41f6-9db4-568ee89b90e7",
          "citation": "USP42-NF37 - 4441, Triacetin Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "68993fdc-a3a0-40b1-9332-61e8d1552a0e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f5cf9cda-68dd-4cff-a9aa-9c4bc73864b2",
          "citation": "USP42-NF37 - 4441, Triacetin Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3840bebc-2bb5-43ea-9649-f4426be755ef",
          "citation": "USP42-NF37 - 4441, Triacetin Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "01f7d9fc-b156-42b3-8693-34e7c14eba01",
          "citation": "USP42-NF37 - 4441, Triacetin Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "154d1f02-d4d8-4079-b491-29ea853cee44",
          "citation": "USP42-NF37 - 4441, Triacetin Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cd8a01e1-733c-4869-8ebe-d75fc4de8282",
          "citation": "USP42-NF37 - 4441, Triacetin Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e0acebf6-67aa-43d9-a74e-6f94dcda040c",
          "citation": "https://clinicaltrials.gov/ct2/show/NCT00278707",
          "url": "https://clinicaltrials.gov/ct2/show/NCT00278707",
          "doc_type": "CLINICAL_TRIALS.GOV",
          "public_domain": true
        },
        {
          "uuid": "d9a527ca-3934-cc4d-5ce1-250ebbc1b2e1",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "3f8db0a2-14eb-454c-3c8e-a74d78bdcf98",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "c25186df-e9fa-67c3-ee3a-9eb79acafe0e",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a4049dea-9b08-18fa-9409-eba43bb5f28c",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2e7382f0-f30e-46f8-2ad7-bcd418103d73",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "60c25dbb-4c08-03d5-887e-d702897f7dca",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "8f04ceb0-246c-049c-d86c-849977310bcc",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ddbca671-0317-4a27-9c54-97987987fe36",
          "id": "ddbca671-0317-4a27-9c54-97987987fe36",
          "molfile": "\n  Marvin  01132111302D          \n\n 15 14  0  0  0  0            999 V2000\n   10.2587   -0.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5447   -0.1670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5364    0.6597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8308   -0.5804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1168   -0.1754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4028   -0.5887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6888   -0.1796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9749   -0.5929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2609   -0.1796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5469   -0.5929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2526    0.6471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3945   -1.4154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1085   -1.8288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8224   -1.4071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1085   -2.6555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 12  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)OCC(COC(=O)C)OC(=O)C",
          "formula": "C9H14O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c6a72754-c980-4a54-803a-d3787eb27866"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "218.2042",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "332a6af2-cfaa-4b2e-9004-6a7a589dbed1",
      "version": "34",
      "structure": {
        "id": "871bc58c-c141-474b-83ab-4b30d7e288e2",
        "molfile": "\n  Marvin  01132107012D          \n\n 15 14  0  0  0  0            999 V2000\n    8.1085   -1.8288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5447   -0.1670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2609   -0.1796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3945   -1.4154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1085   -2.6555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2526    0.6471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5364    0.6597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9749   -0.5929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8308   -0.5804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4028   -0.5887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1168   -0.1754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6888   -0.1796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8224   -1.4071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2587   -0.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5469   -0.5929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  9  1  0  0  0  0\n  3  8  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  3  2  0  0  0  0\n  7  2  2  0  0  0  0\n  8 12  1  0  0  0  0\n  9 11  1  0  0  0  0\n 10  4  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  1  0  0  0  0\n 13  1  1  0  0  0  0\n 14  2  1  0  0  0  0\n 15  3  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)OCC(COC(=O)C)OC(=O)C",
        "formula": "C9H14O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "218.2042",
        "optical_activity": "NONE",
        "references": [
          "ec799e89-a06a-476e-a9ea-84ffad93a72b",
          "973d2493-a1c3-45f8-942b-6d4e0973a54a",
          "3c5067fa-670f-45b0-80b6-dc373b72a4aa"
        ],
        "stereo_centers": 0
      },
      "unii": "XHX3C3X673"
    }
  ]
}