{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "24698164-bf96-4513-83ce-3b06d6a0f255", "code": "116265-66-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=116265-66-8", "code_system": "CAS", "references": [ "55260bac-3ef0-4bc2-a5a0-0c43d99a9ee5", "5d147edd-11e2-42e6-be89-1d8488de1d0d" ] }, { "uuid": "eb954dfe-1e3b-4bc3-9feb-b22d79b955d3", "code": "14474513", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14474513", "code_system": "PUBCHEM", "references": [ "55260bac-3ef0-4bc2-a5a0-0c43d99a9ee5" ] }, { "uuid": "8895673b-317d-4b83-80b2-4a1a69d50143", "code": "XB88J87KY4", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "3a6e9b6a-af05-b45d-f3ea-be97e7d0b091", "code": "DTXSID40881335", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40881335", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "32188fa6-8252-43c1-aa52-efbe17ac04c6", "name": "FIFLOW 260", "stdName": "FIFLOW 260", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "52526c81-4fcc-4b1e-b85d-86c7b7f35609", "a1c279c6-0d95-4c8c-93c3-36e564efb1d4" ], "display_name": false }, { "uuid": "207fa2f5-3e94-46a0-8395-19b1825a140d", "name": "NAPHTHALENE, 2-(DIFLUORO(1,2,2,3,3,4,4,5,5,6,6-UNDECAFLUOROCYCLOHEXYL)METHYL)-1,1,2,3,3,4,4,4A,5,5,6,6,7,7,8,8,8A-HEPTADECAFLUORODECAHYDRO-", "stdName": "NAPHTHALENE, 2-(DIFLUORO(1,2,2,3,3,4,4,5,5,6,6-UNDECAFLUOROCYCLOHEXYL)METHYL)-1,1,2,3,3,4,4,4A,5,5,6,6,7,7,8,8,8A-HEPTADECAFLUORODECAHYDRO-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a1c279c6-0d95-4c8c-93c3-36e564efb1d4", "e804d4ab-db71-4180-abf8-c250ed3a05cc" ], "display_name": false }, { "uuid": "d76ed3c0-dddf-45a1-828c-2275338899e5", "name": "NAPHTHALENE, 2-(DIFLUORO(UNDECAFLUOROCYCLOHEXYL)METHYL)-1,1,2,3,3,4,4,4A,5,5,6,6,7,7,8,8,8A-HEPTADECAFLUORODECAHYDRO-", "stdName": "NAPHTHALENE, 2-(DIFLUORO(UNDECAFLUOROCYCLOHEXYL)METHYL)-1,1,2,3,3,4,4,4A,5,5,6,6,7,7,8,8,8A-HEPTADECAFLUORODECAHYDRO-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a1c279c6-0d95-4c8c-93c3-36e564efb1d4", "e804d4ab-db71-4180-abf8-c250ed3a05cc" ], "display_name": false }, { "uuid": "6c9e7997-f6d4-4a17-b555-2babc4e6e0d1", "name": "PERFLUOROPERHYDROBENZYL TETRALIN", "stdName": "PERFLUOROPERHYDROBENZYL TETRALIN", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "52526c81-4fcc-4b1e-b85d-86c7b7f35609", "a1c279c6-0d95-4c8c-93c3-36e564efb1d4", "8aa98fb6-2bb2-41cc-962d-4d7a02f323aa" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "4d1de78d-6abb-4f78-acb7-221f698d7594", "name_org": "INCI" } ] }, { "uuid": "b449c550-0256-4a24-9d07-72fb7ac045ce", "name": "PP 25", "stdName": "PP 25", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "a1c279c6-0d95-4c8c-93c3-36e564efb1d4", "e804d4ab-db71-4180-abf8-c250ed3a05cc" ], "display_name": false } ], "references": [ { "uuid": "52526c81-4fcc-4b1e-b85d-86c7b7f35609", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "a1c279c6-0d95-4c8c-93c3-36e564efb1d4", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e804d4ab-db71-4180-abf8-c250ed3a05cc", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "55260bac-3ef0-4bc2-a5a0-0c43d99a9ee5", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390707000, "tags": [ "NOMEN" ] }, { "uuid": "d491dc03-f24a-4e48-9bcb-6e01c2103f2c", "citation": "SRS import [XB88J87KY4]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=XB88J87KY4", "doc_type": "SRS", "public_domain": true, "document_date": 1493390707000, "tags": [ "NOMEN" ] }, { "uuid": "8aa98fb6-2bb2-41cc-962d-4d7a02f323aa", "citation": "PERFLUOROPERHYDROBENZYL TETRALIN [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "5d147edd-11e2-42e6-be89-1d8488de1d0d", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "8f2578c8-ad27-491b-90d3-804b52c51616", "id": "8f2578c8-ad27-491b-90d3-804b52c51616", "molfile": "\n Marvin 01132107252D \n\n 47 49 0 0 0 0 999 V2000\n 9.3225 -6.5212 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9105 -5.8056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7347 -5.8056 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9105 -4.9842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6233 -5.3963 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6233 -4.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0382 -5.2877 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4503 -4.5693 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6233 -3.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4503 -3.7451 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0382 -3.0295 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9105 -3.3302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3225 -2.6174 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4984 -2.6174 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1949 -3.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7828 -3.0295 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3736 -3.7451 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1949 -4.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3736 -4.5693 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7828 -5.2877 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1949 -6.2205 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 8.9105 -6.6325 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1949 -7.0446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6070 -7.7602 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0191 -7.0446 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4793 -7.4568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0700 -8.1723 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8914 -8.1723 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7693 -7.0446 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 6.7693 -7.8688 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0537 -7.4568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6416 -8.1723 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4658 -8.1723 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3382 -7.0446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5112 -7.0446 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9260 -7.7602 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3382 -6.2205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9260 -5.5048 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5112 -6.2205 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0537 -5.8056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4658 -5.0956 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6416 -5.0956 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7693 -6.2205 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 6.7693 -5.3963 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4793 -5.8056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2339 -5.4715 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1508 -5.0510 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 21 2 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 6 1 0 0 0 0\n 4 18 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 6 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 9 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 15 12 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 18 15 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 1 0 0 0 0\n 45 21 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 26 23 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 28 1 0 0 0 0\n 29 26 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 1 0 0 0 0\n 43 29 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 1 0 0 0 0\n 31 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 34 36 1 0 0 0 0\n 37 34 1 0 0 0 0\n 37 38 1 0 0 0 0\n 37 39 1 0 0 0 0\n 40 37 1 0 0 0 0\n 40 41 1 0 0 0 0\n 40 42 1 0 0 0 0\n 43 40 1 0 0 0 0\n 43 44 1 0 0 0 0\n 43 45 1 0 0 0 0\n 45 46 1 0 0 0 0\n 45 47 1 0 0 0 0\nM END", "smiles": "C12(C(C(C(C(C1(F)F)(C(C3(C(C(C(C(C3(F)F)(F)F)(F)F)(F)F)(F)F)F)(F)F)F)(F)F)(F)F)(C(C(C(C2(F)F)(F)F)(F)F)(F)F)F)F", "formula": "C17F30", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e5ca4fe8-4716-4db8-960b-cce00d22c4e0" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "774.1346", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "54c60962-37d9-4355-baf4-81619731aa7d", "version": "5", "structure": { "id": "6cb40ac8-7280-4996-ae49-b2ff9ec96589", "molfile": "\n Marvin 01132105392D \n\n 47 49 0 0 0 0 999 V2000\n 9.3225 -2.6174 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4984 -2.6174 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4503 -3.7451 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0382 -3.0295 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7828 -3.0295 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3736 -3.7451 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9105 -3.3302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0382 -5.2877 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4503 -4.5693 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6233 -3.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3736 -4.5693 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7828 -5.2877 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1949 -3.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6233 -5.3963 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6233 -4.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1949 -4.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3225 -6.5212 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7347 -5.8056 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9105 -4.9842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5112 -7.0446 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9260 -7.7602 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6070 -7.7602 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0191 -7.0446 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9260 -5.5048 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5112 -6.2205 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9105 -6.6325 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9105 -5.8056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6416 -8.1723 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4658 -8.1723 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3382 -7.0446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0700 -8.1723 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8914 -8.1723 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1949 -7.0446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4658 -5.0956 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6416 -5.0956 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3382 -6.2205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2339 -5.4715 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1508 -5.0510 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1949 -6.2205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7693 -7.8688 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0537 -7.4568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4793 -7.4568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7693 -5.3963 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0537 -5.8056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4793 -5.8056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7693 -7.0446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7693 -6.2205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10 7 1 0 0 0 0\n 36 30 1 0 0 0 0\n 39 33 1 0 0 0 0\n 7 1 1 0 0 0 0\n 7 2 1 0 0 0 0\n 10 3 1 0 0 0 0\n 10 4 1 0 0 0 0\n 13 5 1 0 0 0 0\n 13 6 1 0 0 0 0\n 13 7 1 0 0 0 0\n 15 8 1 0 0 0 0\n 15 9 1 0 0 0 0\n 15 10 1 0 0 0 0\n 16 11 1 0 0 0 0\n 16 12 1 0 0 0 0\n 16 13 1 0 0 0 0\n 19 14 1 0 0 0 0\n 19 15 1 0 0 0 0\n 19 16 1 0 0 0 0\n 27 17 1 0 0 0 0\n 27 18 1 0 0 0 0\n 27 19 1 0 0 0 0\n 30 20 1 0 0 0 0\n 30 21 1 0 0 0 0\n 33 22 1 0 0 0 0\n 33 23 1 0 0 0 0\n 36 24 1 0 0 0 0\n 36 25 1 0 0 0 0\n 39 26 1 0 0 0 0\n 39 27 1 0 0 0 0\n 41 28 1 0 0 0 0\n 41 29 1 0 0 0 0\n 41 30 1 0 0 0 0\n 42 31 1 0 0 0 0\n 42 32 1 0 0 0 0\n 42 33 1 0 0 0 0\n 44 34 1 0 0 0 0\n 44 35 1 0 0 0 0\n 44 36 1 0 0 0 0\n 45 37 1 0 0 0 0\n 45 38 1 0 0 0 0\n 45 39 1 0 0 0 0\n 46 40 1 0 0 0 0\n 46 41 1 0 0 0 0\n 46 42 1 0 0 0 0\n 47 43 1 0 0 0 0\n 47 44 1 0 0 0 0\n 47 45 1 0 0 0 0\n 47 46 1 0 0 0 0\nM END", "smiles": "C12(C(C(C(C(C1(F)F)(C(C3(C(C(C(C(C3(F)F)(F)F)(F)F)(F)F)(F)F)F)(F)F)F)(F)F)(F)F)(C(C(C(C2(F)F)(F)F)(F)F)(F)F)F)F", "formula": "C17F30", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "774.1346", "optical_activity": "UNSPECIFIED", "references": [ "d491dc03-f24a-4e48-9bcb-6e01c2103f2c", "e804d4ab-db71-4180-abf8-c250ed3a05cc" ], "stereo_centers": 3 }, "unii": "XB88J87KY4" } ] }