{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "935deaf1-f7dd-442a-8bdf-c6733e20b4f1",
          "code": "302-27-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=302-27-2",
          "code_system": "CAS",
          "references": [
            "0403f51f-635f-45d9-9f2f-ce1b924604b7",
            "b0dd7228-6235-40bf-98a3-5197fac0bb8c"
          ]
        },
        {
          "uuid": "2c665e6d-4159-4e4c-b721-c376357bf4d9",
          "code": "C87421",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87421",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0403f51f-635f-45d9-9f2f-ce1b924604b7"
          ]
        },
        {
          "uuid": "acaddd87-82a8-471e-992d-93cb9e4a0ab4",
          "code": "D000157",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68000157",
          "code_system": "MESH",
          "references": [
            "0403f51f-635f-45d9-9f2f-ce1b924604b7"
          ]
        },
        {
          "uuid": "70c04b31-209e-40b8-a014-a40a9eac0083",
          "code": "ACONITINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Aconitine",
          "code_system": "WIKIPEDIA",
          "references": [
            "0403f51f-635f-45d9-9f2f-ce1b924604b7"
          ]
        },
        {
          "uuid": "cc1915a6-6ffa-4e25-bcc1-4478fb477286",
          "code": "1441664",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1441664/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0403f51f-635f-45d9-9f2f-ce1b924604b7"
          ]
        },
        {
          "uuid": "4456c384-8f2f-45a7-aa6a-cb71a3a03713",
          "code": "m1380",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1380?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0403f51f-635f-45d9-9f2f-ce1b924604b7"
          ]
        },
        {
          "uuid": "6242a7b4-f4ca-4476-917a-168e1e5afafa",
          "code": "SUB15952MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0403f51f-635f-45d9-9f2f-ce1b924604b7"
          ]
        },
        {
          "uuid": "4fe1dabc-01e6-4c5e-88bf-1f27647933da",
          "code": "CHEMBL2103747",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2103747",
          "code_system": "ChEMBL",
          "references": [
            "0403f51f-635f-45d9-9f2f-ce1b924604b7"
          ]
        },
        {
          "uuid": "9b16139b-ab0a-4f09-88f0-9d6b8a27ddb3",
          "code": "206-121-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.566",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0403f51f-635f-45d9-9f2f-ce1b924604b7"
          ]
        },
        {
          "uuid": "3e35a88d-cd7c-44e3-83f2-b6f2573bf88a",
          "code": "24832676",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/24832676",
          "code_system": "PUBCHEM",
          "references": [
            "0403f51f-635f-45d9-9f2f-ce1b924604b7"
          ]
        },
        {
          "uuid": "cc990444-7b92-7ad5-e740-15c6cdeaa962",
          "code": "DTXSID4046319",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4046319",
          "code_system": "EPA CompTox",
          "references": [
            "e15e3091-8d46-28b3-c57d-96266aa2661d"
          ]
        },
        {
          "uuid": "bf7b9080-7305-d38c-15f6-f17ff17dc636",
          "code": "C221",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Alkaloid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C221",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6f718197-214e-020b-a95c-6e57a4f4be41"
          ]
        },
        {
          "uuid": "0d04933e-a539-4f7b-8e89-9e983dbb9b95",
          "code": "SUB99904",
          "type": "ALTERNATIVE",
          "code_system": "EVMPD"
        },
        {
          "uuid": "8fe44a5f-d86d-4af8-8058-06ac13a9b2a9",
          "code": "X8YN71D5WC",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f53a9dc2-c469-c863-f27b-3d177e22ec2b",
          "code": "2430",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:2430",
          "code_system": "CHEBI",
          "references": [
            "6f718197-214e-020b-a95c-6e57a4f4be41"
          ]
        },
        {
          "uuid": "5e652736-3426-f382-4c5c-3364f9000ec2",
          "code": "56464",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=56464",
          "code_system": "NSC",
          "references": [
            "4a69ec06-4186-a6d5-8f74-b855c304d67a"
          ]
        },
        {
          "uuid": "a6e7eae5-5cec-41ec-981c-c804e40c48b4",
          "code": "X8YN71D5WC",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=X8YN71D5WC",
          "code_system": "DAILYMED",
          "references": [
            "ef9297ed-16a2-c580-8b89-a7c9303620a3"
          ]
        },
        {
          "uuid": "e2387430-7731-aa47-a261-77afac777357",
          "code": "759627",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759627",
          "code_system": "NSC",
          "references": [
            "4a69ec06-4186-a6d5-8f74-b855c304d67a"
          ]
        },
        {
          "uuid": "b9ec3361-4c70-97b3-9831-e06c2e5048b7",
          "code": "100000076438",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2078e280-a3f8-4756-4ea9-5dd900b2073d"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ad0369fa-984b-4919-876e-0d231d2527a8",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "686815c9-67a8-4177-b631-6180e628512f",
            "refuuid": "25af1b33-4d12-4271-8b1a-8a0c77573edf",
            "name": "ACONITINE",
            "unii": "X8YN71D5WC",
            "linking_id": "X8YN71D5WC",
            "ref_pname": "ACONITINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e4555267-7bf6-485e-91e4-183f0fc85267",
          "amount": {
            "uuid": "2f4adbc4-aa60-4a19-ad99-ccc02721aa53"
          },
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "15328a72-ccc4-46c2-a64f-56fab8929720"
          ],
          "related_substance": {
            "uuid": "cb4ea338-0c43-4f34-9c36-d0a36cec52fe",
            "refuuid": "4dd78491-8606-4a99-8638-c90406d89b9b",
            "name": "ACONITUM COREANUM ROOT",
            "unii": "IT971G3SUX",
            "linking_id": "IT971G3SUX",
            "ref_pname": "ACONITUM COREANUM ROOT",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9cc1f277-83b2-4e91-b38b-8b87a30cca3a",
          "name": "(1.ALPHA.,3.ALPHA.,6.ALPHA.,14.ALPHA,15.ALPHA.,16.BETA.)-20-ETHYL-1,6,16-TRIMETHOXY-4-(METHOXYMETHYL)ACONITANE-3,8,13,14,15-PENTOL 8-ACETATE 14-BENZOATE",
          "stdName": "(1.ALPHA.,3.ALPHA.,6.ALPHA.,14.ALPHA,15.ALPHA.,16.BETA.)-20-ETHYL-1,6,16-TRIMETHOXY-4-(METHOXYMETHYL)ACONITANE-3,8,13,14,15-PENTOL 8-ACETATE 14-BENZOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ae088ae-1d83-4ecd-a80c-bb4f7a546fb3"
          ],
          "display_name": false
        },
        {
          "uuid": "16df7afb-1438-4cb4-8a35-7f3992135c86",
          "name": "(1.ALPHA.,3.ALPHA.,6.ALPHA.,14.ALPHA.,15.ALPHA.,16.BETA.)-20-ETHYL-1,6,16-TRIMETHOXY-4-(METHOXYMETHYL)ACONITANE-3,8,13,14,15-PENTOL 8-ACETATE 14-BENZOATE",
          "stdName": "(1.ALPHA.,3.ALPHA.,6.ALPHA.,14.ALPHA.,15.ALPHA.,16.BETA.)-20-ETHYL-1,6,16-TRIMETHOXY-4-(METHOXYMETHYL)ACONITANE-3,8,13,14,15-PENTOL 8-ACETATE 14-BENZOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba08a144-67d6-44c1-b582-25d1f8ff890f"
          ],
          "display_name": false
        },
        {
          "uuid": "6d89b38a-c749-42a9-ac08-8e93896906ac",
          "name": "ACONITINE",
          "stdName": "ACONITINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "80f80117-a5f5-43e2-b36b-27e779426e95",
            "7ae088ae-1d83-4ecd-a80c-bb4f7a546fb3",
            "c36aaac5-6ced-4a6f-abc5-ba80adb2e9d1"
          ],
          "display_name": true
        },
        {
          "uuid": "09ce7909-bbee-4492-b1d3-12251d678c90",
          "name": "ACONITINE [MI]",
          "stdName": "ACONITINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "80f80117-a5f5-43e2-b36b-27e779426e95"
          ],
          "display_name": false
        },
        {
          "uuid": "bdee0052-156a-4435-8348-9aa620dd5f1d",
          "name": "ACONITINUM",
          "stdName": "ACONITINUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6ec57ee-5d09-430f-81b6-5b765125fb57",
            "98243316-d9e1-4300-9594-118109d0bfc9",
            "eade4d83-ec88-4517-bc75-5fb9c1ad9394",
            "b41fb6db-0154-40c5-b67b-37755b2a408e"
          ],
          "display_name": false
        },
        {
          "uuid": "e8bcf49e-6d4a-43d9-a3f6-b21a048afe78",
          "name": "ACONITINUM [HPUS]",
          "stdName": "ACONITINUM [HPUS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98243316-d9e1-4300-9594-118109d0bfc9",
            "b41fb6db-0154-40c5-b67b-37755b2a408e"
          ],
          "display_name": false
        },
        {
          "uuid": "ca3f9520-d2bb-4503-8d7d-efdfc7ad1bcd",
          "name": "NSC-56464",
          "stdName": "NSC-56464",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba4ed207-3be4-47fa-83c9-a3c8eac4bc67"
          ],
          "display_name": false
        },
        {
          "uuid": "d7a60f9f-0e1f-a646-1554-9a70ba7d0242",
          "name": "NSC-759627",
          "stdName": "NSC-759627",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a69ec06-4186-a6d5-8f74-b855c304d67a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7ae088ae-1d83-4ecd-a80c-bb4f7a546fb3",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a6ec57ee-5d09-430f-81b6-5b765125fb57",
          "citation": "HPUS 2004",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba08a144-67d6-44c1-b582-25d1f8ff890f",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98243316-d9e1-4300-9594-118109d0bfc9",
          "citation": "HPUS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b41fb6db-0154-40c5-b67b-37755b2a408e",
          "citation": "HPUS 2011",
          "doc_type": "HOMEOPATHIC PHARMACOPOEIA US",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "80f80117-a5f5-43e2-b36b-27e779426e95",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba4ed207-3be4-47fa-83c9-a3c8eac4bc67",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0403f51f-635f-45d9-9f2f-ce1b924604b7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390754000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82a535bd-fb20-4880-b3bf-302cd3e75334",
          "citation": "SRS import [X8YN71D5WC]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=X8YN71D5WC",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390754000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eade4d83-ec88-4517-bc75-5fb9c1ad9394",
          "citation": "ACONITINUM [HPUS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c36aaac5-6ced-4a6f-abc5-ba80adb2e9d1",
          "citation": "ACONITINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e15e3091-8d46-28b3-c57d-96266aa2661d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=302-27-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6f718197-214e-020b-a95c-6e57a4f4be41",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "15328a72-ccc4-46c2-a64f-56fab8929720",
          "citation": "https://en.wikipedia.org/wiki/Aconitum_coreanum",
          "url": "https://en.wikipedia.org/wiki/Aconitum_coreanum",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "b0dd7228-6235-40bf-98a3-5197fac0bb8c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4a69ec06-4186-a6d5-8f74-b855c304d67a",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ef9297ed-16a2-c580-8b89-a7c9303620a3",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "2078e280-a3f8-4756-4ea9-5dd900b2073d",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "60a126cf-c367-44f3-8c5b-05e59d9665d8",
          "id": "60a126cf-c367-44f3-8c5b-05e59d9665d8",
          "molfile": "\n  Marvin  01132105002D          \n\n 46 52  0  0  1  0            999 V2000\n    7.6538   -6.2328    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.5320   -7.2970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8909   -7.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3846   -6.2328    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.3653   -3.2133    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.5126   -4.7647    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7562   -4.5019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1151   -5.0148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9517   -6.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7242   -5.7905    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.7242   -6.9957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0831   -7.5150    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4420   -6.9957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3653   -5.2776    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.3653   -4.2455    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.0384   -3.7262    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.3461   -4.8224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9552   -4.2647    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.5963   -3.7454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3013   -3.7262    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.3013   -2.6941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0168   -2.3440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8209   -1.6126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7482   -2.5399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2838   -2.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0128   -2.2007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2088   -2.9323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6771   -3.4661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9451   -3.2744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6667   -4.2455    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.6667   -5.2776    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.6667   -6.4828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4707   -7.2142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0061   -7.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9353   -7.7497    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3013   -5.7969    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.3013   -6.8290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9552   -5.2263    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   10.5963   -5.7392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2310   -5.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7178   -3.7262    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.0831   -4.2455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0831   -5.2776    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.4420   -5.7905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7178   -2.6941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0831   -2.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  4  1  0  0  0  0\n 14  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 31  1  1  0  0  0\n  5  6  1  0  0  0  0\n 15  5  1  6  0  0  0\n  6  7  1  0  0  0  0\n  6  9  1  0  0  0  0\n  7  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  1  0  0  0\n 14 10  1  6  0  0  0\n 10 43  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 41  1  0  0  0  0\n 16 17  1  6  0  0  0\n 16 30  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  6  0  0  0\n 20 18  1  0  0  0  0\n 18 38  1  0  0  0  0\n 20 21  1  0  0  0  0\n 30 20  1  6  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 22 24  1  0  0  0  0\n 25 24  1  0  0  0  0\n 24 29  2  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  2  0  0  0  0\n 29 28  1  0  0  0  0\n 30 31  1  0  0  0  0\n 31 32  1  0  0  0  0\n 31 36  1  0  0  0  0\n 32 33  1  0  0  0  0\n 33 34  1  0  0  0  0\n 33 35  2  0  0  0  0\n 36 37  1  6  0  0  0\n 36 38  1  0  0  0  0\n 38 39  1  1  0  0  0\n 39 40  1  0  0  0  0\n 41 42  1  0  0  0  0\n 41 45  1  6  0  0  0\n 43 42  1  0  0  0  0\n 43 44  1  6  0  0  0\n 45 46  1  0  0  0  0\nM  END",
          "smiles": "CCN1C[C@]2(COC)[C@@H](C[C@@H]([C@@]34[C@@H]5C[C@]6([C@H]([C@@H]5C([C@@H]([C@@H]([C@H]23)OC)[C@@H]41)([C@H]([C@@H]6OC)O)OC(=O)C)OC(=O)c7ccccc7)O)OC)O",
          "formula": "C34H47NO11",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f08cfd13-40ee-4948-936e-d52c5693cfac"
          },
          "defined_stereo": 14,
          "ez_centers": 0,
          "molecular_weight": "645.7384",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 15
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "25af1b33-4d12-4271-8b1a-8a0c77573edf",
      "version": "12",
      "structure": {
        "id": "bef0d278-b4d6-4a8c-a42b-42336e3fbe3c",
        "molfile": "\n  Marvin  01132109522D          \n\n 48 54  0  0  1  0            999 V2000\n    6.7178   -2.6941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0831   -2.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7178   -3.7262    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.3653   -4.2455    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.3653   -5.2776    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.7242   -5.7905    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.7242   -6.9957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0831   -7.5150    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4420   -6.9957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9517   -6.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5126   -4.7647    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n    7.3653   -3.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3846   -6.2328    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.6538   -6.2328    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.5320   -7.2970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8909   -7.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6667   -5.2776    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.6667   -4.2455    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.0384   -3.7262    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.3461   -4.8224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9552   -4.2647    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.3013   -3.7262    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.3013   -2.6941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5963   -3.7454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9552   -5.2263    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.5963   -5.7392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2310   -5.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3013   -5.7969    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.3013   -6.8290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6667   -3.2133    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6667   -6.4828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7562   -4.5019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1151   -5.0148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0831   -5.2776    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.4420   -5.7905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0831   -4.2455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1730   -6.2713    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4707   -7.2142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0168   -2.3440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8209   -1.6126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9353   -7.7497    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0061   -7.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7482   -2.5399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0128   -2.2007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2838   -2.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2088   -2.9323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9451   -3.2744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6771   -3.4661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  1  1  6  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  1  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  6 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n  4 12  1  6  0  0  0\n 14 13  1  0  0  0  0\n  5 14  1  0  0  0  0\n 14 15  1  6  0  0  0\n 15 16  1  0  0  0  0\n 13 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n  4 19  1  0  0  0  0\n 19 20  1  6  0  0  0\n 21 20  1  6  0  0  0\n 22 21  1  0  0  0  0\n 18 22  1  0  0  0  0\n 22 23  1  1  0  0  0\n 21 24  1  0  0  0  0\n 21 25  1  0  0  0  0\n 25 26  1  1  0  0  0\n 26 27  1  0  0  0  0\n 28 25  1  0  0  0  0\n 17 28  1  0  0  0  0\n 28 29  1  6  0  0  0\n 18 30  1  1  0  0  0\n 17 31  1  1  0  0  0\n 11 32  1  0  0  0  0\n 32 33  1  0  0  0  0\n 34  6  1  0  0  0  0\n 34 35  1  6  0  0  0\n 36 34  1  0  0  0  0\n  3 36  1  0  0  0  0\n  5 37  1  1  0  0  0\n 12 11  1  6  0  0  0\n 13 12  1  6  0  0  0\n 31 38  1  0  0  0  0\n 23 39  1  0  0  0  0\n 39 40  2  0  0  0  0\n 38 41  2  0  0  0  0\n 38 42  1  0  0  0  0\n 39 43  1  0  0  0  0\n 48 46  1  0  0  0  0\n 47 48  2  0  0  0  0\n 44 45  1  0  0  0  0\n 46 44  2  0  0  0  0\n 45 43  2  0  0  0  0\n 43 47  1  0  0  0  0\nM  END",
        "smiles": "CCN1C[C@]2(COC)[C@@H](C[C@@H]([C@@]34[C@@H]5C[C@]6([C@@H]([C@]5([H])[C@@]([C@@H]([C@@H]([C@]23[H])OC)[C@H]41)([C@H]([C@@H]6OC)O)OC(=O)C)OC(=O)c7ccccc7)O)OC)O",
        "formula": "C34H47NO11",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 15,
        "ez_centers": 0,
        "molecular_weight": "645.7384",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "7ae088ae-1d83-4ecd-a80c-bb4f7a546fb3",
          "82a535bd-fb20-4880-b3bf-302cd3e75334"
        ],
        "stereo_centers": 15
      },
      "unii": "X8YN71D5WC"
    }
  ]
}