{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7001b347-435f-4adb-b888-e7953f883f04",
          "code": "63-29-6",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=63-29-6",
          "code_system": "CAS",
          "references": [
            "e3ae753f-3e6a-42f3-a2e3-c560736321e7",
            "c61070dc-ca85-487b-9ca6-5b90cd2bcf79"
          ]
        },
        {
          "uuid": "c24a3de0-bd2c-4750-b7c9-f0caf550cd56",
          "code": "32449-92-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=32449-92-6",
          "code_system": "CAS",
          "references": [
            "e3ae753f-3e6a-42f3-a2e3-c560736321e7",
            "236c50fa-3b97-4876-9be4-7312b148c6b0"
          ]
        },
        {
          "uuid": "be5cdf36-7fc0-4094-85a8-d8b99a6c8900",
          "code": "C101515",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C101515",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e3ae753f-3e6a-42f3-a2e3-c560736321e7"
          ]
        },
        {
          "uuid": "1a515783-52e9-4cbe-ae55-92d95dd7d967",
          "code": "72508",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2022",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "e3ae753f-3e6a-42f3-a2e3-c560736321e7"
          ]
        },
        {
          "uuid": "429dce2a-3e91-4c0a-8614-7771ec551f73",
          "code": "663",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=663",
          "code_system": "INN",
          "references": [
            "e3ae753f-3e6a-42f3-a2e3-c560736321e7"
          ]
        },
        {
          "uuid": "7c6740bf-3910-410e-a5c8-3f517dd2fbf4",
          "code": "251-053-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.046.397",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e3ae753f-3e6a-42f3-a2e3-c560736321e7"
          ]
        },
        {
          "uuid": "54b296e8-8ee6-40cb-81b9-c6eb1434ec9f",
          "code": "m5773",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5773?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e3ae753f-3e6a-42f3-a2e3-c560736321e7"
          ]
        },
        {
          "uuid": "26d27ff2-d460-43b9-a3de-6d7252b4c03d",
          "code": "SUB13986MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e3ae753f-3e6a-42f3-a2e3-c560736321e7"
          ]
        },
        {
          "uuid": "f87071ad-dd7e-4246-a2e2-c91c44623187",
          "code": "CHEMBL2107425",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2107425",
          "code_system": "ChEMBL",
          "references": [
            "e3ae753f-3e6a-42f3-a2e3-c560736321e7"
          ]
        },
        {
          "uuid": "c8e26198-0d50-4b59-af2f-9aa19eb6b87e",
          "code": "1535222",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1535222/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e3ae753f-3e6a-42f3-a2e3-c560736321e7"
          ]
        },
        {
          "uuid": "96899eeb-213a-4552-86f7-b7e124f88306",
          "code": "92283",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/92283",
          "code_system": "PUBCHEM",
          "references": [
            "e3ae753f-3e6a-42f3-a2e3-c560736321e7"
          ]
        },
        {
          "uuid": "91bfd92c-0fdc-d75b-8d1a-00a9ea307523",
          "code": "Glucuronolactone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Glucuronolactone",
          "code_system": "WIKIPEDIA",
          "references": [
            "90061e30-6f56-90b6-2a6b-7707862c4da0"
          ]
        },
        {
          "uuid": "712dcfc5-64e3-a470-2bf8-0a40c52cbd0a",
          "code": "DTXSID6041844",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6041844",
          "code_system": "EPA CompTox",
          "references": [
            "f5af80b9-0eba-25da-60dc-21dd4d966a76"
          ]
        },
        {
          "uuid": "11dd7bed-be11-5d22-2959-e6a3694baaec",
          "code": "C344",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Carbohydrate",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C344",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5526d887-9536-4b3d-7089-f6cfa799d095"
          ]
        },
        {
          "uuid": "7ade204a-acf1-4d5b-b709-ba5728f5467d",
          "code": "XE4Y3016M9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0606c197-b404-d22f-c145-07bac69580f5",
          "code": "720 (Number of products:319)",
          "comments": "Dietary Supplement Label Database|Chemical|Glucuronolactone",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=720&item=Glucuronolactone",
          "code_system": "DSLD",
          "references": [
            "5526d887-9536-4b3d-7089-f6cfa799d095"
          ]
        },
        {
          "uuid": "ebd08a1c-da7b-29ef-3c7c-d672e1062544",
          "code": "3266",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3266",
          "code_system": "DRUG CENTRAL",
          "references": [
            "5526d887-9536-4b3d-7089-f6cfa799d095"
          ]
        },
        {
          "uuid": "635f9f00-dd53-0867-2337-23ed698e28dc",
          "code": "18268",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:18268",
          "code_system": "CHEBI",
          "references": [
            "5526d887-9536-4b3d-7089-f6cfa799d095"
          ]
        },
        {
          "uuid": "169e98d9-280e-f5c3-7e57-14abbceec4d7",
          "code": "XE4Y3016M9",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=XE4Y3016M9",
          "code_system": "DAILYMED",
          "references": [
            "7f2d8c50-907d-e359-d161-8b92352b9a91"
          ]
        },
        {
          "uuid": "5b1ce5d7-d16e-cc57-cf58-934c276ffe1a",
          "code": "656",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=656",
          "code_system": "NSC",
          "references": [
            "2dd7387d-2489-c63f-1b78-a97d2b2a499d"
          ]
        },
        {
          "uuid": "07c5a673-f11e-0016-db11-5166a4df35f2",
          "code": "100000078192",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "4899e497-a8d3-a993-3959-ec6f5ef8c995"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a59ae309-fe32-446d-a92a-1282646a50d4",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "d799c12d-2c78-4562-9015-7851df09ac6e",
            "refuuid": "b27ea813-7b5a-4f36-a0c5-a08404ae3bba",
            "name": "GLUCUROLACTONE",
            "unii": "XE4Y3016M9",
            "linking_id": "XE4Y3016M9",
            "ref_pname": "GLUCUROLACTONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4b83d09a-8160-4d59-a9c2-6b66b3524e0b",
          "name": ".GAMMA-LACTONE OF D-GLUCOFURANURONIC ACID",
          "stdName": ".GAMMA-LACTONE OF D-GLUCOFURANURONIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5b93b9e-fe69-4080-97d1-7dc852ad3aea"
          ],
          "display_name": false
        },
        {
          "uuid": "15dccfa6-b1cc-421e-924b-66697fc7c086",
          "name": "D-GLUCURONOLACTONE",
          "stdName": "D-GLUCURONOLACTONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99f3b01a-8796-4df5-a93e-241c3cd63975",
            "259d8688-3216-4690-8d14-377fac656b99",
            "0117bd40-7f73-43b8-97a5-7d27e2c74027",
            "b77101c4-1f29-4d42-b973-729f7e453e43"
          ],
          "display_name": false
        },
        {
          "uuid": "f0a88717-6872-4ec2-b4bc-fe8245014e19",
          "name": "D-GLUCURONOLACTONE [MI]",
          "stdName": "D-GLUCURONOLACTONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "259d8688-3216-4690-8d14-377fac656b99",
            "0117bd40-7f73-43b8-97a5-7d27e2c74027"
          ],
          "display_name": false
        },
        {
          "uuid": "6d74b787-7c6f-4860-9496-cd7b843df554",
          "name": "GLUCUROLACTONE",
          "stdName": "GLUCUROLACTONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bdd1924a-4913-4f67-9fe6-1ef2365c31d6",
            "f14b1ce8-7f22-40bf-9428-3a1ce8f00756",
            "56285ea7-1529-49ca-b3d4-253d8517082b",
            "9324e693-6dd9-4f0a-bc51-a81862eb9291",
            "56ccc34f-df81-43cf-b383-54646b61e96e",
            "259d8688-3216-4690-8d14-377fac656b99",
            "b8cd16e7-4dc9-48b6-9571-95eee7cb6305",
            "afa92496-ec60-47da-85e1-6fad86006e96"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "2fda86df-e1e1-4cd8-a9a1-9e574c7aef28",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "aa01e921-e83b-4589-886a-79e487e47b2e",
          "name": "GLUCUROLACTONE [MART.]",
          "stdName": "GLUCUROLACTONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8cd16e7-4dc9-48b6-9571-95eee7cb6305"
          ],
          "display_name": false
        },
        {
          "uuid": "654be043-82b1-4735-b5dc-c19aad003485",
          "name": "GLUCURONOLACTONE",
          "stdName": "GLUCURONOLACTONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "7464caeb-b10f-4477-bda5-436459c6b971",
            "646109c7-08ba-4141-af48-822b47abde8f",
            "259d8688-3216-4690-8d14-377fac656b99",
            "2d6ef8ca-3e33-497c-91c4-3fb4203240b3"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c47ccc1c-6b5d-40d2-b8ea-6c7d61978772",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "b29377b1-dd54-402e-972c-752e56a544ac",
          "name": "GLUCURONOLACTONE [JAN]",
          "stdName": "GLUCURONOLACTONE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7464caeb-b10f-4477-bda5-436459c6b971",
            "259d8688-3216-4690-8d14-377fac656b99"
          ],
          "display_name": false
        },
        {
          "uuid": "97ef5bab-c49f-44f3-bebe-bd46451d31c9",
          "name": "GURONSAN",
          "stdName": "GURONSAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3bda48f-9aa1-44c7-a0d2-c6113635cf64",
            "129d488e-d59d-46f6-9abf-e94f2c67ee63"
          ],
          "display_name": false
        },
        {
          "uuid": "cbda11d8-68b6-2d36-c536-61269f800de9",
          "name": "Glucurolactone [WHO-DD]",
          "stdName": "GLUCUROLACTONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd4b1f52-755c-9cd8-530c-a5f7cba1fb48"
          ],
          "display_name": false
        },
        {
          "uuid": "7434809e-1596-4e50-9d61-a85eeaecd0fc",
          "name": "NSC-656",
          "stdName": "NSC-656",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "259d8688-3216-4690-8d14-377fac656b99",
            "ffc179bf-33b9-4941-8a7c-1c964e324a92"
          ],
          "display_name": false
        },
        {
          "uuid": "58d22597-c2a8-4781-8899-8b82605fb500",
          "name": "glucurolactone [INN]",
          "stdName": "GLUCUROLACTONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56ccc34f-df81-43cf-b383-54646b61e96e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "afa92496-ec60-47da-85e1-6fad86006e96",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c7b08a33-d045-47da-9a66-8bad93cf930e",
          "citation": "STN 2008",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d5b93b9e-fe69-4080-97d1-7dc852ad3aea",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56ccc34f-df81-43cf-b383-54646b61e96e",
          "citation": "INN Proposed List 6",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL06.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b8cd16e7-4dc9-48b6-9571-95eee7cb6305",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "129d488e-d59d-46f6-9abf-e94f2c67ee63",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3bda48f-9aa1-44c7-a0d2-c6113635cf64",
          "citation": "D01800",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bdd1924a-4913-4f67-9fe6-1ef2365c31d6",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "259d8688-3216-4690-8d14-377fac656b99",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7464caeb-b10f-4477-bda5-436459c6b971",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99f3b01a-8796-4df5-a93e-241c3cd63975",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0117bd40-7f73-43b8-97a5-7d27e2c74027",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ffc179bf-33b9-4941-8a7c-1c964e324a92",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "646109c7-08ba-4141-af48-822b47abde8f",
          "citation": "IUPHAR",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e3ae753f-3e6a-42f3-a2e3-c560736321e7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389654000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9de45f53-efeb-4741-8941-df3d67ca412d",
          "citation": "SRS import [XE4Y3016M9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=XE4Y3016M9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389654000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab606e77-246e-442a-81f1-10db63f8005d",
          "citation": "USP Dictionary; INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9324e693-6dd9-4f0a-bc51-a81862eb9291",
          "citation": "GLUCUROLACTONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "56285ea7-1529-49ca-b3d4-253d8517082b",
          "citation": "GLUCUROLACTONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f14b1ce8-7f22-40bf-9428-3a1ce8f00756",
          "citation": "GLUCUROLACTONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2d6ef8ca-3e33-497c-91c4-3fb4203240b3",
          "citation": "GLUCURONOLACTONE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b77101c4-1f29-4d42-b973-729f7e453e43",
          "citation": "D-GLUCURONOLACTONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "90061e30-6f56-90b6-2a6b-7707862c4da0",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Glucuronolactone",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f5af80b9-0eba-25da-60dc-21dd4d966a76",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=32449-92-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5526d887-9536-4b3d-7089-f6cfa799d095",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "277b66b3-0436-cb8c-e9e1-c6d03d83728a",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "c61070dc-ca85-487b-9ca6-5b90cd2bcf79",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "236c50fa-3b97-4876-9be4-7312b148c6b0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "cd4b1f52-755c-9cd8-530c-a5f7cba1fb48",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2dd7387d-2489-c63f-1b78-a97d2b2a499d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7f2d8c50-907d-e359-d161-8b92352b9a91",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "4899e497-a8d3-a993-3959-ec6f5ef8c995",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e3edbaaf-fb11-474d-bde0-81561f328569",
          "id": "e3edbaaf-fb11-474d-bde0-81561f328569",
          "molfile": "\n  Marvin  01132111482D          \n\n 12 12  0  0  1  0            999 V2000\n    6.8792   -2.3829    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.0519   -1.5762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4916   -2.9358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2765   -2.6820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0943   -2.6368    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.4250   -2.1500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7599   -2.6368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9752   -2.3822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0125   -3.4209    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.5267   -4.0877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8375   -3.4209    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.3216   -4.0889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  6  1  6  0  0  0\n  5 11  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  6  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  6  0  0  0\nM  END",
          "smiles": "C(=O)[C@@H]([C@@H]1[C@@H]([C@@H](C(=O)O1)O)O)O",
          "formula": "C6H8O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bee81a9b-bb5d-46a2-9238-83489cf3d903"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "176.1244",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b27ea813-7b5a-4f36-a0c5-a08404ae3bba",
      "version": "16",
      "structure": {
        "id": "0c1cd157-8218-4ae5-9580-a26bd4a671bd",
        "molfile": "\n  Marvin  01132100522D          \n\n 13 13  0  0  1  0            999 V2000\n    5.0125   -3.4209    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.8375   -3.4209    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.0943   -2.6368    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.4250   -2.1500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7599   -2.6368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5267   -4.0877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3216   -4.0889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8792   -2.3829    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.9752   -2.3822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4916   -2.9358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0519   -1.5762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2765   -2.6820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6301   -3.1739    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  7  1  6  0  0  0\n  2  3  1  0  0  0  0\n  3  8  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  9  2  0  0  0  0\n  4  5  1  0  0  0  0\n  8 10  1  0  0  0  0\n  5  1  1  0  0  0  0\n  8 11  1  1  0  0  0\n  1  2  1  0  0  0  0\n 10 12  2  0  0  0  0\n  1  6  1  6  0  0  0\n  3 13  1  1  0  0  0\nM  END",
        "smiles": "C(=O)[C@@H]([C@]1([H])[C@@H]([C@@H](C(=O)O1)O)O)O",
        "formula": "C6H8O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "176.1244",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "9de45f53-efeb-4741-8941-df3d67ca412d",
          "ab606e77-246e-442a-81f1-10db63f8005d",
          "56ccc34f-df81-43cf-b383-54646b61e96e"
        ],
        "stereo_centers": 4
      },
      "unii": "XE4Y3016M9"
    }
  ]
}