{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5169a75a-14ca-42ef-b4ad-db8191f3f045",
          "code": "366-70-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=366-70-1",
          "code_system": "CAS",
          "references": [
            "9ea7624c-3478-4b78-82c6-8a6d89e50093",
            "7544890c-f0ff-4993-95e7-e32721964512"
          ]
        },
        {
          "uuid": "9379a419-8b3d-4827-9da8-890eba74b274",
          "code": "PROCARBAZINE HYDROCHLORIDE",
          "comments": "Description: A white to yellowish, crystalline powder. Solubility: Soluble in water and methanol R; sparingly soluble in ethanol (~750 g/l) TS; practically insoluble in ether R. Category: Cytotoxic drug. Storage: Procarbazine hydrochloride should be kept in a tightly closed container, protected from light. Additional information: Procarbazine hydrochloride melts at about 223?C with decomposition. Even in the absence of light,Procarbazine hydrochloride is gradually degraded on exposure to a humid atmosphere, the decomposition being faster at highertemperatures. CAUTION: Procarbazine hydrochloride must be handled with care, avoiding contact with the skin and inhalation ofairborne particles. Wear rubber gloves while handling this substance. Definition: Procarbazine hydrochloride contains not less than 98.5% and not more than 100.5% of C12H19N3O,HCl, calculatedwith reference to the dried substance.",
          "type": "PRIMARY",
          "url": "http://apps.who.int/phint/pdf/b/Jb.6.1.341.pdf",
          "code_system": "WHO INTERNATIONAL PHARMACOPEIA",
          "references": [
            "9ea7624c-3478-4b78-82c6-8a6d89e50093"
          ]
        },
        {
          "uuid": "6ba2f86e-110c-4d48-8691-b0c3f642c3e8",
          "code": "C773",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C773",
          "code_system": "NCI_THESAURUS",
          "references": [
            "9ea7624c-3478-4b78-82c6-8a6d89e50093"
          ]
        },
        {
          "uuid": "e5f0d1b8-4c18-48b2-84c3-7734b74bebca",
          "code": "66925",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/66925/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "9ea7624c-3478-4b78-82c6-8a6d89e50093"
          ]
        },
        {
          "uuid": "356af6d3-7e95-4007-8696-229f2619cdc7",
          "code": "m9146",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9146?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "9ea7624c-3478-4b78-82c6-8a6d89e50093"
          ]
        },
        {
          "uuid": "d829051e-21b7-49a0-99d6-a56d2cd6ba3f",
          "code": "SUB15017MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "9ea7624c-3478-4b78-82c6-8a6d89e50093"
          ]
        },
        {
          "uuid": "5f9648d5-095e-4b8b-8445-09999042668c",
          "code": "CHEMBL1321",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1321",
          "code_system": "ChEMBL",
          "references": [
            "9ea7624c-3478-4b78-82c6-8a6d89e50093"
          ]
        },
        {
          "uuid": "82f4f70d-b866-4e29-9aff-5533631f6b6a",
          "code": "206-678-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.072",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9ea7624c-3478-4b78-82c6-8a6d89e50093"
          ]
        },
        {
          "uuid": "744bdd74-c064-54bc-80fa-2608feb04319",
          "code": "DTXSID3021190",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3021190",
          "code_system": "EPA CompTox",
          "references": [
            "9efe84a0-401d-9fc5-0657-a73420098bcd"
          ]
        },
        {
          "uuid": "fb4eb646-8a4c-dc68-c2fc-9b00959342d3",
          "code": "217005",
          "comments": "ORPHAN DRUG|Designated|Treatment of malignant glioma",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=217005",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "0877ebda-b300-22b1-d87f-3b3c660d8b7a",
          "code": "C902",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Antineoplastic Alkylating Agent[C1590]|Triazene Compound",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C902",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e4fc6ace-7f6d-1b04-4d93-3fbcbb7a4030"
          ]
        },
        {
          "uuid": "9c5485db-00f7-6bc9-cd09-0c6c0ed20da8",
          "code": "9703",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9703",
          "code_system": "PUBCHEM",
          "references": [
            "d05a39e2-285a-4c08-810a-9a1cd5c19255"
          ]
        },
        {
          "uuid": "f4b3cf57-aed2-54d7-0405-005c7df5a654",
          "code": "DBSALT000731",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT000731",
          "code_system": "DRUG BANK",
          "references": [
            "e4fc6ace-7f6d-1b04-4d93-3fbcbb7a4030"
          ]
        },
        {
          "uuid": "69ab0de6-323c-4564-b794-e4f5834d5776",
          "code": "XH0NPH5ZX8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f76d44bf-5681-008c-555c-e5f9af123223",
          "code": "71428",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:71428",
          "code_system": "CHEBI",
          "references": [
            "e4fc6ace-7f6d-1b04-4d93-3fbcbb7a4030"
          ]
        },
        {
          "uuid": "85dd1946-ac0f-730d-35d5-6724df9926dd",
          "code": "1565009",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1565009",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "e4fc6ace-7f6d-1b04-4d93-3fbcbb7a4030"
          ]
        },
        {
          "uuid": "aaa20e22-fb8f-e357-6557-365df403128b",
          "code": "77213",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=77213",
          "code_system": "NSC",
          "references": [
            "6e508253-4fd6-6484-0540-6addb091e87a"
          ]
        },
        {
          "uuid": "0bb3d40a-aa7c-7c6f-93b8-090c864a5c59",
          "code": "XH0NPH5ZX8",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=XH0NPH5ZX8",
          "code_system": "DAILYMED",
          "references": [
            "448ad29b-d6cb-729a-fc1c-095cdd66a04b"
          ]
        },
        {
          "uuid": "f7bfef27-2126-aef0-192c-1a78c90f62b7",
          "code": "100000089939",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "46d8f40a-e5d3-205b-03f3-4e95cc68f8d1"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "76b30c32-02e9-469d-8da3-0f917ccaba55",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "d49e1b9b-a7d5-421c-98fe-2ebdc07f179c",
            "refuuid": "f432c44b-b43c-44fd-ab75-ef856e6c024d",
            "name": "PROCARBAZINE",
            "unii": "35S93Y190K",
            "linking_id": "35S93Y190K",
            "ref_pname": "PROCARBAZINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b57a6adf-cdb0-4f6c-93a3-1eeb5bda8e4e",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "e66a547c-b83d-446a-a417-647282e4f8b0",
            "refuuid": "f432c44b-b43c-44fd-ab75-ef856e6c024d",
            "name": "PROCARBAZINE",
            "unii": "35S93Y190K",
            "linking_id": "35S93Y190K",
            "ref_pname": "PROCARBAZINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b0cf8395-0972-4b10-b630-102641e52559",
          "name": "BENZAMIDE, N-(1-METHYLETHYL)-4-((2-METHYLHYDRAZINO)METHYL)-, MONOHYDROCHLORIDE",
          "stdName": "BENZAMIDE, N-(1-METHYLETHYL)-4-((2-METHYLHYDRAZINO)METHYL)-, MONOHYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "016b0b2a-2e72-4dd8-8044-e2e46d908045"
          ],
          "display_name": false
        },
        {
          "uuid": "7769f3de-c7cc-4455-ae1e-c4fa99d27673",
          "name": "IBENZMETHYZINE HYDROCHLORIDE",
          "stdName": "IBENZMETHYZINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4621734-f4e5-47b4-9808-4226b352c7ef"
          ],
          "display_name": false
        },
        {
          "uuid": "8cde1976-4e0a-4913-abf4-6b60be36617d",
          "name": "IBZ",
          "stdName": "IBZ",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4621734-f4e5-47b4-9808-4226b352c7ef"
          ],
          "display_name": false
        },
        {
          "uuid": "afbb88ab-9156-4c67-93b5-3d37744448ad",
          "name": "MATULANE",
          "stdName": "MATULANE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "016b0b2a-2e72-4dd8-8044-e2e46d908045"
          ],
          "display_name": false
        },
        {
          "uuid": "6abd79b3-2df7-4bd0-bfb5-17accb258fec",
          "name": "MBH",
          "stdName": "MBH",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4621734-f4e5-47b4-9808-4226b352c7ef"
          ],
          "display_name": false
        },
        {
          "uuid": "f3a6520e-e052-4882-bdf4-242e9964a3c5",
          "name": "N-ISOPROPYL-.ALPHA.-(2-METHYLHYDRAZINO)-P-TOLUAMIDE MONOHYDROCHLORIDE",
          "stdName": "N-ISOPROPYL-.ALPHA.-(2-METHYLHYDRAZINO)-P-TOLUAMIDE MONOHYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "016b0b2a-2e72-4dd8-8044-e2e46d908045"
          ],
          "display_name": false
        },
        {
          "uuid": "1a6eb2ff-0100-490f-8016-5bd087571e48",
          "name": "NATULAN",
          "stdName": "NATULAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cca71f31-2426-41fa-b9e5-be4e8a0f3be7"
          ],
          "display_name": false
        },
        {
          "uuid": "7e799b6d-982b-46c6-93ce-e89296a30de4",
          "name": "NCI-C 01810",
          "stdName": "NCI-C 01810",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a46d1555-7c8b-4a19-98c4-2d206684950d"
          ],
          "display_name": false
        },
        {
          "uuid": "3cc52172-e9f2-4af0-8bf2-3ecd8fcd614c",
          "name": "NCI-C-01810",
          "stdName": "NCI-C-01810",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4621734-f4e5-47b4-9808-4226b352c7ef"
          ],
          "display_name": false
        },
        {
          "uuid": "fda8c6c4-ebf9-4534-8cf5-9c424a680dd4",
          "name": "NSC-77213",
          "stdName": "NSC-77213",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a46d1555-7c8b-4a19-98c4-2d206684950d"
          ],
          "display_name": false
        },
        {
          "uuid": "c339fd39-9de1-4c18-9bb6-c332b243140b",
          "name": "PROCARBAZINE HCL",
          "stdName": "PROCARBAZINE HCL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ba395ad-1a34-4c31-8d69-6c6041f99069"
          ],
          "display_name": false
        },
        {
          "uuid": "832c4ee5-a4c9-4665-874a-628805923081",
          "name": "PROCARBAZINE HYDROCHLORIDE",
          "stdName": "PROCARBAZINE HYDROCHLORIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f0486c7-9400-4436-a1e6-7ee0b9f5e413",
            "93013d85-fe01-4e01-8e6a-5b5634f8a1c7",
            "245b2b63-6781-4542-a18a-7b774d7feca1",
            "5c6321e5-ea42-401d-bc00-6b4d03561a40",
            "8e905915-6c61-4cab-a3b6-aed6b46a8563",
            "a7c2aeea-fe0a-443a-ace5-59c08527de0e",
            "cca71f31-2426-41fa-b9e5-be4e8a0f3be7",
            "750f3190-c945-42eb-80d5-6f91172ba3e3",
            "511c1573-e2b1-45fb-80e8-7cc936a27382",
            "4cd11a5e-1f88-487c-9775-7c187006bd70",
            "eb5a3255-91b6-4750-89e6-5a59689ff978",
            "dd0e6fec-c364-48b3-b37e-a338a0144028",
            "0f4ff94f-c759-406f-adb1-04fab99796f9",
            "88a80280-d8b7-4e95-9a5c-0f5289c420ee",
            "798990b0-95a0-4751-88c0-3f8b982db643",
            "35baae82-39db-4657-9a93-7241ad208f18",
            "b83847d3-da31-484a-8b40-3c121fbcc614",
            "4946d2cc-320e-4978-95d5-acf04762cebe",
            "4892e4fb-4870-4272-9ffb-00aeac5c6540"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "022cdeca-f1b1-4aa3-8d40-94307c7352ae",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "483c13f0-3b29-a44e-19ef-d339d1f1a18f",
          "name": "PROCARBAZINE HYDROCHLORIDE [IARC]",
          "stdName": "PROCARBAZINE HYDROCHLORIDE [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0bffbb79-8ba8-4562-aee7-6f132563f946"
          ],
          "display_name": false
        },
        {
          "uuid": "d264b895-1aed-42fa-a2c0-0dbdee5be827",
          "name": "PROCARBAZINE HYDROCHLORIDE [JAN]",
          "stdName": "PROCARBAZINE HYDROCHLORIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b42a410d-f986-ebc7-85d8-a69c3ddaa8ac"
          ],
          "display_name": false
        },
        {
          "uuid": "2cdd5fcc-5ca7-4e66-890a-6c3f4baa68d0",
          "name": "PROCARBAZINE HYDROCHLORIDE [MART.]",
          "stdName": "PROCARBAZINE HYDROCHLORIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eb5a3255-91b6-4750-89e6-5a59689ff978"
          ],
          "display_name": false
        },
        {
          "uuid": "6ade0674-c790-4464-8514-b4e16a5a71cf",
          "name": "PROCARBAZINE HYDROCHLORIDE [MI]",
          "stdName": "PROCARBAZINE HYDROCHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cca71f31-2426-41fa-b9e5-be4e8a0f3be7"
          ],
          "display_name": false
        },
        {
          "uuid": "ee56daec-167c-429c-8528-bc9f0e7fe75c",
          "name": "PROCARBAZINE HYDROCHLORIDE [ORANGE BOOK]",
          "stdName": "PROCARBAZINE HYDROCHLORIDE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f4ff94f-c759-406f-adb1-04fab99796f9"
          ],
          "display_name": false
        },
        {
          "uuid": "7ae72f84-896c-4588-b6fc-70ae58ca5757",
          "name": "PROCARBAZINE HYDROCHLORIDE [USAN]",
          "stdName": "PROCARBAZINE HYDROCHLORIDE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "798990b0-95a0-4751-88c0-3f8b982db643"
          ],
          "display_name": false
        },
        {
          "uuid": "62612c85-3d0c-cf79-0503-7068087945a3",
          "name": "PROCARBAZINE HYDROCHLORIDE [USP MONOGRAPH]",
          "stdName": "PROCARBAZINE HYDROCHLORIDE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bedb531c-1a4a-a8b9-08fb-c5c66caec82f"
          ],
          "display_name": false
        },
        {
          "uuid": "35a639ed-1d32-4ccf-b7f2-15cd9ac470b5",
          "name": "PROCARBAZINE HYDROCHLORIDE [USP-RS]",
          "stdName": "PROCARBAZINE HYDROCHLORIDE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93013d85-fe01-4e01-8e6a-5b5634f8a1c7"
          ],
          "display_name": false
        },
        {
          "uuid": "b0daf19a-0c7f-4062-b0f4-3a375b405db9",
          "name": "PROCARBAZINE HYDROCHLORIDE [VANDF]",
          "stdName": "PROCARBAZINE HYDROCHLORIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f0486c7-9400-4436-a1e6-7ee0b9f5e413"
          ],
          "display_name": false
        },
        {
          "uuid": "02748128-4973-4cd3-a9ac-17541fa6461d",
          "name": "PROCARBAZINE HYDROCHLORIDE [WHO-IP]",
          "stdName": "PROCARBAZINE HYDROCHLORIDE [WHO-IP]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4892e4fb-4870-4272-9ffb-00aeac5c6540"
          ],
          "display_name": false
        },
        {
          "uuid": "6fe73e07-30a4-4b60-8402-3f82c2c22dd9",
          "name": "PROCARBAZINI HYDROCHLORIDUM [WHO-IP LATIN]",
          "stdName": "PROCARBAZINI HYDROCHLORIDUM [WHO-IP LATIN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4892e4fb-4870-4272-9ffb-00aeac5c6540"
          ],
          "display_name": false
        },
        {
          "uuid": "4d88cc45-3039-cf85-9823-1061e018bad7",
          "name": "Procarbazine hydrochloride [WHO-DD]",
          "stdName": "PROCARBAZINE HYDROCHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7647407c-97b3-4230-0ad4-ba6595e0db11"
          ],
          "display_name": false
        },
        {
          "uuid": "732fd76b-eea0-4a8c-aa64-016b4ab77f1d",
          "name": "RO 4 6467/1",
          "stdName": "RO 4 6467/1",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a46d1555-7c8b-4a19-98c4-2d206684950d"
          ],
          "display_name": false
        },
        {
          "uuid": "43ba9787-2fde-4609-a68b-d9db891711cd",
          "name": "RO 4-6467/1",
          "stdName": "RO 4-6467/1",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b6c1850-9726-4ceb-9b18-34957f7e2b5b"
          ],
          "display_name": false
        },
        {
          "uuid": "09c2c330-c168-4356-93f7-17d532db27d1",
          "name": "RO-4-6467 HYDROCHLORIDE",
          "stdName": "RO-4-6467 HYDROCHLORIDE",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cca71f31-2426-41fa-b9e5-be4e8a0f3be7"
          ],
          "display_name": false
        },
        {
          "uuid": "635a9b58-8c5f-46d8-b15c-ada3ae50b4a3",
          "name": "RO-4-6467/1",
          "stdName": "RO-4-6467/1",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4621734-f4e5-47b4-9808-4226b352c7ef"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "88a80280-d8b7-4e95-9a5c-0f5289c420ee",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4ba395ad-1a34-4c31-8d69-6c6041f99069",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "016b0b2a-2e72-4dd8-8044-e2e46d908045",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "798990b0-95a0-4751-88c0-3f8b982db643",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4946d2cc-320e-4978-95d5-acf04762cebe",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f4ff94f-c759-406f-adb1-04fab99796f9",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb5a3255-91b6-4750-89e6-5a59689ff978",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93013d85-fe01-4e01-8e6a-5b5634f8a1c7",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd0e6fec-c364-48b3-b37e-a338a0144028",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f0486c7-9400-4436-a1e6-7ee0b9f5e413",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cca71f31-2426-41fa-b9e5-be4e8a0f3be7",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4892e4fb-4870-4272-9ffb-00aeac5c6540",
          "citation": "WHO-IP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a46d1555-7c8b-4a19-98c4-2d206684950d",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a4621734-f4e5-47b4-9808-4226b352c7ef",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b6c1850-9726-4ceb-9b18-34957f7e2b5b",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ea7624c-3478-4b78-82c6-8a6d89e50093",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389696000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a74b6c4-fb8c-414c-b67e-7d94cc7dc495",
          "citation": "SRS import [XH0NPH5ZX8]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=XH0NPH5ZX8",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389696000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "750f3190-c945-42eb-80d5-6f91172ba3e3",
          "citation": "PROCARBAZINE HYDROCHLORIDE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b83847d3-da31-484a-8b40-3c121fbcc614",
          "citation": "PROCARBAZINE HYDROCHLORIDE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "511c1573-e2b1-45fb-80e8-7cc936a27382",
          "citation": "PROCARBAZINE HYDROCHLORIDE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "245b2b63-6781-4542-a18a-7b774d7feca1",
          "citation": "PROCARBAZINE HYDROCHLORIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5c6321e5-ea42-401d-bc00-6b4d03561a40",
          "citation": "PROCARBAZINE HYDROCHLORIDE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "35baae82-39db-4657-9a93-7241ad208f18",
          "citation": "PROCARBAZINE HYDROCHLORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4cd11a5e-1f88-487c-9775-7c187006bd70",
          "citation": "PROCARBAZINE HYDROCHLORIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8e905915-6c61-4cab-a3b6-aed6b46a8563",
          "citation": "PROCARBAZINE HYDROCHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a7c2aeea-fe0a-443a-ace5-59c08527de0e",
          "citation": "PROCARBAZINE HYDROCHLORIDE [WHO-IP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b42a410d-f986-ebc7-85d8-a69c3ddaa8ac",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9efe84a0-401d-9fc5-0657-a73420098bcd",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=366-70-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0bffbb79-8ba8-4562-aee7-6f132563f946",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "e4fc6ace-7f6d-1b04-4d93-3fbcbb7a4030",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7544890c-f0ff-4993-95e7-e32721964512",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d05a39e2-285a-4c08-810a-9a1cd5c19255",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "bedb531c-1a4a-a8b9-08fb-c5c66caec82f",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "6e508253-4fd6-6484-0540-6addb091e87a",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7647407c-97b3-4230-0ad4-ba6595e0db11",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "448ad29b-d6cb-729a-fc1c-095cdd66a04b",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "46d8f40a-e5d3-205b-03f3-4e95cc68f8d1",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0288ceaf-e138-45fb-abcb-562db22c5a31",
          "id": "0288ceaf-e138-45fb-abcb-562db22c5a31",
          "molfile": "\n  Marvin  01132100272D          \n\n  1  0  0  0  0  0            999 V2000\n    7.5777   -1.4809    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "090aa331-8d6a-4ccd-b175-6f0c18ec0a2d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "2b5abfc5-544c-4324-9495-3e616db7f389",
          "id": "2b5abfc5-544c-4324-9495-3e616db7f389",
          "molfile": "\n  Marvin  01132102212D          \n\n 16 16  0  0  0  0            999 V2000\n    6.9225    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4324   -0.9536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5960   -0.9536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1566   -1.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3655   -1.6807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9473   -2.3918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1430   -2.3918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7115   -1.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1270   -0.9775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9260   -0.9775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8165   -1.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4729   -2.4318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4170   -0.9775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5434   -0.9775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.6567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0187   -0.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 11  1  0  0  0  0\n 10  9  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  1  0  0  0  0\nM  END",
          "smiles": "CC(C)NC(=O)c1ccc(cc1)CNNC",
          "formula": "C12H19N3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "09b7e540-ea4a-4f7b-a303-66f55bcc0aec"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "221.2992",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "76f58abe-d9a0-46f9-8bf1-6e173bc72835",
      "version": "25",
      "structure": {
        "id": "668c301f-b606-4284-a96f-7391670ad07e",
        "molfile": "\n  Marvin  01132105202D          \n\n 17 16  0  0  0  0            999 V2000\n    1.8165   -1.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4170   -0.9775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7115   -1.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4729   -2.4318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1430   -2.3918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1270   -0.9775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5960   -0.9536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4324   -0.9536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9260   -0.9775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9473   -2.3918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3655   -1.6807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5434   -0.9775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1566   -1.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9225    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.6567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0187   -0.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5777   -1.4809    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  3  2  0  0  0  0\n  6  3  1  0  0  0  0\n  7 13  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  6  2  0  0  0  0\n 10  5  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12  2  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14  8  1  0  0  0  0\n 15 12  1  0  0  0  0\n 16 12  1  0  0  0  0\n 11 10  2  0  0  0  0\nM  END",
        "smiles": "CC(C)NC(=O)c1ccc(cc1)CNNC.Cl",
        "formula": "C12H19N3O.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "257.7601",
        "optical_activity": "NONE",
        "references": [
          "88a80280-d8b7-4e95-9a5c-0f5289c420ee",
          "9a74b6c4-fb8c-414c-b67e-7d94cc7dc495"
        ],
        "stereo_centers": 0
      },
      "unii": "XH0NPH5ZX8"
    }
  ]
}