{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "48297a1b-1524-4378-bcfb-da5461c95c6f",
          "code": "54-12-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=54-12-6",
          "code_system": "CAS",
          "references": [
            "2f9a9795-db7b-44e4-b381-3244660e7345",
            "85deeff4-14fe-4986-b8ce-ab64372973d3"
          ]
        },
        {
          "uuid": "7708c7ee-1e6d-4670-9313-718df9588814",
          "code": "1148",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1148",
          "code_system": "PUBCHEM",
          "references": [
            "2f9a9795-db7b-44e4-b381-3244660e7345"
          ]
        },
        {
          "uuid": "092cc36c-7992-4417-b15d-8de1a1ea6825",
          "code": "200-194-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.178",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2f9a9795-db7b-44e4-b381-3244660e7345"
          ]
        },
        {
          "uuid": "840ceb20-8474-8adf-0308-c806ad922e44",
          "code": "DTXSID0021418",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0021418",
          "code_system": "EPA CompTox",
          "references": [
            "31362fc3-61ec-6f8f-7497-e13dffb0aee2"
          ]
        },
        {
          "uuid": "93f7606c-fd96-4a52-aa61-e331a53f7e17",
          "code": "X9U7434L7A",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f5060411-e18b-26f3-5067-81d59d5b9c4d",
          "code": "13118",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=13118",
          "code_system": "NSC",
          "references": [
            "1d73e25a-8319-0146-074d-7c643f146585"
          ]
        },
        {
          "uuid": "699ebcc8-7865-a402-af06-47324a7d834f",
          "code": "300000033067",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "84c22500-16e0-8318-ee1e-367dee697804"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "23288427-8d7f-4330-b83c-9d02c71c6a12",
          "name": "(±)-2-AMINO-3-INDOLYLPROPANOIC ACID",
          "stdName": "(+/-)-2-AMINO-3-INDOLYLPROPANOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03dc7297-09ea-4e2c-9363-61d30d2ca6c0",
            "1ebac4c2-9333-4d44-afbe-822cbd333b9b"
          ],
          "display_name": false
        },
        {
          "uuid": "105abb88-1254-438e-b24f-1fc4582be70e",
          "name": "DL-TRYPTOPHAN",
          "stdName": "DL-TRYPTOPHAN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a629ce4-fcdf-4784-b23e-2ef4c0e73bf1",
            "4b3371e2-dbe5-4506-9e22-5cfc3396e5b3",
            "1ebac4c2-9333-4d44-afbe-822cbd333b9b"
          ],
          "display_name": false
        },
        {
          "uuid": "8e834204-5334-42f7-98bb-5b3bcd2c7eda",
          "name": "DL-TRYPTOPHAN [FCC]",
          "stdName": "DL-TRYPTOPHAN [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a629ce4-fcdf-4784-b23e-2ef4c0e73bf1",
            "1ebac4c2-9333-4d44-afbe-822cbd333b9b"
          ],
          "display_name": false
        },
        {
          "uuid": "560350b8-2b22-45b9-9d1a-cffe97c4d996",
          "name": "DL-TRYPTOPHANE",
          "stdName": "DL-TRYPTOPHANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1bf0be5d-09a2-41a8-a579-ba6d78fcf327",
            "1ebac4c2-9333-4d44-afbe-822cbd333b9b"
          ],
          "display_name": false
        },
        {
          "uuid": "76675a05-0a87-42de-8fcf-d7834681b501",
          "name": "NSC-13118",
          "stdName": "NSC-13118",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ebac4c2-9333-4d44-afbe-822cbd333b9b",
            "224cdc6b-5316-4cb0-b6dc-1ca17e286d8d"
          ],
          "display_name": false
        },
        {
          "uuid": "594d5572-f139-49a6-8791-bc046ca0179d",
          "name": "TRYPTOPHAN, DL-",
          "stdName": "TRYPTOPHAN, DL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9729f86a-b557-4157-9313-a6a994d13bb9",
            "1ebac4c2-9333-4d44-afbe-822cbd333b9b"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "4a629ce4-fcdf-4784-b23e-2ef4c0e73bf1",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1ebac4c2-9333-4d44-afbe-822cbd333b9b",
          "citation": "USP FOOD CHEMICALS CODEX",
          "doc_type": "USP FOOD CHEMICALS CODEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9729f86a-b557-4157-9313-a6a994d13bb9",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "03dc7297-09ea-4e2c-9363-61d30d2ca6c0",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1bf0be5d-09a2-41a8-a579-ba6d78fcf327",
          "citation": "HEALTH CANADA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "224cdc6b-5316-4cb0-b6dc-1ca17e286d8d",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f9a9795-db7b-44e4-b381-3244660e7345",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391892000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2f72c9a-6dcc-435a-925a-2cf1856cc2ba",
          "citation": "SRS import [X9U7434L7A]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=X9U7434L7A",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391892000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b3371e2-dbe5-4506-9e22-5cfc3396e5b3",
          "citation": "DL-TRYPTOPHAN [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "31362fc3-61ec-6f8f-7497-e13dffb0aee2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=54-12-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "85deeff4-14fe-4986-b8ce-ab64372973d3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1d73e25a-8319-0146-074d-7c643f146585",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "84c22500-16e0-8318-ee1e-367dee697804",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "08239e19-56f3-44af-b2f0-42a26a8f4ec9",
          "id": "08239e19-56f3-44af-b2f0-42a26a8f4ec9",
          "molfile": "\n  Marvin  01132100422D          \n\n 15 16  0  0  0  0            999 V2000\n    5.4146   -1.8307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0957   -2.3019    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.8277   -3.0398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1710   -3.1207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5850   -2.5400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8532   -2.9117    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9791   -3.7262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4576   -4.3642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7506   -5.1381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5657   -5.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0879   -4.6279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7942   -3.8580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8366   -1.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9104   -1.1249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5141   -2.4208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 13  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n 12  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7 12  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  2  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)c(CC(C(=O)O)N)c[nH]2",
          "formula": "C11H12N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "483604d1-82e9-45cf-8a0b-7473f322ca02"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "204.2256",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "73197190-14ab-4ad7-b09e-6735f8ab53f2",
      "version": "5",
      "structure": {
        "id": "0393fd7e-3452-4f9c-b9a2-eff301ab3b96",
        "molfile": "\n  Marvin  01132100292D          \n\n 15 16  0  0  0  0            999 V2000\n    5.1710   -3.1207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8532   -2.9117    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5850   -2.5400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7942   -3.8580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8366   -1.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8277   -3.0398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9791   -3.7262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0957   -2.3019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9104   -1.1249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4146   -1.8307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5141   -2.4208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0879   -4.6279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4576   -4.3642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5657   -5.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7506   -5.1381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  8  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  4  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  5  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11  5  1  0  0  0  0\n 12  4  1  0  0  0  0\n 13  7  1  0  0  0  0\n 14 12  2  0  0  0  0\n 15 14  1  0  0  0  0\n  2  7  1  0  0  0  0\n 13 15  2  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)c(CC(C(=O)O)N)c[nH]2",
        "formula": "C11H12N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "204.2256",
        "optical_activity": "( + / - )",
        "references": [
          "e2f72c9a-6dcc-435a-925a-2cf1856cc2ba",
          "4a629ce4-fcdf-4784-b23e-2ef4c0e73bf1"
        ],
        "stereo_centers": 1
      },
      "unii": "X9U7434L7A"
    }
  ]
}