{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fcc6bcce-5b15-9cca-ccdb-e87e02286936",
          "code": "19683-98-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=19683-98-8",
          "code_system": "CAS",
          "references": [
            "2d54303e-95b9-49b9-9161-56ae7216cd4e"
          ]
        },
        {
          "uuid": "f4f6810c-80c7-3435-bc85-ce10db2dd4f4",
          "code": "DTXSID40941443",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40941443",
          "code_system": "EPA CompTox",
          "references": [
            "c3627904-2213-a97e-99bd-0e44781cfd5a"
          ]
        },
        {
          "uuid": "179d381a-0018-142b-24a8-a1c000ffb6b9",
          "code": "10957430",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10957430",
          "code_system": "PUBCHEM",
          "references": [
            "83d103a2-44ae-f76c-e23e-85b48b78b4db"
          ]
        },
        {
          "uuid": "b9b2975f-c58b-467b-b8ee-cf4e9d8a95ec",
          "code": "XBF6GMZ9TW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5bcb5dfc-7f3f-4b7b-a1fb-6440655ebebe",
          "name": "(-)-Ovalicin",
          "stdName": "(-)-OVALICIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d54303e-95b9-49b9-9161-56ae7216cd4e"
          ],
          "display_name": false
        },
        {
          "uuid": "968136c6-a65c-4bd3-81e3-bab4b35963a5",
          "name": "(3S,4R,5S)-4-Hydroxy-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methyl-2-buten-1-yl)-2-oxiranyl]-1-oxaspiro[2.5]octan-6-one",
          "stdName": "(3S,4R,5S)-4-HYDROXY-5-METHOXY-4-((2S,3R)-2-METHYL-3-(3-METHYL-2-BUTEN-1-YL)-2-OXIRANYL)-1-OXASPIRO(2.5)OCTAN-6-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d54303e-95b9-49b9-9161-56ae7216cd4e"
          ],
          "display_name": false
        },
        {
          "uuid": "48ab144a-5b2e-4fa0-85c6-df5a6dff0ec8",
          "name": "1-Oxaspiro[2.5]octan-6-one, 4-(1,2-epoxy-1,5-dimethyl-4-hexenyl)-4-hydroxy-5-methoxy-, (1S,2R,3S,4R,5S)-(-)-",
          "stdName": "1-OXASPIRO(2.5)OCTAN-6-ONE, 4-(1,2-EPOXY-1,5-DIMETHYL-4-HEXENYL)-4-HYDROXY-5-METHOXY-, (1S,2R,3S,4R,5S)-(-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d54303e-95b9-49b9-9161-56ae7216cd4e"
          ],
          "display_name": false
        },
        {
          "uuid": "118a0573-9543-486e-9eca-d11e4ca1c67c",
          "name": "1-Oxaspiro[2.5]octan-6-one, 4-hydroxy-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methyl-2-buten-1-yl)-2-oxiranyl]-, (3S,4R,5S)-",
          "stdName": "1-OXASPIRO(2.5)OCTAN-6-ONE, 4-HYDROXY-5-METHOXY-4-((2S,3R)-2-METHYL-3-(3-METHYL-2-BUTEN-1-YL)-2-OXIRANYL)-, (3S,4R,5S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d54303e-95b9-49b9-9161-56ae7216cd4e"
          ],
          "display_name": false
        },
        {
          "uuid": "85826e34-8876-4b78-a87e-f80d7f0faf2c",
          "name": "1-Oxaspiro[2.5]octan-6-one, 4-hydroxy-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methyl-2-butenyl)oxiranyl]-, (3S,4R,5S)-",
          "stdName": "1-OXASPIRO(2.5)OCTAN-6-ONE, 4-HYDROXY-5-METHOXY-4-((2S,3R)-2-METHYL-3-(3-METHYL-2-BUTENYL)OXIRANYL)-, (3S,4R,5S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d54303e-95b9-49b9-9161-56ae7216cd4e"
          ],
          "display_name": false
        },
        {
          "uuid": "a0d82e2d-fc74-44d6-9c83-2376d810ed9c",
          "name": "Graphinone",
          "stdName": "GRAPHINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d54303e-95b9-49b9-9161-56ae7216cd4e"
          ],
          "display_name": false
        },
        {
          "uuid": "449fce67-8ffa-4e27-ba9c-50df27a7cabb",
          "name": "Ovalicin",
          "stdName": "OVALICIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d54303e-95b9-49b9-9161-56ae7216cd4e"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "0d5878e8-6f5c-4002-a126-c45458ec19a7",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "2d54303e-95b9-49b9-9161-56ae7216cd4e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "83d103a2-44ae-f76c-e23e-85b48b78b4db",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "c3627904-2213-a97e-99bd-0e44781cfd5a",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "a6233410-0fce-aa8b-e49e-301053d6f972",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "58b53a02-478e-49b0-84ae-a5051583b43e",
          "id": "58b53a02-478e-49b0-84ae-a5051583b43e",
          "molfile": "\n  Marvin  09232217282D          \n\n 21 23  0  0  1  0            999 V2000\n   12.2190   -2.6767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6315   -3.3912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4565   -3.3912    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.8690   -2.6767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4565   -1.9623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6939   -2.6767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1065   -3.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6939   -4.1056    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   15.4084   -4.5181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6939   -4.9306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8690   -4.1056    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.0938   -4.3877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0123   -4.9181    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.4377   -5.0242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8690   -5.7305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2370   -5.2002    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.4246   -5.0570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8942   -5.6890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0819   -5.5457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5516   -6.1777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7997   -4.7704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  6  0  0  0\n  3  4  1  0  0  0  0\n 11  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  1  0  0  0\n  8  9  1  0  0  0  0\n  8 11  1  0  0  0  0\n 10  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 12  1  6  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  6  0  0  0\n 13 15  1  0  0  0  0\n 16 13  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  6  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\nM  END",
          "smiles": "CC(=CC[C@@H]1[C@@](C)([C@]2([C@@H](C(=O)CC[C@@]32CO3)OC)O)O1)C",
          "formula": "C16H24O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2a3992aa-1899-431f-b85e-85482c3f91b4"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "296.3594",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "21d70cf0-d168-4826-bfe3-3dcff690feb5",
      "version": "12",
      "structure": {
        "id": "06e5b520-bb7a-4d67-b3ba-ac78eabbb542",
        "molfile": "ZINC000003925938\n   JSDraw209232217282D\n\n 21 23  0  0  1  0              0 V2000\n   23.1051   -5.0614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8850   -6.4124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.4450   -6.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.2250   -5.0614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.4450   -3.7106    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.7849   -5.0614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5651   -6.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.7849   -7.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.1359   -8.5434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.7849   -9.3234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.2250   -7.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7592   -8.2968    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.4959   -9.2997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.3003   -9.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.2250  -10.8359    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.0299   -9.8331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4938   -9.5624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4909  -10.7574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.9548  -10.4864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.9521  -11.6814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4212   -9.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  6  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  1  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n 11 12  1  6  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  6  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  6  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 11  3  1  0  0  0  0\n 16 13  1  0  0  0  0\n 10  8  1  0  0  0  0\nM  END",
        "smiles": "CC(=CC[C@@H]1[C@@](C)([C@]2([C@@H](C(=O)CC[C@@]32CO3)OC)O)O1)C",
        "formula": "C16H24O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "296.3594",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "2d54303e-95b9-49b9-9161-56ae7216cd4e"
        ],
        "stereo_centers": 5
      },
      "unii": "XBF6GMZ9TW"
    }
  ]
}