{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "738764a4-c5fd-4ab3-a607-1eddf4d851f2",
          "code": "6408-80-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6408-80-6",
          "code_system": "CAS",
          "references": [
            "91ca933d-9840-4805-922e-aa54cf99da78",
            "fabbb087-01ab-45a1-97fb-07f9e851a65d"
          ]
        },
        {
          "uuid": "50976254-1c52-4b84-b418-f27104e8c025",
          "code": "229-069-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.427",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "91ca933d-9840-4805-922e-aa54cf99da78"
          ]
        },
        {
          "uuid": "bc283713-6214-a882-7c0a-f4ef25bd201d",
          "code": "62606",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/62606",
          "code_system": "PUBCHEM",
          "references": [
            "b9c59ade-716c-6945-e63e-a4463abfaea3"
          ]
        },
        {
          "uuid": "f7b6d927-c9c0-4101-a7ec-e5db716b9988",
          "code": "X9BN4V7C7T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "29327ffb-f798-2490-d5b2-6d8e522a99b2",
          "code": "DTXSID7041704",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7041704",
          "code_system": "EPA CompTox",
          "references": [
            "0b9bdc54-9da0-928a-16c5-12ead02a4d42"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "b4a5f559-68dc-4521-8c10-4509a4c4d2da",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ddae6bc7-b017-4859-af11-3ef7c8d0d53d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "156c6245-fe9c-4d0c-9b41-74f9eb7d7e65",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "91ca933d-9840-4805-922e-aa54cf99da78",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390888000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e441ecd-6711-4750-a74c-5df90834e23e",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9c59ade-716c-6945-e63e-a4463abfaea3",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "fabbb087-01ab-45a1-97fb-07f9e851a65d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4ee94c2c-8383-42fa-91af-220d212f74be",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ac66414f-a445-4cd3-9e50-e82fd7453b9d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0b9bdc54-9da0-928a-16c5-12ead02a4d42",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d652d433-1beb-4aa1-a704-ee90b1b7874d",
          "id": "d652d433-1beb-4aa1-a704-ee90b1b7874d",
          "molfile": "\n  Marvin  06052310062D          \n\n 33 36  0  0  0  0            999 V2000\n   13.7225   -3.3555    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4850   -2.6410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8350   -5.4990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0725   -6.2134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7225   -6.2134    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0080   -6.6260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4369   -5.8009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1350   -6.9279    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   14.5475   -1.9265    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2620   -1.5140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8330   -2.3390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1350   -1.2121    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   17.0225   -3.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4850   -4.0699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0725   -4.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3100   -4.0699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0725   -3.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2474   -4.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4850   -5.4990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7225   -4.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2474   -3.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8350   -4.0699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3100   -5.4990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8350   -2.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0100   -4.0699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0100   -2.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5975   -3.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5475   -3.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9600   -2.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9600   -4.0699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7849   -2.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7849   -4.0699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1974   -3.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1 16  1  0  0  0  0\n  1 28  1  0  0  0  0\n  2 17  2  0  0  0  0\n  3 18  2  0  0  0  0\n  4 19  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  2  0  0  0  0\n  5  8  1  0  0  0  0\n  5 23  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  2  0  0  0  0\n  9 12  1  0  0  0  0\n  9 29  1  0  0  0  0\n 13 33  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 14 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 15 19  2  0  0  0  0\n 16 20  1  0  0  0  0\n 17 21  1  0  0  0  0\n 18 22  1  0  0  0  0\n 19 23  1  0  0  0  0\n 20 23  2  0  0  0  0\n 21 22  1  0  0  0  0\n 21 24  2  0  0  0  0\n 22 25  2  0  0  0  0\n 24 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 26 27  2  0  0  0  0\n 28 29  2  0  0  0  0\n 28 30  1  0  0  0  0\n 29 31  1  0  0  0  0\n 30 32  2  0  0  0  0\n 31 33  2  0  0  0  0\n 32 33  1  0  0  0  0\nM  CHG  2   8  -1  12  -1\nM  END",
          "smiles": "Cc1ccc(c(c1)S(=O)(=O)[O-])Nc2cc(c(c3c2C(=O)c4ccccc4C3=O)N)S(=O)(=O)[O-]",
          "formula": "C21H14N2O8S2",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8a1db0b2-9e90-44be-81fb-db82da8a9e3c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "486.4774",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "a8368321-4e2f-4de3-9aed-1e22d3c99409",
          "id": "a8368321-4e2f-4de3-9aed-1e22d3c99409",
          "molfile": "\n  Marvin  06052310062D          \n\n  1  0  0  0  0  0            999 V2000\n    7.1225   -3.6245    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "21ba35aa-28d0-4d43-837a-44270547a02b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c75d47f3-890b-4452-8f50-d4cf26479c20",
      "version": "13",
      "structure": {
        "id": "e8b8337f-d7ad-4d6a-a219-d28eaaad781f",
        "molfile": "2-Anthracenesulfonic acid, 1-amino-9,10-dihydro-4-[(4-methyl-2-sulfophenyl)am...\n   JSDraw206052310062D\n\n 35 36  0  0  0  0              0 V2000\n   25.9480   -6.3450    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.6080   -4.9939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4880  -10.3981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.8280  -11.7490    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9480  -11.7490    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   24.5970  -12.5291    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.2989  -10.9690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.7280  -13.1000    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   27.5080   -3.6429    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   28.8590   -2.8629    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.1570   -4.4229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.7280   -2.2920    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   32.1880   -6.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.6080   -7.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.8280   -9.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1680   -7.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.8280   -6.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2679   -9.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.6080  -10.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9480   -9.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2679   -6.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4880   -7.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1680  -10.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4880   -4.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.9280   -7.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.9280   -4.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1480   -6.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.5080   -6.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.2880   -4.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.2880   -7.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.8479   -4.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.8479   -7.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.6279   -6.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4680   -6.8536    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n   13.4680   -6.8536    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  1 16  1  0  0  0  0\n  1 28  1  0  0  0  0\n  2 17  2  0  0  0  0\n  3 18  2  0  0  0  0\n  4 19  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  2  0  0  0  0\n  5  8  1  0  0  0  0\n  5 23  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  2  0  0  0  0\n  9 12  1  0  0  0  0\n  9 29  1  0  0  0  0\n 13 33  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 14 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 15 19  2  0  0  0  0\n 16 20  1  0  0  0  0\n 17 21  1  0  0  0  0\n 18 22  1  0  0  0  0\n 19 23  1  0  0  0  0\n 20 23  2  0  0  0  0\n 21 22  1  0  0  0  0\n 21 24  2  0  0  0  0\n 22 25  2  0  0  0  0\n 24 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 26 27  2  0  0  0  0\n 28 29  2  0  0  0  0\n 28 30  1  0  0  0  0\n 29 31  1  0  0  0  0\n 30 32  2  0  0  0  0\n 31 33  2  0  0  0  0\n 32 33  1  0  0  0  0\nM  STY  1   1 MUL\nM  SAL   1  2  34  35\nM  SPA   1  1  34\nM  SDI   1  4   12.4800   -8.1016   12.4800   -6.0736\nM  SDI   1  4   14.5600   -6.0736   14.5600   -8.1016\nM  SMT   1 2\nM  CHG  4   8  -1  12  -1  34   1  35   1\nM  END",
        "smiles": "Cc1ccc(c(c1)S(=O)(=O)[O-])Nc2cc(c(c3c2C(=O)c4ccccc4C3=O)N)S(=O)(=O)[O-].[Na+].[Na+]",
        "formula": "C21H14N2O8S2.2Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "532.457",
        "optical_activity": "NONE",
        "references": [
          "8e441ecd-6711-4750-a74c-5df90834e23e",
          "fabbb087-01ab-45a1-97fb-07f9e851a65d"
        ],
        "stereo_centers": 0
      },
      "unii": "X9BN4V7C7T",
      "relationships": [
        {
          "uuid": "c795db80-2118-4f6f-8c1d-700308f76cac",
          "amount": {
            "uuid": "29b3ad27-d0c1-4a1e-90bf-832b70ba158b"
          },
          "type": "PARENT->SALT/SOLVATE",
          "references": [
            "ac66414f-a445-4cd3-9e50-e82fd7453b9d"
          ],
          "related_substance": {
            "uuid": "7ea3cbbe-91df-458c-8db5-3d5fb665bb89",
            "refuuid": "3e4ebe67-33da-4f97-9627-0949d3e4c764",
            "name": "Acid Blue 145 Free Acid",
            "unii": "494T7W9RR4",
            "linking_id": "494T7W9RR4",
            "ref_pname": "Acid Blue 145 Free Acid",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "95dd2f9c-7606-4ae8-8d7e-d9236f36d15e",
          "name": "2-Anthracenesulfonic acid, 1-amino-9,10-dihydro-4-[(4-methyl-2-sulfophenyl)amino]-9,10-dioxo-, disodium salt",
          "stdName": "2-ANTHRACENESULFONIC ACID, 1-AMINO-9,10-DIHYDRO-4-((4-METHYL-2-SULFOPHENYL)AMINO)-9,10-DIOXO-, DISODIUM SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ddae6bc7-b017-4859-af11-3ef7c8d0d53d",
            "156c6245-fe9c-4d0c-9b41-74f9eb7d7e65"
          ],
          "display_name": false
        },
        {
          "uuid": "13e89c0e-7dd8-4c1d-b7ef-de50bdfa8021",
          "name": "2-Anthracenesulfonic acid, 1-amino-9,10-dihydro-4-[(4-methyl-2-sulfophenyl)amino]-9,10-dioxo-, sodium salt (1:2)",
          "stdName": "2-ANTHRACENESULFONIC ACID, 1-AMINO-9,10-DIHYDRO-4-((4-METHYL-2-SULFOPHENYL)AMINO)-9,10-DIOXO-, SODIUM SALT (1:2)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ddae6bc7-b017-4859-af11-3ef7c8d0d53d",
            "156c6245-fe9c-4d0c-9b41-74f9eb7d7e65"
          ],
          "display_name": false
        },
        {
          "uuid": "16d9d1d7-44ce-4e31-8dd4-e7502dfdf0d3",
          "name": "ACID BLUE 145",
          "stdName": "ACID BLUE 145",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4a5f559-68dc-4521-8c10-4509a4c4d2da"
          ],
          "display_name": true
        },
        {
          "uuid": "2bf76fbb-2d11-4c56-b452-642181912fcb",
          "name": "ALIZARINE AZUROL ASR",
          "stdName": "ALIZARINE AZUROL ASR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ddae6bc7-b017-4859-af11-3ef7c8d0d53d",
            "156c6245-fe9c-4d0c-9b41-74f9eb7d7e65"
          ],
          "display_name": false
        },
        {
          "uuid": "f3524656-a4ce-47f4-85c1-26155f2ba2fb",
          "name": "ALIZARINE SKY BLUE FFG",
          "stdName": "ALIZARINE SKY BLUE FFG",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ddae6bc7-b017-4859-af11-3ef7c8d0d53d",
            "156c6245-fe9c-4d0c-9b41-74f9eb7d7e65"
          ],
          "display_name": false
        },
        {
          "uuid": "33aad654-feeb-4995-980c-b8f0fa4051aa",
          "name": "BEST ACID BLUE CD-FG",
          "stdName": "BEST ACID BLUE CD-FG",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ddae6bc7-b017-4859-af11-3ef7c8d0d53d",
            "156c6245-fe9c-4d0c-9b41-74f9eb7d7e65"
          ],
          "display_name": false
        },
        {
          "uuid": "723a0ee1-24e0-4f1c-928d-841dcf1afc93",
          "name": "C.I. 62070",
          "stdName": "C.I. 62070",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ddae6bc7-b017-4859-af11-3ef7c8d0d53d",
            "156c6245-fe9c-4d0c-9b41-74f9eb7d7e65"
          ],
          "display_name": false
        },
        {
          "uuid": "b422c0ca-605f-4da5-a4a3-2873523e7d62",
          "name": "C.I. Acid Blue 145",
          "stdName": "C.I. ACID BLUE 145",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fabbb087-01ab-45a1-97fb-07f9e851a65d"
          ],
          "display_name": false
        },
        {
          "uuid": "92deb588-4b24-4df3-b101-0c8a4c9bd71c",
          "name": "CI 62070",
          "stdName": "CI 62070",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fabbb087-01ab-45a1-97fb-07f9e851a65d"
          ],
          "display_name": false
        },
        {
          "uuid": "aff085a2-5a5f-4147-8aec-8235851c3a87",
          "name": "Disodium1-amino-9,10-dihydro-4-[(4-methyl-2-sulphonatophenyl)amino]-9,10-dioxoanthracene-2-sulphonate",
          "stdName": "DISODIUM1-AMINO-9,10-DIHYDRO-4-((4-METHYL-2-SULPHONATOPHENYL)AMINO)-9,10-DIOXOANTHRACENE-2-SULPHONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fabbb087-01ab-45a1-97fb-07f9e851a65d"
          ],
          "display_name": false
        },
        {
          "uuid": "af311d20-6990-427b-91b8-3e2facbe107a",
          "name": "SPECIAL BLUE CD-FG",
          "stdName": "SPECIAL BLUE CD-FG",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ddae6bc7-b017-4859-af11-3ef7c8d0d53d",
            "156c6245-fe9c-4d0c-9b41-74f9eb7d7e65"
          ],
          "display_name": false
        },
        {
          "uuid": "f243639d-498f-45bc-ba44-ab5d5463cc59",
          "name": "TRIACID LIGHT PURE BLUE FG",
          "stdName": "TRIACID LIGHT PURE BLUE FG",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ddae6bc7-b017-4859-af11-3ef7c8d0d53d",
            "156c6245-fe9c-4d0c-9b41-74f9eb7d7e65"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "bb8e3791-c746-44e7-8182-306a715d3d76"
      }
    }
  ]
}