{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d68352e3-e382-49a9-a2bd-72118b5606cf", "code": "1103-38-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1103-38-4", "code_system": "CAS", "references": [ "d2b3b7bd-6853-4026-8b39-0c7ddc7367ff", "26ef8165-38ee-4e05-95ae-314628fca90a" ] }, { "uuid": "daddfcdd-2c6b-42cf-beb8-dd35fc85d8b7", "code": "214-160-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.873", "code_system": "ECHA (EC/EINECS)", "references": [ "d2b3b7bd-6853-4026-8b39-0c7ddc7367ff" ] }, { "uuid": "a19c58c2-0c07-4928-dff0-3aa5f1aeb3e6", "code": "5523", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5523", "code_system": "HSDB", "references": [ "fe99e998-44f7-1b51-578f-8f3ebc0d89ce" ] }, { "uuid": "af13c1c4-4ecc-86d4-1602-4c26b5440cec", "code": "DTXSID0027359", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0027359", "code_system": "EPA CompTox", "references": [ "02035d7c-6d25-8b19-7d37-ea105b2d3c44" ] }, { "uuid": "368cdd2c-2ce9-4ca9-a79f-efcfaa4f3d06", "code": "XA4L9U490C", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "22f83034-3184-459f-8754-6814e63d93ff", "name": "1-NAPHTHALENESULFONIC ACID, 2-((2-HYDROXY-1-NAPHTHALENYL)AZO)-, BARIUM SALT", "stdName": "1-NAPHTHALENESULFONIC ACID, 2-((2-HYDROXY-1-NAPHTHALENYL)AZO)-, BARIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "25c595f0-a143-423c-b3bd-df7604079509", "e2141102-a8ef-49c2-9326-6eb1844ba90a" ], "display_name": false }, { "uuid": "38262227-0a82-4536-8e4d-a6f54da40c3c", "name": "1-NAPHTHALENESULFONIC ACID, 2-(2-(2-HYDROXY-1-NAPHTHALENYL)DIAZENYL)-, BARIUM SALT (2:1)", "stdName": "1-NAPHTHALENESULFONIC ACID, 2-(2-(2-HYDROXY-1-NAPHTHALENYL)DIAZENYL)-, BARIUM SALT (2:1)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e2141102-a8ef-49c2-9326-6eb1844ba90a", "9ad8297a-b70d-424a-b3b8-2d1542023634" ], "display_name": false }, { "uuid": "f6452ea3-7bb6-4a91-9e0d-6cbe0c88f5b1", "name": "AKA-207", "stdName": "AKA-207", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "82d63b21-ce87-4a15-ac4d-6b1f8a2bf7ec", "e2141102-a8ef-49c2-9326-6eb1844ba90a" ], "display_name": false }, { "uuid": "e47b0446-b3f7-4918-8693-b7916fb8dd19", "name": "AKA207", "stdName": "AKA207", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "25c595f0-a143-423c-b3bd-df7604079509", "cf875f8e-648a-4241-833b-2ac07e009b7a", "e2141102-a8ef-49c2-9326-6eb1844ba90a" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "d37500fa-8b8d-448f-b26a-7cf0aa280ef0", "name_org": "INCI" } ] }, { "uuid": "d1c4efe2-8bc5-4164-abe2-677aac0250c8", "name": "BARIUM LITHOL RED [HSDB]", "stdName": "BARIUM LITHOL RED [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ab85cf1c-7f54-4972-9bfd-f2fac89917a9", "e2141102-a8ef-49c2-9326-6eb1844ba90a" ], "display_name": false }, { "uuid": "ee99465c-5989-4768-addc-e2c518ac3d31", "name": "C.I. PIGMENT RED 49:1", "stdName": "C.I. PIGMENT RED 49:1", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2da42295-be51-4b69-ac37-240d5776e4e3", "e2141102-a8ef-49c2-9326-6eb1844ba90a" ], "display_name": false }, { "uuid": "c81f6a62-41eb-4ac9-9388-af7fb1bf081d", "name": "CI 15630:1", "stdName": "CI 15630:1", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "25c595f0-a143-423c-b3bd-df7604079509", "e2141102-a8ef-49c2-9326-6eb1844ba90a" ], "display_name": false }, { "uuid": "642b3f3a-eb81-4bbb-a6f9-ca2f72653bdd", "name": "LITHOL RED BA", "stdName": "LITHOL RED BA", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "25c595f0-a143-423c-b3bd-df7604079509", "e2141102-a8ef-49c2-9326-6eb1844ba90a" ], "display_name": false }, { "uuid": "848f7acf-b386-464b-bf76-ce922931290b", "name": "PIGMENT RED 49:1", "stdName": "PIGMENT RED 49:1", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "25c595f0-a143-423c-b3bd-df7604079509", "e2141102-a8ef-49c2-9326-6eb1844ba90a" ], "display_name": false }, { "uuid": "f56d43ad-8f32-4cce-96d8-d0a5d2ac413c", "name": "RED 12", "stdName": "RED 12", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "25c595f0-a143-423c-b3bd-df7604079509", "e2141102-a8ef-49c2-9326-6eb1844ba90a" ], "display_name": false }, { "uuid": "24cd4d14-738c-436c-90bc-1efb7ca20df0", "name": "RED NO. 207", "stdName": "RED NO. 207", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "25c595f0-a143-423c-b3bd-df7604079509", "e2141102-a8ef-49c2-9326-6eb1844ba90a" ], "display_name": false } ], "references": [ { "uuid": "25c595f0-a143-423c-b3bd-df7604079509", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "e2141102-a8ef-49c2-9326-6eb1844ba90a", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9ad8297a-b70d-424a-b3b8-2d1542023634", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ab85cf1c-7f54-4972-9bfd-f2fac89917a9", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "82d63b21-ce87-4a15-ac4d-6b1f8a2bf7ec", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2da42295-be51-4b69-ac37-240d5776e4e3", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d2b3b7bd-6853-4026-8b39-0c7ddc7367ff", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391420000, "tags": [ "NOMEN" ] }, { "uuid": "1eb0ad15-8d6b-4ba4-bfe2-e491e8d9e1ad", "citation": "SRS import [XA4L9U490C]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=XA4L9U490C", "doc_type": "SRS", "public_domain": true, "document_date": 1493391420000, "tags": [ "NOMEN" ] }, { "uuid": "cf875f8e-648a-4241-833b-2ac07e009b7a", "citation": "AKA207 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "fe99e998-44f7-1b51-578f-8f3ebc0d89ce", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+1103-38-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "02035d7c-6d25-8b19-7d37-ea105b2d3c44", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1103-38-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "26ef8165-38ee-4e05-95ae-314628fca90a", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "50b919c1-bfc2-4436-b1ae-86e26d992275", "id": "50b919c1-bfc2-4436-b1ae-86e26d992275", "molfile": "\n Marvin 01132104122D \n\n 1 0 0 0 0 0 999 V2000\n 11.7580 -3.3339 0.0000 Ba 0 2 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 2\nM END", "smiles": "[Ba+2]", "formula": "Ba", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b77f6b80-5be1-4de4-ad9a-40aa229a6182" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "137.3269", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "efe80c2e-277b-4217-9965-0fe0a2eadc60", "id": "efe80c2e-277b-4217-9965-0fe0a2eadc60", "molfile": "\n Marvin 01132112272D \n\n 27 30 0 0 0 0 999 V2000\n 4.0268 -3.8933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8487 -3.8214 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6456 -3.6079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7055 -3.0089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8487 -4.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5632 -5.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5632 -5.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8487 -6.2965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1342 -5.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4197 -6.2965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7052 -5.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7052 -5.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4197 -4.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1342 -5.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2776 -4.6465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9921 -5.0590 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7065 -4.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7065 -3.8214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9921 -3.4089 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 8.4211 -3.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1355 -3.8214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1355 -4.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8500 -5.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8500 -5.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1355 -6.2965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4211 -5.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4211 -5.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 2 0 0 0 0\n 5 2 1 0 0 0 0\n 6 5 1 0 0 0 0\n 14 5 2 0 0 0 0\n 7 6 2 0 0 0 0\n 6 15 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 9 14 1 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 2 0 0 0 0\n 14 13 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 17 27 2 0 0 0 0\n 18 19 1 0 0 0 0\n 20 18 2 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 2 0 0 0 0\n 22 23 1 0 0 0 0\n 27 22 1 0 0 0 0\n 24 23 2 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 2 0 0 0 0\n 27 26 1 0 0 0 0\nM CHG 1 19 -1\nM END", "smiles": "c1ccc2c(c1)ccc(c2/N=N/c3ccc4ccccc4c3S(=O)(=O)O)[O-]", "formula": "C20H13N2O4S", "atropisomerism": "No", "charge": -1, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "b151fd9e-8894-4446-89dc-267b239465b6" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "377.3951", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "ccf56667-b67f-4d0a-b1b2-75297812d086", "version": "5", "structure": { "id": "a05a5d6f-9216-4fa2-bd58-df066a49bb2d", "molfile": "\n Marvin 01132108202D \n\n 55 60 0 0 0 0 999 V2000\n 11.7580 -3.3339 0.0000 Ba 0 2 0 0 0 0 0 0 0 0 0 0\n 2.7052 -5.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7052 -5.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4197 -6.2965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1342 -5.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1342 -5.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4197 -4.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8487 -4.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5632 -5.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5632 -5.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8487 -6.2965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2776 -4.6465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9921 -5.0590 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7065 -4.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7065 -3.8214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4211 -3.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1355 -3.8214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1355 -4.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4211 -5.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4211 -5.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1355 -6.2965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8500 -5.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8500 -5.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9921 -3.4089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8487 -3.8214 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6456 -3.6079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7055 -3.0089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0268 -3.8933 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 2.7052 -5.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7052 -5.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4197 -6.2965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1342 -5.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1342 -5.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4197 -4.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8487 -4.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5632 -5.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5632 -5.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8487 -6.2965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2776 -4.6465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9921 -5.0590 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7065 -4.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7065 -3.8214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4211 -3.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1355 -3.8214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1355 -4.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4211 -5.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4211 -5.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1355 -6.2965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8500 -5.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8500 -5.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9921 -3.4089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8487 -3.8214 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6456 -3.6079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7055 -3.0089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0268 -3.8933 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 25 26 2 0 0 0 0\n 25 27 2 0 0 0 0\n 25 28 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 2 7 2 0 0 0 0\n 6 8 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 2 0 0 0 0\n 5 11 1 0 0 0 0\n 9 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 2 0 0 0 0\n 14 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 18 23 1 0 0 0 0\n 15 24 1 0 0 0 0\n 8 25 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 34 2 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 32 38 1 0 0 0 0\n 33 34 1 0 0 0 0\n 33 35 1 0 0 0 0\n 36 35 2 0 0 0 0\n 35 52 1 0 0 0 0\n 37 36 1 0 0 0 0\n 36 39 1 0 0 0 0\n 38 37 2 0 0 0 0\n 39 40 2 0 0 0 0\n 40 41 1 0 0 0 0\n 42 41 2 0 0 0 0\n 41 46 1 0 0 0 0\n 43 42 1 0 0 0 0\n 42 51 1 0 0 0 0\n 44 43 2 0 0 0 0\n 45 44 1 0 0 0 0\n 46 45 2 0 0 0 0\n 45 50 1 0 0 0 0\n 46 47 1 0 0 0 0\n 47 48 2 0 0 0 0\n 48 49 1 0 0 0 0\n 49 50 2 0 0 0 0\n 52 53 2 0 0 0 0\n 52 54 2 0 0 0 0\n 52 55 1 0 0 0 0\nM CHG 3 1 2 28 -1 55 -1\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 15 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16\nM SAL 1 15 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31\nM SAL 1 15 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46\nM SAL 1 9 47 48 49 50 51 52 53 54 55\nM SPA 1 15 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16\nM SPA 1 12 17 18 19 20 21 22 23 24 25 26 27 28\nM SDI 1 4 2.2852 -6.7165 2.2852 -2.5889\nM SDI 1 4 10.2700 -2.5889 10.2700 -6.7165\nM SMT 1 2\nM END", "smiles": "c1ccc2c(c1)ccc(c2/N=N/c3ccc4ccccc4c3S(=O)(=O)[O-])O.c1ccc2c(c1)ccc(c2/N=N/c3ccc4ccccc4c3S(=O)(=O)[O-])O.[Ba+2]", "formula": "2C20H13N2O4S.Ba", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "892.117", "optical_activity": "NONE", "references": [ "25c595f0-a143-423c-b3bd-df7604079509", "1eb0ad15-8d6b-4ba4-bfe2-e491e8d9e1ad" ], "stereo_centers": 0 }, "unii": "XA4L9U490C" } ] }