{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "299a5e6f-fea2-49d6-9f41-5192ef7187df",
          "code": "484-12-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=484-12-8",
          "code_system": "CAS",
          "references": [
            "9b728f70-8bcd-4e63-8361-01235291a60a",
            "ea945780-52a7-49f1-bf62-1c571335af1c"
          ]
        },
        {
          "uuid": "97aa3f9f-d3a0-4d58-aa11-dd9efb449a80",
          "code": "C046627",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67046627",
          "code_system": "MESH",
          "references": [
            "9b728f70-8bcd-4e63-8361-01235291a60a"
          ]
        },
        {
          "uuid": "df9bf627-1bd3-4be3-abfa-54b20d349189",
          "code": "OSTHOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Osthol",
          "code_system": "WIKIPEDIA",
          "references": [
            "9b728f70-8bcd-4e63-8361-01235291a60a"
          ]
        },
        {
          "uuid": "80cc039e-e1e9-46ac-ad4c-89ca19ae731f",
          "code": "1547630",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1547630/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "9b728f70-8bcd-4e63-8361-01235291a60a"
          ]
        },
        {
          "uuid": "cbd6a729-8c0d-40c1-8485-053dfe9852ce",
          "code": "m8263",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8263?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "9b728f70-8bcd-4e63-8361-01235291a60a"
          ]
        },
        {
          "uuid": "24eabb77-2493-4f13-a33c-601651300997",
          "code": "10228",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10228",
          "code_system": "PUBCHEM",
          "references": [
            "9b728f70-8bcd-4e63-8361-01235291a60a"
          ]
        },
        {
          "uuid": "c79496ac-bc73-84bb-20c7-8bb5c0822743",
          "code": "DTXSID20197507",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20197507",
          "code_system": "EPA CompTox",
          "references": [
            "6eb803b7-c455-879a-675e-627501535852"
          ]
        },
        {
          "uuid": "4387805c-9e92-43d2-9257-61c03e315a98",
          "code": "XH1TI1759C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "498f435a-b999-6e1d-9d3e-0ca773fa5c8e",
          "code": "XH1TI1759C",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=XH1TI1759C",
          "code_system": "DAILYMED",
          "references": [
            "d1d1b201-328b-4284-0c01-d1b1434f6271"
          ]
        },
        {
          "uuid": "b16c608b-9e94-a799-ed9d-a705d2dfcc00",
          "code": "31868",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=31868",
          "code_system": "NSC",
          "references": [
            "70fc05d3-41f8-fd39-41c8-6de57758d7c9"
          ]
        },
        {
          "uuid": "988c18a9-8e29-068e-7cfb-dc84391b2d04",
          "code": "osthol",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/osthol.html",
          "code_system": "ALANWOOD",
          "references": [
            "b058fc2f-8b4b-17de-3eca-6305a48b2a34"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9a8e8bb7-8066-4243-a5a2-753b942a4a79",
          "name": "7-METHOXY-8-(3-METHYL-2-BUTENYL)-2H-1-BENZOPYRAN-2-ONE",
          "stdName": "7-METHOXY-8-(3-METHYL-2-BUTENYL)-2H-1-BENZOPYRAN-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "927de496-0b85-4a22-b8e5-39f0dc66547d",
            "1df090c0-4c92-4330-b9f0-9ed7de9fd8b6"
          ],
          "display_name": false
        },
        {
          "uuid": "3e120984-80e0-43fa-80d3-2a25b96b6c4a",
          "name": "7-METHOXY-8-(3-METHYLBUT-2-EN-1-YL)-2H-CHROMEN-2-ONE",
          "stdName": "7-METHOXY-8-(3-METHYLBUT-2-EN-1-YL)-2H-CHROMEN-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c7928c42-d39d-4257-83f8-73c61e744062",
            "1df090c0-4c92-4330-b9f0-9ed7de9fd8b6"
          ],
          "display_name": false
        },
        {
          "uuid": "e31b5f35-c143-4b29-a691-c59f55c8211d",
          "name": "7-METHOXY-8-(3-METHYLBUT-2-ENYL)-2-CHROMENONE",
          "stdName": "7-METHOXY-8-(3-METHYLBUT-2-ENYL)-2-CHROMENONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ac5fdf7-136b-46ad-a33f-73a271ad923f"
          ],
          "display_name": false
        },
        {
          "uuid": "6b9c1cb0-5ee4-4225-9292-1ae7218d7d2b",
          "name": "NSC-31868",
          "stdName": "NSC-31868",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf915ce7-ea88-4343-86a6-2517786f82d1"
          ],
          "display_name": false
        },
        {
          "uuid": "3564ea6c-f003-43c8-aeb8-e7ceeb21c5e9",
          "name": "OSTHOL",
          "stdName": "OSTHOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6a30897-0919-42de-9e0e-939e760d2237"
          ],
          "display_name": true
        },
        {
          "uuid": "de371c0c-75aa-48fa-a901-c073ccea6197",
          "name": "OSTHOLE",
          "stdName": "OSTHOLE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "ab4f5eed-0eb9-4230-84d7-a35911e3afff",
            "dd2ef3bf-1a01-41e8-bd1f-2fda9517b496",
            "a560bc6e-cb63-4269-89cf-eaaa06ec201c",
            "99f60912-6ac4-4db8-a62d-4f40b9d8facf",
            "194d2d2e-a7c9-4f9b-afa7-e5b22b4d63b1"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4d4071b6-a816-46a6-8c87-64b5109102c1",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "23e6172d-5531-496a-b294-5a9a92dc9908",
          "name": "OSTHOLE [MI]",
          "stdName": "OSTHOLE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99f60912-6ac4-4db8-a62d-4f40b9d8facf"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1df090c0-4c92-4330-b9f0-9ed7de9fd8b6",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c7928c42-d39d-4257-83f8-73c61e744062",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "927de496-0b85-4a22-b8e5-39f0dc66547d",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ac5fdf7-136b-46ad-a33f-73a271ad923f",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6a30897-0919-42de-9e0e-939e760d2237",
          "citation": "ALANWOOD.NET 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99f60912-6ac4-4db8-a62d-4f40b9d8facf",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "194d2d2e-a7c9-4f9b-afa7-e5b22b4d63b1",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab4f5eed-0eb9-4230-84d7-a35911e3afff",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf915ce7-ea88-4343-86a6-2517786f82d1",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b728f70-8bcd-4e63-8361-01235291a60a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390979000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4fee99d8-a0a4-46fd-9bab-daa8a96c587a",
          "citation": "SRS import [XH1TI1759C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=XH1TI1759C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390979000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c5376a25-1258-481b-981c-d88b3c779ff3",
          "citation": "CHEMID  2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd2ef3bf-1a01-41e8-bd1f-2fda9517b496",
          "citation": "OSTHOLE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a560bc6e-cb63-4269-89cf-eaaa06ec201c",
          "citation": "OSTHOLE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6eb803b7-c455-879a-675e-627501535852",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=484-12-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b058fc2f-8b4b-17de-3eca-6305a48b2a34",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "ea945780-52a7-49f1-bf62-1c571335af1c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "70fc05d3-41f8-fd39-41c8-6de57758d7c9",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d1d1b201-328b-4284-0c01-d1b1434f6271",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3a7dec76-5ed7-4230-8151-281b8076e7f6",
          "id": "3a7dec76-5ed7-4230-8151-281b8076e7f6",
          "molfile": "\n  Marvin  01132103062D          \n\n 18 19  0  0  0  0            999 V2000\n    4.9511   -4.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9511   -5.6114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6736   -6.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6736   -6.8327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3916   -7.2390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1122   -6.8327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8072   -7.2390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5330   -6.8327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5330   -6.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2732   -5.6114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8072   -5.6114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1122   -6.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3916   -5.6114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3916   -4.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7011   -4.3916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7011   -3.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4191   -3.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9733   -3.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 13  3  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n 12  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\nM  END",
          "smiles": "CC(=CCc1c(ccc2ccc(=O)oc21)OC)C",
          "formula": "C15H16O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "77e636e4-9e5f-4154-833a-cf7efb2d888d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "244.2863",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "71554bd6-6154-4cd3-b391-5866c766a762",
      "version": "7",
      "structure": {
        "id": "95c26421-a3fe-4daf-bc3d-3f6579bde037",
        "molfile": "\n  Marvin  01132107462D          \n\n 18 19  0  0  0  0            999 V2000\n    7.1122   -6.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3916   -5.6114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6736   -6.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6736   -6.8327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3916   -7.2390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1122   -6.8327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8072   -7.2390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5330   -6.8327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5330   -6.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8072   -5.6114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2732   -5.6114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9511   -5.6114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9511   -4.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3916   -4.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7011   -4.3916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7011   -3.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4191   -3.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9733   -3.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  1 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n  3 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n  2 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\nM  END",
        "smiles": "CC(=CCc1c(ccc2ccc(=O)oc21)OC)C",
        "formula": "C15H16O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "244.2863",
        "optical_activity": "NONE",
        "references": [
          "c5376a25-1258-481b-981c-d88b3c779ff3",
          "4fee99d8-a0a4-46fd-9bab-daa8a96c587a"
        ],
        "stereo_centers": 0
      },
      "unii": "XH1TI1759C"
    }
  ]
}