{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8c02fdd9-d904-4c24-8a55-5a91c546cfcd",
          "code": "19943-27-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=19943-27-2",
          "code_system": "CAS",
          "references": [
            "788404d9-97e2-7c8b-8189-9db971a12a20"
          ]
        },
        {
          "uuid": "cd44fe4a-1e08-4453-be01-ac3807325620",
          "code": "6708-06-1",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6708-06-1",
          "code_system": "CAS",
          "references": [
            "788404d9-97e2-7c8b-8189-9db971a12a20"
          ]
        },
        {
          "uuid": "920d0802-f181-4a64-9891-d19204618543",
          "code": "36588-47-3",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=36588-47-3",
          "code_system": "CAS",
          "references": [
            "788404d9-97e2-7c8b-8189-9db971a12a20"
          ]
        },
        {
          "uuid": "688c67d4-bd84-4651-5634-b5e9068592de",
          "code": "DTXSID201313224",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201313224",
          "code_system": "EPA CompTox",
          "references": [
            "5112ae83-52f4-4daa-0a6d-ecca8205ecfd"
          ]
        },
        {
          "uuid": "724be81c-e871-7a08-5f84-7c51ebb95b47",
          "code": "736756",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/736756",
          "code_system": "PUBCHEM",
          "references": [
            "b081c66c-d0cd-e501-48be-6ae54d78ea8a"
          ]
        },
        {
          "uuid": "a940f193-7439-4a8b-8212-db70eb43a488",
          "code": "XGU973420W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3536c60b-24aa-b86b-a924-8afab172fc7a",
          "name": "5H,10H-DIPYRROLO(1,2-A:1',2'-D)PYRAZINE-5,10-DIONE, OCTAHYDRO-, (5AS,10AS)-",
          "stdName": "5H,10H-DIPYRROLO(1,2-A:1',2'-D)PYRAZINE-5,10-DIONE, OCTAHYDRO-, (5AS,10AS)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "788404d9-97e2-7c8b-8189-9db971a12a20"
          ],
          "display_name": false
        },
        {
          "uuid": "6be0b51a-2ebc-3fd1-5269-1b7d8bde49e5",
          "name": "CYCLO(L-PRO-L-PRO)",
          "stdName": "CYCLO(L-PRO-L-PRO)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "788404d9-97e2-7c8b-8189-9db971a12a20"
          ],
          "display_name": false
        },
        {
          "uuid": "f4d5e81f-3690-e7b4-4c71-46ed6454dcfe",
          "name": "CYCLO(L-PROLYL-L-PROLYL)",
          "stdName": "CYCLO(L-PROLYL-L-PROLYL)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "788404d9-97e2-7c8b-8189-9db971a12a20"
          ],
          "display_name": false
        },
        {
          "uuid": "81ecfbda-4888-a5c0-116c-5a02da904b92",
          "name": "CYCLO(PROLYLPROLINE)",
          "stdName": "CYCLO(PROLYLPROLINE)",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "52f39df3-ad5a-e1f8-30fc-f175a99b2894"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "e3d304b1-7960-4dbb-b940-41f1360a69d6",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "c495fcaf-368c-8a23-dc89-2363a020e862",
          "name": "CYCLO(PROLYLPROLYL)",
          "stdName": "CYCLO(PROLYLPROLYL)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "788404d9-97e2-7c8b-8189-9db971a12a20"
          ],
          "display_name": false
        },
        {
          "uuid": "3cb00a24-6b49-9542-ae68-845c44668fd6",
          "name": "L-PROLINE ANHYDRIDE",
          "stdName": "L-PROLINE ANHYDRIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "788404d9-97e2-7c8b-8189-9db971a12a20"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b081c66c-d0cd-e501-48be-6ae54d78ea8a",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "788404d9-97e2-7c8b-8189-9db971a12a20",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "52f39df3-ad5a-e1f8-30fc-f175a99b2894",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5112ae83-52f4-4daa-0a6d-ecca8205ecfd",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7c777395-84a7-f8cd-d57b-d46831e65e14",
          "id": "7c777395-84a7-f8cd-d57b-d46831e65e14",
          "molfile": "\n  Marvin  01132106282D          \n\n 16 18  0  0  1  0            999 V2000\n   15.2160   -2.4207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2393   -3.2454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5368   -3.6780    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.5602   -4.5027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2861   -4.8947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9886   -4.4621    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   15.9651   -3.6375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7423   -3.3604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2459   -4.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7801   -4.6947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0981   -5.2798    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3096   -5.7194    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7831   -4.7798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2795   -4.1264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7453   -3.4454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4273   -2.8603    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  2  7  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 15  1  0  0  0  0\n  3 16  1  6  0  0  0\n  4  5  1  0  0  0  0\n  4 13  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 12  2  0  0  0  0\n  7  6  1  0  0  0  0\n  6 10  1  0  0  0  0\n  6 11  1  6  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\nM  END",
          "smiles": "C1C[C@@]2([H])C(=O)N3CCC[C@@]3([H])C(=O)N2C1",
          "formula": "C10H14N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c1b419ae-7c02-43f7-92a9-8ef29ef13d8c"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "194.2307",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d552c674-5264-461f-9b1a-cbc7864d9f80",
      "version": "5",
      "structure": {
        "id": "46975ec8-4102-a051-2b89-c6e5cb80d8c4",
        "molfile": "5H,10H-Dipyrrolo[1,2-a:1',2'-d]pyrazine-5,10-dione, octahydro-, (5aS,10aS)-\n  Marvin  01132103422D          \n\n 16 18  0  0  1  0            999 V2000\n   15.2160   -2.4207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2393   -3.2454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5368   -3.6780    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.5602   -4.5027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2861   -4.8947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9886   -4.4621    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   15.9651   -3.6375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7423   -3.3604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2459   -4.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7801   -4.6947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0981   -5.2798    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3096   -5.7194    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7831   -4.7798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2795   -4.1264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7453   -3.4454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4273   -2.8603    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n  6 10  1  0  0  0  0\n  6 11  1  6  0  0  0\n  5 12  2  0  0  0  0\n  4 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n  3 15  1  0  0  0  0\n  3 16  1  6  0  0  0\nM  END",
        "smiles": "C1C[C@@]2([H])C(=O)N3CCC[C@@]3([H])C(=O)N2C1",
        "formula": "C10H14N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "194.2307",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "52f39df3-ad5a-e1f8-30fc-f175a99b2894",
          "788404d9-97e2-7c8b-8189-9db971a12a20"
        ],
        "stereo_centers": 2
      },
      "unii": "XGU973420W"
    }
  ]
}