{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2a48adb8-9001-4d9c-83ad-fdb1324e94e8",
          "code": "206354-95-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=206354-95-2",
          "code_system": "CAS",
          "references": [
            "29840916-5124-4236-93fa-5e10f367889f",
            "6ccbedf3-dcfe-4430-8aba-a14a3ca97897"
          ]
        },
        {
          "uuid": "b86725eb-11e0-44a7-ab69-11a0757bfeed",
          "code": "56554-53-1",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=56554-53-1",
          "code_system": "CAS",
          "references": [
            "29840916-5124-4236-93fa-5e10f367889f",
            "ba102a05-9b62-44db-92a0-e3cc37866932"
          ]
        },
        {
          "uuid": "2e33d990-df98-4250-a3bc-2c5b7a3f7f19",
          "code": "1427124",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1427124/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "29840916-5124-4236-93fa-5e10f367889f"
          ]
        },
        {
          "uuid": "05fa9623-f1c7-44e9-89ee-9251bb3f4623",
          "code": "92447",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/92447",
          "code_system": "PUBCHEM",
          "references": [
            "29840916-5124-4236-93fa-5e10f367889f"
          ]
        },
        {
          "uuid": "8ca6b23d-1cd9-4ab6-8169-23991c28e1ae",
          "code": "260-257-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.054.762",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "29840916-5124-4236-93fa-5e10f367889f"
          ]
        },
        {
          "uuid": "91324ffa-1329-4177-b52e-f67c5d2b4d8a",
          "code": "XF4K22WN6T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b9f1a2f6-a6bb-2ca4-cfc5-07072ffcb76f",
          "code": "DTXSID10971994",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10971994",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "7c76f82c-b69a-7d94-4a52-1ad0d406ae31",
          "code": "XF4K22WN6T",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=XF4K22WN6T",
          "code_system": "DAILYMED",
          "references": [
            "60486c2d-c158-b39f-5e4e-eeb7b6bee1fb"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1b06fad4-32c7-46ae-addc-9dbc4375110d",
          "name": "DUB TING",
          "stdName": "DUB TING",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3685034b-9848-4321-a462-bdd1f88fee2d",
            "351f07ae-4274-4d64-b39d-2b3b35f32cfd"
          ],
          "display_name": false
        },
        {
          "uuid": "771540bd-dbe9-4600-a93a-d2517b5b8b72",
          "name": "GLYCEROL TRIISONONANOATE",
          "stdName": "GLYCEROL TRIISONONANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60c4970b-358a-4d73-83c0-8ccebe628c68",
            "351f07ae-4274-4d64-b39d-2b3b35f32cfd"
          ],
          "display_name": false
        },
        {
          "uuid": "437cd371-5cc7-4c54-8088-f70a0aa7f53f",
          "name": "GLYCERYL TRIISONONANOATE",
          "stdName": "GLYCERYL TRIISONONANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60c4970b-358a-4d73-83c0-8ccebe628c68",
            "351f07ae-4274-4d64-b39d-2b3b35f32cfd"
          ],
          "display_name": false
        },
        {
          "uuid": "906a62c5-53e9-4f52-afe2-05b48dd85f9b",
          "name": "HEXANOIC ACID, 3,5,5-TRIMETHYL-, 1,2,3-PROPANETRIYL ESTER",
          "stdName": "HEXANOIC ACID, 3,5,5-TRIMETHYL-, 1,2,3-PROPANETRIYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54708d48-d6f6-4da7-bed7-1a40c3e872c0",
            "351f07ae-4274-4d64-b39d-2b3b35f32cfd"
          ],
          "display_name": false
        },
        {
          "uuid": "85f44ab4-eaa8-4f86-b596-832ce8badd04",
          "name": "ISODRAGOL",
          "stdName": "ISODRAGOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54708d48-d6f6-4da7-bed7-1a40c3e872c0",
            "351f07ae-4274-4d64-b39d-2b3b35f32cfd"
          ],
          "display_name": false
        },
        {
          "uuid": "3f50933f-e4e9-499c-8d1a-6623e307c87f",
          "name": "ISODRAGOL 660061",
          "stdName": "ISODRAGOL 660061",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3685034b-9848-4321-a462-bdd1f88fee2d",
            "351f07ae-4274-4d64-b39d-2b3b35f32cfd"
          ],
          "display_name": false
        },
        {
          "uuid": "3bfa60b2-0843-4719-b14c-4f940ff2c5d6",
          "name": "ISONONANOIC ACID, 1,1',1''-(1,2,3-PROPANETRIYL) ESTER",
          "stdName": "ISONONANOIC ACID, 1,1',1''-(1,2,3-PROPANETRIYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54708d48-d6f6-4da7-bed7-1a40c3e872c0",
            "351f07ae-4274-4d64-b39d-2b3b35f32cfd"
          ],
          "display_name": false
        },
        {
          "uuid": "80c7e364-59a9-47cc-844a-d37590b3cece",
          "name": "ISONONANOIC ACID, 1,2,3-PROPANETRIYL ESTER",
          "stdName": "ISONONANOIC ACID, 1,2,3-PROPANETRIYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54708d48-d6f6-4da7-bed7-1a40c3e872c0",
            "351f07ae-4274-4d64-b39d-2b3b35f32cfd"
          ],
          "display_name": false
        },
        {
          "uuid": "7d10b0ea-585d-428e-a97d-ca894af1fe7b",
          "name": "TRIISONONANOIN",
          "stdName": "TRIISONONANOIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3685034b-9848-4321-a462-bdd1f88fee2d",
            "1f307edf-12cf-4436-80e9-c008186c1d68",
            "351f07ae-4274-4d64-b39d-2b3b35f32cfd"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7f0625c3-6d61-46b5-ace6-91eeb8504626",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "3685034b-9848-4321-a462-bdd1f88fee2d",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "351f07ae-4274-4d64-b39d-2b3b35f32cfd",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54708d48-d6f6-4da7-bed7-1a40c3e872c0",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60c4970b-358a-4d73-83c0-8ccebe628c68",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "29840916-5124-4236-93fa-5e10f367889f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391935000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6321f12-f183-46c1-b21c-220a8da09985",
          "citation": "SRS import [XF4K22WN6T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=XF4K22WN6T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391935000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f307edf-12cf-4436-80e9-c008186c1d68",
          "citation": "TRIISONONANOIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6ccbedf3-dcfe-4430-8aba-a14a3ca97897",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ba102a05-9b62-44db-92a0-e3cc37866932",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "60486c2d-c158-b39f-5e4e-eeb7b6bee1fb",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "26304c4a-1c76-4882-b917-e6019720ca39",
          "id": "26304c4a-1c76-4882-b917-e6019720ca39",
          "molfile": "\n  Marvin  01132102072D          \n\n 36 35  0  0  0  0            999 V2000\n    9.0028   -7.9022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7094   -8.3281    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   10.4315   -7.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4470   -7.1043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7405   -6.6785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1691   -6.7054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1847   -5.8805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4781   -5.4546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4936   -4.6298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7238   -4.3331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5959   -3.5180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8261   -3.2213    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2378   -2.9998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1098   -2.1847    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.3400   -1.8880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7517   -1.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6238   -0.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4958   -0.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8540   -0.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2656   -0.3331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7560   -5.8536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0494   -5.4277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0649   -4.6029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3273   -5.8266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6207   -5.4008    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.6362   -4.5759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8986   -5.7998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1920   -5.3739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4699   -5.7729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2075   -4.5490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4854   -4.9480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6938   -9.1530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9717   -9.5519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9562  -10.3768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2652   -9.1261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2496   -9.9509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 32  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 21  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 20 17  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  2  0  0  0  0\n 24 22  1  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 27 25  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  1  0  0  0  0\n 28 30  1  0  0  0  0\n 28 31  1  0  0  0  0\n 33 32  1  0  0  0  0\n 34 33  1  0  0  0  0\n 33 35  1  0  0  0  0\n 33 36  1  0  0  0  0\nM  END",
          "smiles": "CC(CC(=O)OCC(COC(=O)CC(C)CC(C)(C)C)OC(=O)CC(C)CC(C)(C)C)CC(C)(C)C",
          "formula": "C30H56O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a086b721-cd76-4b37-9b63-a03c10a2c821"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "512.7632",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "INCOMPLETE",
      "uuid": "4695360c-2218-42d9-aa9d-31df6cc84b32",
      "version": "5",
      "structure": {
        "id": "db055c81-6860-4efc-a310-3d1574b60578",
        "molfile": "\n  Marvin  01132111222D          \n\n 36 35  0  0  0  0            999 V2000\n    8.9562  -10.3768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9717   -9.5519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6938   -9.1530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7094   -8.3281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4315   -7.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4470   -7.1043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1691   -6.7054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7405   -6.6785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0028   -7.9022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2652   -9.1261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2496   -9.9509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4699   -5.7729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1920   -5.3739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8986   -5.7998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6207   -5.4008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3273   -5.8266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0494   -5.4277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7560   -5.8536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0649   -4.6029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6362   -4.5759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2075   -4.5490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4854   -4.9480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1847   -5.8805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4781   -5.4546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4936   -4.6298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4958   -0.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8540   -0.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3400   -1.8880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8261   -3.2213    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7238   -4.3331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5959   -3.5180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2378   -2.9998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1098   -2.1847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7517   -1.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6238   -0.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2656   -0.3331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  2  0  0  0  0\n  4  9  1  0  0  0  0\n  2 10  1  0  0  0  0\n  2 11  1  0  0  0  0\n 24 18  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n 15 20  1  0  0  0  0\n 13 21  1  0  0  0  0\n 13 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 30 25  1  0  0  0  0\n 35 26  1  0  0  0  0\n 35 27  1  0  0  0  0\n 33 28  1  0  0  0  0\n 31 29  2  0  0  0  0\n 31 30  1  0  0  0  0\n 32 31  1  0  0  0  0\n 33 32  1  0  0  0  0\n 34 33  1  0  0  0  0\n 35 34  1  0  0  0  0\n 36 35  1  0  0  0  0\n 23  7  1  0  0  0  0\nM  END",
        "smiles": "CC(CC(=O)OCC(COC(=O)CC(C)CC(C)(C)C)OC(=O)CC(C)CC(C)(C)C)CC(C)(C)C",
        "formula": "C30H56O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "512.7632",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3685034b-9848-4321-a462-bdd1f88fee2d",
          "f6321f12-f183-46c1-b21c-220a8da09985"
        ],
        "stereo_centers": 3
      },
      "unii": "XF4K22WN6T"
    }
  ]
}