{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f3cd7659-98e6-4cb7-8b37-d1362db5704a",
          "code": "24600-36-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=24600-36-0",
          "code_system": "CAS",
          "references": [
            "8b3c1a5e-8c55-4783-aba4-9adb994e284b",
            "116a10a3-2198-49de-82e4-a7c33d3f6921"
          ]
        },
        {
          "uuid": "3291a0e8-7953-4f94-808e-e4bb3365b079",
          "code": "246-344-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.042.116",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8b3c1a5e-8c55-4783-aba4-9adb994e284b"
          ]
        },
        {
          "uuid": "91ea10c3-2503-4f19-8158-22b68ba900db",
          "code": "m5525",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5525?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8b3c1a5e-8c55-4783-aba4-9adb994e284b"
          ]
        },
        {
          "uuid": "eb45ceff-6fc1-4cb0-b3bc-9e2b733c5b92",
          "code": "SUB02252MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "8b3c1a5e-8c55-4783-aba4-9adb994e284b"
          ]
        },
        {
          "uuid": "19bff7bc-2006-4c1b-bced-9fb6d6241d7c",
          "code": "CHEMBL1697837",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1697837",
          "code_system": "ChEMBL",
          "references": [
            "8b3c1a5e-8c55-4783-aba4-9adb994e284b"
          ]
        },
        {
          "uuid": "f4d78d55-a6cd-3747-5dcf-c49a38fbe4fe",
          "code": "DTXSID6048759",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6048759",
          "code_system": "EPA CompTox",
          "references": [
            "bd3bf857-0945-d7d4-40fc-b822886d2d66"
          ]
        },
        {
          "uuid": "ffbecee0-2703-4dbd-9b79-2d200cc5529a",
          "code": "18053-32-2",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=18053-32-2",
          "code_system": "CAS",
          "references": [
            "2672a055-8173-44aa-8f51-400892e342fb"
          ]
        },
        {
          "uuid": "f36985d1-0db0-f444-65f5-37c358e91219",
          "code": "443983",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/443983",
          "code_system": "PUBCHEM",
          "references": [
            "1dcf1b91-8328-d547-e089-782b050f9fc3"
          ]
        },
        {
          "uuid": "3ef8dc1c-6179-3958-0e45-269e25f86928",
          "code": "241-966-5",
          "type": "ALTERNATIVE",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.038.136",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8a3b73a7-3d75-d6ba-ccf6-f39cd5677e5d"
          ]
        },
        {
          "uuid": "66108604-b55f-66fe-4877-4762b462b57c",
          "code": "DBSALT002831",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT002831",
          "code_system": "DRUG BANK",
          "references": [
            "003b5220-afb0-e365-8c8b-8c61c95cc54d"
          ]
        },
        {
          "uuid": "4751ce36-419b-4c81-bbdd-4c0ddae31232",
          "code": "XCT2R4OS1G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a29488f6-18d0-789c-ed52-b9614196a2bf",
          "code": "293901",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=293901",
          "code_system": "NSC",
          "references": [
            "2bfdf670-8271-7eb2-129d-08dc16043aae"
          ]
        },
        {
          "uuid": "36b0acff-3bcc-7226-38f2-5f0c5fa2ed74",
          "code": "100000087017",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f0c9a10f-b7da-34f8-14b6-ce04797d6500"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "1c3317f9-536c-4954-b5e0-bfbb309e8f0e",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "24ab6a39-acd7-4abc-aed9-29624ac097c3",
            "refuuid": "da2948e8-a6e6-47b4-b295-df059f5af43f",
            "name": "FOMINOBEN",
            "unii": "TJ2KK6NYJS",
            "linking_id": "TJ2KK6NYJS",
            "ref_pname": "FOMINOBEN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c6f0fdf0-6b7e-4ca9-a9d9-2e73fbacb69a",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "5aa8128b-c0f6-4274-aafe-7018ccf2976b",
            "refuuid": "da2948e8-a6e6-47b4-b295-df059f5af43f",
            "name": "FOMINOBEN",
            "unii": "TJ2KK6NYJS",
            "linking_id": "TJ2KK6NYJS",
            "ref_pname": "FOMINOBEN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e92e42e3-659d-40ba-be0f-f929eb05a371",
          "name": "3'-CHLORO-2'-(N-METHYL-N-(MORPHOLINOCARBONYLMETHYL)AMINOMETHYL)BENZANILIDE HYDROCHLORIDE",
          "stdName": "3'-CHLORO-2'-(N-METHYL-N-(MORPHOLINOCARBONYLMETHYL)AMINOMETHYL)BENZANILIDE HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3714489-bbf0-471d-ae7c-9dfaf9bd6be6",
            "2672a055-8173-44aa-8f51-400892e342fb"
          ],
          "display_name": false
        },
        {
          "uuid": "59985d61-9c12-45b1-8ae8-9b996a8f093f",
          "name": "BENZAMIDE, N-(3-CHLORO-2-((METHYL(2-(4-MORPHOLINYL)-2-OXOETHYL)AMINO)METHYL)PHENYL)-, HYDROCHLORIDE (1:1)",
          "stdName": "BENZAMIDE, N-(3-CHLORO-2-((METHYL(2-(4-MORPHOLINYL)-2-OXOETHYL)AMINO)METHYL)PHENYL)-, HYDROCHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "362378fd-9c12-456d-84a7-41ecb6d85b7e",
            "2672a055-8173-44aa-8f51-400892e342fb"
          ],
          "display_name": false
        },
        {
          "uuid": "b07a96f9-b7c7-488f-921f-fd786964f733",
          "name": "FINATEN",
          "stdName": "FINATEN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "362378fd-9c12-456d-84a7-41ecb6d85b7e",
            "2672a055-8173-44aa-8f51-400892e342fb"
          ],
          "display_name": false
        },
        {
          "uuid": "5ff6c6a6-fe17-47df-88ae-740b94fff3fd",
          "name": "FOMINOBEN HYDROCHLORIDE",
          "stdName": "FOMINOBEN HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2780ed99-e20e-42ac-9377-d3bf83b5ad8e",
            "2672a055-8173-44aa-8f51-400892e342fb",
            "9940839f-923d-4112-a7fe-68f7288ec83b",
            "48973555-eadf-4db2-9428-e70967905195",
            "2d3e480c-6bad-47c8-894f-25714911be09",
            "2e6a48ed-54d1-4dd7-ac33-f3b8243d04b0",
            "8a7dc753-e01f-4c74-a3d7-8458e5b4bd0b",
            "0aacc140-ce61-43c7-92f1-c6c8f6c9785c",
            "ca44b30f-e384-48d5-80d8-9d1107ec1399",
            "4e34eb05-9f1c-4b57-bc3c-eb3bce5e36df"
          ],
          "display_name": true
        },
        {
          "uuid": "04a27d1b-8706-4016-be4b-af44769da0f4",
          "name": "FOMINOBEN HYDROCHLORIDE [JAN]",
          "stdName": "FOMINOBEN HYDROCHLORIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca44b30f-e384-48d5-80d8-9d1107ec1399",
            "2672a055-8173-44aa-8f51-400892e342fb"
          ],
          "display_name": false
        },
        {
          "uuid": "007a0d08-f820-43ff-89a2-437a5c0af14e",
          "name": "FOMINOBEN HYDROCHLORIDE [MART.]",
          "stdName": "FOMINOBEN HYDROCHLORIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d3e480c-6bad-47c8-894f-25714911be09"
          ],
          "display_name": false
        },
        {
          "uuid": "ccb38e15-f7b2-48d9-855a-0e068bb3810f",
          "name": "FOMINOBEN HYDROCHLORIDE [MI]",
          "stdName": "FOMINOBEN HYDROCHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0aacc140-ce61-43c7-92f1-c6c8f6c9785c",
            "2672a055-8173-44aa-8f51-400892e342fb"
          ],
          "display_name": false
        },
        {
          "uuid": "e4e1a722-3322-c423-e891-05bf79fc81f0",
          "name": "Fominoben hydrochloride [WHO-DD]",
          "stdName": "FOMINOBEN HYDROCHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b96ae091-2c13-7a68-d915-20f9cf96c22d"
          ],
          "display_name": false
        },
        {
          "uuid": "c9d55769-7760-4ec3-9c86-d79634ed0c57",
          "name": "N-(2-BENZOYLAMINO-6-CHLOROBENZYL)-N-METHYLGLYCINE MORPHOLIDE HYDROCHLORIDE",
          "stdName": "N-(2-BENZOYLAMINO-6-CHLOROBENZYL)-N-METHYLGLYCINE MORPHOLIDE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "362378fd-9c12-456d-84a7-41ecb6d85b7e",
            "2672a055-8173-44aa-8f51-400892e342fb"
          ],
          "display_name": false
        },
        {
          "uuid": "457ff213-1907-4e5f-835b-66a0bc569467",
          "name": "NOLEPTAN",
          "stdName": "NOLEPTAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "362378fd-9c12-456d-84a7-41ecb6d85b7e",
            "2672a055-8173-44aa-8f51-400892e342fb"
          ],
          "display_name": false
        },
        {
          "uuid": "192624b5-a338-43e3-9f52-45bb0ee0e570",
          "name": "NSC-293901",
          "stdName": "NSC-293901",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2672a055-8173-44aa-8f51-400892e342fb",
            "f6e30efc-ccf0-406e-91dc-864c868ea9e3"
          ],
          "display_name": false
        },
        {
          "uuid": "fb4b9390-9217-4274-8a09-9e19c0b90158",
          "name": "OLEPTAN",
          "stdName": "OLEPTAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "362378fd-9c12-456d-84a7-41ecb6d85b7e",
            "2672a055-8173-44aa-8f51-400892e342fb"
          ],
          "display_name": false
        },
        {
          "uuid": "62cd1555-8a24-4303-80dc-2e7942f9d44a",
          "name": "PB 89",
          "stdName": "PB 89",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2cf55562-8b7d-4b21-8c3a-ca4c8d98583a",
            "2672a055-8173-44aa-8f51-400892e342fb"
          ],
          "display_name": false
        },
        {
          "uuid": "2b86e3c8-fa89-4475-869c-b01f571d427a",
          "name": "PB 89CL",
          "stdName": "PB 89CL",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "362378fd-9c12-456d-84a7-41ecb6d85b7e",
            "2672a055-8173-44aa-8f51-400892e342fb"
          ],
          "display_name": false
        },
        {
          "uuid": "02da5879-277f-4085-a718-c94522d10ecf",
          "name": "PB-89",
          "stdName": "PB-89",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3714489-bbf0-471d-ae7c-9dfaf9bd6be6",
            "2672a055-8173-44aa-8f51-400892e342fb"
          ],
          "display_name": false
        },
        {
          "uuid": "8223b45f-929e-404e-baab-566807eeab32",
          "name": "PB-89CL",
          "stdName": "PB-89CL",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "362378fd-9c12-456d-84a7-41ecb6d85b7e",
            "2672a055-8173-44aa-8f51-400892e342fb"
          ],
          "display_name": false
        },
        {
          "uuid": "5ab652c8-778f-4ff5-ac03-f3e6667ae1fb",
          "name": "TUSSIRAMA",
          "stdName": "TUSSIRAMA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "362378fd-9c12-456d-84a7-41ecb6d85b7e",
            "2672a055-8173-44aa-8f51-400892e342fb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "362378fd-9c12-456d-84a7-41ecb6d85b7e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2672a055-8173-44aa-8f51-400892e342fb",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9940839f-923d-4112-a7fe-68f7288ec83b",
          "citation": "EMA LIST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e3714489-bbf0-471d-ae7c-9dfaf9bd6be6",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca44b30f-e384-48d5-80d8-9d1107ec1399",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d3e480c-6bad-47c8-894f-25714911be09",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48973555-eadf-4db2-9428-e70967905195",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0aacc140-ce61-43c7-92f1-c6c8f6c9785c",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2cf55562-8b7d-4b21-8c3a-ca4c8d98583a",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6e30efc-ccf0-406e-91dc-864c868ea9e3",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b3c1a5e-8c55-4783-aba4-9adb994e284b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390889000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02d31dee-ba79-4258-b7a5-adf8dd64d02d",
          "citation": "SRS import [XCT2R4OS1G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=XCT2R4OS1G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390889000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2780ed99-e20e-42ac-9377-d3bf83b5ad8e",
          "citation": "FOMINOBEN HYDROCHLORIDE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2e6a48ed-54d1-4dd7-ac33-f3b8243d04b0",
          "citation": "FOMINOBEN HYDROCHLORIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4e34eb05-9f1c-4b57-bc3c-eb3bce5e36df",
          "citation": "FOMINOBEN HYDROCHLORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8a7dc753-e01f-4c74-a3d7-8458e5b4bd0b",
          "citation": "FOMINOBEN HYDROCHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bd3bf857-0945-d7d4-40fc-b822886d2d66",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=24600-36-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "116a10a3-2198-49de-82e4-a7c33d3f6921",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1dcf1b91-8328-d547-e089-782b050f9fc3",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "8a3b73a7-3d75-d6ba-ccf6-f39cd5677e5d",
          "citation": "EC",
          "doc_type": "ECHA (EC/EINECS)",
          "public_domain": true
        },
        {
          "uuid": "003b5220-afb0-e365-8c8b-8c61c95cc54d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "2bfdf670-8271-7eb2-129d-08dc16043aae",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b96ae091-2c13-7a68-d915-20f9cf96c22d",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f0c9a10f-b7da-34f8-14b6-ce04797d6500",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b91a60f1-7dca-42c5-872f-7d8690aa9a9e",
          "id": "b91a60f1-7dca-42c5-872f-7d8690aa9a9e",
          "molfile": "\n  Marvin  01132109342D          \n\n  1  0  0  0  0  0            999 V2000\n    7.8815   -4.2519    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b60f89ed-a8ab-4095-a77c-4f1ef1d70cfd"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "380df648-a531-4211-9957-6ce2db3c8f2e",
          "id": "380df648-a531-4211-9957-6ce2db3c8f2e",
          "molfile": "\n  Marvin  01132102592D          \n\n 28 30  0  0  0  0            999 V2000\n    2.6532   -4.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2615   -3.4417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6762   -2.7733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5105   -2.7641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9207   -3.4509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9437   -2.0636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5381   -1.3354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9437   -0.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7917   -0.6301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1927   -1.3584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7457   -2.0497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4180   -3.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0446   -4.1377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4318   -4.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2384   -4.8889    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.0354   -5.5803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2104   -5.5849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1998   -4.8567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2334   -4.1147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1859   -3.4095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0249   -3.4186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4397   -4.1238    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4304   -2.7411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0157   -2.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4397   -1.2938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2693   -1.2938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6657   -1.9991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2739   -2.7503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 12  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n 11  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 19 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 21  1  0  0  0  0\n 24 23  1  0  0  0  0\n 28 23  2  0  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  2  0  0  0  0\n 27 28  1  0  0  0  0\nM  END",
          "smiles": "CN(Cc1c(cccc1NC(=O)c2ccccc2)Cl)CC(=O)N3CCOCC3",
          "formula": "C21H24ClN3O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c1fe2b3c-b93a-4c74-8e4f-5b8e5b54a9b4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "401.8873",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cde46c53-24ba-434e-903a-8a038771285c",
      "version": "11",
      "structure": {
        "id": "ebce2db0-e728-4450-81d0-c3f816f02eaa",
        "molfile": "\n  Marvin  01132112122D          \n\n 29 30  0  0  0  0            999 V2000\n   -2.2693   -1.2938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4397   -1.2938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0157   -2.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4304   -2.7411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2739   -2.7503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6657   -1.9991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0249   -3.4186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4397   -4.1238    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1859   -3.4095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2334   -4.1147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1998   -4.8567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2104   -5.5849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0354   -5.5803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4318   -4.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2384   -4.8889    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.0446   -4.1377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4180   -3.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2615   -3.4417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6532   -4.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6762   -2.7733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5105   -2.7641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9207   -3.4509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9437   -2.0636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5381   -1.3354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9437   -0.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7917   -0.6301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1927   -1.3584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7457   -2.0497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8815   -4.2519    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 14 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 18  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 21  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 23  1  0  0  0  0\n 10 16  2  0  0  0  0\nM  END",
        "smiles": "CN(Cc1c(cccc1NC(=O)c2ccccc2)Cl)CC(=O)N3CCOCC3.Cl",
        "formula": "C21H24ClN3O3.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "438.3482",
        "optical_activity": "NONE",
        "references": [
          "e3714489-bbf0-471d-ae7c-9dfaf9bd6be6",
          "02d31dee-ba79-4258-b7a5-adf8dd64d02d"
        ],
        "stereo_centers": 0
      },
      "unii": "XCT2R4OS1G"
    }
  ]
}