{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "f5010b7e-9340-47dd-93e5-9aa78487e079", "code": "129944-99-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=129944-99-6", "code_system": "CAS", "references": [ "4257a6c9-88a3-40e5-84c3-b003a1449d05", "5a8d181f-4628-4ae8-a7a6-25780bdb832d" ] }, { "uuid": "ed395210-7960-4aff-851e-e06f76521441", "code": "448357", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/448357", "code_system": "PUBCHEM", "references": [ "4257a6c9-88a3-40e5-84c3-b003a1449d05" ] }, { "uuid": "7d52a225-f6aa-4342-b0a3-61575190b786", "code": "XD3FI6U4BP", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "5e6ca0b8-e9c8-65f9-f384-86fc229cb0e5", "code": "DTXSID40926533", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40926533", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "d7f1f00f-4ace-427d-9769-2e4eede9d25b", "name": "(1R,2R,3S,5S)-3-((3-HYDROXYBENZOYL)OXY)-8-METHYL-8-AZABICYCLO(3.2.1)OCTANE-2-CARBOXYLIC ACID", "stdName": "(1R,2R,3S,5S)-3-((3-HYDROXYBENZOYL)OXY)-8-METHYL-8-AZABICYCLO(3.2.1)OCTANE-2-CARBOXYLIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7c82c8d2-d287-455f-a957-36ee9a1b54f5", "f7645473-2bbd-4bc4-94f2-cdcc4afdb6c5" ], "display_name": false }, { "uuid": "02d8c8ab-0203-4031-82cc-5add3b68e9ac", "name": "3'-HYDROXYBENZOYLECGONINE", "stdName": "3'-HYDROXYBENZOYLECGONINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7c82c8d2-d287-455f-a957-36ee9a1b54f5", "f7645473-2bbd-4bc4-94f2-cdcc4afdb6c5" ], "display_name": false }, { "uuid": "f24f0b71-f194-411c-99f7-dce01d391ac8", "name": "3-HYDROXYLBENZOYLECGONINE", "stdName": "3-HYDROXYLBENZOYLECGONINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6399aa69-6f98-45b0-8066-fae22a53bbbd", "f7645473-2bbd-4bc4-94f2-cdcc4afdb6c5" ], "display_name": false }, { "uuid": "881bdb0f-a603-4a31-8ae5-3b81ac2f19be", "name": "8-AZABICYCLO(3.2.1)OCTANE-2-CARBOXYLIC ACID, 3-((3-HYDROXYBENZOYL)OXY)-8-METHYL-, (1R-(EXO,EXO))-", "stdName": "8-AZABICYCLO(3.2.1)OCTANE-2-CARBOXYLIC ACID, 3-((3-HYDROXYBENZOYL)OXY)-8-METHYL-, (1R-(EXO,EXO))-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7c82c8d2-d287-455f-a957-36ee9a1b54f5", "f7645473-2bbd-4bc4-94f2-cdcc4afdb6c5" ], "display_name": false }, { "uuid": "5feacb45-1fdc-ae8a-ff6c-bbb6d102a35f", "name": "META-HYDROXYBENZOYLECGONINE", "stdName": "META-HYDROXYBENZOYLECGONINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7c82c8d2-d287-455f-a957-36ee9a1b54f5" ], "display_name": true } ], "references": [ { "uuid": "f7645473-2bbd-4bc4-94f2-cdcc4afdb6c5", "citation": "stn", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "6399aa69-6f98-45b0-8066-fae22a53bbbd", "citation": "DL", "doc_type": "INN", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7c82c8d2-d287-455f-a957-36ee9a1b54f5", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4257a6c9-88a3-40e5-84c3-b003a1449d05", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390186000, "tags": [ "NOMEN" ] }, { "uuid": "5a8d181f-4628-4ae8-a7a6-25780bdb832d", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "408e7fc5-b814-44b1-b177-d1199ad31240", "id": "408e7fc5-b814-44b1-b177-d1199ad31240", "molfile": "\n Marvin 01132103252D \n\n 22 24 0 0 0 0 999 V2000\n 2.4143 -12.5000 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 1.7571 -11.9786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7571 -11.1536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4107 -10.6286 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 2.9107 -11.5821 0.0000 N 0 0 2 0 0 0 0 0 0 0 0 0\n 3.7750 -12.4464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2214 -10.8071 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 3.6357 -10.0821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4715 -10.0821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2143 -9.3572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5786 -11.5571 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 3.2286 -12.3071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2857 -11.5536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8964 -11.1964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8928 -10.4893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5071 -11.5464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5107 -12.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1250 -12.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7357 -12.2428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7322 -11.5357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3429 -11.1786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1143 -11.1857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 5 1 1 0 0 0\n 1 12 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 1 0 0 0\n 7 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 8 1 1 0 0 0\n 7 11 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 8 2 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 1 0 0 0\n 14 13 1 0 0 0 0\n 15 14 2 0 0 0 0\n 16 14 1 0 0 0 0\n 17 16 1 0 0 0 0\n 22 16 2 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 2 0 0 0 0\n 21 20 1 0 0 0 0\n 20 22 1 0 0 0 0\nM END", "smiles": "CN1[C@H]2CC[C@@H]1[C@H]([C@H](C2)OC(=O)c3cccc(c3)O)C(=O)O", "formula": "C16H19NO5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e66babd6-e217-4160-8d21-63fd633af715" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "305.3264", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "4c1441ad-001e-4358-9d2b-dac21bd1b45d", "version": "7", "structure": { "id": "ffe04426-9112-4d2e-ab24-d60016712ddc", "molfile": "\n Marvin 01132113142D \n\n 22 24 0 0 1 0 999 V2000\n 2.4107 -10.6286 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.2214 -10.8071 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 2.9107 -11.5821 0.0000 N 0 0 1 0 0 0 0 0 0 0 0 0\n 3.5786 -11.5571 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 4.8964 -11.1964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4143 -12.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.2286 -12.3071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2857 -11.5536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6357 -10.0821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7571 -11.1536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5071 -11.5464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7571 -11.9786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8928 -10.4893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4715 -10.0821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1143 -11.1857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2143 -9.3572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7750 -12.4464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7322 -11.5357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3429 -11.1786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5107 -12.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1250 -12.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7357 -12.2428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 1 3 1 1 0 0 0\n 4 2 1 0 0 0 0\n 5 8 1 0 0 0 0\n 6 3 1 1 0 0 0\n 7 4 1 0 0 0 0\n 4 8 1 1 0 0 0\n 2 9 1 1 0 0 0\n 10 1 1 0 0 0 0\n 11 5 1 0 0 0 0\n 12 10 1 0 0 0 0\n 13 5 2 0 0 0 0\n 14 9 2 0 0 0 0\n 15 11 2 0 0 0 0\n 16 9 1 0 0 0 0\n 17 3 1 0 0 0 0\n 18 15 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 11 1 0 0 0 0\n 21 20 2 0 0 0 0\n 22 18 2 0 0 0 0\n 6 12 1 0 0 0 0\n 7 6 1 0 0 0 0\n 22 21 1 0 0 0 0\nM END", "smiles": "CN1[C@H]2CC[C@@H]1[C@H]([C@H](C2)OC(=O)c3cccc(c3)O)C(=O)O", "formula": "C16H19NO5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "305.3264", "optical_activity": "UNSPECIFIED", "references": [ "7c82c8d2-d287-455f-a957-36ee9a1b54f5", "f7645473-2bbd-4bc4-94f2-cdcc4afdb6c5" ], "stereo_centers": 4 }, "unii": "XD3FI6U4BP" } ] }